@charset "UTF-8";   :root {  --theme-color:#e3572b;  --theme-color2:#c2df93;  --theme-color3:#ecf8f8;  --title-color:var(--dark-color);  --body-color:var(--gray-color);  --dark-color:#063232;  --dark-color2:#053131;  --dark-color3:#114f4f;  --dark-color4:#093b3b;  --gray-color:#5a7779;  --gray-color2:#90b4b6;  --white-color:#ffffff;  --light-color:#edfbfb;  --light-color2:#f4f8ec;  --light-color3:#dcefef;  --light-color4:#ddf1f1;  --light-color5:#f6f6f6;  --orange-color:#ff9d10;  --orange-color2:#f9c664;  --success-color:#28a745;  --error-color:#ff0000;  --bs-text-color1:#10171d;  --bs-text-color2:rgba(255, 255, 255, 0.70);  --bs-bg-color1:rgba(6, 50, 50, 0.4);  --bs-bg-color2:rgba(0, 0, 0, 0.60);  --bs-bg-color3:rgba(2, 27, 27, 0.7);  --bs-bg-color4:rgba(236, 248, 248, 0.2);  --bs-bg-color5:rgba(255, 255, 255, 0.30);  --bs-bg-color6:rgba(255, 255, 255, 0.50);  --bs-bg-color7:rgba(6, 50, 50, 0.10);  --bs-bg-color8:rgba(6, 50, 50, 0.8);  --bs-bg-color9:rgba(255, 255, 255, .3);  --bs-bg-color10:rgba(255, 255, 255, 0.10);  --bs-bg-color11:rgba(209, 219, 219, 0.3);  --bs-bg-color12:rgba(255, 255, 255, 0.2);  --bs-bg-color13:rgba(6, 50, 50, 0.70);  --bs-bg-color14:rgba(255, 255, 255, 0.6);  --bs-bg-color15:rgba(6, 50, 50, 0.90);  --bs-bg-color16:rgba(6, 50, 50, 0.30);  --bs-bg-color17:rgba(193,223,147,0.9999999999999999);  --bs-bg-color18:rgba(194, 223, 147, 0.5019607843137255);  --bs-bg-color19:rgba(3, 42, 42, 0.9019607843137255);  --bs-bg-color20:#186060;  --bs-border-color:rgba(255, 255, 255, 0.10);  --bs-border-color2:rgba(255, 255, 255, 0.2);  --bs-border-color3:rgba(0, 0, 0, .05);  --bs-border-color4:rgba(212, 226, 226, 0.3);  --bs-border-color5:rgba(0, 67, 70, 0.10);  --bs-border-color6:rgba(6, 50, 50, 0.15);  --bs-border-color7:rgba(6, 50, 50, 0.1);  --bs-border-color8:#dce4d9;  --bs-border-color9:rgba(255, 255, 255, 0.30);  --bs-border-color10:rgba(6, 50, 50, 0.10);  --bs-border-color11:rgba(255, 255, 255, 0.2);  --bs-border-color12:rgba(6, 50, 50, 0.2);  --bs-border-color13:rgba(255, 255, 255, 0.15);  --bs-border-color14:#FFFFFF66;  --title-font:"Inter", sans-serif;  --body-font:"Inter", sans-serif;  --icon-font:"Font Awesome 6 Pro";  --main-container:1320px;  --container-gutters:24px;  --section-space:120px;  --section-space-mobile:80px;  --section-space-small-mobile:60px;  --section-title-space:70px;  --ripple-ani-duration:5s; }  .p-top-left {  position:absolute;  top:0;  left:0;  z-index:-1; } .p-top-right {  position:absolute;  top:0;  right:0;  z-index:-1; } .p-bottom-left {  position:absolute;  bottom:0;  left:0;  z-index:-1; } .p-bottom-right {  position:absolute;  bottom:0;  right:0;  z-index:-1; } .mbm-normal {  mix-blend-mode:normal; } .mbm-multiply {  mix-blend-mode:multiply; } .mbm-screen {  mix-blend-mode:screen; } .mbm-overlay {  mix-blend-mode:overlay; } .mbm-darken {  mix-blend-mode:darken; } .mbm-lighten {  mix-blend-mode:lighten; } .mbm-color-dodge {  mix-blend-mode:color-dodge; } .mbm-color-burn {  mix-blend-mode:color-burn; } .mbm-hard-light {  mix-blend-mode:hard-light; } .mbm-soft-light {  mix-blend-mode:soft-light; } .mbm-difference {  mix-blend-mode:difference; } .mbm-exclusion {  mix-blend-mode:exclusion; } .mbm-hue {  mix-blend-mode:hue; } .mbm-saturation {  mix-blend-mode:saturation; } .mbm-color {  mix-blend-mode:color; } .mbm-luminosity {  mix-blend-mode:luminosity; }  html, body {  scroll-behavior:smooth !important; } body {  font-family:var(--body-font);  font-size:16px;  font-weight:400;  color:var(--body-color);  line-height:26px;  background:var(--dark-color);  overflow-x:hidden;  -webkit-font-smoothing:antialiased; } body::-webkit-scrollbar {  width:8px;  height:8px; } body::-webkit-scrollbar-thumb {  background-color:var(--white-color);  background-image:-webkit-linear-gradient(45deg, var(--theme-color) 25%, transparent 20%, transparent 50%, var(--theme-color) 50%, var(--theme-color) 75%, transparent 75%, transparent);  border-radius:3px; } html.lenis, html.lenis body {  height:auto; } .lenis.lenis-smooth {  scroll-behavior:auto !important; } .lenis.lenis-smooth [data-lenis-prevent] {  overscroll-behavior:contain; } .lenis.lenis-stopped {  overflow:hidden; } section {  position:relative;  z-index:1; } section > .outer-box {  margin:0 60px;  } @media (max-width:1399px) {  section > .outer-box {   margin:0 12px;  } } @media (max-width:540px) {  section > .outer-box {   margin:0;  } } iframe, input, button, a, textarea {  border:none;  outline:none;  background:transparent;  transition:all ease 0.4s; } iframe:focus, iframe:active, iframe:hover, input:focus, input:active, input:hover, button:focus, button:active, button:hover, a:focus, a:active, a:hover, textarea:focus, textarea:active, textarea:hover {  outline:none;  box-shadow:none; } img, embed, object, video {  max-width:100%;  height:auto;  border:none; } ul, ol {  list-style:none;  margin-bottom:0;  padding:0; } ul.styled, ol.styled {  list-style-type:decimal; } table {  margin:0 0 1.5em;  width:100%;  border-collapse:collapse;  border-spacing:0;  border:1px solid var(--bs-border-color); } table th, table td {  border:1px solid var(--bs-border-color);  padding:9px 12px; } table th th, table td th {  font-weight:700;  color:var(--title-color); } a {  color:var(--title-color);  text-decoration:none; } a:hover {  color:var(--theme-color); } pre {  font-family:var(--body-font);  background:#f5f5f5;  color:#666;  font-size:14px;  margin:20px 0;  padding:20px;  white-space:pre-wrap;  word-wrap:break-word;  overflow:auto; } span.ajax-loader:empty, p:empty {  display:none; } p {  font-family:var(--body-font);  margin:0 0 15px;  color:var(--gray-color);  line-height:1.75; } p a {  font-size:inherit;  font-family:inherit;  font-weight:inherit;  line-height:inherit; } h1, h2, h3, h4, h5, h6 {  font-family:var(--title-font);  color:var(--title-color);  text-transform:none;  font-weight:600;  line-height:1.4;  margin:0 0 15px; } h1 a, h2 a, h3 a, h4 a, h5 a, h6 a {  font-size:inherit;  font-family:inherit;  font-weight:inherit;  line-height:inherit; } h1, .h1 {  font-size:62px;  line-height:72px; } h2, .h2 {  font-size:42px;  line-height:50px; } h3, .h3 {  font-size:36px;  line-height:1.417; } h4, .h4 {  font-size:24px;  line-height:1.417; } h5, .h5 {  font-size:22px;  line-height:1.417; } h6, .h6 {  font-size:18px;  line-height:1.5; }  @media (max-width:1399px) {  h1, .h1 {   font-size:48px;  } } @media (max-width:1199px) {  h1, .h1 {   font-size:44px;   line-height:1.3;  }  h2, .h2 {   font-size:40px;   line-height:1.25;  }  h3, .h3 {   font-size:30px;  }  h4, .h4 {   font-size:24px;  }  h5, .h5 {   font-size:20px;  }  h6, .h6 {   font-size:16px;  } } @media (max-width:767px) {  h1, .h1 {   font-size:40px;  }  h2, .h2 {   font-size:34px;   line-height:1.3;  }  h3, .h3 {   font-size:26px;  }  h4, .h4 {   font-size:22px;  }  h5, .h5 {   font-size:18px;  }  h6, .h6 {   font-size:16px;  } } @media (max-width:575px) {  h1, .h1 {   font-size:34px;   line-height:1.35;  }  h2, .h2 {   font-size:30px;  } } @media (max-width:375px) {  h1, .h1 {   font-size:32px;  } }  .container {  max-width:calc(var(--main-container) + var(--container-gutters)); }  @media (max-width:1399px) {  :root {   --main-container:1250px;  } } .container2 {  max-width:1330px;  margin:auto; } @media (min-width:1400px) {  .container, .container-lg, .container-md, .container-sm, .container-xl, .container-xxl {   max-width:calc(var(--main-container) + var(--container-gutters));  }  .container2 {   max-width:1330px;  } } @media only screen and (min-width:1300px) {  .container2.px-0,  .container-xxl.px-0,  .container-xl.px-0,  .container-lg.px-0,  .container-md.px-0,  .container-sm.px-0,  .container.px-0 {   max-width:var(--main-container);  }  .container2 {   max-width:1330px;  } } @media (max-width:1399px) {  .container2 {   max-width:1140px;  } } @media (max-width:1199px) {  .container2 {   max-width:960px;  } } @media (max-width:991px) {  .container2 {   max-width:720px;  } } @media (max-width:767px) {  .container2 {   max-width:540px;  } } @media only screen and (max-width:1600px) {  .container-fluid.px-0 {   padding-left:15px !important;   padding-right:15px !important;  }  .container-fluid.px-0 .row {   margin-left:0 !important;   margin-right:0 !important;  } } select, .single-select, .form-control, .form-select, textarea, input {  height:56px;  padding:0 20px;  border:1px solid transparent;  color:var(--white-color);  background-color:var(--dark-color2);  font-size:16px;  font-weight:400;  width:100%;  transition:all 0.4s ease 0s;  padding-right:45px;  border-radius:5px; } select:focus, .single-select:focus, .form-control:focus, .form-select:focus, textarea:focus, input:focus {  color:var(--white-color);  outline:0;  box-shadow:none;  border-color:transparent;  background-color:var(--dark-color2); } select::-moz-placeholder, .single-select::-moz-placeholder, .form-control::-moz-placeholder, .form-select::-moz-placeholder, textarea::-moz-placeholder, input::-moz-placeholder {  color:var(--gray-color); } select::-webkit-input-placeholder, .single-select::-webkit-input-placeholder, .form-control::-webkit-input-placeholder, .form-select::-webkit-input-placeholder, textarea::-webkit-input-placeholder, input::-webkit-input-placeholder {  color:var(--gray-color); } select:-ms-input-placeholder, .single-select:-ms-input-placeholder, .form-control:-ms-input-placeholder, .form-select:-ms-input-placeholder, textarea:-ms-input-placeholder, input:-ms-input-placeholder {  color:var(--gray-color); } select::placeholder, .single-select::placeholder, .form-control::placeholder, .form-select::placeholder, textarea::placeholder, input::placeholder {  color:var(--gray-color); } select.style2, .single-select.style2, .form-control.style2, .form-select.style2, textarea.style2, input.style2 {  height:auto;  border:none;  color:var(--white-color);  background-color:var(--dark-color2);  border-radius:10px; } select.style2 option, .single-select.style2 option, .form-control.style2 option, .form-select.style2 option, textarea.style2 option, input.style2 option {  background-color:var(--title-color);  color:var(--body-color);  padding:2px 15px; } select.style2::-moz-placeholder, .single-select.style2::-moz-placeholder, .form-control.style2::-moz-placeholder, .form-select.style2::-moz-placeholder, textarea.style2::-moz-placeholder, input.style2::-moz-placeholder {  color:var(--body-color); } select.style2::-webkit-input-placeholder, .single-select.style2::-webkit-input-placeholder, .form-control.style2::-webkit-input-placeholder, .form-select.style2::-webkit-input-placeholder, textarea.style2::-webkit-input-placeholder, input.style2::-webkit-input-placeholder {  color:var(--body-color); } select.style2:-ms-input-placeholder, .single-select.style2:-ms-input-placeholder, .form-control.style2:-ms-input-placeholder, .form-select.style2:-ms-input-placeholder, textarea.style2:-ms-input-placeholder, input.style2:-ms-input-placeholder {  color:var(--body-color); } select.style2::placeholder, .single-select.style2::placeholder, .form-control.style2::placeholder, .form-select.style2::placeholder, textarea.style2::placeholder, input.style2::placeholder {  color:var(--body-color); } select.style-white, .single-select.style-white, .form-control.style-white, .form-select.style-white, textarea.style-white, input.style-white {  background:var(--white-color); } select.style-border, .single-select.style-border, .form-control.style-border, .form-select.style-border, textarea.style-border, input.style-border {  background:transparent;  border-bottom:2px solid var(--title-color);  border-radius:0;  color:var(--title-color);  font-size:18px;  font-weight:400;  padding:0; } select.style-border::placeholder, .single-select.style-border::placeholder, .form-control.style-border::placeholder, .form-select.style-border::placeholder, textarea.style-border::placeholder, input.style-border::placeholder {  color:var(--title-color); } select.style-border2, .single-select.style-border2, .form-control.style-border2, .form-select.style-border2, textarea.style-border2, input.style-border2 {  background:transparent;  border:1px solid #E8E8E8;  border-radius:0;  color:var(--title-color); } select.style3, .single-select.style3, .form-control.style3, .form-select.style3, textarea.style3, input.style3 {  background:var(--dark-color); } .form-text {  font-size:16px; } .form-text a {  color:var(--title-color);  font-weight:500; } .single-select, .form-select, select {  display:block;  width:100%;  line-height:60px;  cursor:pointer;  background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3E%3Cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M2 5l6 6 6-6'/%3E%3C/svg%3E");  background-position:right 26px center;  background-repeat:no-repeat;  background-size:16px 12px;  -webkit-appearance:none;  -moz-appearance:none;  appearance:none; } .single-select:after, .form-select:after, select:after {  right:30px;  height:8px;  width:8px; } .single-select .list, .form-select .list, select .list {  width:100%; } textarea.form-control, textarea {  min-height:100px;  padding-top:16px;  padding-bottom:17px; } textarea.form-control.style2, textarea.style2 {  min-height:195px; } textarea.form-control.style-border, textarea.style-border {  padding-top:12px; } .form-group {  margin-bottom:25px;  position:relative; } .form-group > i {  display:inline-block;  position:absolute;  right:25px;  top:21px;  font-size:16px;  color:var(--body-color); } .form-group > i.fa-envelope {  padding-top:1px; } .form-group > i.fa-comment {  margin-top:-2px; } .form-group > i.fa-chevron-down {  width:17px;  background-color:var(--dark-color); } .form-group.form-icon-left > i {  display:inline-block;  position:absolute;  left:25px;  right:auto;  top:20px;  font-size:16px;  color:var(--body-color);  line-height:1; } .form-group.form-icon-left > i.fa-envelope {  padding-top:0px; } .form-group.form-icon-left > i.fa-comment {  margin-top:-2px; } .form-group.form-icon-left > i.fa-chevron-down {  width:17px;  background-color:var(--dark-color); } .form-group.form-icon-left input {  padding:0 30px 0 55px; } .form-group.has-label > i {  top:50px; } .form-group.has-icon .form-control {  padding-left:70px; } .form-group.has-icon .input-icon {  display:inline-block;  position:absolute;  left:40px;  top:18px;  font-size:16px;  color:var(--body-color); } .form-group.has-icon .input-icon:hover {  color:var(--theme-color); } .form-group.radius-group input {  border-radius:100px; } .form-group.style-2 .form-control {  padding:0 30px 0 55px; } .form-group.style-2 textarea.form-control {  padding:16px 30px 30px 55px; } .form-group.style-3 .form-control {  padding:0 60px 0 30px; } .form-group.style-4 i {  color:var(--theme-color); } .form-group.style-4 .form-control {  padding:0 30px 0 60px;  border:1px solid #E3E1DC;  height:60px;  line-height:60px;  color:var(--body-color); } .form-group.style-4 .form-control::placeholder {  color:var(--body-color);  font-size:14px;  font-weight:300; } .form-group.style-4 textarea.form-control {  line-height:normal;  padding:15px 30px 30px 60px; } .form-btn .link-btn {  border:0;  align-items:center; } input[type=date] {  padding:0 25px 0 25px;  position:relative; } input[type=date]::-webkit-calendar-picker-indicator {  background:transparent;  position:absolute;  left:0px;  height:100%;  width:100%;  z-index:1;  cursor:pointer; } [class*=col-].form-group > i {  right:calc(var(--bs-gutter-x) / 2 + 25px); } [class*=col-].form-group .form-icon-left {  left:calc(var(--bs-gutter-x) / 2 + 30px);  right:auto; } option:checked, option:focus, option:hover {  background-color:var(--theme-color);  color:var(--white-color); } input::-webkit-outer-spin-button, input::-webkit-inner-spin-button {  -webkit-appearance:none;  margin:0; }  input[type=number] {  -moz-appearance:textfield;  appearance:textfield; } input[type=radio] {  visibility:hidden;  opacity:0;  display:inline-block;  vertical-align:middle;  width:0;  height:0;  display:none; } input[type=radio] ~ label {  position:relative;  padding-left:30px;  cursor:pointer;  line-height:1;  display:inline-block;  font-weight:600;  margin-bottom:0; } input[type=radio] ~ label::before {  content:"\f111";  position:absolute;  font-family:var(--icon-font);  left:0;  top:-2px;  width:20px;  height:20px;  padding-left:0;  font-size:0.6em;  line-height:19px;  text-align:center;  border:1px solid var(--theme-color);  border-radius:100%;  font-weight:700;  background:var(--white-color);  color:transparent;  transition:all 0.2s ease; } input[type=radio]:checked ~ label::before {  border-color:var(--theme-color);  background-color:var(--theme-color);  color:var(--white-color); } label {  margin-bottom:0.5em;  margin-top:-0.3em;  display:block;  color:var(--title-color);  font-family:var(--body-font);  font-size:16px; } textarea.is-invalid, select.is-invalid, input.is-invalid, .was-validated input:invalid {  border:1px solid var(--error-color) !important;  background-position:right calc(0.375em + 0.8875rem) center;  background-image:none; } textarea.is-invalid:focus, select.is-invalid:focus, input.is-invalid:focus, .was-validated input:invalid:focus {  outline:0;  box-shadow:none; } textarea.is-invalid {  background-position:top calc(0.375em + 0.5875rem) right calc(0.375em + 0.8875rem); } .row.no-gutters > .form-group {  margin-bottom:0; } .status, .status1, .status2 {  padding:5px 15px;  border-radius:4px;  font-size:16px;  margin:10px 0;  display:none; } .status i, .status1 i, .status2 i {  margin-right:10px; } .status i.far.fa-check-circle:before, .status i.far.fa-times-circle:before, .status1 i.far.fa-check-circle:before, .status1 i.far.fa-times-circle:before, .status2 i.far.fa-check-circle:before, .status2 i.far.fa-times-circle:before {  font-size:20px; } .status.error, .status1.error, .status2.error {  background-color:#f2dede;  color:var(--error-color);  border:1px solid #ebccd1;  display:inline-block; } .status.success, .status1.success, .status2.success {  background-color:#dff0d8;  color:var(--success-color);  border:1px solid #d6e9c6;  display:inline-block; }  .swiper-dot {  position:relative; } .swiper-dot .swiper-pagination-bullet {  width:10px;  height:10px;  transition:0.6s;  background-color:var(--bs-bg-color1);  opacity:1;  border-radius:50%; } .swiper-dot .swiper-pagination-bullet:not(:last-child) {  margin-left:0;  margin-right:15px; } .swiper-dot .swiper-pagination-bullet.swiper-pagination-bullet-active {  position:relative;  background-color:var(--dark-color); } .swiper-dot .swiper-pagination-bullet.swiper-pagination-bullet-active::before {  position:absolute;  top:-5px;  left:-5px;  width:20px;  height:20px;  line-height:20px;  border-radius:50%;  background-color:transparent;  border:1px solid var(--dark-color);  content:""; } .swiper-dot.theme-color .swiper-pagination-bullet {  background-color:var(--theme-color); } .swiper-dot.theme-color .swiper-pagination-bullet.swiper-pagination-bullet-active {  background-color:var(--theme-color); } .swiper-dot.theme-color .swiper-pagination-bullet.swiper-pagination-bullet-active::before {  border-color:var(--theme-color); } .array-button {  display:flex;  align-items:center;  gap:15px; } .array-button .s-prev, .array-button .s-next, .array-button .array-prev, .array-button .array-next {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  border-radius:50%;  width:50px;  height:50px;  font-size:18px;  border:1px solid var(--white-color);  background-color:transparent;  transition:background-color 0.3s, transform 0.3s;  font-family:var(--icon-font);  font-weight:900;  color:var(--white-color);  } @media (max-width:767px) {  .array-button .s-prev,  .array-button .s-next,  .array-button .array-prev,  .array-button .array-next {   width:35px;   height:35px;   font-size:16px;  } } @media (max-width:430px) {  .array-button .s-prev,  .array-button .s-next,  .array-button .array-prev,  .array-button .array-next {   width:30px;   height:30px;   font-size:14px;  } } .array-button .s-prev:hover, .array-button .s-next:hover, .array-button .array-prev:hover, .array-button .array-next:hover {  background-color:var(--theme-color);  border-color:var(--theme-color); } .swiper-button-prev, .swiper-button-next {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  border-radius:50%;  width:60px;  height:60px;  font-size:16px;  background-color:var(--white-color);  transition:all 0.4s ease 0s;  font-family:var(--icon-font);  font-weight:900;  color:var(--dark-color);  } @media (max-width:767px) {  .swiper-button-prev,  .swiper-button-next {   width:35px;   height:35px;   font-size:16px;  } } @media (max-width:430px) {  .swiper-button-prev,  .swiper-button-next {   width:30px;   height:30px;   font-size:14px;  } } .swiper-button-prev:hover, .swiper-button-next:hover {  background-color:var(--theme-color); } .swiper-button-prev:hover::after, .swiper-button-next:hover::after {  color:var(--white-color); } .swiper-button-prev::after, .swiper-button-next::after {  font-size:16px;  color:var(--dark-color);  transition:all 0.4s ease 0s; } .swiper-button-prev, .swiper-rtl .swiper-button-next {  left:var(--swiper-navigation-sides-offset, 50px); } .swiper-button-next, .swiper-rtl .swiper-button-prev {  right:var(--swiper-navigation-sides-offset, 50px); }  .owl-nav button {  background:none;  border:none;  cursor:pointer;  display:flex;  align-items:center;  justify-content:center;  transition:all 0.3s ease; }  .owl-nav {  display:flex; } .owl-nav .owl-prev span, .owl-nav .owl-next span {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  border-radius:50%;  width:50px;  height:50px;  font-size:18px;  border:1px solid var(--white-color);  background-color:transparent;  transition:background-color 0.3s, transform 0.3s;  font-family:var(--icon-font);  font-weight:900;  color:var(--white-color); } .owl-nav .owl-prev span:hover, .owl-nav .owl-next span:hover {  background-color:var(--theme-color);  border-color:var(--theme-color); } .pagination-area .page-numbers {  align-items:center;  text-align:center;  width:50px;  height:50px;  line-height:50px;  border-radius:50%;  background-color:var(--white-color);  border:1px solid var(--bs-border-color7);  font-size:18px;  color:var(--dark-color);  display:inline-block;  font-weight:500;  position:relative;  z-index:1;  transition:all 0.4s ease 0s; } .pagination-area .page-numbers.current, .pagination-area .page-numbers:hover {  background-color:var(--theme-color);  color:var(--white-color); } .pagination-area .woocommerce-pagination.nav-links {  text-align:left;  margin-top:30px; }  .mobile-menu-wrapper {  position:fixed;  top:0;  left:0;  bottom:0;  background-color:var(--bs-bg-color2);  z-index:999999;  width:100%;  height:100%;  transition:all 0.4s cubic-bezier(0.785, 0.135, 0.15, 0.86) 0s;  opacity:0;  visibility:hidden; } .mobile-menu-wrapper .mobile-logo {  padding:20px;  display:block;  text-align:start;  background-color:var(--dark-color); } .mobile-menu-wrapper .mobile-logo svg {  max-width:185px; } .mobile-menu-wrapper .menu-toggle {  border:2px solid var(--white-color);  position:absolute;  right:20px;  top:15px;  padding:0;  line-height:1;  width:35px;  height:35px;  line-height:35px;  font-size:14px;  z-index:1;  color:var(--white-color);  background-color:transparent;  border-radius:50%; } .mobile-menu-wrapper .menu-toggle:hover {  transform:rotate(90deg); } .mobile-menu-wrapper .mobile-menu-area {  width:100%;  max-width:310px;  background-color:var(--dark-color);  height:100%;  position:absolute;  left:0;  opacity:0;  visibility:hidden;  transform:translateX(-100%);  transition:all 0.4s cubic-bezier(0.785, 0.135, 0.15, 0.86) 0s;  z-index:1;  overflow-y:auto; } .mobile-menu-wrapper.body-visible {  opacity:1;  visibility:visible;  transition:all 0.4s cubic-bezier(0.785, 0.135, 0.15, 0.86) 0s; } .mobile-menu-wrapper.body-visible .mobile-menu-area {  transform:translateX(0);  opacity:1;  visibility:visible;  transition:all 0.4s cubic-bezier(0.785, 0.135, 0.15, 0.86) 0s; } .mobile-menu-wrapper .sidebar-wrap {  margin-bottom:20px;  padding:0 20px; } .mobile-menu-wrapper .sidebar-wrap h6 {  font-size:14px;  font-weight:600;  color:var(--white-color);  margin-bottom:0;  line-height:24px; } .mobile-menu-wrapper .sidebar-wrap a {  color:var(--white-color); } .mobile-menu-wrapper .sidebar-wrap a:hover {  color:var(--theme-color); } .mobile-menu-wrapper .social-btn.style3 {  padding:0 20px; } .mobile-menu {  padding-bottom:25px;  margin-bottom:40px;  text-align:left;  border-bottom:2px solid var(--white-color); } .mobile-menu::-webkit-scrollbar {  display:none; } .mobile-menu ul {  margin:0;  padding:5px 0; } .mobile-menu ul li {  list-style-type:none;  border-bottom:1px solid var(--bs-border-color); } .mobile-menu ul li:first-child {  border-top:1px solid var(--bs-border-color); } .mobile-menu ul li.active > a {  color:var(--theme-color); } .mobile-menu ul li a {  display:block;  position:relative;  padding:10px 20px;  line-height:1.4;  font-size:18px;  font-weight:600;  font-family:var(--title-font);  color:var(--white-color);  letter-spacing:normal;  text-transform:capitalize; } .mobile-menu ul li a.dropdown-toggle::after {  display:none; } .mobile-menu ul li.active-class > a {  color:var(--theme-color); } .mobile-menu ul li.active-class > a:before {  background:var(--theme-color);  border-color:var(--theme-color); } .mobile-menu ul li ul li {  padding-left:20px; } .mobile-menu ul li ul li a {  font-weight:400;  font-family:var(--body-font);  letter-spacing:normal;  text-transform:capitalize;  font-size:16px;  padding:8px 20px; } .mobile-menu ul li ul li a .mean-expand-class:before {  font-size:14px; } .mobile-menu ul li ul li:last-child {  border-bottom:none; } .mobile-menu ul .submenu-item-has-children.active > a > .mean-expand-class, .mobile-menu ul .submenu-item-has-children.active-class > a > .mean-expand-class {  color:var(--theme-color); } .mobile-menu ul .submenu-item-has-children > a .mean-expand-class {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  right:0;  width:50px;  height:45px;  line-height:45px;  cursor:pointer;  z-index:5;  font-size:18px;  color:var(--white-color);  font-weight:400;  display:inline-block;  text-align:center;  background-color:transparent; } .mobile-menu ul .submenu-item-has-children > a .mean-expand-class:before {  content:"\f107";  font-family:var(--icon-font);  font-weight:700; } .mobile-menu ul .submenu-item-has-children.active-class > a .mean-expand-class:before {  content:"\f106"; } .mobile-menu > ul > li:last-child {  border-bottom:none; } @media (max-width:400px) {  .mobile-menu-wrapper .mobile-menu-area {   width:100%;   max-width:270px;  } }  .loading-screen {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  cursor:default;  position:fixed;  left:0;  top:0;  width:100%;  height:100%;  background:var(--dark-color);  z-index:99999999; } .loading-screen .preloader-close {  position:fixed;  top:15px;  right:15px;  width:30px;  height:30px;  border-radius:50%;  font-size:18px;  line-height:30px;  background:var(--theme-color);  color:var(--white-color);  text-align:center;  cursor:pointer;  z-index:99999999; } .loading-screen .animation-preloader {  z-index:99999999; } .loading-screen .animation-preloader .txt-loading {  font:bold 3em var(--title-font), sans-serif;  text-align:center;  user-select:none; } .loading-screen .animation-preloader .txt-loading .letters-loading {  color:var(--white-color);  position:relative; } .loading-screen .animation-preloader .txt-loading .letters-loading::before {  animation:letters-loading 4s infinite;  color:var(--theme-color);  content:attr(data-text-preloader);  left:0;  opacity:0;  font-family:var(--title-font), sans-serif;  position:absolute;  top:-3px;  transform:rotateY(-90deg); } .loading-screen .animation-preloader .txt-loading .letters-loading:nth-child(1):before {  animation-delay:0s; } .loading-screen .animation-preloader .txt-loading .letters-loading:nth-child(2):before {  animation-delay:0.2s; } .loading-screen .animation-preloader .txt-loading .letters-loading:nth-child(3):before {  animation-delay:0.4s; } .loading-screen .animation-preloader .txt-loading .letters-loading:nth-child(4):before {  animation-delay:0.6s; } .loading-screen .animation-preloader .txt-loading .letters-loading:nth-child(5):before {  animation-delay:0.8s; } .loading-screen .animation-preloader .txt-loading .letters-loading:nth-child(6):before {  animation-delay:1s; } .loading-screen .animation-preloader .txt-loading .letters-loading:nth-child(7):before {  animation-delay:1.2s; } .loading-screen .animation-preloader .txt-loading .letters-loading:nth-child(8):before {  animation-delay:1.4s; } @-webkit-keyframes spinner {  to {   -webkit-transform:rotateZ(360deg);   transform:rotateZ(360deg);  } } @keyframes spinner {  to {   -webkit-transform:rotateZ(360deg);   transform:rotateZ(360deg);  } } @-webkit-keyframes letters-loading {  0%, 75%, 100% {   opacity:0;   -webkit-transform:rotateY(-90deg);   transform:rotateY(-90deg);  }  25%, 50% {   opacity:1;   -webkit-transform:rotateY(0deg);   transform:rotateY(0deg);  } } @keyframes letters-loading {  0%, 75%, 100% {   opacity:0;   -webkit-transform:rotateY(-90deg);   transform:rotateY(-90deg);  }  25%, 50% {   opacity:1;   -webkit-transform:rotateY(0deg);   transform:rotateY(0deg);  } } @media (max-width:767px) {  .loading-screen .animation-preloader .txt-loading {   font:bold 3.5em var(--title-font), sans-serif;  } } @media screen and (max-width:500px) {  .loading-screen .animation-preloader .txt-loading {   font:bold 2em var(--title-font), sans-serif;  } } .link-effect {  position:relative;  overflow:hidden;  display:block;  height:26px;  line-height:1.66; } .link-effect .effect-1 {  display:block;  height:100%;  position:relative;  top:0%;  transition:0.3s; } .link-effect:hover .effect-1 {  top:-100%; } .theme-btn {  font-size:16px;  font-weight:500;  font-family:var(--title-font);  position:relative;  padding:15px 40px;  margin-bottom:0px;  color:var(--dark-color);  background-color:var(--theme-color2);  display:inline-flex;  justify-content:center;  gap:10px;  text-decoration:none;  border-radius:40px;  } @media (max-width:767px) {  .theme-btn {   padding:12px 35px;  } } .theme-btn svg {  width:20px !important; } .theme-btn.bg-white {  background-color:var(--white-color);  border:1px solid var(--dark-color); } .theme-btn.bg-dark {  background-color:var(--dark-color);  color:var(--white-color); } .theme-btn.bg-dark:hover {  color:var(--white-color);  background-color:var(--theme-color) !important; } .theme-btn.bg-dark svg {  fill:var(--white-color);  width:20px;  height:auto; } .theme-btn.bg-dark3 {  background-color:var(--dark-color3);  color:var(--white-color); } .theme-btn.bg-dark3:hover {  color:var(--white-color); } .theme-btn.bg-theme {  background-color:var(--theme-color);  color:var(--white-color); } .theme-btn.bg-theme svg {  fill:var(--white-color); } .theme-btn.bg-theme:hover {  color:var(--white-color); } .theme-btn.bg-border {  background-color:var(--bs-border-color);  color:var(--white-color); } .theme-btn.bg-border:hover {  color:var(--white-color); } .theme-btn.bg-border svg {  fill:var(--white-color);  width:20px; } .theme-btn.bg-transparent {  background-color:transparent;  border:1px solid var(--dark-color); } .theme-btn.bg-transparent svg {  fill:var(--dark-color);  width:20px; } .theme-btn i {  font-size:16px;  height:26px;  line-height:1.66; } .theme-btn:hover {  color:var(--dark-color); } .theme-btn:hover .effect-1 {  top:-100%; } .theme-btn.text-theme:before, .theme-btn.text-theme:after {  background:var(--theme-color); } .theme-btn.text-theme img {  filter:brightness(99); } .icon-btn {  display:inline-block;  width:var(--btn-size, 46px);  height:var(--btn-size, 46px);  line-height:var(--btn-size, 46px);  font-size:var(--btn-font-size, 16px);  background-color:var(--theme-color);  color:var(--white-color);  text-align:center;  border-radius:0px;  border:none;  transition:0.4s ease-in-out; } .icon-btn:hover {  background-color:var(--title-color);  color:var(--white-color); } .icon-btn.btn-border {  background:transparent;  border:2px solid var(--theme-color);  color:var(--theme-color); } .icon-btn.btn-border:hover {  background:var(--theme-color);  color:var(--white-color); } .scroll-top {  position:fixed;  right:30px;  bottom:30px;  height:50px;  width:50px;  cursor:pointer;  display:block;  border-radius:50%;  z-index:10000;  opacity:1;  visibility:hidden;  transform:translateY(45px);  transition:all 300ms linear; } .scroll-top:after {  content:"\f062";  font-family:var(--icon-font);  font-weight:700;  position:absolute;  text-align:center;  line-height:50px;  font-size:20px;  color:var(--title-color);  left:0;  top:0;  height:100%;  width:100%;  cursor:pointer;  display:block;  z-index:1;  border-radius:50%; } .scroll-top svg {  color:var(--title-color);  border-radius:50%;  background:var(--white-color);  border:1px solid var(--white-color); } .scroll-top svg path {  fill:none; } .scroll-top .progress-circle path {  stroke:var(--theme-color);  stroke-width:6px;  box-sizing:border-box;  transition:all 400ms linear; } .scroll-top.show {  opacity:1;  visibility:visible;  transform:translateY(0); }  @media (max-width:575px) {  .scroll-top {   right:15px;   bottom:15px;   height:40px;   width:40px;  }  .scroll-top:after {   font-size:16px;   line-height:40px;  }  .btn {   padding:15.5px 20px;   font-size:12px;   font-weight:500;  }  .btn.circle-btn {   height:120px;   width:120px;   line-height:120px;  } } .top-scroll {  cursor:pointer;  display:inline-block;  padding:19px 13px;  border-radius:7px;  background-color:var(--theme-color);  text-align:center;  transition:all 300ms linear; }  @media (max-width:767px) {  .play-btn {   --icon-size:70px;   --icon-font-size:24px;  }  .btn {   font-size:14px;   font-weight:600;   line-height:1;   padding:17px 25px;  } } body.bg-title .scroll-top svg {  color:var(--white-color); } body.bg-title .scroll-top svg path {  stroke:var(--theme-color); } body.bg-title .scroll-top::after {  color:var(--white-color);  box-shadow:inset 0 0 0 2px rgba(255, 255, 255, 0.4); }  .title-area {  margin-bottom:calc(var(--section-title-space) - 30px);  position:relative;  z-index:2; } @media (max-width:991px) {  .title-area {   --section-title-space:60px;  } } @media (max-width:767px) {  .title-area {   --section-title-space:55px;  } } .title-area.two {  margin-bottom:calc(var(--section-title-space) - 30px); } .title-area.twoT {  margin-bottom:calc(var(--section-title-space) - 42px); } .title-area.three {  margin-bottom:calc(var(--section-title-space) - 20px); } .title-area.threeT {  margin-bottom:calc(var(--section-title-space) - 34px); } .title-area.threeT .sec-title {  margin-bottom:13px; } .sub-title {  display:flex;  align-items:center;  gap:10px;  color:var(--theme-color);  text-transform:uppercase;  font-size:16px;  font-weight:500;  margin-bottom:18px;  position:relative; } .sub-title.style-2 {  display:inline-block;  padding:0 14px;  height:44px;  line-height:44px;  text-align:center;  border-radius:22px;  background-color:var(--bs-bg-color10);  font-size:16px;  color:var(--white-color) !important;  font-weight:500; } .sub-title span {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:36px;  height:36px;  border-radius:50%;  background-color:var(--theme-color); } .text-center .sub-title {  justify-content:center; } .sec-title {  font-size:42px;  line-height:1.18;  margin-bottom:20px;  margin-top:-0.18em;  font-weight:400;  position:relative; } .sec-title .bold {  font-weight:700; } @media (max-width:1280px) {  .sec-title {   font-size:34px;  } } @media (min-width:992px) and (max-width:1024px) {  .sec-title {   font-size:30px;  } } @media (max-width:540px) {  .sec-title {   font-size:30px;   letter-spacing:normal;  } } @media (max-width:430px) {  .sec-title {   font-size:28px;  } } @media (max-width:414px) {  .sec-title {   font-size:24px;  } } .sec-text {  font-size:16px;  line-height:1.66;  color:var(--gray-color2);  margin-bottom:0; } @media (min-width:992px) and (max-width:1024px) {  .sec-text br {   display:none;  } } .white .sub-title {  color:var(--theme-color2); } .white .sec-title {  color:var(--white-color); }  .asterisk {  display:inline-block;  width:13px !important;  height:14px !important;  position:relative; } .asterisk::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/asterisk.png.webp") no-repeat center/cover; } .arrow-down {  display:inline-block;  width:40px !important;  height:50px !important;  position:relative; } .arrow-down::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/arrow-down-long.png.webp") no-repeat center/cover; } .icon-quote {  display:inline-block;  width:58px !important;  height:47px !important;  position:relative; } .icon-quote::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/quote.png.webp") no-repeat center/cover; } .icon-phone-circle {  display:inline-block;  width:34px !important;  height:34px !important;  position:relative; } .icon-phone-circle::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/phone-circle.png.webp") no-repeat center/cover; } .icon-phone-circle-small {  display:inline-block;  width:24px !important;  height:24px !important;  position:relative; } .icon-phone-circle-small::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/phone-circle.png.webp") no-repeat center/cover; } .icon-arrow-up-right {  display:inline-block;  width:16px !important;  height:16px !important;  position:relative; } .icon-arrow-up-right::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/arrow-up-right.png.webp") no-repeat center/cover; } .icon-switch {  display:inline-block;  width:60px !important;  height:60px !important;  position:relative; } .icon-switch::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/icon-switch.png.webp") no-repeat center/cover; } .icon-risk {  display:inline-block;  width:60px !important;  height:60px !important;  position:relative; } .icon-risk::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/icon-risk.png.webp") no-repeat center/cover; } .icon-checked-box {  display:inline-block;  width:60px !important;  height:60px !important;  position:relative; } .icon-checked-box::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/checked-box.png.webp") no-repeat center/cover; } .icon-inverted-triangle {  display:inline-block;  width:65px !important;  height:60px !important;  position:relative; } .icon-inverted-triangle::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/inverted-triangle.png.webp") no-repeat center/cover; } .icon-refresh-arrow {  display:inline-block;  width:60px !important;  height:60px !important;  position:relative; } .icon-refresh-arrow::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/refresh-arrow.png.webp") no-repeat center/cover; } .icon-recycle-arrow {  display:inline-block;  width:24px !important;  height:24px !important;  position:relative; } .icon-recycle-arrow::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/recycle-arrow.png.webp") no-repeat center/cover; } .icon-growth-arrow {  display:inline-block;  width:36px !important;  height:36px !important;  position:relative; } .icon-growth-arrow::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/growth-arrow.png.webp") no-repeat center/cover; } .icon-bentol {  display:inline-block;  width:14px !important;  height:16px !important;  position:relative; } .icon-bentol::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/bentol.png.webp") no-repeat center/cover; } .icon-checkmark {  display:inline-block;  width:22px !important;  height:20px !important;  position:relative; } .icon-checkmark::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/checkmark.png.webp") no-repeat center/cover; } .icon-checkmark2 {  display:inline-block;  width:18px !important;  height:16px !important;  position:relative;  filter:brightness(0) saturate(100%) invert(12%) sepia(97%) saturate(556%) hue-rotate(135deg) brightness(92%) contrast(95%); } .icon-checkmark2::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/checkmark.png.webp") no-repeat center/cover; } .icon-checkmark-small {  display:inline-block;  width:16px !important;  height:14px !important;  position:relative;  filter:brightness(0) invert(1);  background-repeat:no-repeat;  background-size:contain; } .icon-checkmark-small::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/checkmark.png.webp") no-repeat center/cover; } .icon-check-circle {  display:inline-block;  width:18px !important;  height:18px !important;  position:relative; } .icon-check-circle::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/check-circle.png.webp") no-repeat center/cover; } .icon-check-circle {  display:inline-block;  width:18px !important;  height:18px !important;  position:relative; } .icon-check-circle::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/check-circle.png.webp") no-repeat center/cover; } .icon-since {  display:inline-block;  width:31px !important;  height:35px !important;  position:relative; } .icon-since::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/icon-since.png.webp") no-repeat center/cover; } .icon-comercial {  display:inline-block;  width:57px !important;  height:60px !important;  position:relative; } .icon-comercial::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/icon-comercial.png.webp") no-repeat center/cover; } .icon-infomsg {  display:inline-block;  width:67px !important;  height:60px !important;  position:relative; } .icon-infomsg::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/icon-infomsg.png.webp") no-repeat center/cover; } .icon-finished {  display:inline-block;  width:60px !important;  height:60px !important;  position:relative; } .icon-finished::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/icon-finished.png.webp") no-repeat center/cover; } .icon-mom-star {  display:inline-block;  width:40px !important;  height:60px !important;  position:relative; } .icon-mom-star::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/mom-star.png.webp") no-repeat center/cover; } .icon-angel-left {  display:inline-block;  width:22px !important;  height:40px !important;  position:relative; } .icon-angel-left::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/angel-left.png.webp") no-repeat center/cover; } .icon-angel-right {  display:inline-block;  width:22px !important;  height:40px !important;  position:relative; } .icon-angel-right::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/angel-right.png.webp") no-repeat center/cover; } .icon-small-hand {  display:inline-block;  width:26px !important;  height:28px !important;  position:relative; } .icon-small-hand::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/icon-hand.png.webp") no-repeat center/cover; } .icon-growth-chartt, .icon-growth-chart {  display:inline-block;  width:46px !important;  height:46px !important;  position:relative; } .icon-growth-chartt::before, .icon-growth-chart::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/growth-chart.png.webp") no-repeat center/cover; } .icon-growth-chart2 {  display:inline-block;  width:60px !important;  height:60px !important;  position:relative; } .icon-growth-chart2::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/growth-chart2.png.webp") no-repeat center/cover; } .icon-three-people-global {  display:inline-block;  width:60px !important;  height:60px !important;  position:relative; } .icon-three-people-global::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/three-people-global.png.webp") no-repeat center/cover; } .icon-target-goal {  display:inline-block;  width:46px !important;  height:46px !important;  position:relative; } .icon-target-goal::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/target-goal.png.webp") no-repeat center/cover; } .icon-frustration {  display:inline-block;  width:46px !important;  height:46px !important;  position:relative; } .icon-frustration::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/icon-frustration.png.webp") no-repeat center/cover; } .icon-e {  display:inline-block;  width:53px !important;  height:60px !important;  position:relative; } .icon-e::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/icon-e.png.webp") no-repeat center/cover; } .icon-three-people {  display:inline-block;  width:70px !important;  height:70px !important;  position:relative; } .icon-three-people::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/icon-three-people.png.webp") no-repeat center/cover; } .icon-target {  display:inline-block;  width:70px !important;  height:70px !important;  position:relative; } .icon-target::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/icon-target.png.webp") no-repeat center/cover; } .icon-target2 {  display:inline-block;  width:60px !important;  height:60px !important;  position:relative; } .icon-target2::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/icon-target.png.webp") no-repeat center/cover; } .icon-message {  display:inline-block;  width:77px !important;  height:70px !important;  position:relative; } .icon-message::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/icon-message.png.webp") no-repeat center/cover; } .icon-handshake {  display:inline-block;  width:56px !important;  height:50px !important;  position:relative; } .icon-handshake::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/icon-handshake.png.webp") no-repeat center/cover; } .line-long-arrow {  display:inline-block;  width:26px !important;  height:50px !important;  position:relative; } .line-long-arrow::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/line-long-arrow.png.webp") no-repeat center/cover; } .icon-check-circle2 {  display:inline-block;  width:22px !important;  height:20px !important;  position:relative; } .icon-check-circle2::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/check-circle2.png.webp") no-repeat center/cover; } .icon-calender {  display:inline-block;  width:18px !important;  height:16px !important;  position:relative; } .icon-calender::before {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  width:100%;  height:100%;  transform:translate(-50%, -50%);  background:url("/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/icon-calender.png.webp") no-repeat center/cover; } .icon-growth-chartt, .icon-switch {  background-position:center center;  background-size:cover; } .icon-growth-chartt::before, .icon-switch::before {  display:none; }  .page-wrapper {  position:relative;  z-index:1;  margin:0 auto;  width:100%;  min-width:300px; } .shape-mockup-wrap {  z-index:2;  position:relative; } .shape-mockup {  position:absolute;  z-index:-1; } .shape-mockup.z-index-3 {  z-index:3; } .z-index-step1 {  position:relative;  z-index:4 !important; } .z-index-common {  position:relative;  z-index:3; } .z-index-3 {  z-index:3; } .z-index-n1 {  z-index:-1; } .media-body {  flex:1; } .style-italic {  font-style:italic; } .social-btn {  display:flex;  gap:10px; } .social-btn a {  height:var(--icon-size, 48px);  width:var(--icon-size, 48px);  line-height:48px;  display:inline-block;  color:var(--title-color);  text-align:center;  font-size:16px;  border-radius:50%;  border:1px solid var(--bs-border-color);  background:var(--bs-border-color); } .social-btn a:hover {  background:var(--title-color);  color:var(--white-color);  border-color:var(--title-color); } .social-btn.style2 {  gap:25px; } .social-btn.style2 .link-effect {  height:25px; } .social-btn.style2 a {  background:transparent;  width:auto;  height:auto;  line-height:normal;  border-radius:0;  color:var(--white-color);  border:0;  font-size:20px; } .social-btn.style2 a:hover {  background:transparent;  color:var(--theme-color); } .social-btn.style3 {  gap:15px; } .social-btn.style3 .link-effect {  height:46px;  line-height:46px; } .social-btn.style3 a {  display:inline-block;  background:var(--theme-color);  width:45px;  height:45px;  line-height:45px;  border-radius:50%;  color:var(--white-color);  border:0;  font-size:16px; } .social-btn.style3 a:hover {  color:var(--white-color); } .social-btn.color-theme a {  color:var(--body-color);  border-color:var(--theme-color); } .btn-group {  display:flex;  flex-wrap:wrap;  align-items:center;  gap:20px; } .btn-group .btn {  border-radius:40px;  flex:none; } .btn-group.style2 {  gap:20px 70px;  } @media (max-width:767px) {  .btn-group.style2 {   gap:20px 30px;  } } .w-fit {  width:-moz-fit-content !important;  width:fit-content !important; }  .f-thumbs__slide__img {  height:100% !important; } .select2-results__option {  padding:0 10px;  color:var(--gray-color); } .select2-container--default .select2-selection--single {  border-radius:0; } .select2-container--default .select2-selection--single .select2-selection__rendered {  color:var(--gray-color);  padding-left:0;  line-height:38px;  padding:0; } .select2-container--default .select2-selection--single .select2-selection__arrow {  bottom:1px;  height:auto;  width:40px;  display:flex;  align-items:center;  justify-content:center;  font-size:12px;  color:var(--gray-color); } .select2-container--default .select2-selection--single .select2-selection__arrow:before {  position:relative;  content:"\f107";  font-family:var(--icon-font);  font-weight:900; } .select2-container--default .select2-selection--single .select2-selection__arrow b {  display:none; } .select2-container--default .select2-results__option--highlighted[aria-selected] {  background-color:var(--theme-color); } .select2-container--default .select2-search--dropdown .select2-search__field {  height:30px;  background:var(--white-color);  color:var(--dark-color); } .form-group .select2-container--default .select2-selection--single {  position:relative;  display:block;  width:100%;  height:56px;  padding:10px 25px;  line-height:1.4;  border-radius:28px;  color:var(--dark-color);  background-color:var(--white-color);  border:1px solid var(--bs-border-color6);  transition:all 300ms ease; } .select2-container {  flex:1; }  #ui-datepicker-div {  z-index:10 !important; } .custom-date-input {  width:200px;  padding:10px;  border-radius:5px;  border:1px solid var(--bs-border-color);  font-size:16px;  background-color:var(--white-color); } .ui-datepicker {  background:var(--white-color);  border:1px solid var(--white-color);  color:#fff; } table.ui-datepicker-calendar {  margin-bottom:0; } table.ui-datepicker-calendar td:hover {  background:var(--dark-color);  color:var(--white-color); } table.ui-datepicker-calendar td:hover a {  background:transparent;  color:var(--white-color); } .ui-datepicker-title {  display:flex; } .ui-datepicker-title select {  max-height:200px;  overflow-y:auto; } .ui-datepicker-title select.ui-datepicker-year, .ui-datepicker-title select.ui-datepicker-month {  background:var(--white-color);  border:1px solid var(--dark-color);  color:var(--dark-color);  height:30px;  line-height:30px;  border-radius:0;  width:100%;  padding:0;  text-align:center; } .ui-datepicker-next.ui-corner-all {  float:right; } td.ui-datepicker-days-cell-over.ui-datepicker-today {  background:var(--theme-color); } td.ui-datepicker-days-cell-over.ui-datepicker-today a {  color:var(--white-color);  cursor:pointer; } .ui-datepicker-header {  background:var(--white-color);  border-bottom:1px solid #555; } .ui-datepicker-prev, .ui-datepicker-next {  color:var(--dark-color); } .ui-state-active {  background:var(--theme-color); } .ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {  border:1px solid var(--theme-color);  background:var(--theme-color);  color:var(--white-color); }  .ui-timepicker-list {  background-color:var(--white-color);  border:1px solid var(--dark-color);  max-height:200px;  overflow-y:auto; } .popup-status {  position:fixed;  bottom:20px;  left:20px;  padding:15px;  border-radius:5px;  color:var(--white-color);  font-size:16px;  z-index:1000;  display:flex;  align-items:center;  animation:slideIn 0.3s ease-out; } .popup-status i {  margin-right:10px;  cursor:pointer; } .popup-status.success {  background-color:var(--success-color); } .popup-status.error {  background-color:var(--error-color); } @keyframes slideIn {  from {   opacity:0;   transform:translateY(10px);  }  to {   opacity:1;   transform:translateY(0);  } } .img-half {  position:absolute;  top:0;  width:50%;  height:100%;  z-index:-1; } .img-half img {  width:100%;  height:100%;  object-fit:cover; } .img-half.img-right {  right:0; } .icon-box {  display:inline-flex;  gap:10px; } .btn-wrap {  display:flex;  flex-wrap:wrap;  align-items:center;  gap:20px 30px; } .btn-wrap.style2 {  gap:30px 40px; } .category-tag {  height:34px;  line-height:34px;  padding:0 17px;  font-size:14px;  color:var(--white-color);  font-weight:500;  border-radius:17px;  background-color:var(--dark-color);  transition:all 0.4s ease 0s;  cursor:pointer; } .category-tag:hover {  background-color:var(--theme-color); } .overlay-anim1 {  position:relative; } .overlay-anim1::after {  background-color:var(--bs-bg-color9);  content:"";  position:absolute;  left:0;  top:0;  width:100%;  height:0;  opacity:1;  z-index:1;  pointer-events:none; } .overlay-anim1:hover::after {  height:100%;  opacity:0;  -webkit-transition:all 400ms linear;  -o-transition:all 400ms linear;  transition:all 400ms linear; } .overlay-anim2 {  position:relative;  transition:all 0.4s ease-in-out; } .overlay-anim2:after {  content:"";  position:absolute;  pointer-events:none;  opacity:1;  z-index:1;  top:50%;  right:0;  bottom:50%;  left:0;  background:var(--bs-bg-color5); } .overlay-anim2:hover:after {  top:0;  bottom:0;  opacity:0;  transition:all 900ms linear; } .overlay-anim3 {  position:relative;  overflow:hidden; } .overlay-anim3::before {  background-color:rgba(0, 0, 0, 0.6);  content:"";  position:absolute;  left:50%;  top:50%;  width:0;  height:0;  opacity:0;  z-index:1;  pointer-events:none;  -webkit-transition:all 500ms ease-in-out;  -o-transition:all 500ms ease-in-out;  transition:all 500ms ease-in-out;  transform:translate(-50%, -50%); } .overlay-anim3:hover::before {  width:100%;  height:100%;  opacity:1;  transform:translate(-50%, -50%); } .overlay-fade {  position:relative; } .overlay-fade::after {  background-color:var(--bs-bg-color2);  content:"";  position:absolute;  left:0;  top:0;  width:100%;  height:100%;  opacity:0;  transition:opacity 400ms ease-in-out;  z-index:9;  pointer-events:none; } .overlay-fade:hover::after {  opacity:1; } .overlay-diagonal {  position:relative; } .overlay-diagonal::after {  background-color:var(--bs-bg-color2);  content:"";  position:absolute;  left:-100%;   top:100%;   width:100%;  height:100%;  transition:left 400ms ease-in-out, top 400ms ease-in-out;  z-index:9;  pointer-events:none; } .overlay-diagonal:hover::after {  left:0;   top:0;  } .js-marquee {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:start; } .border {  position:relative;  border-bottom:1px solid var(--bs-border-color7) !important; } .border.white {  position:relative;  border-bottom:1px solid rgba(244, 248, 236, 0.102) !important; } .cover-background {  background-size:cover;  background-position:center center !important; } .bg {  position:absolute;  z-index:-1;  left:0;  top:0;  height:100%;  width:100%;  background-repeat:no-repeat;  background-position:center;  background-size:cover; } .bg.image img {  width:100%;  height:100%;  object-fit:cover; } .bg-image.overlay::before {  position:absolute;  content:"";  left:0;  top:0;  width:100%;  height:100%;  background:var(--bs-bg-color3); } label.error {  font-size:13px;  color:var(--error-color); } .bg-image1 {  background-image:linear-gradient(var(--white-color) 50%, var(--dark-color) 50%); } .bg-image2 {  background-image:linear-gradient(var(--theme-color2) 50%, var(--dark-color) 50%); } .bg-image3 {  background-image:linear-gradient(transparent 50%, var(--dark-color) 50%); } .mbm-multiply {  mix-blend-mode:multiply; } .mbm-color {  mix-blend-mode:color; } .mbm-screen {  mix-blend-mode:screen; } .mbm-overlay {  mix-blend-mode:overlay; } .mbm-lighten {  mix-blend-mode:lighten; } .mbm-darken {  mix-blend-mode:darken; } .mbm-difference {  mix-blend-mode:difference; } .mbm-exclusion {  mix-blend-mode:exclusion; } .mbm-luminosity {  mix-blend-mode:luminosity; } .mw-inherit {  max-width:inherit !important; } .mw-fit-content {  max-width:fit-content !important; } .mw-max-content {  max-width:max-content !important; } .mw-min-content {  max-width:min-content !important; } .mw-none {  max-width:none !important; } .mw-unset {  max-width:unset !important; } .direction-rtl {  direction:rtl; } .direction-ltr {  direction:ltr; } .direction-initial {  direction:initial; } .direction-inherit {  direction:inherit; }  .font-icon {  font-family:var(--icon-font); } .font-title {  font-family:var(--title-font); } .font-body {  font-family:var(--body-font); } .fw-extralight {  font-weight:100; } .fw-light {  font-weight:300; } .fw-normal {  font-weight:400; } .fw-medium {  font-weight:500 !important; } .fw-semibold {  font-weight:600 !important; } .fw-bold {  font-weight:700; } .fw-extrabold {  font-weight:800; } .fs-md {  font-size:18px; } .fs-xs {  font-size:14px; } .text-underline {  text-decoration:underline; }  .bg-theme {  background-color:var(--theme-color) !important; } .bg-theme2 {  background-color:var(--theme-color2) !important; } .bg-theme3 {  background-color:var(--theme-color3) !important; } .bg-white {  background-color:var(--white-color) !important; } .bg-dark {  background-color:var(--dark-color) !important; } .bg-dark2 {  background-color:var(--dark-color2) !important; } .bg-dark3 {  background-color:var(--dark-color3) !important; } .bg-dark4 {  background-color:var(--dark-color4) !important; } .bg-light {  background-color:var(--light-color) !important; } .bg-light2 {  background-color:var(--light-color2) !important; } .bg-light3 {  background-color:var(--light-color3) !important; } .bg-gray {  background-color:var(--gray-color) !important; } .bg-border {  background-color:var(--bs-border-color) !important; } .bg-title {  background-color:var(--title-color) !important; } .background-image, [data-bg-src] {  background-repeat:no-repeat;  background-size:cover;  background-position:center center; } .bg-fluid {  background-repeat:no-repeat;  background-size:100% 100%;  background-position:center center; } .bg-auto {  background-size:auto auto; } .bg-top-center {  background-size:auto;  background-position:top center; } .bg-repeat {  background-size:auto;  background-repeat:repeat; }  .text-theme {  color:var(--theme-color) !important; } .text-theme2 {  color:var(--theme-color2) !important; } .text-white {  color:var(--white-color) !important; } .text-dark {  color:var(--dark-color) !important; } .text-dark2 {  color:var(--dark-color2) !important; } .text-dark3 {  color:var(--dark-color3) !important; } .text-dark4 {  color:var(--dark-color4) !important; } .text-gray {  color:var(--gray-color) !important; } .text-gray2 {  color:var(--gray-color2) !important; } .text-light {  color:var(--light-color) !important; } .text-light2 {  color:var(--light-color2) !important; } .text-success {  color:var(--success-color) !important; } .text-error {  color:var(--error-color) !important; } .text-inherit {  color:inherit; } .text-inherit:hover {  color:var(--theme-color); } a.text-theme:hover, .text-reset:hover {  text-decoration:none; }  .overlay {  position:absolute;  top:0;  left:0;  height:100%;  width:100%; } .position-center {  position:absolute;  left:50%;  top:50%;  transform:translate(-50%, -50%); } [data-overlay] {  position:relative;  z-index:2; } [data-overlay] [class^=col-], [data-overlay] [class*=col-] {  z-index:1; } [data-overlay]:before {  content:"";  position:absolute;  left:0;  top:0;  right:0;  bottom:0;  z-index:1; } [data-overlay=theme]:before {  background-color:var(--theme-color); } [data-overlay=theme2]:before {  background-color:var(--theme-color2); } [data-overlay=white]:before {  background-color:var(--white-color); } [data-overlay=dark]:before {  background-color:var(--dark-color); } [data-overlay=dark2]:before {  background-color:var(--dark-color2); } [data-overlay=dark3]:before {  background-color:var(--dark-color3); } [data-overlay=dark4]:before {  background-color:var(--dark-color4); } [data-overlay=light]:before {  background-color:var(--light-color); } [data-overlay=light2]:before {  background-color:var(--light-color2); } [data-overlay=gray]:before {  background-color:var(--gray-color); } [data-overlay=overlay1]:before {  background-color:#131B23; } [data-opacity="1"]:before {  opacity:0.1; } [data-opacity="2"]:before {  opacity:0.2; } [data-opacity="3"]:before {  opacity:0.3; } [data-opacity="4"]:before {  opacity:0.4; } [data-opacity="5"]:before {  opacity:0.5; } [data-opacity="6"]:before {  opacity:0.6; } [data-opacity="7"]:before {  opacity:0.7; } [data-opacity="8"]:before {  opacity:0.8; } [data-opacity="9"]:before {  opacity:0.9; } [data-opacity="10"]:before {  opacity:1; }  .ripple-animation {  animation-duration:var(--ripple-ani-duration);  animation-timing-function:ease-in-out;  animation-iteration-count:infinite;  animation-name:ripple; } @keyframes ripple {  0% {   transform:scale(1);   opacity:0;  }  30% {   opacity:1;  }  100% {   transform:scale(2.1);   opacity:0;  } } @-webkit-keyframes ripple-video {  0% {   -webkit-box-shadow:0 0 0 0 rgba(255, 255, 255, 0.3), 0 0 0 10px rgba(255, 255, 255, 0.3), 0 0 0 20px rgba(255, 255, 255, 0.3);   box-shadow:0 0 0 0 rgba(255, 255, 255, 0.3), 0 0 0 10px rgba(255, 255, 255, 0.3), 0 0 0 20px rgba(255, 255, 255, 0.3);  }  100% {   -webkit-box-shadow:0 0 0 10px rgba(255, 255, 255, 0.3), 0 0 0 20px rgba(255, 255, 255, 0.3), 0 0 0 30px rgba(255, 255, 255, 0);   box-shadow:0 0 0 10px rgba(255, 255, 255, 0.3), 0 0 0 20px rgba(255, 255, 255, 0.3), 0 0 0 30px rgba(255, 255, 255, 0);  } } @keyframes ripple-video {  0% {   -webkit-box-shadow:0 0 0 0 rgba(255, 255, 255, 0.3), 0 0 0 10px rgba(255, 255, 255, 0.3), 0 0 0 20px rgba(255, 255, 255, 0.3);   box-shadow:0 0 0 0 rgba(255, 255, 255, 0.3), 0 0 0 10px rgba(255, 255, 255, 0.3), 0 0 0 20px rgba(255, 255, 255, 0.3);  }  100% {   -webkit-box-shadow:0 0 0 10px rgba(255, 255, 255, 0.3), 0 0 0 20px rgba(255, 255, 255, 0.3), 0 0 0 30px rgba(255, 255, 255, 0);   box-shadow:0 0 0 10px rgba(255, 255, 255, 0.3), 0 0 0 20px rgba(255, 255, 255, 0.3), 0 0 0 30px rgba(255, 255, 255, 0);  } } .play-btn:after, .play-btn:before {  -webkit-animation-duration:var(--ripple-ani-duration);  animation-duration:var(--ripple-ani-duration);  -webkit-animation-timing-function:ease-in-out;  animation-timing-function:ease-in-out;  -webkit-animation-iteration-count:infinite;  animation-iteration-count:infinite;  -webkit-animation-name:ripple2;  animation-name:ripple2; } @-webkit-keyframes ripple2 {  0% {   -webkit-transform:scale(1);   transform:scale(1);   opacity:0;  }  30% {   opacity:0.4;  }  100% {   -webkit-transform:scale(1.4);   transform:scale(1.4);   opacity:0;  } } @keyframes ripple2 {  0% {   -webkit-transform:scale(1);   transform:scale(1);   opacity:0;  }  30% {   opacity:0.4;  }  100% {   -webkit-transform:scale(1.4);   transform:scale(1.4);   opacity:0;  } } @-webkit-keyframes ripple3 {  0% {   -webkit-transform:scale(1);   transform:scale(1);   opacity:0;  }  30% {   opacity:0.4;  }  100% {   -webkit-transform:scale(2.8);   transform:scale(2.8);   opacity:0;  } } @keyframes ripple3 {  0% {   -webkit-transform:scale(1);   transform:scale(1);   opacity:0;  }  30% {   opacity:0.4;  }  100% {   -webkit-transform:scale(2.8);   transform:scale(2.8);   opacity:0;  } } .movingX {  animation:movingX 8s linear infinite; } @keyframes movingX {  0% {   transform:translateX(0);  }  50% {   transform:translateX(50px);  }  100% {   transform:translateX(0);  } } .moving {  animation:moving 8s linear infinite; } @keyframes moving {  0% {   transform:translateX(0);  }  50% {   transform:translateX(-50px);  }  100% {   transform:translateX(0);  } } .jump {  animation:jumpAni 7s linear infinite; } .jump1 {  animation:jumpAni 6s linear infinite; } .jump2 {  animation:jumpAni 5s linear infinite; } .jump3 {  animation:jumpAni 4s linear infinite; } @keyframes jumpAni {  0% {   transform:translateY(0);  }  40% {   transform:translateY(-30px);  }  100% {   transform:translateY(0);  } } .jump-reverse {  animation:jumpReverseAni 7s linear infinite; } @keyframes jumpReverseAni {  0% {   transform:translateY(0);  }  50% {   transform:translateY(30px);  }  100% {   transform:translateY(0);  } } .spin {  animation:spin 15s linear infinite; } .spin2 {  animation:spin2 20s linear infinite; } .spin-slow {  animation:spin 50s linear infinite; } @keyframes spin {  0% {   transform:rotate(0);  }  100% {   transform:rotate(-360deg);  } } @keyframes spin2 {  0% {   transform:rotate(0);  }  100% {   transform:rotate(360deg);  } } @keyframes animate-positive {  0% {   width:0;  } } .scalein.slider-animated {  --animation-name:scalein; } .slidetopleft.slider-animated {  --animation-name:slidetopleft; } .slidebottomright.slider-animated {  --animation-name:slidebottomright; } .slideinleft.slider-animated {  --animation-name:slideinleft; } .slideinright.slider-animated {  --animation-name:slideinright; } .slideinup.slider-animated {  --animation-name:slideinup; } .slideindown.slider-animated {  --animation-name:slideindown; } .rollinleft.slider-animated {  --animation-name:rollinleft; } .rollinright.slider-animated {  --animation-name:rollinright; } .scalein, .slidetopleft, .slidebottomright, .slideinleft, .slideinright, .slideindown, .slideinup, .rollinleft, .rollinright {  opacity:0;  animation-fill-mode:both;  animation-iteration-count:1;  animation-duration:1s;  animation-delay:0.3s;  animation-name:var(--animation-name); } .slider-animated {  opacity:1; } @keyframes slideinup {  0% {   opacity:0;   transform:translateY(70px);  }  100% {   transform:translateY(0);  } } @keyframes slideinright {  0% {   opacity:0;   transform:translateX(70px);  }  100% {   transform:translateX(0);  } } @keyframes slideindown {  0% {   opacity:0;   transform:translateY(-70px);  }  100% {   transform:translateY(0);  } } @keyframes slideinleft {  0% {   opacity:0;   transform:translateX(-70px);  }  100% {   transform:translateX(0);  } } @keyframes slidebottomright {  0% {   opacity:0;   transform:translateX(100px) translateY(100px);  }  100% {   transform:translateX(0) translateY(0);  } } @keyframes slidetopleft {  0% {   opacity:0;   transform:translateX(-100px) translateY(-100px);  }  100% {   transform:translateX(0) translateY(0);  } } @keyframes rotate {  from {   transform:rotate(0deg);  }  to {   transform:rotate(360deg);  }  0% {   border-right-color:transparent;   border-bottom-color:transparent;   border-top-color:transparent;   border-left-color:transparent;  }  75% {   border-top-color:#fff;   border-left-color:#fff;   border-right-color:#fff;   border-bottom-color:transparent;  }  100% {   border-right-color:transparent;   border-bottom-color:transparent;   border-top-color:transparent;   border-left-color:transparent;  } } .img-anim-right {  animation:img-anim-right 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0.4s;  opacity:0; } @keyframes img-anim-right {  0% {   transform:translateX(5%);   clip-path:inset(0 0 0 100%);   opacity:0;  }  100% {   transform:translateX(0);   clip-path:inset(0 0 0 0);   opacity:1;  } } .img-anim-left {  animation:img-anim-left 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0.4s;  opacity:0; } @keyframes img-anim-left {  0% {   transform:translateX(-5%);   clip-path:inset(0 100% 0 0);   opacity:0;  }  100% {   transform:translateX(0);   clip-path:inset(0 0 0 0);   opacity:1;  } } .img-anim-top {  animation:img-anim-top 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1);  opacity:0; } @keyframes img-anim-top {  0% {   transform:translateY(-5%);   clip-path:inset(0 0 100% 0);   opacity:0;  }  100% {   transform:translateY(0);   clip-path:inset(0 0 0 0);   opacity:1;  } } .img-anim-bottom {  animation:img-anim-bottom 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1);  opacity:0; } @keyframes img-anim-bottom {  0% {   transform:translateY(5%);   clip-path:inset(100% 0 0 0);   opacity:0;  }  100% {   transform:translateY(0);   clip-path:inset(0 0 0 0);   opacity:1;  } } .text-anim-right {  animation:text-anim-right 0.4s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes text-anim-right {  from {   transform:translateX(5%);   clip-path:inset(0 0 0 100%);   opacity:0;  }  to {   transform:translateX(0);   clip-path:inset(0 0 0 0);   opacity:1;  } } .text-anim-left {  animation:text-anim-left 0.4s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes text-anim-left {  from {   transform:translateX(-5%);   clip-path:inset(0 0 0 100%);   opacity:0;  }  to {   transform:translateX(0);   clip-path:inset(0 0 0 0);   opacity:1;  } } .text-anim-top {  animation:text-anim-top 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes text-anim-top {  from {   transform:translateY(-5%);   opacity:0;  }  to {   transform:translateY(0);   opacity:1;  } } .bentol-fadeInLeft {  animation:asfadeInLeft 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asfadeInLeft {  from {   transform:translateX(-50px);   opacity:0;  }  to {   transform:translateX(0);   opacity:1;  } } .bentol-fadeInRight {  animation:asfadeInRight 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asfadeInRight {  from {   transform:translateX(50px);   opacity:0;  }  to {   transform:translateX(0);   opacity:1;  } } .bentol-fadeInDown {  animation:asfadeInDown 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asfadeInDown {  from {   transform:translateX(-50px);   opacity:0;  }  to {   transform:translateX(0);   opacity:1;  } } .bentol-fadeInUp {  animation:asfadeInUp 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asfadeInUp {  from {   transform:translateX(50px);   opacity:0;  }  to {   transform:translateX(0);   opacity:1;  } } .bentol-moveFromLeft {  animation:asmoveFromLeft 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asmoveFromLeft {  from {   visibility:hidden;   transform:translateX(-50px);  }  to {   visibility:visible;  } } .bentol-moveFromRight {  animation:asmoveFromRight 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asmoveFromRight {  from {   visibility:hidden;   transform:translateX(50px);  }  to {   visibility:visible;  } } .bentol-moveFromTop {  animation:asmoveFromTop 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asmoveFromTop {  from {   visibility:hidden;   transform:translateX(-50px);  }  to {   visibility:visible;  } } .bentol-moveFromBottom {  animation:asmoveFromBottom 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asmoveFromBottom {  from {   visibility:hidden;   transform:translateX(50px);  }  to {   visibility:visible;  } } .bentol-blurInLeft {  animation:asblurInLeft 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asblurInLeft {  from {   transform:translateX(-50px);   filter:blur(20px);   opacity:0;  } } .bentol-blurInRight {  animation:asblurInRight 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asblurInRight {  from {   transform:translateX(50px);   filter:blur(20px);   opacity:0;  } } .bentol-blurInTop {  animation:asblurInTop 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asblurInTop {  from {   transform:translateX(-50px);   filter:blur(20px);   opacity:0;  } } .bentol-blurInBottom {  animation:asblurInBottom 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asblurInBottom {  from {   transform:translateX(50px);   filter:blur(20px);   opacity:0;  } } .bentol-zoomInLeft {  animation:aszoomInLeft 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes aszoomInLeft {  from {   transform:scale(5) translateX(-50px);   opacity:0;  } } .bentol-zoomInRight {  animation:aszoomInRight 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes aszoomInRight {  from {   transform:scale(5) translateX(50px);   opacity:0;  } } .bentol-zoomInTop {  animation:aszoomInTop 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes aszoomInTop {  from {   transform:scale(5) translateX(-50px);   opacity:0;  } } .bentol-zoomInBottom {  animation:aszoomInBottom 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes aszoomInBottom {  from {   transform:scale(5) translateX(50px);   opacity:0;  } } .bentol-flipInTop {  animation:asflipInTop 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asflipInTop {  from {   transform:perspective(600px);   opacity:0;  }  30% {   transform:perspective(600px) rotateX(180deg);   transform-origin:0 0;   animation-timing-function:ease-out;  }  to {   transform:perspective(600px);  } } .bentol-flipInBottom {  animation:asflipInBottom 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asflipInBottom {  from {   transform:perspective(600px);   opacity:0;  }  30% {   transform:perspective(600px) rotateX(180deg);   transform-origin:bottom;   animation-timing-function:ease-out;  }  to {   transform:perspective(600px);  } } .bentol-rollFromLeft {  animation:asrollFromLeft 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asrollFromLeft {  from {   transform:translateX(-50px) perspective(600px) rotateX(180deg);   opacity:0;  } } .bentol-rollFromRight {  animation:asrollFromRight 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asrollFromRight {  from {   transform:translateX(50px) perspective(600px) rotateX(180deg);   opacity:0;  } } .bentol-rollFromTop {  animation:asrollFromTop 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asrollFromTop {  from {   transform:translateY(-50px) perspective(600px) rotateY(180deg);   opacity:0;  } } .bentol-rollFromBottom {  animation:asrollFromBottom 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asrollFromBottom {  from {   transform:translateY(50px) perspective(600px) rotateY(180deg);   opacity:0;  } } .bentol-rotateSkateInRight {  animation:asrotateSkateInRight 1s ease-out forwards 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asrotateSkateInRight {  from {   transform:scaleX(0.2) translateX(50px);   opacity:0;  }  to {   transform:scaleX(1) translateX(0);   opacity:1;  } } .bentol-rotateSkateInLeft {  animation:asrotateSkateInLeft 1s ease-out forwards 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asrotateSkateInLeft {  from {   transform:scaleX(0.2) translateX(-50px);   opacity:0;  }  to {   transform:scaleX(1) translateX(0);   opacity:1;  } } .bentol-rotateSkateInTop {  animation:asrotateSkateInTop 1s ease-out forwards 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asrotateSkateInTop {  from {   transform:scaleY(0.2) translateY(-50px);   opacity:0;  }  to {   transform:scaleY(1) translateY(0);   opacity:1;  } } .bentol-rotateSkateInBottom {  animation:asrotateSkateInBottom 1s ease-out forwards 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes asrotateSkateInBottom {  from {   transform:scaleY(0.2) translateY(50px);   opacity:0;  }  to {   transform:scaleY(1) translateY(0);   opacity:1;  } } .bentol-popUpLeft {  animation:aspopUpLeft 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes aspopUpLeft {  0% {   visibility:hidden;  }  50% {   transform:translateX(-50px) scale(1.1);   visibility:visible;   animation-timing-function:ease-in;  } } .bentol-popUpRight {  animation:aspopUpRight 1.3s forwards cubic-bezier(0.645, 0.045, 0.355, 1) 0s; } @keyframes aspopUpRight {  0% {   visibility:hidden;  }  50% {   transform:translateX(50px) scale(1.1);   visibility:visible;   animation-timing-function:ease-in;  } } @-webkit-keyframes wobble_vertical {  16.65% {   transform:translateY(8px);  }  33.3% {   transform:translateY(-6px);  }  49.95% {   transform:translateY(4px);  }  66.6% {   transform:translateY(-2px);  }  83.25% {   transform:translateY(1px);  }  100% {   transform:translateY(0);  } } @keyframes wobble_vertical {  16.65% {   transform:translateY(8px);  }  33.3% {   transform:translateY(-6px);  }  49.95% {   transform:translateY(4px);  }  66.6% {   transform:translateY(-2px);  }  83.25% {   transform:translateY(1px);  }  100% {   transform:translateY(0);  } } @-webkit-keyframes wobble_spatial {  16.65% {   transform:translate3d(10px, 8px, 0px);  }  33.3% {   transform:translate3d(-10px, -6px, 5px);  }  49.95% {   transform:translate3d(7px, 4px, -5px);  }  66.6% {   transform:translate3d(-7px, -2px, 3px);  }  83.25% {   transform:translate3d(3px, 1px, -2px);  }  100% {   transform:translate3d(0, 0, 0);  } } @keyframes wobble_spatial {  16.65% {   transform:translate3d(10px, 8px, 0px);  }  33.3% {   transform:translate3d(-10px, -6px, 5px);  }  49.95% {   transform:translate3d(7px, 4px, -5px);  }  66.6% {   transform:translate3d(-7px, -2px, 3px);  }  83.25% {   transform:translate3d(3px, 1px, -2px);  }  100% {   transform:translate3d(0, 0, 0);  } } @-webkit-keyframes wobble_bell {  0% {   transform:rotate(0deg);  }  15% {   transform:rotate(-10deg);  }  30% {   transform:rotate(10deg);  }  45% {   transform:rotate(-5deg);  }  60% {   transform:rotate(5deg);  }  75% {   transform:rotate(-2deg);  }  100% {   transform:rotate(0deg);  } } @keyframes wobble_bell {  0% {   transform:rotate(0deg);  }  15% {   transform:rotate(-10deg);  }  30% {   transform:rotate(10deg);  }  45% {   transform:rotate(-5deg);  }  60% {   transform:rotate(5deg);  }  75% {   transform:rotate(-2deg);  }  100% {   transform:rotate(0deg);  } } @-webkit-keyframes mirror_effect {  0% {   transform:scaleX(1);  }  50% {   transform:scaleX(-1);  }  100% {   transform:scaleX(1);  } } @keyframes mirror_effect {  0% {   transform:scaleX(1);  }  50% {   transform:scaleX(-1);  }  100% {   transform:scaleX(1);  } } @keyframes mirrorEffect {  0% {   transform:scaleX(1);   opacity:1;  }  25% {   transform:scaleX(1.2);   opacity:0.9;  }  50% {   transform:scaleX(0.8);   opacity:0.7;  }  75% {   transform:scaleX(1.1);   opacity:0.85;  }  100% {   transform:scaleX(1);   opacity:1;  } } @keyframes mirrorReflection {  0%, 100% {   transform:translateY(0);  }  50% {   transform:translateY(-10px);  } } @keyframes mirrorWave {  0%, 100% {   transform:scale(1);  }  25% {   transform:scale(1.05);  }  50% {   transform:scale(1.1);  }  75% {   transform:scale(1.05);  } } @keyframes mirrorSlide {  0% {   transform:translateX(0);  }  50% {   transform:translateX(-20px);  }  100% {   transform:translateX(0);  } } @keyframes rotateAndScale {  0% {   transform:rotate(0deg) scale(1);  }  50% {   transform:rotate(180deg) scale(1.2);  }  100% {   transform:rotate(360deg) scale(1);  } } .rotateAndScale {  animation:rotateAndScale 4s infinite ease-in-out; }  @-webkit-keyframes typing {  0% {   width:0;   opacity:0;  }  5% {   opacity:1;  }  100% {   width:100%;   opacity:1;  } } @keyframes typing {  0% {   width:0;   opacity:0;  }  5% {   opacity:1;  }  100% {   width:100%;   opacity:1;  } } @keyframes moveBorder {  0% {   left:0;  }  50% {   left:calc(100% - 60px);  }  100% {   left:0;  } } .play-btn:after, .play-btn:before {  content:"";  position:absolute;  left:0;  top:0;  right:0;  bottom:0;  background-color:transparent;  z-index:-1;  border-radius:50%;  transition:all 0.4s ease 0s; } .play-btn:after {  -webkit-animation-delay:2s;  animation-delay:2s; } .play-btn.style-2:before, .play-btn.style-2:after {  background-color:transparent;  border:2px solid rgba(255, 255, 255, 0.8); } @-webkit-keyframes emgSwing {  0% {   -webkit-transform:rotate(20deg);   -ms-transform:rotate(20deg);   transform:rotate(20deg);  }  100% {   -webkit-transform:rotate(-10deg);   -ms-transform:rotate(-10deg);   transform:rotate(-10deg);  } } @keyframes emgSwing {  0% {   -webkit-transform:rotate(20deg);   -ms-transform:rotate(20deg);   transform:rotate(20deg);  }  100% {   -webkit-transform:rotate(-10deg);   -ms-transform:rotate(-10deg);   transform:rotate(-10deg);  } }  @media (min-width:992px) {  .magic-cursor {   display:block;   width:10px;   height:10px;   border-radius:50%;   position:fixed;   left:10px;   top:10px;   user-select:none;   pointer-events:none;   visibility:hidden;   z-index:999999;   -webkit-transition:all 0.3s cubic-bezier(0.165, 0.84, 0.44, 1);   transition:all 0.3s cubic-bezier(0.165, 0.84, 0.44, 1);  }  .magic-cursor:before {   background:var(--theme-color);   opacity:1;   content:"";   width:100%;   height:100%;   border-radius:50%;   position:absolute;   left:0;   top:0;   transition:all 0.3s ease;  }  .magic-cursor.cursor-zero:before {   opacity:0.4;   transform:scale(5);   transition:all 0.4s ease 0s;   background:var(--theme-color);   opacity:0;   visibility:hidden;  }  .magic-cursor.cursor-grow:before {   opacity:0.6;   transform:scale(6);   transition:all 0.4s ease 0s;   background:var(--theme-color);  }  .magic-cursor.hide {   opacity:0;   transition-delay:0.4s;   transition:all 0.4s ease 0s;  }  .magic-cursor.hide .inner {   transform:scale(0.1);   transition:all 0.4s ease 0s;  } } .search-popup {  position:fixed;  left:0;  top:0;  height:100vh;  width:100%;  z-index:99999;  margin-top:-540px;  -webkit-transform:translateY(-100%);  transform:translateY(-100%);  background-color:var(--bs-bg-color8);  transition:all 1000ms cubic-bezier(0.02, 1.13, 1, 0.05);  transition-timing-function:cubic-bezier(0.86, 0, 0.07, 1);  backdrop-filter:blur(5px);  width:100%; } .search-popup .close-search {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:60px;  height:60px;  border-radius:50%;  background:var(--dark-color2);  border:2px solid var(--theme-color);  cursor:pointer;  transition:all 0.4s ease 0s;  opacity:0;  visibility:hidden;  position:absolute;  content:"";  left:50%;  top:50%;  transform:translate(-50%, -50%);  transition:all 0.4s ease 0s;  margin:0 auto; } .search-popup .close-search i {  position:relative;  font-size:20px;  color:var(--white-color); } .search-popup form {  position:absolute;  max-width:700px;  top:50%;  left:15px;  right:15px;  margin:0 auto 0;  transform:scaleX(0);  transform-origin:center;  background-color:transparent;  transition:all 0.4s ease 0s; } .search-popup .form-group {  position:relative;  margin:0;  overflow:hidden; } .search-popup .form-group input[type=search] {  position:relative;  display:block;  font-size:16px;  line-height:50px;  font-weight:500;  text-transform:capitalize;  color:var(--dark-color);  height:70px;  width:100%;  padding:10px 30px;  padding-right:60px;  background-color:var(--white-color);  transition:all 0.4s ease 0s; } .search-popup .form-group input {  border-radius:5px;  border:2px solid var(--theme-color); } .search-popup .form-group input::placeholder {  font-size:18px; } .search-popup .form-group button {  position:absolute;  right:30px;  top:0;  height:70px;  line-height:70px;  background:transparent;  text-align:center;  font-size:24px;  color:var(--dark-color);  padding:0;  cursor:pointer;  transition:all 0.4s ease 0s;  border:none; } .search-popup .form-group button i {  transition:all 0.4s ease 0s; } .search-popup .form-group button:hover {  color:var(--theme-color); } .search-popup .form-group button:hover i {  color:var(--theme-color); } .search-popup input::placeholder {  color:var(--dark-color);  color:inherit; } .search-active .search-popup {  -webkit-transform:translateY(0%);  -ms-transform:translateY(0%);  transform:translateY(0%);  margin-top:0; } .search-active .search-popup .close-search {  visibility:visible;  opacity:1;  transition-delay:1400ms;  margin-top:-105px; } .search-active .search-popup form {  -webkit-transform:scaleX(1);  -ms-transform:scaleX(1);  transform:scaleX(1);  transition-delay:1100ms; }  ::selection {  background:var(--theme-color);  color:var(--white-color);  text-shadow:none; } ::-moz-selection {  background:var(--theme-color);  color:var(--white-color);  text-shadow:none; }  @media (min-width:992px) and (max-width:1024px) {  .page-id-2652 .elementor-2652 .elementor-element {   --padding-left:0;   --padding-right:0;  }  .page-id-2652 .elementor-2652 .elementor-element.elementor-element-7a09ec3 {   --padding-bottom:0;  }  .hero-section.style-4,  section.service-section.style-4,  section.choose-section.style-4,  section.feature-section.style-3,  section.case-studies-section.style-4,  section.testimonial-section.style-4,  footer.footer-section.bg-dark.style-2 {   border-radius:0 !important;  } } @media (max-width:991px) {  .page-id-2652 .elementor-2652 .elementor-element {   --padding-left:0;   --padding-right:0;  }  .page-id-2652 .elementor-2652 .elementor-element.elementor-element-7a09ec3 {   --padding-bottom:0;  }  .hero-section.style-4,  section.service-section.style-4,  section.choose-section.style-4,  section.feature-section.style-3,  section.case-studies-section.style-4,  section.testimonial-section.style-4,  footer.footer-section.bg-dark.style-2 {   border-radius:0 !important;  } } .page-id-3389 .main-menu li a.active, .page-id-3366 .main-menu li a.active, .page-id-3342 .main-menu li a.active, .page-id-3311 .main-menu li a.active {  color:var(--theme-color); } .sticky-header.fixed-header {  top:0; } .elementor.elementor-5218 .header-style5, .elementor.elementor-5033 .header-style5, .elementor.elementor-4872 .header-style5, .elementor.elementor-4661 .header-style5 {  position:absolute; } .elementor.elementor-5033 .header-style5 .main-wrapper .header-right-wrapper .header-right .search-btn, .elementor.elementor-4872 .header-style5 .main-wrapper .header-right-wrapper .header-right .search-btn, .elementor.elementor-4661 .header-style5 .main-wrapper .header-right-wrapper .header-right .search-btn {  background-color:var(--bs-bg-color5);  color:var(--white-color); } .elementor.elementor-5033 .header-style5 .main-wrapper .header-right-wrapper .header-right .search-btn:hover, .elementor.elementor-4872 .header-style5 .main-wrapper .header-right-wrapper .header-right .search-btn:hover, .elementor.elementor-4661 .header-style5 .main-wrapper .header-right-wrapper .header-right .search-btn:hover {  color:var(--theme-color); } .page-id-5406 .newsletter-section, .page-id-5210 .newsletter-section, .page-id-5304 .newsletter-section, .page-id-4891 .newsletter-section {  background-image:linear-gradient(#093B3B 50%, var(--dark-color) 50%); } .page-id-1252 .newsletter-section {  background-image:linear-gradient(#ECF8F8 50%, var(--dark-color) 50%); } .woocommerce-page .newsletter-section, .woocommerce-shop .newsletter-section, .postid-1167 .newsletter-section, .page-id-1563 .newsletter-section, .page-id-1337 .newsletter-section {  background-image:linear-gradient(#FFFFFF 50%, var(--dark-color) 50%); }  .widget_nav_menu ul, .widget_meta ul, .widget_pages ul, .widget_archive ul, .widget_price_filter ul, .wp-block-page-list ul, .widget_categories ul {  list-style:none;  padding:0;  margin:0 0 0 0; } .widget_nav_menu .menu, .widget_nav_menu > ul, .widget_meta .menu, .widget_meta > ul, .widget_pages .menu, .widget_pages > ul, .widget_archive .menu, .widget_archive > ul, .widget_price_filter .menu, .widget_price_filter > ul, .wp-block-page-list .menu, .wp-block-page-list > ul, .widget_categories .menu, .widget_categories > ul {  margin:-3px 0 0px 0; } .widget_nav_menu a, .widget_meta a, .widget_pages a, .widget_archive a, .widget_price_filter a, .wp-block-page-list a, .widget_categories a {  display:block;  border:none;  margin:0 0px 12px 0px;  padding:0px;  font-size:16px;  font-weight:300;  font-family:var(--body-font);  line-height:1.313;  color:var(--title-color);  position:relative;  display:flex;  align-items:center; } .widget_nav_menu a:before, .widget_meta a:before, .widget_pages a:before, .widget_archive a:before, .widget_price_filter a:before, .wp-block-page-list a:before, .widget_categories a:before {  content:"";  position:relative;  height:18px;  width:18px;  border:1px solid #DCDCDC;  border-radius:50%;  margin-right:14px; } .widget_nav_menu a:after, .widget_meta a:after, .widget_pages a:after, .widget_archive a:after, .widget_price_filter a:after, .wp-block-page-list a:after, .widget_categories a:after {  content:"";  position:absolute;  left:5px;  top:6px;  height:8px;  width:8px;  border-radius:50%;  background:var(--theme-color);  transition:0.4s;  opacity:0; } .widget_nav_menu a i, .widget_meta a i, .widget_pages a i, .widget_archive a i, .widget_price_filter a i, .wp-block-page-list a i, .widget_categories a i {  margin-right:12px;  transition:0.4s all; } .widget_nav_menu a.active, .widget_nav_menu a:hover, .widget_meta a.active, .widget_meta a:hover, .widget_pages a.active, .widget_pages a:hover, .widget_archive a.active, .widget_archive a:hover, .widget_price_filter a.active, .widget_price_filter a:hover, .wp-block-page-list a.active, .wp-block-page-list a:hover, .widget_categories a.active, .widget_categories a:hover {  color:var(--theme-color); } .widget_nav_menu a.active i, .widget_nav_menu a:hover i, .widget_meta a.active i, .widget_meta a:hover i, .widget_pages a.active i, .widget_pages a:hover i, .widget_archive a.active i, .widget_archive a:hover i, .widget_price_filter a.active i, .widget_price_filter a:hover i, .wp-block-page-list a.active i, .wp-block-page-list a:hover i, .widget_categories a.active i, .widget_categories a:hover i {  color:var(--theme-color);  opacity:1; } .widget_nav_menu a.active ~ span, .widget_nav_menu a:hover ~ span, .widget_meta a.active ~ span, .widget_meta a:hover ~ span, .widget_pages a.active ~ span, .widget_pages a:hover ~ span, .widget_archive a.active ~ span, .widget_archive a:hover ~ span, .widget_price_filter a.active ~ span, .widget_price_filter a:hover ~ span, .wp-block-page-list a.active ~ span, .wp-block-page-list a:hover ~ span, .widget_categories a.active ~ span, .widget_categories a:hover ~ span {  color:var(--theme-color); } .widget_nav_menu a.active:after, .widget_nav_menu a:hover:after, .widget_meta a.active:after, .widget_meta a:hover:after, .widget_pages a.active:after, .widget_pages a:hover:after, .widget_archive a.active:after, .widget_archive a:hover:after, .widget_price_filter a.active:after, .widget_price_filter a:hover:after, .wp-block-page-list a.active:after, .wp-block-page-list a:hover:after, .widget_categories a.active:after, .widget_categories a:hover:after {  opacity:1; } .widget_nav_menu li, .widget_meta li, .widget_pages li, .widget_archive li, .widget_price_filter li, .wp-block-page-list li, .widget_categories li {  display:block;  position:relative; } .widget_nav_menu li > span, .widget_meta li > span, .widget_pages li > span, .widget_archive li > span, .widget_price_filter li > span, .wp-block-page-list li > span, .widget_categories li > span {  font-size:16px;  position:absolute;  right:0;  top:0px;  background:transparent;  border-radius:0;  height:auto;  width:auto;  line-height:initial;  text-align:center;  color:var(--body-color);  transition:all ease 0.4s; } .widget_nav_menu li:last-child a, .widget_meta li:last-child a, .widget_pages li:last-child a, .widget_archive li:last-child a, .widget_price_filter li:last-child a, .wp-block-page-list li:last-child a, .widget_categories li:last-child a {  margin-bottom:-5px;  padding-bottom:0;  border-bottom:0; } .widget_nav_menu .wp-block-navigation__submenu-container, .widget_nav_menu .sub-menu, .widget_nav_menu .children, .widget_meta .wp-block-navigation__submenu-container, .widget_meta .sub-menu, .widget_meta .children, .widget_pages .wp-block-navigation__submenu-container, .widget_pages .sub-menu, .widget_pages .children, .widget_archive .wp-block-navigation__submenu-container, .widget_archive .sub-menu, .widget_archive .children, .widget_price_filter .wp-block-navigation__submenu-container, .widget_price_filter .sub-menu, .widget_price_filter .children, .wp-block-page-list .wp-block-navigation__submenu-container, .wp-block-page-list .sub-menu, .wp-block-page-list .children, .widget_categories .wp-block-navigation__submenu-container, .widget_categories .sub-menu, .widget_categories .children {  margin-left:10px; } .widget_nav_menu .wp-block-navigation__submenu-container li a, .widget_nav_menu .sub-menu li a, .widget_nav_menu .children li a, .widget_meta .wp-block-navigation__submenu-container li a, .widget_meta .sub-menu li a, .widget_meta .children li a, .widget_pages .wp-block-navigation__submenu-container li a, .widget_pages .sub-menu li a, .widget_pages .children li a, .widget_archive .wp-block-navigation__submenu-container li a, .widget_archive .sub-menu li a, .widget_archive .children li a, .widget_price_filter .wp-block-navigation__submenu-container li a, .widget_price_filter .sub-menu li a, .widget_price_filter .children li a, .wp-block-page-list .wp-block-navigation__submenu-container li a, .wp-block-page-list .sub-menu li a, .wp-block-page-list .children li a, .widget_categories .wp-block-navigation__submenu-container li a, .widget_categories .sub-menu li a, .widget_categories .children li a {  border-bottom:1px solid #E6E6E6;  margin:0 0px 19px 0px;  padding:0px 0px 20px; } .widget_nav_menu a, .widget_meta a, .widget_pages a {  padding-right:20px; } .widget_nav_menu .sub-menu {  margin-left:10px; }  .sticky .blog-content {  padding-left:60px; } .sticky .blog-content h3::before {  font:400 26px "remixicon";  content:"\f037";  position:absolute;  top:4px;  left:-40px;  color:var(--white-color);  -webkit-font-smoothing:antialiased;  -moz-osx-font-smoothing:grayscale; }  .no-results {  background:var(--white-color);  padding:35px;  margin-bottom:20px;  box-shadow:0 0 29px rgba(102, 102, 102, 0.1); } .no-results h1.page-title {  font:700 25px/1;  margin-bottom:5px; } .no-results form {  position:relative; } .no-results form label {  margin-bottom:0; } .no-results form .screen-reader-text {  display:none; } .no-results form .search-field {  background:var(--white-color);  border:1px solid var(--light-color);  height:50px;  padding:6px 15px;  width:100%;  outline:0;  transition:0.5s;  color:var(--gray-color); } .no-results form button {  position:absolute;  right:0;  bottom:0;  height:50px;  width:50px;  padding:0;  font-size:20px;  line-height:55px;  border:none;  border-radius:5px;  background:var(--theme-color);  color:var(--white-color);  transition:0.5s;  z-index:1; } .no-results form button:hover {  background:var(--theme-color2); }  .blog-details-area {  position:relative;  z-index:1; } .blog-details .blog-details-content {  padding:30px;  background:var(--white-color);  box-shadow:0 0 40px 3px rgba(0, 0, 0, 0.05);  border-top:none;  overflow:hidden; } .blog-details .blog-details-content .entry-meta {  padding-left:0;  margin-bottom:17px;  list-style:none;  text-transform:capitalize; } .blog-details .blog-details-content .entry-meta li {  display:inline-block;  margin-right:21px;  position:relative; } .blog-details .blog-details-content .entry-meta li::before {  content:"";  position:absolute;  top:16px;  right:-12px;  width:1px;  height:13px;  background:#d4c7c7; } .blog-details .blog-details-content .entry-meta li:last-child {  margin-right:0; } .blog-details .blog-details-content .entry-meta li:last-child::before {  display:none; } .blog-details .blog-details-content .entry-meta li a {  display:inline-block;  text-decoration:none; } .blog-details .blog-details-content .entry-meta li a:hover {  color:var(--theme-color); } .blog-details .blog-details-content .entry-meta li i {  margin-right:2px;  color:var(--theme-color);  font-style:normal;  font-size:20px;  position:relative;  top:4px; } .blog-details .blog-details-content h3 {  margin-bottom:15px;  font:700 23px/1; } .blog-details .blog-details-content .category {  padding:0;  margin:20px 0 0;  border-top:1px solid #eee;  list-style:none;  clear:both; } .blog-details .blog-details-content .category li {  display:inline-block;  margin-top:10px; } .blog-details .blog-details-content .category li span.icon-book {  font:600 20px/1;  color:#323232;  margin-right:5px;  position:relative;  top:2px; } .blog-details .blog-details-content .category li span.icon-book i {  font:normal 16px/1; } .blog-details .blog-details-content .category li:last-child span {  display:none; } .blog-details .blog-details-content .category li a {  font:600 13px/1;  text-decoration:none;  text-transform:capitalize;  color:#666; } .blog-details .blog-details-content .category li a:hover {  color:var(--theme-color); } .blog-details .wp-block-search .wp-block-search__button {  color:var(--white-color); }  .blog-details .blog-details-content .entry-meta {  margin-top:10px; } .blog-details .blog-details-content .wp-block-group__inner-container {  padding:15px; } .blog-details .blog-details-content h1, .blog-details .blog-details-content h2, .blog-details .blog-details-content h3, .blog-details .blog-details-content h4, .blog-details .blog-details-content h5, .blog-details .blog-details-content h6 {  margin-top:0;  margin-bottom:15px; } .blog-details .blog-details-content h1 {  font-size:30px; } .blog-details .blog-details-content h2 {  font-size:25px; } .blog-details .blog-details-content h3 {  font-size:20px; } .blog-details .blog-details-content h4 {  font-size:18px; } .blog-details .blog-details-content h5 {  font-size:16px; } .blog-details .blog-details-content h6 {  font-size:14px; } .blog-details .blog-details-content p {  line-height:1.8;  word-break:break-word; } .blog-details .blog-details-content p a {  text-decoration:underline;  color:var(--theme-color); } .blog-details .blog-details-content p a:hover {  text-decoration:none; } .blog-details .blog-details-content .entry-content a {  text-decoration:underline; } .blog-details .blog-details-content .entry-content a:hover {  text-decoration:none; } .blog-details .blog-details-content dl, .blog-details .blog-details-content ol, .blog-details .blog-details-content ul {  margin:20px 0; } .blog-details .blog-details-content dl a, .blog-details .blog-details-content ol a, .blog-details .blog-details-content ul a {  text-decoration:underline; } .blog-details .blog-details-content dl a:hover, .blog-details .blog-details-content ol a:hover, .blog-details .blog-details-content ul a:hover {  text-decoration:none;  color:var(--theme-color); } .blog-details .blog-details-content dt {  margin-bottom:5px;  color:var(--dark-color); } .blog-details .blog-details-content dd {  margin:0 1rem 1rem;  font-size:15px;  line-height:26px; } .blog-details .blog-details-content dd a {  text-decoration:underline; } .blog-details .blog-details-content dd a:hover {  text-decoration:none; } .blog-details .blog-details-content ul {  list-style:disc;  padding-left:20px; } .blog-details .blog-details-content ul li {  line-height:1.8;  margin-bottom:10px;  color:var(--gray-color);  font-size:15.5px; } .blog-details .blog-details-content ul li ul {  margin:10px 0 0;  list-style-type:circle; } .blog-details .blog-details-content ul li ol {  margin:10px 0 0;  list-style-type:decimal; } .blog-details .blog-details-content ol {  padding-left:20px; } .blog-details .blog-details-content ol li {  line-height:1.8;  margin-bottom:10px;  color:var(--gray-color); } .blog-details .blog-details-content ol li ol, .blog-details .blog-details-content ol li ul {  margin:10px 0 0; } .blog-details .blog-details-content b, .blog-details .blog-details-content strong {  font-weight:600;  color:#212529; } .blog-details .blog-details-content dfn, .blog-details .blog-details-content cite, .blog-details .blog-details-content em, .blog-details .blog-details-content i {  font-style:italic; } .blog-details .blog-details-content code, .blog-details .blog-details-content kbd, .blog-details .blog-details-content tt, .blog-details .blog-details-content var {  font-size:0.88889em;  font-family:Menlo, monaco, Consolas, Lucida Console, monospace; } .blog-details .blog-details-content code {  color:var(--theme-color); } .blog-details .blog-details-content kbd {  background-color:#eee;  color:var(--theme-color); } .blog-details .blog-details-content mark, .blog-details .blog-details-content ins {  background:var(--light-color2);  text-decoration:none;  color:var(--dark-color);  padding:0 5px; } .blog-details .blog-details-content pre {  font-size:0.88889em;  font-family:"Courier 10 Pitch", Courier, monospace;  line-height:1.8;  overflow:auto; } .blog-details .blog-details-content abbr, .blog-details .blog-details-content acronym {  border-bottom:1px dotted #484848;  cursor:help; } .blog-details .blog-details-content i.fa {  font-style:normal; } .blog-details .blog-details-content ul.entry-meta {  margin:0 0 20px;  padding:0; } .blog-details .blog-details-content ul.entry-meta li a {  text-transform:capitalize;  color:#666666; } .blog-details .blog-details-content ul.entry-meta li a:hover {  color:var(--theme-color); } .blog-details .blog-details-content ul.entry-meta li a span a {  text-decoration:none; } .blog-details .blog-details-content iframe, .blog-details .blog-details-content video {  width:100%; }  blockquote p:last-child, .blockquote p:last-child {  margin-bottom:0 !important; } .pages-links {  margin:15px 0; } .pages-links .page-links-title {  padding-right:5px;  font-weight:500; } .pages-links .post-page-numbers {  width:45px;  height:45px;  margin:0 3px;  display:inline-block;  background:var(--white-color);  line-height:48px;  box-shadow:0 2px 10px #d8dde6;  font:700 18px/1; } .pages-links .post-page-numbers.current, .pages-links .post-page-numbers:hover, .pages-links .post-page-numbers:focus {  color:var(--white-color);  background:var(--theme-color); }  .sticky .single-blog h3 {  position:relative; } .sticky .single-blog .blog-content {  background:var(--dark-color); } .sticky .single-blog .blog-content h3 a, .sticky .single-blog .blog-content .read-more, .sticky .single-blog .blog-content .tag {  color:var(--white-color); } .sticky .single-blog .blog-content .tag:hover {  border-color:var(--white-color); }  .page-main-content {  padding:100px 0;  overflow:hidden; } .page-main-content h1, .page-main-content h2, .page-main-content h3, .page-main-content h4, .page-main-content h5, .page-main-content h6 {  font-weight:800;  line-height:1;  margin-bottom:15px; } .page-main-content h1 {  font-size:35px; } .page-main-content h2 {  font-size:30px; } .page-main-content h3 {  font-size:25px; } .page-main-content h4 {  font-size:20px; } .page-main-content h5 {  font-size:18px; } .page-main-content h6 {  font-size:15px; } .page-main-content p {  margin:18px 0; } .page-main-content p:first-child {  margin-top:0; } .page-main-content .entry-content a {  text-decoration:underline;  display:inline-block;  color:var(--theme-color); } .page-main-content .entry-content a:hover {  text-decoration:none; } .page-main-content footer.entry-footer {  clear:both; } .page-main-content footer.entry-footer .edit-link {  margin:10px 0;  display:block; } .page-main-content dl, .page-main-content ol, .page-main-content ul {  margin:20px 0; } .page-main-content dt {  margin-bottom:5px;  color:var(--dark-color); } .page-main-content dd {  margin:0 1rem 1rem;  line-height:1.8; } .page-main-content ul {  list-style:disc;  padding-left:20px; } .page-main-content ul li {  line-height:1.8;  margin-bottom:5px; } .page-main-content ul li ul {  margin:5px 0 0;  list-style-type:circle; } .page-main-content ul li ul li {  list-style-type:circle; } .page-main-content ol {  padding-left:20px; } .page-main-content ol li {  line-height:1.8;  margin-bottom:5px; } .page-main-content ol li ol {  margin:5px 0 0; } .page-main-content b, .page-main-content strong {  color:#212529; } .page-main-content dfn, .page-main-content cite, .page-main-content em {  font-style:italic; } .page-main-content code, .page-main-content kbd, .page-main-content tt, .page-main-content var {  font-size:0.88889em;  font-family:Menlo, monaco, Consolas, Lucida Console, monospace; } .page-main-content code.code, .page-main-content code.kbd, .page-main-content kbd.code, .page-main-content kbd.kbd, .page-main-content tt.code, .page-main-content tt.kbd, .page-main-content var.code, .page-main-content var.kbd {  color:var(--theme-color); } .page-main-content code.kbd, .page-main-content kbd.kbd, .page-main-content tt.kbd, .page-main-content var.kbd {  background-color:var(--light-color); } .page-main-content mark, .page-main-content ins {  background:var(--light-color2);  text-decoration:none; } .page-main-content pre {  font-size:0.88889em;  font-family:"Courier 10 Pitch", Courier, monospace;  line-height:1.8;  overflow:auto; } .page-main-content abbr, .page-main-content acronym {  border-bottom:1px dotted #484848;  cursor:help; }  .comments-area .comment-content h1 {  font-size:30px;  margin-bottom:15px; } .comments-area .comment-content h2 {  font-size:25px;  margin-bottom:15px; } .comments-area .comment-content h3 {  font-size:20px;  margin-bottom:15px; } .comments-area .comment-content h4 {  font-size:18px;  margin-bottom:15px; } .comments-area .comment-content h5 {  font-size:16px;  margin-bottom:15px; } .comments-area .comment-content h6 {  font-size:14px;  margin-bottom:15px; } .comments-area .comment-content p {  margin-bottom:20px;  line-height:1.8;  font-size:14px; } .comments-area .comment-content p:last-child {  margin-bottom:0; } .comments-area .comment-content .entry-content a {  text-decoration:underline; } .comments-area .comment-content .entry-content a:hover {  text-decoration:none; } .comments-area .comment-content dl, .comments-area .comment-content ol, .comments-area .comment-content ul {  margin:20px 0; } .comments-area .comment-content dt {  margin-bottom:5px; } .comments-area .comment-content dd {  margin:0 1rem 1rem;  font-size:15px;  line-height:26px; } .comments-area .comment-content ul {  list-style:disc;  padding-left:20px; } .comments-area .comment-content ul li {  line-height:1.8;  margin-bottom:10px; } .comments-area .comment-content ul li ul {  margin:10px 0 0;  list-style:circle;  padding-left:20px; } .comments-area .comment-content ul li ul li {  list-style:circle;  padding-left:20px; } .comments-area .comment-content ol {  list-style:decimal;  padding-left:20px; } .comments-area .comment-content ol li {  line-height:1.8;  margin-bottom:10px; } .comments-area .comment-content ol li ol {  margin:10px 0 0; } .comments-area .comment-content b, .comments-area .comment-content strong {  font-weight:600;  color:#212529; } .comments-area .comment-content dfn, .comments-area .comment-content cite, .comments-area .comment-content em, .comments-area .comment-content i {  font-style:italic; } .comments-area .comment-content code, .comments-area .comment-content kbd, .comments-area .comment-content tt, .comments-area .comment-content var {  font-size:0.88889em;  font-family:Menlo, monaco, Consolas, Lucida Console, monospace; } .comments-area .comment-content code.code, .comments-area .comment-content code.kbd, .comments-area .comment-content kbd.code, .comments-area .comment-content kbd.kbd, .comments-area .comment-content tt.code, .comments-area .comment-content tt.kbd, .comments-area .comment-content var.code, .comments-area .comment-content var.kbd {  color:var(--theme-color); } .comments-area .comment-content code.kbd, .comments-area .comment-content kbd.kbd, .comments-area .comment-content tt.kbd, .comments-area .comment-content var.kbd {  background-color:#fafafa; } .comments-area .comment-content mark, .comments-area .comment-content ins {  background:#fff9c0;  text-decoration:none;  color:#000;  padding:0 6px; } .comments-area .comment-content pre {  font-size:0.88889em;  font-family:"Courier 10 Pitch", Courier, monospace;  line-height:1.8;  overflow:auto;  background:#fafafa;  color:var(--BlackColor); } .comments-area .comment-content abbr, .comments-area .comment-content acronym {  border-bottom:1px dotted #484848;  cursor:help; }  #comments {  clear:both;  overflow:hidden;  list-style:none;  margin-top:50px;  padding-top:5px; } #comments .comment-list {  margin:0;  padding:0;  list-style-type:none; } #comments .comment-list.children {  margin:0;  padding-left:10px !important;  list-style-type:none; } #comments .comment-list:before {  display:none; } #comments .comment-list .comment-body {  border-bottom:1px solid #eeeeee;  margin-left:65px;  font-size:14px;  margin-bottom:20px;  padding-bottom:20px; } #comments .comment-list .comment-body #div-comment-17 {  margin-left:70px; } #comments .comment-list .comment-body #div-comment-18 {  margin-left:75px; } #comments .comment-list .comment-body #div-comment-19 {  margin-left:80px; } #comments .comment-list .comment-body #div-comment-20 {  margin-left:85px; } #comments .comment-list .comment-body #div-comment-21 {  margin-left:90px; } #comments .comment-list .comment-body a {  text-decoration:underline;  color:var(--theme-color); } #comments .comment-list .comment-body a:hover {  text-decoration:none; } #comments .comment-list .comment-body .comment-content img {  margin:5px 0; } #comments .comment-list .comment-body .reply a {  border:1px solid #ded9d9;  background:var(--white-color);  display:inline-flex;  padding:10px 20px;  line-height:1;  border-radius:30px;  text-transform:uppercase;  font-size:10px;  font-weight:700;  text-decoration:none; } #comments .comment-list .comment-body .reply a:hover {  color:var(--white-color);  background-color:var(--theme-color); } #comments .comment-list .comment-author {  font-size:15px;  margin-bottom:10px;  position:relative;  z-index:2;  clear:both; } #comments .comment-list .comment-author .avatar {  height:50px;  left:-65px;  position:absolute;  width:50px; } .children #comments .comment-list .comment-author .avatar {  height:30px;  left:-45px;  width:30px; } .bypostauthor #comments .comment-list .comment-author .avatar {  border:1px solid #575757;  padding:2px; } #comments .comment-list .comment-author b.fn {  font-weight:600;  color:var(--dark-color); } #comments .comment-list .comment-author b.fn a {  color:var(--dark-color);  text-decoration:none; } #comments .comment-list .comment-author .says {  display:none; } #comments .comment-list .comment-meta {  margin-bottom:1em; } #comments .comment-list .comment-meta .comment-metadata {  font-size:10px;  font-weight:600;  letter-spacing:0.1818em;  text-transform:uppercase; } #comments .comment-list .comment-meta .comment-metadata a {  text-decoration:none !important; } #comments .comment-list .comment-meta .comment-metadata a.comment-edit-link {  color:#222;  margin-left:1em; } #comments .comment-list .comment-meta .comment-reply-link {  font-weight:600; } #comments .comment-list .comment-meta .comment-reply-link .icon {  color:#222;  left:-2em;  height:1em;  position:absolute;  top:0;  width:1em; } #comments .no-comments, #comments .comment-awaiting-moderation {  color:#767676;  font-size:14px;  font-style:italic; } #comments .comments-pagination {  margin:2em 0 3em; } #comments .comment-respond {  margin-bottom:30px; } .comments-title {  position:relative;  margin-bottom:25px !important;  font-size:20px !important;  line-height:1.5;  font-weight:700;  border-bottom:1px solid #eeeeee;  padding-bottom:10px; } .comments-title::before {  content:"";  position:absolute;  left:-30px;  top:13px;  height:25px;  width:3px;  transform:translateY(-50%);  background-color:var(--theme-color); }  .comment-respond {  background:var(--white-color);  padding:0;  clear:both; } .comment-respond .comment-reply-title {  font-size:20px;  font-weight:600;  line-height:25px;  border-bottom:1px solid #eeeeee;  padding-bottom:10px;  margin-bottom:15px;  margin-top:-6px;  position:relative;  text-transform:capitalize; } .comment-respond .comment-reply-title::before {  content:"";  height:25px;  width:3px;  left:-30px;  position:absolute;  top:13px;  transform:translateY(-50%);  background-color:var(--theme-color); } .comment-respond .comment-reply-title #cancel-comment-reply-link {  font-size:14px;  color:red;  display:inline-block;  margin-left:10px; } .comment-respond label {  display:block;  margin-bottom:8px;  color:var(--dark-color);  font-weight:600;  font-size:14px; } .comment-respond input[type=date], .comment-respond input[type=time], .comment-respond input[type=datetime-local], .comment-respond input[type=week], .comment-respond input[type=month], .comment-respond input[type=text], .comment-respond input[type=email], .comment-respond input[type=url], .comment-respond input[type=password], .comment-respond input[type=search], .comment-respond input[type=tel], .comment-respond input[type=number], .comment-respond textarea {  background-image:none;  background-color:var(--white-color);  border:1px solid #eeeeee;  border-radius:5px;  color:#000;  padding:0.625em 15px;  width:100%;  height:45px;  font-size:14px; } .comment-respond textarea {  height:auto !important; } .comment-respond .form-submit {  text-align:left; } .comment-respond .form-submit input {  border:none;  color:var(--white-color);  padding:12px 30px;  height:52px;  display:inline-block;  cursor:pointer;  outline:0;  transition:0.5s;  border-radius:40px;  text-transform:capitalize;  background-color:var(--dark-color);  font-weight:500;  font-size:15px;  width:auto; } .comment-respond .form-submit input:hover, .comment-respond .form-submit input:focus {  color:var(--white-color);  background-color:var(--theme-color); } .comment-respond input:focus, .comment-respond textarea:focus {  outline:0; } .comment-respond p {  line-height:1;  margin-bottom:0;  margin-top:25px; } .comment-respond .comment-form-cookies-consent label {  display:inline-block;  margin:0;  line-height:20px;  font-weight:normal;  font-size:13.4px; } .comment-respond .comment-form-cookies-consent input {  position:absolute;  left:0;  top:3px;  display:none; } .comment-respond p.comment-notes {  line-height:26px;  font-size:14px;  margin-top:5px; } .comment-respond p.comment-form-comment {  float:left;  width:100%; } .comment-respond p.comment-form-author, .comment-respond p.comment-form-email {  width:50%;  float:left; } .comment-respond p.comment-form-author {  padding-right:12px; } .comment-respond p.comment-form-email {  padding-left:12px; } .comment-respond p.comment-form-url, .comment-respond p.comment-form-cookies-consent, .comment-respond p.form-submit {  float:left;  width:100%;  position:relative;  padding-left:0; } .comment-respond p.logged-in-as {  line-height:26px;  font-size:15px;  margin-top:5px; } .comment-respond p.logged-in-as a {  display:inline-block;  text-decoration:underline;  font-size:14px; } .comment-respond p.logged-in-as a:hover {  text-decoration:none; } .parent .comment-respond p.form-submit, .depth-1 .comment-respond p.form-submit {  margin-bottom:30px; }  .wp-block-image {  margin-bottom:20px; } .wp-block-image figcaption {  font-size:14px;  margin-top:12px;  text-align:center; } .wp-block-image figcaption a {  text-decoration:underline;  display:inline-block;  color:var(--theme-color); } .wp-block-image figcaption a:hover {  text-decoration:none; } .wp-block-button {  margin-bottom:1.5em; } .wp-block-button .wp-block-button__link {  font-size:16px;  border-radius:5px;  color:var(--white-color) !important;  background-color:var(--theme-color); } .wp-block-button .wp-block-button__link br {  display:none; } .wp-block-button .wp-block-button__link:hover {  background-color:var(--gray-color);  color:var(--white-color); } .wp-block-cover .wp-block-cover-text {  color:var(--white-color) !important; } .is-style-outline .wp-block-button__link {  background-color:transparent !important;  font-size:16px;  border-radius:5px;  color:var(--theme-color) !important; } .is-style-outline .wp-block-button__link:hover {  background-color:transparent;  color:#222 !important;  border-color:#222; } pre.wp-block-code {  border:1px solid #eee;  padding:10px 15px; } pre.wp-block-preformatted {  background-color:#fafafa;  padding:20px;  margin:20px 0; } .wp-block-pullquote {  border-top:4px solid #555d66;  border-bottom:4px solid #555d66;  color:#40464d;  border-color:transparent;  border-width:2px;  padding:0; } .wp-block-pullquote blockquote {  color:#111;  border:none;  margin-right:0;  padding-left:0; } .wp-block-pullquote blockquote p {  font-size:2.25em;  font-style:italic; } .wp-block-pullquote blockquote cite {  display:inline-block;  font-family:-apple-system, BlinkMacSystemFont, "Segoe UI", "Roboto", "Oxygen", "Ubuntu", "Cantarell", "Fira Sans", "Droid Sans", "Helvetica Neue", sans-serif;  line-height:1.6;  text-transform:none;  color:#767676;  font-size:15px;  font-style:normal; } .wp-block-table.is-style-stripes td {  border-color:#767676; } .wp-block-verse {  font-family:"Poppins", sans-serif !important;  font-size:16px !important; } .wp-block-columns {  margin-top:20px;  margin-bottom:20px; } .wp-block-media-text {  margin-top:30px;  margin-bottom:30px; } .wp-block-media-text .has-large-font-size {  font-size:25px;  margin-top:0 !important; } .page-links {  margin-top:20px;  margin-bottom:20px;  clear:both; } .page-links span.page-links-title {  font-weight:500;  font-size:20px;  padding-right:10px; } .page-links .post-page-numbers {  width:35px;  height:35px;  border-radius:25px;  background-color:var(--white-color);  border:1px solid #eee;  font-size:15px;  line-height:35px;  color:#0a0c19;  text-align:center;  display:inline-block;  margin-left:5px;  text-decoration:none !important; } .page-links .post-page-numbers:hover {  color:var(--white-color);  background-color:var(--theme-color); } .page-links .current {  color:var(--white-color);  background-color:var(--theme-color); } .wp-block-archives-list {  padding:0 !important; } .wp-block-archives-list li {  list-style:none !important; } .wp-block-archives-list li a:hover {  text-decoration:underline; } .wp-block-categories-list {  padding:0 !important; } .wp-block-categories-list li {  list-style:none !important; } .wp-block-categories-list li a {  text-transform:capitalize; } .wp-block-categories-list li a:hover {  text-decoration:underline; } .wp-block-categories-list li span.post-count {  padding-left:8px;  float:right; } .wp-block-categories-list li .children li a {  position:relative; } .wp-block-categories-list li .children li a::before {  content:"-";  position:absolute;  left:-13px;  top:-2px; } .wp-block-archives-dropdown {  margin-bottom:20px; } .wp-block-archives-dropdown select {  height:45px;  border:1px solid #eee;  width:100%;  font-size:14px;  padding:8px 15px;  color:#555; } .wp-block-latest-comments {  padding:0 !important; } .wp-block-latest-comments .wp-block-latest-comments__comment-meta a {  font-weight:500;  text-decoration:none;  font-size:15px;  line-height:24px;  color:var(--title-color); } .wp-block-latest-comments .wp-block-latest-comments__comment-meta a:hover {  text-decoration:none; } .wp-block-latest-posts li a {  font-weight:500;  color:var(--dark-color); } .wp-block-gallery {  padding:0 !important;  margin-top:-3px !important;  margin-bottom:0 !important; } .wp-block-gallery .blocks-gallery-item {  margin-bottom:15px !important; } .wp-block-gallery .blocks-gallery-grid {  padding:0 !important;  margin-top:3px !important;  margin-bottom:5px !important; } .wp-block-gallery.alignwide {  width:100%; } .wp-block-gallery.columns-2.is-cropped.alignleft.extraclass {  margin-top:0 !important;  margin-right:15px; } .wp-block-gallery.columns-2.is-cropped.alignleft.extraclass.blocks-gallery-grid {  margin-top:0 !important; } .wp-block-cover {  margin-top:30px;  margin-bottom:30px; } .wp-block-cover p.wp-block-cover-text {  font-weight:bold;  margin-bottom:20px !important;  font-size:30px !important;  line-height:1.5; } .wp-block-cover p.wp-block-cover-text strong {  color:var(--white-color); } .wp-block-cover.has-background-dim.alignleft {  margin-top:0; } .wp-block-cover.has-background-dim-60.has-background-dim .wp-block-cover-text a {  color:var(--white-color); } .wp-block-file a {  text-decoration:underline;  font-size:15px;  color:var(--theme-color); } .wp-block-file a:hover {  text-decoration:none; } .wp-block-file .wp-block-file__button {  border-radius:4px !important;  font-size:14px !important;  font-weight:500;  display:table;  margin:10px 0 0;  background-color:var(--theme-color) !important;  color:var(--white-color); } .wp-block-file .wp-block-file__button:hover {  background-color:#000 !important;  color:var(--white-color); } .wp-block-quote.is-style-large {  border:none;  padding-left:0;  margin:20px 0; } .has-cyan-bluish-gray-background-color.has-cyan-bluish-gray-background-color {  background-color:var(--theme-color); } .has-cyan-bluish-gray-background-color.has-cyan-bluish-gray-background-color p {  color:var(--white-color); } .has-cyan-bluish-gray-background-color.has-cyan-bluish-gray-background-color cite {  display:none; } .has-cyan-bluish-gray-background-color.has-cyan-bluish-gray-background-color blockquote {  max-width:80%;  background:transparent; } .wp-caption {  max-width:100%; } .wp-caption .wp-caption-text {  font-size:15px;  line-height:20px;  margin:0;  text-align:center;  padding:12px 0 0; } .wp-caption .wp-caption-text a {  text-decoration:underline;  display:inline-block;  color:var(--theme-color); } .wp-caption .wp-caption-text a:hover {  text-decoration:none; } .wp-caption.alignnone {  margin:15px auto 10px; } .wp-caption.alignleft {  margin:5px 20px 20px 0; } .wp-caption.alignright {  margin:5px 0 20px 20px; } .wp-caption img {  border:0 none;  height:auto;  margin:0;  max-width:100%;  padding:0;  width:auto; } .wp-caption p.wp-caption-text {  font-size:14px;  line-height:17px;  margin:0;  padding:0 4px 5px; } .has-very-light-gray-color.has-very-light-gray-color {  color:var(--white-color); } .is-style-squared .wp-block-button__link {  border-radius:0 !important; }  .gallery {  margin:30px -1.1666667% 0; } .gallery-item {  display:inline-block;  max-width:33.33%;  padding:0 1.1400652% 2.2801304%;  text-align:center;  vertical-align:top;  width:100%; } .gallery-columns-1 .gallery-item {  max-width:100%; } .gallery-columns-2 .gallery-item {  max-width:50%; } .gallery-columns-3 .gallery-item {  max-width:33.3333333333%; } .gallery-columns-4 .gallery-item {  max-width:25%; } .gallery-columns-5 .gallery-item {  max-width:20%; } .gallery-columns-6 .gallery-item {  max-width:16.6666666667%; } .gallery-columns-7 .gallery-item {  max-width:14.2857142857%; } .gallery-columns-8 .gallery-item {  max-width:12.5%; } .gallery-columns-9 .gallery-item {  max-width:11.1111111111%; } .gallery-icon img {  margin:0 auto; } .gallery-caption {  display:block;  font-size:14px;  font-style:italic;  line-height:1.6153846154;  padding-top:0.5384615385em;  z-index:100000; } .gallery-columns-6 .gallery-caption, .gallery-columns-7 .gallery-caption, .gallery-columns-8 .gallery-caption, .gallery-columns-9 .gallery-caption {  display:none; }  .post-password-form label {  font-weight:600; } .post-password-form label input {  border:1px solid #ccc;  height:45px;  margin:0 10px;  padding:5px 15px; } .post-password-form input[type=submit] {  border:1px solid;  color:#fff;  height:45px;  padding:5px 20px;  font-weight:600;  background-color:var(--theme-color);  cursor:pointer;  transition:0.4s; } .post-password-form input[type=submit]:hover {  background-color:var(--theme-color2);  border:1px solid;  color:#fff; }  .comments-area .comment-list .trackback .comment-body, .comments-area .comment-list .pingback .comment-body {  margin-left:0 !important;  font-size:15px !important; } .comments-area .comment-list .trackback .comment-body a, .comments-area .comment-list .pingback .comment-body a {  text-decoration:underline;  color:red !important; } .comments-area .comment-list .trackback .comment-body a:hover, .comments-area .comment-list .pingback .comment-body a:hover {  text-decoration:none; } .comments-area .comment-list .trackback a.url, .comments-area .comment-list .pingback a.url {  margin-top:5px;  font-size:14px; }  .comment-navigation .nav-links {  overflow:hidden;  margin-bottom:25px; } .comment-navigation .nav-links .nav-previous a, .comment-navigation .nav-links .nav-next a {  border:1px solid #eee;  padding:7px 18px;  font-size:14px;  text-transform:capitalize;  background:#fff;  display:block; } .comment-navigation .nav-links .nav-previous a:hover, .comment-navigation .nav-links .nav-next a:hover {  color:#fff;  background-color:var(--theme-color); } .comment-navigation .nav-links .nav-previous {  float:left; } .comment-navigation .nav-links .nav-next {  float:right; }  .no-results .alert .page-title {  margin:0;  font-size:20px; } .no-results h1.page-title {  font-size:22px;  font-weight:600;  margin-top:-6px; } .search-form {  position:relative; } .search-form label {  display:block; } .search-form .search-field {  background-color:var(--white-color);  height:50px;  padding:6px 15px;  border:1px solid #eeeeee;  width:100%;  display:block;  outline:0;  transition:all 0.4s ease 0s; } .search-form .search-submit {  position:absolute;  cursor:pointer;  top:0;  right:0;  outline:0;  border:none;  color:var(--white-color);  background-color:var(--theme-color);  height:50px;  padding:0 20px;  transition:all 0.4s ease 0s;  text-transform:capitalize;  font-weight:600;  font-size:15px; } .search-form .search-submit:hover {  color:var(--white-color);  background:var(--dark-color); }  .bentol-single-blank-page {  height:320px; }  .archive-description p {  color:var(--white-color); } .alignnone {  display:block;  margin-bottom:15px; } .aligncenter, div.aligncenter {  display:block;  margin:15px auto; } .alignright {  clear:both;  float:right;  margin:5px 0 20px 20px; } .alignleft {  float:left;  margin:5px 20px 20px 0; } a img.alignright {  float:right;  margin:5px 0 20px 20px; } a img.alignnone {  margin:5px 20px 20px 0; } a img.alignleft {  float:left;  margin:5px 20px 20px 0; } a img.aligncenter {  display:block;  margin-left:auto;  margin-right:auto; } .screen-reader-text {  border:0;  clip:rect(1px, 1px, 1px, 1px);  -webkit-clip-path:inset(50%);  clip-path:inset(50%);  height:1px;  margin:-1px;  overflow:hidden;  padding:0;  position:absolute !important;  width:1px;  word-wrap:normal !important;  display:none; } .screen-reader-text:focus {  background-color:#eee;  clip:auto !important;  -webkit-clip-path:none;  clip-path:none;  color:#444;  display:block;  font-size:1em;  height:auto;  left:5px;  line-height:normal;  padding:15px 23px 14px;  text-decoration:none;  top:5px;  width:auto;  z-index:100000; } .blocks-gallery-caption {  margin-bottom:12px; } .wp-block-archives-list li span.post-count {  padding-left:8px;  float:right; } .wp-block-categories-dropdown {  margin-bottom:20px; } .wp-block-categories-dropdown select {  height:45px;  border:1px solid #eee;  width:100%;  font-size:14px;  padding:8px 15px;  color:#555; } .wp-block-tag-cloud a {  display:inline-block;  font-weight:600;  font-size:12.5px !important;  padding:6px 13px;  border:1px dashed #eeeeee;  position:relative;  color:#393953 !important;  text-decoration:none !important;  margin-top:8px;  margin-right:4px; } .wp-block-tag-cloud a:hover, .wp-block-tag-cloud a:focus {  color:#ffffff !important;  background-color:var(--theme-color) !important; } .wp-block-search {  margin-bottom:30px;  position:relative; } .wp-block-search label {  display:block;  margin-bottom:10px; } .wp-block-search .screen-reader-text {  display:none; } .wp-block-search .wp-block-search__input {  background-color:#ffffff;  height:50px;  padding:6px 15px;  border:1px solid #eeeeee;  max-width:100%;  display:block;  outline:0;  transition:var(--Transition);  color:var(--body-color); } .wp-block-search button {  position:absolute;  right:0;  bottom:0;  height:50px;  width:80px;  z-index:1;  border:none;  color:#ffffff;  background-color:var(--dark-color) !important; } .wp-block-search button:hover {  color:#ffffff;  background:#393953 !important; } .post-tag-media {  clear:both;  margin-top:20px; } .post-tag-media ul {  padding:0 !important;  margin:0 !important; } .post-tag-media ul li {  display:inline-block;  margin-top:5px;  margin-bottom:5px !important;  margin-left:0;  margin-right:0; } .post-tag-media ul li span {  font-weight:600;  margin-right:5px;  display:inline-block; } .post-tag-media ul.social-share {  text-align:right; }  #comments .comment-list .children .comment-respond {  background:#fafafa;  padding:20px;  border-radius:5px;  margin-bottom:20px;  margin-left:65px; } #comments .comment-list .children .comment-respond input[type=date], #comments .comment-list .children .comment-respond input[type=time], #comments .comment-list .children .comment-respond input[type=datetime-local], #comments .comment-list .children .comment-respond input[type=week], #comments .comment-list .children .comment-respond input[type=month], #comments .comment-list .children .comment-respond input[type=text], #comments .comment-list .children .comment-respond input[type=email], #comments .comment-list .children .comment-respond input[type=url], #comments .comment-list .children .comment-respond input[type=password], #comments .comment-list .children .comment-respond input[type=search], #comments .comment-list .children .comment-respond input[type=tel], #comments .comment-list .children .comment-respond input[type=number], #comments .comment-list .children .comment-respond textarea {  background-color:var(--white-color); } #comments .comment-list .children .comment-respond p {  margin-top:20px; } #comments .comment-list .children .comment-respond p.form-submit {  margin-bottom:0; } #comments .comment-list .children .comment-respond .logged-in-as {  margin-top:5px; } #comments .comment-list .children .comment-respond .comment-reply-title {  border-bottom:none;  margin-bottom:0;  margin-top:-6px;  padding-bottom:0; } #comments .comment-list .children .comment-respond .comment-reply-title::before {  display:none; } #comments .comment-list .children .comment-respond .form-submit {  float:unset;  margin-bottom:0; } #comments .comment-list .children .comment-respond .comment-form-comment {  background:#fafafa;  float:unset; } .widget.widget_block.widget_search .wp-block-search__label {  position:relative;  margin-bottom:5px;  margin-top:-6px;  padding-bottom:12px;  font-size:22px;  font-weight:600;  bottom:50%;  color:var(--dark-color); } .widget.widget_block.widget_search .wp-block-search__label::before {  display:none; } .wpcf7-not-valid-tip {  margin-top:10px; } span.wp-calendar-nav-prev, .wp-calendar-nav-next {  position:relative;  top:8px; } span.wp-calendar-nav-prev.wp-calendar-nav-next, .wp-calendar-nav-next.wp-calendar-nav-next {  float:right; } .wp-block-search__button.has-icon path {  fill:#fff; } .blocks-gallery-item {  padding-left:0; } .blocks-gallery-item::before {  display:none; } .bentol-admin-menu-activate.is-sticky, .bentol-admin-menu-activate .navbar-area.is-sticky {  margin-top:32px; } .bentol-admin-menu-activate.elementor-editor-active.is-sticky, .bentol-admin-menu-activate.elementor-editor-active .navbar-area.is-sticky {  top:0;  margin-top:0; } .bentol-nav .navbar .navbar-brand h2 {  margin:0;  padding:16px 0;  font-weight:bold;  font-size:38px; } .bentol-nav .navbar .navbar-nav .nav-item .nav-link {  text-transform:capitalize; } .bentol-nav .navbar .navbar-nav .nav-item .nav-link:hover, .bentol-nav .navbar .navbar-nav .nav-item .nav-link:active {  background:transparent; } .bentol-nav .navbar .navbar-nav .nav-item .nav-link .dropdown-menu {  width:268px; } .select2-results__option span i.fa {  font-family:var(--icon-font);  font-weight:400;  -moz-osx-font-smoothing:grayscale;  -webkit-font-smoothing:antialiased;  display:inline-block;  font-style:normal;  font-variant:normal;  text-rendering:auto;  line-height:1; } .page-title-area {  -ms-word-break:break-all;  word-break:break-all;  word-break:break-word; } .wp-block-calendar {  text-align:left;  margin-bottom:15px; } .wp-block-calendar .wp-calendar-table {  margin:0;  width:100%;  text-align:center; } .wp-block-calendar .wp-calendar-table th, .wp-block-calendar .wp-calendar-table td {  font-size:14px;  padding:8px 5px; } .wp-block-calendar .wp-calendar-table th a, .wp-block-calendar .wp-calendar-table td a {  text-decoration:none; } .wp-block-calendar .wp-calendar-table #today {  background-color:#eee;  font-weight:800; } .wp-block-calendar .wp-calendar-table caption {  padding-top:0;  color:#393d40;  caption-side:top;  font-weight:600;  margin-top:-5px; } .wp-block-calendar .wp-calendar-table .wp-calendar-nav-next, .wp-block-calendar .wp-calendar-table .wp-calendar-nav-prev {  margin-top:5px; } .wp-block-calendar .wp-calendar-table .wp-calendar-nav-next.wp-calendar-nav-next, .wp-block-calendar .wp-calendar-table .wp-calendar-nav-prev.wp-calendar-nav-next {  float:right; } .single-blog .blog-content .default-btn {  background-color:var(--theme-color); } .single-blog .blog-content .default-btn:hover {  background-color:var(--theme-color); } .wpcf7-list-item {  display:inline-block;  margin:0; } .bentol-post-next-prev {  padding:30px;  background-color:#ffffff;  -webkit-box-shadow:0 0 40px 3px rgba(0, 0, 0, 0.05);  box-shadow:0 0 40px 3px rgba(0, 0, 0, 0.05);  margin-top:30px; } .bentol-post-next-prev .navigation .nav-links {  display:flex;  justify-content:space-between;  flex-wrap:wrap; } .bentol-post-next-prev .navigation .nav-links .nav-next, .bentol-post-next-prev .navigation .nav-links .nav-previous {  flex:0 1 auto;  margin-bottom:inherit;  margin-top:inherit;  transition:0.4s; } .bentol-post-next-prev .navigation .nav-links .nav-next.nav-next, .bentol-post-next-prev .navigation .nav-links .nav-previous.nav-next {  text-align:right; } .bentol-post-next-prev .navigation .nav-links .nav-next.nav-next i, .bentol-post-next-prev .navigation .nav-links .nav-previous.nav-next i {  margin-left:10px; } .bentol-post-next-prev .navigation .nav-links .nav-next.nav-previous i, .bentol-post-next-prev .navigation .nav-links .nav-previous.nav-previous i {  margin-right:10px; } .bentol-post-next-prev .navigation .nav-links .nav-next a:hover p.post-title, .bentol-post-next-prev .navigation .nav-links .nav-next a:hover p.meta-nav, .bentol-post-next-prev .navigation .nav-links .nav-previous a:hover p.post-title, .bentol-post-next-prev .navigation .nav-links .nav-previous a:hover p.meta-nav {  color:var(--theme-color); } .bentol-post-next-prev p.meta-nav {  margin-bottom:0;  font-family:var(--body-font);  font-weight:bold;  transition:0.4s; } .bentol-post-next-prev p.meta-nav i {  font-size:19px;  position:relative;  top:3px; } .bentol-post-next-prev p.post-title {  font-size:21px;  font-weight:600;  color:#141414;  font-family:var(--body-font); }  @media (max-width:767px) {  .bentol-admin-menu-activate {   margin-top:0;  }  .bentol-admin-menu-activate.is-sticky,  .bentol-admin-menu-activate .navbar-area.is-sticky {   margin-top:0;  }  .bentol-admin-menu-activate .top-header-area.white-color {   margin-top:10px;  }  .bentol-post-next-prev {   padding:20px;  }  .bentol-post-next-prev .navigation .nav-links .nav-next,  .bentol-post-next-prev .navigation .nav-links .nav-previous {   text-align:center;  }  .page-main-content {   padding-top:60px;   padding-bottom:60px;  }  .page-main-content h1 {   font-size:24px;  }  .page-main-content h2 {   font-size:20px;  }  .page-main-content h3 {   font-size:18px;  }  .page-main-content h4 {   font-size:17px;  }  .page-main-content h5 {   font-size:16px;  }  .page-main-content h6 {   font-size:14px;  }  .single-blog .blog-content {   padding:20px;  }  .pb-70 {   padding-bottom:30px;  }  .wp-block-group__inner-container {   padding:0;  }  .sidebar .wp-block-search .wp-block-search__button {   font-size:14px !important;  }  .bentol-toolkit-activate .blog-details .blog-details-content h3 {   margin-top:30px;   margin-bottom:25px;  }  .bentol-toolkit-activate .blog-details .blog-details-content ul.entry-meta {   margin-top:20px;   margin-bottom:5px;  }  .bentol-toolkit-activate .blog-details .blog-details-content ul.entry-meta li {   font-size:12px;   margin-right:5px;  }  .bentol-toolkit-activate .blog-details .blog-details-content ul.entry-meta li i {   font-size:14px;  }  .bentol-toolkit-activate .blog-details .blog-details-content {   box-shadow:none;   padding:0;  }  .entry-meta li::before {   display:none;  }  .sidebar {   padding-left:0;   margin-top:30px;  }  .sidebar .widget {   padding:20px;   border:1px solid #efefef;  }  .sidebar .widget ul li {   padding-left:17px;  }  .wp-block-media-text .has-large-font-size {   font-size:22px;  }  .wp-block-embed-youtube iframe,  .wp-block-embed-youtube video {   height:100%;  }  table td,  table th {   padding:7px 7px;  }  #comments {   padding:20px;  }  #comments .comment-author .avatar {   height:50px;   width:50px;   left:0;   position:relative;   display:block;   margin-bottom:7px;  }  #comments .comment-list .comment-body {   margin-left:0;  }  #comments .comment-list .children .comment-respond {   margin-left:0;  }  #comments .comment-list .children .comment-respond .comment-author .avatar {   left:0;  }  #comments .comment-list .comment-metadata {   font-size:9px;  }  .post-password-form label input {   margin-left:0;   display:block;  }  .post-password-form input[type=submit] {   margin-top:5px;   margin-left:-1px;  }  blockquote,  .blockquote {   padding:25px !important;  }  blockquote p,  .blockquote p {   font-size:14px !important;  }  blockquote::before,  .blockquote::before {   left:25px;   top:-10px;   font-size:60px;  }  .widget_bentol_posts_thumbs .item .info .title {   font-size:15px;  }  .no-results {   margin-bottom:30px;  } } @media only screen and (min-width:600px) and (max-width:767px) {  .bentol-admin-menu-activate.is-sticky,  .bentol-admin-menu-activate .navbar-area.is-sticky {   margin-top:46px;  } } @media only screen and (min-width:768px) and (max-width:782px) {  .bentol-admin-menu-activate.is-sticky,  .bentol-admin-menu-activate .navbar-area.is-sticky {   margin-top:46px;  } } .nav-link.dropdown-item:active {  background-color:#e9ecef; } .wpcf7-list-item-label a {  color:var(--theme-color); } .navbar-nav .nav-item a {  text-transform:capitalize; } .post-tag-media ul li a {  padding:5px 20px;  margin-right:8px;  border-radius:30px;  text-decoration:none !important;  display:inline-block;  color:var(--dark-color) !important;  background-color:#f9f9f9;  font-size:14px;  font-weight:500; } .post-tag-media ul li a:hover {  background-color:var(--theme-color);  color:var(--white-color) !important;  border-radius:5px; } .admin-bar .nav-header {  top:33px; } .admin-bar .header-sticky {  top:32px; } .menu-area .header-logo a h2 {  color:var(--white-color); } .menu-area .header-logo a h2.header-style1 .menu-area .header-logo a h2 {  color:var(--dark-color);  margin-bottom:0; } .menu-area .header-logo a h2:last-child {  display:inline-block; } .menu-area .dropdown-toggle::after {  display:none; } .main-menu ul.sub-menu {  display:block !important; } .main-menu ul.sub-menu li ul.sub-menu {  left:auto;  right:100%; } @media (max-width:991px) {  .menu-area .header-logo a h2 {   color:var(--dark-color);   margin:0;   padding:0;   font-weight:bold;  } } .mobile-menu-default .mobile-menu {  border-bottom:0; } .mobile-menu-default .mobile-menu ul {  width:100%; } .mobile-menu-default .mobile-menu ul li a:hover {  color:var(--theme-color) !important; } .mobile-menu-default .mobile-menu ul .current-menu-item a {  color:var(--theme-color) !important; } .not-found-area {  padding-top:120px;  padding:120px; } .not-found-area .not-found-content {  text-align:center; } .not-found-area .not-found-content h3 {  font-size:60px;  color:var(--light-color); } .not-found-area .not-found-content p {  color:var(--light-color); } select.wpcf7-form-control.wpcf7-select {  line-height:1; } ul.sub-menu.submenu-class {  position:relative; } .mobile-menu-wrapper .sidebar-wrap {  margin-bottom:0; } .mobile-menu-wrapper .sidebar-wrap p, .mobile-menu-wrapper .sidebar-wrap {  color:var(--white-color);  margin-bottom:0;  font-size:14px;  font-weight:600; } .mobile-menu-wrapper .social-btn.style3 {  margin-top:20px; } .elementor-editor-active .sticky-header.fixed-header {  top:0; } form.mailchimp.d-flex.consulation-form .mchimp-sucmessage, form.mailchimp.d-flex.consulation-form .mchimp-errmessage {  position:absolute;  bottom:-82px;  color:var(--white-color); } .error404 .nav-header, .error404 .newsletter-section {  display:none; } .error404 .footer-section {  display:none !important; } .footer-widget {  margin-left:50px; } @media (max-width:1199px) {  .footer-widget {   margin-left:30px;  } } @media (max-width:1024px) {  .footer-widget {   margin-left:0;  } } @media (max-width:767px) {  .footer-widget {   margin-bottom:46px;  } } .footer-widget .title {  color:var(--white-color);  font-weight:500;  margin-bottom:30px;  } @media (min-width:820px) and (max-width:912px) {  .footer-widget .title {   font-size:20px;  } } @media (max-width:767px) {  .footer-widget .title {   margin-bottom:25px;  } } .footer-widget .text {  color:var(--gray-color2); } .footer-widget .notify {  color:var(--gray-color2);  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-start;  gap:10px;  font-size:14px; } .footer-widget .notify:hover .icon svg, .footer-widget .notify:hover .icon i {  animation:wobble_bell 1s forwards ease-in-out 0s; } .footer-widget .notify .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:38px;  height:38px;  border-radius:50%;  background-color:var(--bs-border-color);  font-size:15px;  color:var(--theme-color2); } .footer-widget .notify .icon svg {  width:20px;  fill:var(--theme-color2); } .footer-widget ul li {  margin-bottom:11px; } .footer-widget ul li:last-child {  margin-bottom:0; } .footer-widget ul li a {  text-decoration:none;  color:var(--gray-color2);  position:relative; } @media (min-width:820px) and (max-width:912px) {  .footer-widget ul li a {   font-size:14px;  } } .footer-widget ul li a:hover {  color:var(--theme-color);  padding-left:18px; } .footer-widget ul li a:hover::before {  opacity:1; } .footer-widget ul li a::before {  content:"";  position:absolute;  top:50%;  transform:translateY(-50%);  left:0;  width:8px;  height:8px;  border-radius:50%;  background-color:var(--theme-color);  transition:all 0.4s ease 0s;  opacity:0; } .newsletter-form {  position:relative; } .newsletter-form .form-group {  position:relative;  margin-bottom:0; } .newsletter-form .form-group input[type=email] {  position:relative;  display:block;  height:60px;  width:100%;  color:var(--gray-color2);  padding:10px 25px;  background-color:var(--white-color);  border-radius:4px 30px 30px 4px;  margin-bottom:35px;  transition:all 0.4s ease 0s; } .newsletter-form .form-group input[type=email]:focus {  color:var(--dark-color); } .newsletter-form .form-group button[type=submit] {  display:inline-block;  position:absolute;  top:50%;  transform:translateY(-50%);  right:10px;  width:38px;  height:38px;  font-size:16px;  color:var(--white-color);  background:var(--theme-color);  border-radius:50%;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center; } .newsletter-form .form-group button[type=submit] svg {  width:20px;  fill:var(--white-color); }  .service-sidebar, .sidebar {  position:sticky;  top:100px;  padding-left:15px; } .service-sidebar .widget, .sidebar .widget {  margin-bottom:30px;  padding:35px;  padding-top:0;  border-radius:5px;  background-color:var(--theme-color3);  border:unset; } .service-sidebar .widget ul li, .service-sidebar .widget ol li, .sidebar .widget ul li, .sidebar .widget ol li {  position:relative;  margin-bottom:12px;  overflow:hidden;  color:var(--dark-color);  font-weight:500;  font-size:15px; } .service-sidebar .widget ul li a, .service-sidebar .widget ol li a, .sidebar .widget ul li a, .sidebar .widget ol li a {  color:var(--dark-color); } .service-sidebar .widget ul li a:hover, .service-sidebar .widget ol li a:hover, .sidebar .widget ul li a:hover, .sidebar .widget ol li a:hover {  color:var(--theme-color); } .service-sidebar .widget ul li a:hover .post_count, .service-sidebar .widget ol li a:hover .post_count, .sidebar .widget ul li a:hover .post_count, .sidebar .widget ol li a:hover .post_count {  border:1px solid; } .service-sidebar .widget ul li a .post_count, .service-sidebar .widget ol li a .post_count, .sidebar .widget ul li a .post_count, .sidebar .widget ol li a .post_count {  position:absolute;  right:0;  border:1px solid #eee;  width:25px;  text-align:center;  height:25px;  line-height:25px;  font-size:13px; } .service-sidebar .widget ul li:last-child, .service-sidebar .widget ol li:last-child, .sidebar .widget ul li:last-child, .sidebar .widget ol li:last-child {  margin-bottom:0; } .service-sidebar .widget ul li::before, .service-sidebar .widget ul li::after, .service-sidebar .widget ol li::before, .service-sidebar .widget ol li::after, .sidebar .widget ul li::before, .sidebar .widget ul li::after, .sidebar .widget ol li::before, .sidebar .widget ol li::after {  display:none; } .service-sidebar .widget .widget-title, .sidebar .widget .widget-title {  font-size:22px;  color:var(--white-color);  font-weight:500;  background-color:var(--dark-color);  padding:10px 35px;  border-radius:10px 10px 0 0;  position:relative;  z-index:1;  margin:0 -35px 20px; } .service-sidebar .widget.widget_search, .sidebar .widget.widget_search {  padding:0;  background-color:transparent;  position:relative; } .service-sidebar .widget.widget_search .search-form, .sidebar .widget.widget_search .search-form {  width:100%;  display:block;  position:relative;  margin-bottom:0; } .service-sidebar .widget.widget_search .search-form input[type=search], .sidebar .widget.widget_search .search-form input[type=search] {  display:block;  font-size:16px;  color:var(--dark-color);  font-weight:500;  height:55px;  width:100%;  padding:0;  background-color:var(--white-color);  border:none;  outline:none;  border-radius:0;  border-bottom:1px solid var(--dark-color);  } @media (max-width:991px) {  .service-sidebar .widget.widget_search .search-form input[type=search],  .sidebar .widget.widget_search .search-form input[type=search] {   padding:0 30px;  } } .service-sidebar .widget.widget_search .search-form button[type=submit], .sidebar .widget.widget_search .search-form button[type=submit] {  position:absolute;  top:0;  right:0;  bottom:0;  width:36px;  outline:none;  border:none;  padding:0;  font-size:16px;  color:var(--dark-color);  background-color:transparent;  transition:all 0.4s ease 0s;  } .service-sidebar .widget.widget_search .search-form button[type=submit]:hover, .sidebar .widget.widget_search .search-form button[type=submit]:hover {  color:var(--theme-color); } @media (max-width:991px) {  .service-sidebar .widget.widget_search .search-form button[type=submit],  .sidebar .widget.widget_search .search-form button[type=submit] {   display:flex;   -webkit-box-align:center;   align-items:center;  }  .service-sidebar .widget.widget_search .search-form button[type=submit]::after,  .sidebar .widget.widget_search .search-form button[type=submit]::after {   position:absolute;   content:"";   left:-20px;   top:50%;   transform:translateY(-50%);   width:1px;   height:20px;   background-color:var(--bs-bg-color3);  } } .service-sidebar .widget.widget_search form, .sidebar .widget.widget_search form {  position:relative;  margin-bottom:0; } .service-sidebar .widget.widget_search form label, .sidebar .widget.widget_search form label {  display:block; } .service-sidebar .widget.widget_search form .screen-reader-text, .sidebar .widget.widget_search form .screen-reader-text {  display:none; } .service-sidebar .widget.widget_categories li, .sidebar .widget.widget_categories li {  padding:16px 0;  border-bottom:1px solid var(--bs-border-color10);  margin-bottom:0;  position:relative; } .service-sidebar .widget.widget_categories li a, .sidebar .widget.widget_categories li a {  margin-bottom:0; } .service-sidebar .widget.widget_categories li a:hover, .sidebar .widget.widget_categories li a:hover {  color:var(--theme-color);  padding-left:15px; } .service-sidebar .widget.widget_categories li a:hover::before, .sidebar .widget.widget_categories li a:hover::before {  opacity:1; } .service-sidebar .widget.widget_categories li a::before, .sidebar .widget.widget_categories li a::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  width:7px;  height:7px;  background:var(--theme-color);  border-radius:50%;  opacity:0;  border:none; } .service-sidebar .widget.widget_categories li a::after, .sidebar .widget.widget_categories li a::after {  display:none; } .service-sidebar .widget.widget_categories li .post-count, .sidebar .widget.widget_categories li .post-count {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s; } .service-sidebar .widget.widget_bentol_posts_thumbs, .sidebar .widget.widget_bentol_posts_thumbs {  position:relative;  overflow:hidden; } .service-sidebar .widget.widget_bentol_posts_thumbs .item, .sidebar .widget.widget_bentol_posts_thumbs .item {  overflow:hidden;  margin-bottom:20px; } .service-sidebar .widget.widget_bentol_posts_thumbs .item:last-child, .sidebar .widget.widget_bentol_posts_thumbs .item:last-child {  margin-bottom:0; } .service-sidebar .widget.widget_bentol_posts_thumbs .item .thumb, .sidebar .widget.widget_bentol_posts_thumbs .item .thumb {  float:left;  height:80px;  width:80px;  margin-right:15px;  position:relative;  overflow:hidden;  border-radius:4px; } .service-sidebar .widget.widget_bentol_posts_thumbs .item .thumb:hover .fullimage, .sidebar .widget.widget_bentol_posts_thumbs .item .thumb:hover .fullimage {  transform:scale(1.1) rotate(-2deg);  filter:brightness(0.5); } .service-sidebar .widget.widget_bentol_posts_thumbs .item .thumb .fullimage, .sidebar .widget.widget_bentol_posts_thumbs .item .thumb .fullimage {  width:100%;  height:100%;  display:inline-block;  transition:all 0.4s ease 0s;  background-size:cover !important;  background-position:center center !important; } .service-sidebar .widget.widget_bentol_posts_thumbs .item .info, .sidebar .widget.widget_bentol_posts_thumbs .item .info {  overflow:hidden; } .service-sidebar .widget.widget_bentol_posts_thumbs .item .info time, .sidebar .widget.widget_bentol_posts_thumbs .item .info time {  display:block;  text-transform:capitalize;  color:var(--body-color);  margin:5px 0;  font-size:12px;  font-weight:500; } .service-sidebar .widget.widget_bentol_posts_thumbs .item .info .title, .sidebar .widget.widget_bentol_posts_thumbs .item .info .title {  margin-bottom:0;  line-height:1.5;  font-size:16px;  font-weight:600; } .service-sidebar .widget.widget_bentol_posts_thumbs .item .info .title a, .sidebar .widget.widget_bentol_posts_thumbs .item .info .title a {  font-size:18px;  color:var(--dark-color);  font-weight:500;  background:linear-gradient(var(--dark-color) 0%, var(--dark-color) 98%);  background-size:0 1px;  background-repeat:no-repeat;  background-position:left 100%;  transition:all 0.4s ease 0s; } .service-sidebar .widget.widget_bentol_posts_thumbs .item .info .title a:hover, .sidebar .widget.widget_bentol_posts_thumbs .item .info .title a:hover {  color:var(--dark-color);  background-size:100% 1px; } @media (max-width:414px) {  .service-sidebar .widget.widget_bentol_posts_thumbs .item .info .title a,  .sidebar .widget.widget_bentol_posts_thumbs .item .info .title a {   font-size:16px;  } } @media (max-width:360px) {  .service-sidebar .widget.widget_bentol_posts_thumbs .item .info .title a,  .sidebar .widget.widget_bentol_posts_thumbs .item .info .title a {   font-size:15px;  } } .service-sidebar .widget.widget_bentol_posts_thumbs .date, .sidebar .widget.widget_bentol_posts_thumbs .date {  font-size:14px; } .service-sidebar .widget.widget_bentol_posts_thumbs .date i, .sidebar .widget.widget_bentol_posts_thumbs .date i {  color:var(--theme-color);  position:relative;  top:2px; } .service-sidebar .widget .tagcloud a, .sidebar .widget .tagcloud a {  font-size:14px !important;  line-height:36px;  font-weight:500;  color:var(--dark-color);  text-transform:uppercase;  padding:0 20px;  border-radius:30px;  background-color:transparent;  border:1px solid var(--bs-border-color6);  transition:all 0.4s ease 0s;  cursor:pointer; } .service-sidebar .widget .tagcloud a:hover, .service-sidebar .widget .tagcloud a:focus, .sidebar .widget .tagcloud a:hover, .sidebar .widget .tagcloud a:focus {  color:var(--white-color);  background-color:var(--theme-color); } .service-sidebar select, .sidebar select {  height:45px;  border:1px solid #eee;  width:100%;  font-size:13.5px;  -webkit-appearance:none;  -moz-appearance:none;  appearance:none;  background:transparent;  background-image:url("data:image/svg+xml;utf8,<svg fill='black' height='24' viewBox='0 0 24 24' width='24' xmlns='http://www.w3.org/2000/svg'><path d='M7 10l5 5 5-5z'/><path d='M0 0h24v24H0z' fill='none'/></svg>");  background-repeat:no-repeat;  background-position-x:100%;  background-position-y:9px;  padding:8px 8px !important; } .service-sidebar .widget_categories ul li a, .sidebar .widget_categories ul li a {  text-transform:capitalize; } .service-sidebar .widget_categories ul li .children, .sidebar .widget_categories ul li .children {  margin-top:10px; } .service-sidebar .widget_pages ul li.page_item_has_children > a, .sidebar .widget_pages ul li.page_item_has_children > a {  margin-bottom:10px;  display:inline-block; } .service-sidebar .widget_pages ul li a, .sidebar .widget_pages ul li a {  text-transform:capitalize; } .service-sidebar .widget_rss ul li, .sidebar .widget_rss ul li {  margin-bottom:20px; } .service-sidebar .widget_rss ul li:last-child, .sidebar .widget_rss ul li:last-child {  margin-bottom:0; } .service-sidebar .widget_rss ul li::before, .sidebar .widget_rss ul li::before {  top:6px; } .service-sidebar .widget_rss ul li .rsswidget, .sidebar .widget_rss ul li .rsswidget {  display:block;  color:#222222;  font-weight:600; } .service-sidebar .widget_rss ul li .rss-date, .sidebar .widget_rss ul li .rss-date {  font-size:13px;  margin:3px 0 10px;  display:block; } .service-sidebar .widget_rss ul li .rssSummary, .sidebar .widget_rss ul li .rssSummary {  color:#222222;  line-height:25px;  font-size:14px; } .service-sidebar .widget_rss ul li cite, .sidebar .widget_rss ul li cite {  font-weight:600;  display:block;  margin-top:10px;  font-style:normal;  color:#222;  font-size:13.5px; } .service-sidebar .widget_text p img, .sidebar .widget_text p img {  margin:10px 0; } .service-sidebar .widget_text .wp-caption-text, .sidebar .widget_text .wp-caption-text {  border:none;  text-align:center;  font-size:13px; } .service-sidebar .calendar_wrap table, .sidebar .calendar_wrap table {  margin:0;  width:100%;  text-align:center; } .service-sidebar .calendar_wrap table th, .service-sidebar .calendar_wrap table td, .sidebar .calendar_wrap table th, .sidebar .calendar_wrap table td {  font-size:14px;  padding:8px 5px; } .service-sidebar .calendar_wrap table th a, .service-sidebar .calendar_wrap table td a, .sidebar .calendar_wrap table th a, .sidebar .calendar_wrap table td a {  text-decoration:none; } .service-sidebar .calendar_wrap table #today, .sidebar .calendar_wrap table #today {  background-color:#eee;  font-weight:800;  color:var(--theme-color); } .service-sidebar .calendar_wrap caption, .sidebar .calendar_wrap caption {  padding-top:0;  color:#393d40;  caption-side:top;  font-weight:600; } .service-sidebar .calendar_wrap .wp-calendar-nav-next, .sidebar .calendar_wrap .wp-calendar-nav-next {  margin-top:1px;  float:right; } .service-sidebar .calendar_wrap .wp-calendar-nav-prev, .sidebar .calendar_wrap .wp-calendar-nav-prev {  margin-top:5px; } .service-sidebar .calendar_wrap .wp-calendar-nav-prev a:hover, .service-sidebar .calendar_wrap .wp-calendar-nav-prev .wp-calendar-nav-next a:hover, .sidebar .calendar_wrap .wp-calendar-nav-prev a:hover, .sidebar .calendar_wrap .wp-calendar-nav-prev .wp-calendar-nav-next a:hover {  color:var(--theme-color); } .service-sidebar .rsswidget.rss-widget-title, .sidebar .rsswidget.rss-widget-title {  color:var(--title-color); } .service-sidebar .widget_nav_menu .sub-menu, .sidebar .widget_nav_menu .sub-menu {  margin-top:8px; } .service-sidebar .widget_recent_comments .recentcomments, .sidebar .widget_recent_comments .recentcomments {  color:var(--body-color);  font-weight:normal; } .service-sidebar .widget_recent_comments .recentcomments .comment-author-link, .sidebar .widget_recent_comments .recentcomments .comment-author-link {  font-weight:400;  font-size:14px; } .service-sidebar .widget_recent_comments .recentcomments .comment-author-link a, .sidebar .widget_recent_comments .recentcomments .comment-author-link a {  font-weight:600; } .service-sidebar .widget_recent_comments .recentcomments a, .sidebar .widget_recent_comments .recentcomments a {  font-weight:600; } .service-sidebar .widget_recent_entries ul li a, .sidebar .widget_recent_entries ul li a {  font-weight:600;  font-size:15.5px; } .service-sidebar .widget_recent_entries ul li .post-date, .sidebar .widget_recent_entries ul li .post-date {  display:block;  font-size:13px;  color:#767676; } .service-sidebar .widget_media_gallery .gallery, .sidebar .widget_media_gallery .gallery {  margin:0; } .service-sidebar .widget_media_gallery .gallery .gallery-item, .sidebar .widget_media_gallery .gallery .gallery-item {  margin:0; } .service-sidebar p, .sidebar p {  font-size:14px; } .service-sidebar span.post-count, .sidebar span.post-count {  float:right; } .widget {  margin-bottom:30px;  position:relative;  padding:var(--widget-padding-x, 40px);  background:var(--white-color);  border:1px solid #E3E5DE;  border-radius:0px; } .widget[data-overlay]:before {  z-index:-1; } .widget_title {  position:relative;  font-size:24px;  font-weight:500;  font-family:var(--title-font);  line-height:1em;  margin:-0.12em 0 47px 0; } .widget-author {  padding-top:60px;  padding-bottom:60px;  text-align:center; } .widget-author .widget-author-thumb {  margin-bottom:30px; } .widget-author .widget_title {  font-size:30px;  margin-bottom:4px; } .widget-author .widget_title:after {  display:none; } .widget-author .widget-author-desig {  font-size:18px;  font-weight:400;  font-family:var(--title-font);  color:var(--body-color);  display:block; } .widget-author .social-btn {  display:inline-flex;  margin-top:22px; } .wp-block-tag-cloud, .widget .tagcloud {  margin-right:-3px;  margin-bottom:-10px; } .wp-block-tag-cloud a, .widget .tagcloud a {  display:inline-block;  border:1px solid #E3E5DE;  font-size:13px !important;  font-weight:500;  font-family:var(--body-font);  text-transform:uppercase;  height:40px;  line-height:40px;  padding:0px 21px;  margin-right:5px;  margin-bottom:10px;  color:var(--body-color);  background-color:var(--white-color);  border-radius:0px; } .wp-block-tag-cloud a:hover, .widget .tagcloud a:hover {  background-color:var(--title-color);  color:var(--white-color) !important;  border-color:var(--title-color); } .widget_gallery .insta-feed {  display:grid;  grid-template-columns:repeat(3, 1fr);  gap:10px; } .widget_gallery a {  position:relative;  border-radius:0px;  display:inline-block;  flex:none; } .widget_gallery a img {  border-radius:0px;  width:100%; } .widget_gallery a:after {  content:"";  position:absolute;  left:0;  top:0;  height:100%;  width:100%;  background-color:var(--theme-color);  border-radius:0px;  transition:0.4s;  opacity:0; } .widget_gallery a i {  position:absolute;  left:50%;  top:50%;  transform:translate(-50%, -50%);  z-index:1;  opacity:0;  transition:0.4s;  color:var(--white-color);  font-size:20px; } .widget_gallery a:hover i {  opacity:1; } .widget_gallery a:hover:after {  opacity:0.7; } .base {  border-radius:6px;  position:absolute;  left:1302px;  top:2098px;  width:80px;  height:78px;  z-index:209; } .widget-project-details {  background:rgba(199, 134, 101, 0.08);  border:0;  margin-bottom:0; } .widget-project-details .widget_title {  margin-bottom:30px; } .widget-project-details .widget_title:after {  display:none; } .widget-project-details ul {  list-style:none;  padding:0;  margin:0; } .widget-project-details ul li {  display:flex;  gap:20px;  align-items:center; } .widget-project-details ul li:not(:last-child) {  border-bottom:1px solid #EEDFD7;  padding-bottom:25px;  margin-bottom:25px; } .widget-project-details ul li .icon {  height:50px;  width:50px;  line-height:50px;  border-radius:50%;  background:var(--white-color);  text-align:center;  color:var(--theme-color); } .widget-project-details ul li .title {  font-size:14px;  font-weight:500;  text-transform:uppercase;  display:block;  margin-bottom:-1px;  margin-top:-0.6em; } .widget-project-details ul li h6 {  font-size:20px;  font-weight:400;  margin-bottom:-0.3em; } .sidebar-widget .widget-box {  width:100%;  margin-bottom:30px;  padding:35px;  border-radius:0 0 10px 10px;  background-color:var(--theme-color3);  } @media (max-width:375px) {  .sidebar-widget .widget-box {   padding:25px;  } }  #sidebar-overlay, .bentol-sidebar {  display:none; } .bentol-sidebar {  background-color:var(--white-color);  border-left:1px solid var(--dark-color);  position:fixed;  right:0;  top:0;  transform:translateX(100%);  width:400px;  height:100%;  z-index:9999;  display:flex;  align-items:flex-start;  justify-content:flex-start;  overflow-y:scroll;  visibility:hidden;  transition:all 0.5s ease-in-out;  padding:60px 40px; } .open-sidebar .bentol-sidebar {  right:0;  visibility:visible;  transform:translate(0); } .sidebar-close-btn {  position:absolute;  right:30px;  top:63px;  color:var(--gray-color);  transition:all 0.4s ease 0s; } .sidebar-close-btn:hover {  color:var(--theme-color); } .sidebar-close-btn svg {  fill:currentColor;  stroke:none;  width:20px;  height:20px; } .sidebar-content .sidebar-logo {  margin-bottom:40px; } .sidebar-content .sidebar-logo img {  max-width:200px; } .sidebar-content .sidebar-about, .sidebar-content .sidebar-contact {  margin-bottom:40px; } .sidebar-content .sidebar-about .theme-btn, .sidebar-content .sidebar-contact .theme-btn {  padding:10px 40px; } .sidebar-content .sidebar-header {  margin-bottom:20px; } .sidebar-content .sidebar-header h3 {  font-size:26px;  font-weight:600;  line-height:1; } .sidebar-content .sidebar-social {  margin-top:40px; } .sidebar-content .sidebar-social li {  display:inline-flex; } .sidebar-content .sidebar-social li:not(:last-of-type) {  margin-right:10px; } .sidebar-content .sidebar-social li a {  background-color:var(--dark-color);  font-size:17px;  color:var(--white-color);  height:40px;  width:40px;  display:flex !important;  align-items:center;  justify-content:center;  border-radius:5px; } .sidebar-content .sidebar-social li a:hover {  background-color:var(--theme-color);  color:var(--white-color); } .sidebar-content .sidebar-menu-wrap {  margin-bottom:40px; } .contact-info li {  display:flex;  align-items:center;  font-weight:600;  font-size:15px; } .contact-info li:not(:last-of-type) {  margin-bottom:20px; } .contact-info li svg, .contact-info li i {  background-color:var(--theme-color);  font-size:12px;  color:var(--white-color);  width:30px;  height:30px;  line-height:30px;  text-align:center;  border-radius:5px;  transition:all 0.2s ease-in-out;  flex-shrink:0; } .contact-info li svg {  padding:9px;  fill:var(--white-color); } .contact-info li p, .contact-info li a {  padding-left:10px;  margin-bottom:0; } .contact-info li a {  color:var(--dark-color); } .contact-info li a:hover {  color:var(--theme-color); }  .sidebar::-webkit-scrollbar {  width:8px;  height:8px; } .sidebar::-webkit-scrollbar-thumb {  cursor:pointer;  background:var(--light-color); } .sidebar::selection {  background-color:var(--light-color);  color:var(--white-color); } .sidebar::-moz-selection {  background-color:var(--light-color);  color:var(--white-color); } #sidebar-overlay {  display:block;  height:100%;  left:0;  opacity:0;  overflow:hidden;  position:fixed;  top:0;  transition:all 0s ease-in-out;  width:calc(100% - 400px);  z-index:-1; } #sidebar-overlay.open-sidebar {  opacity:1;  z-index:1002;  transition:all 0.6s ease-in-out;  transition-delay:0.3s; } .service-sidebar .widget_categories {  margin:0 10px 30px; } .widget.service-details-help .help-title {  line-height:1.2; } .service-sidebar .widget_categories .widget-title {  padding:10px 35px !important; } .services-details__content .title-two {  margin-top:25px !important;  margin-bottom:-10px !important; } .service-download-btn .theme-btn {  padding:12px 25px !important; }  .shop-sidebar {  border:1px solid var(--bs-border-color7);  border-radius:10px;  padding:40px 30px 18px;  position:sticky;  top:100px; } @media (max-width:991px) {  .shop-sidebar {   max-width:400px;  } } @media (max-width:575px) {  .shop-sidebar {   max-width:inherit;  } } .shop-sidebar .shop-widget {  margin-bottom:18px; } .shop-sidebar .shop-widget:last-child {  margin-bottom:0; } .shop-sidebar .shop-widget .widget-title {  font-size:22px;  font-weight:500;  color:var(--dark-color);  border-bottom:1px solid rgba(9, 59, 59, 0.1019607843);  padding:0 0 20px;  margin:0 0 27px;  position:relative; } .shop-sidebar .shop-widget .product-categories li {  display:flex;  justify-content:space-between;  position:relative;  margin-bottom:12px; } .shop-sidebar .shop-widget .product-categories li:last-child {  margin-bottom:0; } .shop-sidebar .shop-widget .product-categories li a {  font-size:15px;  color:var(--gray-color);  flex:1;  position:relative;  padding-left:25px; } .shop-sidebar .shop-widget .product-categories li a::before {  content:"";  position:absolute;  left:0;  top:3px;  width:18px;  height:18px;  border:1px solid rgba(6, 36, 98, 0.1);  background-color:rgba(7, 72, 131, 0);  border-radius:4px;  transition:0.3s ease; } .shop-sidebar .shop-widget .product-categories li a:hover::before {  border-color:var(--theme-color);  background-color:var(--theme-color); } .shop-sidebar .shop-widget .product-categories li .count {  font-size:15px;  color:var(--gray-color2); } .shop-sidebar .shop-widget .tagcloud a {  font-size:15px !important;  color:var(--gray-color);  position:relative;  padding-left:25px;  display:block;  margin-bottom:12px; } .shop-sidebar .shop-widget .tagcloud a:last-child {  margin-bottom:0; } .shop-sidebar .shop-widget .tagcloud a::before {  content:"";  position:absolute;  left:0;  top:3px;  width:18px;  height:18px;  border:1px solid rgba(6, 36, 98, 0.1);  background-color:rgba(7, 72, 131, 0);  border-radius:4px;  transition:0.3s ease; } .shop-sidebar .shop-widget .tagcloud a:hover::before {  border-color:var(--theme-color);  background-color:var(--theme-color); } .shop-sidebar .shop-widget.widget_price_filter .ui-slider-horizontal {  height:8px;  border-radius:4px !important; } .shop-sidebar .shop-widget.widget_price_filter span.ui-slider-handle.ui-corner-all.ui-state-default {  width:18px;  height:18px;  border-radius:50%;  left:0px;  top:-5px;  transform:translateX(-9px);  background-color:var(--white-color);  border:2px solid var(--dark-color); } .shop-sidebar .shop-widget.widget_price_filter .ui-slider .ui-slider-range, .shop-sidebar .shop-widget.widget_price_filter .ui-slider .ui-slider-handle {  border-radius:4px; } .shop-sidebar .shop-widget.widget_price_filter button {  color:var(--white-color) !important; } .shop-sidebar .shop-widget.widget_price_filter button:hover {  background-color:var(--theme-color) !important; } .shop-sidebar .shop-widget.widget_rating_filter li {  margin-bottom:5px; } .shop-sidebar .shop-widget.widget_rating_filter li a {  display:flex;  justify-content:space-between; } .shop-sidebar .shop-widget.widget_rating_filter li a .star-rating {  color:var(--orange-color); } .shop-sidebar .shop-widget.widget_product_search .search-field {  background:var(--theme-color3);  color:var(--dark-color); } .shop-sidebar .shop-widget.widget_product_search button {  font-size:100%;  margin:0;  line-height:1;  cursor:pointer;  position:relative;  text-decoration:none;  overflow:visible;  padding:0.618em 1em;  font-weight:700;  border-radius:3px;  left:auto;  color:var(--white-color);  background-color:var(--dark-color);  border:0;  display:inline-block;  background-image:none;  box-shadow:none;  text-shadow:none;  margin-top:10px; } .shop-sidebar .shop-widget.widget_product_search button:hover {  color:var(--theme-color); } .shop-sidebar .shop-widget .product_list_widget li {  padding-left:0; } .shop-sidebar .shop-widget .product_list_widget li img {  margin-right:10px;  float:left;  margin-left:0;  width:80px; } .shop-sidebar .shop-widget .product_list_widget li dl {  margin:0;  padding-left:0 !important;  border-left:none !important;  display:table-cell; } .shop-sidebar .shop-widget .product_list_widget li::before {  display:none !important; } .shop-sidebar .shop-widget .product_list_widget .star-rating {  color:var(--orange-color);  margin:2px 0 4px; } .shop-sidebar ul.cart_list li img, .shop-sidebar ul.product_list_widget li img {  float:left; }  .sticky-header {  position:fixed;  visibility:hidden;  opacity:0;  left:0;  top:0;  width:100%;  padding:0;  z-index:99999;  background:rgba(6, 50, 50, 0.7294117647);  box-shadow:0 0 20px rgba(255, 255, 255, 0.1098039216);  backdrop-filter:blur(10px); } .sticky-header.fixed-header {  opacity:1;  z-index:9999;  visibility:visible; } .sticky-header .main-menu a {  color:var(--white-color); } .sticky-header .main-menu > ul > li > a {  padding:27px 0; } .sticky-header .menu-area {  background-color:transparent;  padding:0;  border-radius:0;  margin-top:0;  box-shadow:none; } .nav-header {  position:absolute;  top:0;  left:0;  right:0;  z-index:41;  } @media (max-width:991px) {  .nav-header {   background-color:var(--light-color);  } } .menu-area {  position:relative;  background-color:var(--light-color);  padding:0 20px;  border-radius:40px;  margin-top:30px;  box-shadow:0 0 20px var(--bs-border-color3); } @media (max-width:991px) {  .menu-area {   padding:0;   border-radius:0;  } } .menu-area .header-logo {  } .menu-area .header-logo a img:last-child {  display:none; } @media (max-width:991px) {  .menu-area .header-logo a img:first-child {   display:none;  }  .menu-area .header-logo a img:last-child {   display:inherit;  } } @media (max-width:991px) {  .menu-area {   height:70px;   margin-top:0;   box-shadow:none;  } } .fixed-header .menu-area .header-logo a img:last-child {  display:inline-block; }  @media (max-width:991px) {  .header-logo {   padding:18px 0;  } } .main-menu a {  display:block;  position:relative;  font-weight:500;  font-family:var(--title-font);  font-size:16px;  color:var(--dark-color); } .main-menu a:hover {  color:var(--theme-color); } .main-menu .active a {  color:var(--theme-color); } .main-menu li a.active {  color:var(--theme-color); } .main-menu > ul {  display:flex;  align-items:center; } .main-menu > ul > li {  margin:0; } .main-menu > ul > li:last-child {  margin-right:0 !important; } .main-menu > ul > li > a {  padding:32px 0;  text-transform:capitalize; } .main-menu > ul > li > a:hover {  color:var(--theme-color); } .main-menu > ul > li > a:hover .effect-1 {  top:-100%; } .main-menu > ul > li.menu-item-has-children a {  padding-right:18px; } .main-menu > ul > li.menu-item-has-children > a::before {  position:absolute;  content:"\f107";  font-family:var(--icon-font);  font-weight:600;  font-size:14px;  right:0;  top:50%;  transform:translateY(-50%); } .main-menu > ul > li.menu-item-has-children > a::after {  display:none; } .main-menu ul {  margin:0;  padding:0; } .main-menu ul li {  list-style-type:none;  display:inline-block;  position:relative;  margin-right:50px; } .main-menu ul li.mega-menu {  position:static; } @media (max-width:1299px) {  .main-menu ul li {   margin-right:40px;  } } @media (max-width:1199px) {  .main-menu ul li {   margin-right:30px;  } } .main-menu ul li:last-child {  margin-right:0 !important; } .main-menu ul li:first-child {  margin-left:0 !important; } .main-menu ul li:hover > ul.sub-menu {  visibility:visible;  opacity:1;  transform:scaleY(1);  z-index:9; } .main-menu ul.sub-menu {  display:block !important;  position:absolute;  text-align:left;  top:100%;  left:0;  background-color:var(--white-color);  visibility:hidden;  min-width:220px;  width:max-content;  left:-14px;  opacity:0;  z-index:-1;  border:0;  box-shadow:0px 4px 15px rgba(1, 15, 28, 0.06);  border-radius:0;  transform:scaleY(0);  transform-origin:top center;  transition:all 0.4s ease 0s; } .main-menu ul.sub-menu a {  font-weight:400;  font-family:var(--body-font);  letter-spacing:normal;  line-height:1;  padding:15px 30px;  font-size:16px;  color:var(--dark-color); } .main-menu ul.sub-menu a span {  font-size:12px;  padding:0px 5px;  margin-left:4px;  background-color:var(--theme-color);  color:var(--white-color);  padding:2px 5px;  border-radius:4px;  position:relative;  top:-1px; } .main-menu ul.sub-menu a:hover {  color:var(--theme-color); } .main-menu ul.sub-menu {  left:0px; } .main-menu ul.sub-menu li {  display:block;  margin:0;  border-bottom:1px solid rgba(227, 87, 43, 0.1803921569); } .main-menu ul.sub-menu li:last-child {  border-bottom:none; } .main-menu ul.sub-menu li.active > a {  color:var(--theme-color); } .main-menu ul.sub-menu li:hover > a {  color:var(--white-color); } .main-menu ul.sub-menu li:hover > a::before {  height:100%;  top:0; } .main-menu ul.sub-menu li:active > a {  color:var(--theme-color); } .main-menu ul.sub-menu li a {  position:relative; } .main-menu ul.sub-menu li a::before {  position:absolute;  content:"";  width:100%;  height:0;  left:0;  bottom:0;  background:var(--theme-color);  z-index:-1;  transition:all 0.4s ease 0s; } .main-menu ul.sub-menu li.menu-item-has-children > a::after {  font-family:var(--icon-font);  content:"\f105";  position:absolute;  right:20px;  top:50%;  transform:translateY(-50%);  display:block;  line-height:24px;  font-size:11px;  font-weight:900;  z-index:5; } .main-menu ul.sub-menu li ul.sub-menu {  left:100%;  right:auto;  top:0;  margin:0 0;  margin-left:15px; } .main-menu ul.sub-menu li ul.sub-menu li ul {  left:100%;  right:auto; } .header-right-wrapper {  } @media (max-width:991px) {  .header-right-wrapper {   display:none;  } } .header-right-wrapper .header-right {  display:flex;  align-items:center;  gap:30px; } .header-right-wrapper .header-right .header-btn {  color:var(--dark-color);  font-weight:600;  } @media (max-width:1199px) {  .header-right-wrapper .header-right .header-btn {   display:none;  } } .header-right-wrapper .header-right .header-btn span {  font-size:16px;  color:var(--theme-color);  margin-right:5px; } .header-right-wrapper .header-right .sidebar-icon .sidebar-trigger {  display:inline-block;  width:44px;  height:44px;  line-height:44px;  text-align:center;  border-radius:50%;  background-color:var(--theme-color); } .header-right-wrapper .header-right .sidebar-icon .sidebar-trigger span {  color:var(--white-color); } .header-links > ul {  margin:0;  padding:0;  list-style-type:none;  display:flex;  align-items:center; } .header-links li {  display:inline-block;  position:relative;  font-size:14px;  font-weight:400; } .header-links li:not(:last-child) {  margin:0 40px 0 0; } .header-links li > i {  margin-right:8px; } .header-links li .header-sub-links li:not(:last-child) {  margin:0 30px 0 0; } .header-links li .header-sub-links li:not(:last-child):before {  content:"/";  position:absolute;  right:-20px;  top:0;  color:var(--dark-color); } .header-links li, .header-links span, .header-links p, .header-links a {  color:var(--dark-color);  font-family:var(--body-font);  display:inline-flex;  align-items:center; } .header-links a:hover {  color:var(--theme-color); } .header-links b, .header-links strong {  font-weight:600;  margin-right:6px; } .header-links ul {  list-style:none;  padding:0;  margin:0; }  .page-id-14 .main-mega-menu .mega-menu a {  color:var(--theme-color); } .mobile-menu-area .mega-menu, .sticky-header .mega-menu {  display:none; } .main-mega-menu > #menu-item-915 {  display:none;  } @media (max-width:991px) {  .main-mega-menu > #menu-item-915 {   display:block;  } } .tv-mega-menu {  display:block;  position:absolute;  left:0;  right:0;  top:100px;  width:100%;  background:var(--white-color);  padding:50px 50px;  box-shadow:0px 20px 30px rgba(1, 15, 28, 0.1);  opacity:0;  visibility:hidden;  transition:0.3s;  top:100%;  transform:scale(1, 0);  transform-origin:top;  border-radius:20px;  margin:auto;  } @media (max-width:991px) {  .tv-mega-menu {   width:auto;   opacity:1;   visibility:visible;   transition:none;   position:static;   display:none;   transform:scale(1);   padding:30px 20px;  } } .tv-home-thumb {  position:relative;  z-index:1;  text-align:center; } .tv-home-thumb img {  height:350px;  width:100%;  border-radius:20px;  object-fit:cover;  } @media (max-width:991px) {  .tv-home-thumb img {   object-fit:contain;   height:100%;  } } .tv-home-thumb .img1 a {  padding:0 !important;  position:relative;  z-index:1;  overflow:hidden; } .tv-home-thumb .img1 a::after {  position:absolute;  content:"";  height:100%;  width:100%;  left:0;  transition:all 0.4s;  top:0;  background:var(--bs-bg-color1);  border-radius:20px;  transform:scale(0.5);  visibility:hidden;  opacity:0; } .tv-home-thumb a {  display:inline-flex;  padding-top:15px;  color:var(--dark-color) !important; } .tv-home-thumb a:hover {  color:var(--theme-color) !important; } .tv-home-thumb:hover .img1 a::after {  transform:scale(1);  transition:all 0.4s;  visibility:visible;  opacity:0.5; } .main-menu ul li:hover > .tv-mega-menu {  opacity:1;  visibility:visible;  transition:0.3s;  top:100%;  transform:scale(1); } .sidebar-btn {  background:transparent;  position:relative;  height:60px;  width:60px;  border:2px solid var(--dark-color);  border-radius:50%;  text-align:center;  line-height:54px;  padding:0;  } @media (max-width:991px) {  .sidebar-btn {   background:var(--light-color);  } } .sidebar-btn .line {  display:block;  height:2px;  width:18px;  background:var(--dark-color);  margin:auto;  transition:0.4s; } .sidebar-btn .line:not(:last-child) {  margin-bottom:4px; } .sidebar-btn:hover .line:nth-child(2) {  width:10px; }  @media (max-width:575px) {  .sidebar-btn {   height:50px;   width:50px;  } } .header-style2 {  position:relative; } .header-style2 .header-top {  margin:0;  padding:0 60px;  background-color:var(--dark-color);  position:relative;  border-bottom:1px solid var(--bs-border-color) !important; } @media (max-width:1399px) {  .header-style2 .header-top {   padding:0 24px;  } } @media (max-width:991px) {  .header-style2 .header-top {   display:none;  } } .header-style2 .header-top::before {  content:"";  position:absolute;  z-index:1;  left:50%;  transform:translateX(-50%);  bottom:-6px;  width:12px;  height:12px;  border-radius:6px;  background-color:var(--dark-color);  border:1px solid rgba(255, 255, 255, 0.2); } .header-style2 .header-top .inner-container {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:space-between;  background:var(--dark-color);  width:100%; } .header-style2 .header-top .top-left {  display:flex;  align-items:center; } .header-style2 .header-top .outer-box {  min-width:315px;  position:relative;  z-index:1; } .header-style2 .header-top .list-style-1 {  position:relative;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:start;  padding:11px 0; } .header-style2 .header-top .list-style-1 li {  font-size:14px;  color:var(--gray-color2);  padding-left:0; } .header-style2 .header-top .list-style-1 li + li {  margin-left:35px; } .header-style2 .header-top .list-style-1 li svg {  width:15px;  fill:var(--theme-color2);  margin-right:5px; } .header-style2 .header-top .list-style-1 li a {  color:var(--gray-color2); } .header-style2 .header-top .list-style-1 li a:hover {  color:var(--white-color); } .header-style2 .header-top .list-style-1 li .icon {  color:var(--theme-color2);  margin-right:10px; } .header-style2 .social-icon-one {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:end;  flex-wrap:wrap; } .header-style2 .social-icon-one li a {  color:var(--white-color);  font-size:14px; } .header-style2 .social-icon-one li a:hover {  color:var(--theme-color); } .header-style2 .social-icon-one li + li + li a {  margin-left:20px; } .header-style2 .social-icon-one .menu-follow_title {  color:var(--gray-color2);  font-size:14px;  text-transform:uppercase;  margin-right:15px; } .header-style2 .main-wrapper {  padding:0 60px;  background-color:var(--dark-color); } @media (max-width:1399px) {  .header-style2 .main-wrapper {   padding:0 24px;  } } @media (max-width:991px) {  .header-style2 .main-wrapper {   background-color:var(--light-color);   padding:0 12px;  } } .header-style2 .main-wrapper .menu-area {  margin-top:0;  border-radius:0;  background-color:var(--dark-color);  padding-right:0;  } @media (max-width:991px) {  .header-style2 .main-wrapper .menu-area {   background-color:var(--light-color);   padding-right:20px;  }  .header-style2 .main-wrapper .menu-area > .row {   flex-direction:row-reverse;  } } .header-style2 .main-wrapper .nav-menu {  flex:1;  } @media (max-width:991px) {  .header-style2 .main-wrapper .nav-menu {   flex:0;  } } .header-style2 .main-wrapper .nav-menu .main-menu > ul > li {  padding:10px 0; } .header-style2 .main-wrapper .nav-menu .main-menu > ul > li.active > a {  color:var(--theme-color); } .header-style2 .main-wrapper .nav-menu .main-menu > ul > li > a {  color:var(--white-color); } .header-style2 .main-wrapper .nav-menu .main-menu > ul > li > a:hover {  color:var(--theme-color); } .header-style2 .main-wrapper .nav-menu .main-menu > ul > li.menu-item-has-children > a::before {  opacity:0.4; } .header-style2 .main-wrapper .nav-menu .main-menu > ul > li.menu-item-has-children > a:hover::before {  opacity:1; } .header-style2 .main-wrapper .nav-menu .main-menu > ul > li.active > a::before {  opacity:1; } .header-style2 .main-wrapper .nav-menu .main-menu ul.sub-menu li a {  color:var(--dark-color); } .header-style2 .main-wrapper .nav-menu .main-menu ul.sub-menu li.active a {  color:var(--theme-color); } .header-style2 .main-wrapper .nav-menu .main-menu ul.sub-menu li:hover a {  color:var(--white-color); } .header-style2 .main-wrapper .nav-menu .main-menu ul.sub-menu li ul.sub-menu li a {  color:var(--dark-color); } .header-style2 .main-wrapper .nav-menu .main-menu ul.sub-menu li ul.sub-menu li:hover a {  color:var(--white-color); } .header-style2 .main-wrapper .logo {  flex:0 0 auto; } .header-style2 .main-wrapper .header-right-wrapper {  flex:1;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-end; } @media (max-width:1024px) {  .header-style2 .main-wrapper .header-right-wrapper {   display:none;  } } .header-style2 .main-wrapper .header-right-wrapper .header-right .header-btn {  color:var(--white-color);  margin-right:10px; } .header-style2 .header-sticky .main-wrapper {  box-shadow:0 0 20px var(--white-color); } .header-style2 .header-sticky .main-wrapper .nav-menu .main-menu > ul > li {  padding:0; } .header-right {  gap:20px; } .header-right .search-btn {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:36px;  height:36px;  border-radius:50%;  background-color:var(--dark-color);  border:1px solid rgba(255, 255, 255, 0.2);  font-size:14px;  color:var(--gray-color2); } .header-right .search-btn:hover {  color:var(--white-color); } .header-right .header-btn {  color:var(--white-color);  margin-right:10px; }  .header-style3 {  position:relative; } .header-style3 .main-wrapper {  padding:0 60px;  background-color:var(--dark-color); } @media (max-width:1399px) {  .header-style3 .main-wrapper {   padding:0 24px;  } } @media (max-width:991px) {  .header-style3 .main-wrapper {   background-color:var(--light-color);   padding:0 12px;  } } .header-style3 .main-wrapper .menu-area {  margin-top:0;  border-radius:0;  background-color:var(--dark-color);  padding:0;  } @media (max-width:991px) {  .header-style3 .main-wrapper .menu-area {   background-color:var(--light-color);  } } .header-style3 .main-wrapper .logo {  flex:1; } .header-style3 .main-wrapper .nav-menu {  flex:0 0 auto; } .header-style3 .main-wrapper .nav-menu .main-menu > ul > li {  padding:10px 0; } .header-style3 .main-wrapper .nav-menu .main-menu > ul > li.active > a {  color:var(--theme-color); } .header-style3 .main-wrapper .nav-menu .main-menu > ul > li > a {  color:var(--white-color); } .header-style3 .main-wrapper .nav-menu .main-menu > ul > li > a:hover {  color:var(--theme-color); } .header-style3 .main-wrapper .nav-menu .main-menu > ul > li.menu-item-has-children > a::before {  opacity:0.4; } .header-style3 .main-wrapper .nav-menu .main-menu > ul > li.menu-item-has-children > a:hover::before {  opacity:1; } .header-style3 .main-wrapper .nav-menu .main-menu > ul > li.active > a::before {  opacity:1; } .header-style3 .main-wrapper .nav-menu .main-menu ul.sub-menu li a {  color:var(--dark-color); } .header-style3 .main-wrapper .nav-menu .main-menu ul.sub-menu li.active a {  color:var(--theme-color); } .header-style3 .main-wrapper .nav-menu .main-menu ul.sub-menu li:hover a {  color:var(--white-color); } .header-style3 .main-wrapper .nav-menu .main-menu ul.sub-menu li ul.sub-menu li a {  color:var(--dark-color); } .header-style3 .main-wrapper .nav-menu .main-menu ul.sub-menu li ul.sub-menu li:hover a {  color:var(--white-color); } .header-style3 .main-wrapper .header-right-wrapper {  flex:1;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-end; } @media (max-width:1024px) {  .header-style3 .main-wrapper .header-right-wrapper {   display:none;  } } .header-style3 .main-wrapper .header-right-wrapper .header-right {  gap:20px; } .header-style3 .header-sticky .main-wrapper {  box-shadow:0 0 20px var(--white-color); } .header-style3 .header-sticky .main-wrapper .nav-menu .main-menu > ul > li {  padding:0; }  .header-style4 {  } @media (max-width:991px) {  .header-style4 {   position:relative;  } } .header-style4 .header-top {  margin:0;  padding:0 60px;  background-color:transparent;  position:relative;  border-bottom:1px solid var(--bs-border-color) !important; } @media (max-width:1399px) {  .header-style4 .header-top {   padding:0 24px;  } } @media (max-width:991px) {  .header-style4 .header-top {   display:none;  } } .header-style4 .header-top .inner-container {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:space-between;  background:transparent;  width:100%; } .header-style4 .header-top .top-left {  display:flex;  align-items:center; } .header-style4 .header-top .outer-box {  min-width:315px;  position:relative;  z-index:1; } .header-style4 .header-top .list-style-1 {  position:relative;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:start;  padding:11px 0; } .header-style4 .header-top .list-style-1 li {  font-size:14px;  color:var(--gray-color2);  padding-left:0; } .header-style4 .header-top .list-style-1 li + li {  margin-left:35px; } .header-style4 .header-top .list-style-1 li svg {  width:15px;  fill:var(--theme-color2);  margin-right:5px; } .header-style4 .header-top .list-style-1 li a {  color:var(--gray-color2); } .header-style4 .header-top .list-style-1 li a:hover {  color:var(--white-color); } .header-style4 .header-top .list-style-1 li .icon {  color:var(--theme-color2);  margin-right:10px; } .header-style4 .social-icon-one {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:end;  flex-wrap:wrap; } .header-style4 .social-icon-one li a {  color:var(--white-color);  font-size:14px; } .header-style4 .social-icon-one li a:hover {  color:var(--theme-color); } .header-style4 .social-icon-one li + li + li a {  margin-left:20px; } .header-style4 .social-icon-one .menu-follow_title {  color:var(--gray-color2);  font-size:14px;  text-transform:uppercase;  margin-right:15px; } .header-style4 .main-wrapper {  padding:0 60px;  background-color:transparent;  position:relative;  border-bottom:1px solid var(--bs-border-color) !important;  } @media (max-width:991px) {  .header-style4 .main-wrapper {   border:none;  } } @media (max-width:1399px) {  .header-style4 .main-wrapper {   padding:0 24px;  } } @media (max-width:991px) {  .header-style4 .main-wrapper {   background-color:var(--light-color);   padding:0 12px;  } } .header-style4 .main-wrapper .menu-area {  margin-top:0;  border-radius:0;  background-color:transparent;  padding:0;  } @media (max-width:991px) {  .header-style4 .main-wrapper .menu-area {   background-color:var(--light-color);  } } .header-style4 .main-wrapper .logo {  flex:1; } .header-style4 .main-wrapper .nav-menu {  flex:0 0 auto; } .header-style4 .main-wrapper .nav-menu .main-menu > ul > li {  padding:10px 0; } .header-style4 .main-wrapper .nav-menu .main-menu > ul > li.current-menu-ancestor > a, .header-style4 .main-wrapper .nav-menu .main-menu > ul > li.active > a {  color:var(--theme-color); } .header-style4 .main-wrapper .nav-menu .main-menu > ul > li > a {  color:var(--white-color); } .header-style4 .main-wrapper .nav-menu .main-menu > ul > li > a:hover {  color:var(--theme-color); } .header-style4 .main-wrapper .nav-menu .main-menu > ul > li.current-menu-ancestor > a::before, .header-style4 .main-wrapper .nav-menu .main-menu > ul > li.menu-item-has-children > a::before {  opacity:0.4; } .header-style4 .main-wrapper .nav-menu .main-menu > ul > li.current-menu-ancestor > a:hover::before, .header-style4 .main-wrapper .nav-menu .main-menu > ul > li.menu-item-has-children > a:hover::before {  opacity:1; } .header-style4 .main-wrapper .nav-menu .main-menu > ul > li.active > a::before {  opacity:1; } .header-style4 .main-wrapper .nav-menu .main-menu ul.sub-menu li a {  color:var(--dark-color); } .header-style4 .main-wrapper .nav-menu .main-menu ul.sub-menu li.active a {  color:var(--theme-color); } .header-style4 .main-wrapper .nav-menu .main-menu ul.sub-menu li:hover a {  color:var(--white-color); } .header-style4 .main-wrapper .nav-menu .main-menu ul.sub-menu li ul.sub-menu li.active a {  color:var(--theme-color); } .header-style4 .main-wrapper .nav-menu .main-menu ul.sub-menu li ul.sub-menu li a {  color:var(--dark-color); } .header-style4 .main-wrapper .nav-menu .main-menu ul.sub-menu li ul.sub-menu li:hover a {  color:var(--white-color); } .header-style4 .main-wrapper .header-right-wrapper {  flex:1;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-end; } @media (max-width:1024px) {  .header-style4 .main-wrapper .header-right-wrapper {   display:none;  } } .header-style4 .main-wrapper .header-right-wrapper .header-right {  gap:20px; } .header-style4 .main-wrapper .header-right-wrapper .header-right .search-btn {  background-color:transparent;  border:1px solid var(--bs-border-color2);  color:var(--gray-color2); } .header-style4 .main-wrapper .header-right-wrapper .header-right .search-btn:hover {  color:var(--white-color); } .header-style4 .main-wrapper .header-right-wrapper .header-right .theme-btn {  padding:13px 40px; } .header-style4 .header-sticky .main-wrapper {  background:var(--dark-color);  box-shadow:0 0 20px var(--white-color);  } @media (max-width:991px) {  .header-style4 .header-sticky .main-wrapper {   background:var(--light-color);  } } .header-style4 .header-sticky .main-wrapper .nav-menu .main-menu > ul > li {  padding:0; } .elementor-editor-active .header-style4 .header-top {  background-color:var(--dark-color); }  .header-style5 {  position:relative; } .header-style5 .main-wrapper {  background-color:var(--white-color);  } @media (min-width:992px) and (max-width:1024px) {  .header-style5 .main-wrapper {   padding:0 24px;  } } @media (max-width:991px) {  .header-style5 .main-wrapper {   background-color:var(--light-color);   padding:0 12px;  } } .header-style5 .main-wrapper .menu-area {  margin-top:0;  border-radius:0;  background-color:var(--white-color);  padding:0;  box-shadow:none;  } @media (max-width:991px) {  .header-style5 .main-wrapper .menu-area {   background-color:var(--light-color);  } } .header-style5 .main-wrapper .logo {  flex:inherit;  min-width:250px;  } @media (max-width:1299px) {  .header-style5 .main-wrapper .logo {   min-width:240px;  } } .header-style5 .main-wrapper .nav-menu {  flex:0 0 auto; } .header-style5 .main-wrapper .nav-menu .main-menu > ul > li {  padding:10px 0; } .header-style5 .main-wrapper .nav-menu .main-menu > ul > li.active > a {  color:var(--theme-color); } .header-style5 .main-wrapper .nav-menu .main-menu > ul > li > a {  color:var(--dark-color); } .header-style5 .main-wrapper .nav-menu .main-menu > ul > li > a:hover {  color:var(--theme-color); } .header-style5 .main-wrapper .nav-menu .main-menu > ul > li.menu-item-has-children > a::before {  opacity:0.4; } .header-style5 .main-wrapper .nav-menu .main-menu > ul > li.menu-item-has-children > a:hover::before {  opacity:1; } .header-style5 .main-wrapper .nav-menu .main-menu > ul > li.active > a::before {  opacity:1; } .header-style5 .main-wrapper .nav-menu .main-menu ul.sub-menu li a {  color:var(--dark-color); } .header-style5 .main-wrapper .nav-menu .main-menu ul.sub-menu li.active a {  color:var(--theme-color); } .header-style5 .main-wrapper .nav-menu .main-menu ul.sub-menu li:hover a {  color:var(--white-color); } .header-style5 .main-wrapper .nav-menu .main-menu ul.sub-menu li ul.sub-menu li a {  color:var(--dark-color); } .header-style5 .main-wrapper .nav-menu .main-menu ul.sub-menu li ul.sub-menu li:hover a {  color:var(--white-color); } .header-style5 .main-wrapper .header-right-wrapper {  flex:1;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-end; } @media (max-width:1024px) {  .header-style5 .main-wrapper .header-right-wrapper {   display:none;  } } .header-style5 .main-wrapper .header-right-wrapper .header-right {  gap:20px;  } @media (max-width:1500px) {  .header-style5 .main-wrapper .header-right-wrapper .header-right .header-btn {   display:none;  } } .header-style5 .main-wrapper .header-right-wrapper .header-right .search-btn {  background-color:var(--white-color);  border:1px solid var(--bs-border-color12);  color:var(--dark-color); } .header-style5 .main-wrapper .header-right-wrapper .header-right .search-btn:hover {  color:var(--theme-color); } .header-style5 .main-wrapper .header-right-wrapper .header-right .theme-btn {  padding:13px 40px; } .header-style5 .header-sticky .main-wrapper {  box-shadow:0 0 20px var(--white-color); } .header-style5 .header-sticky .main-wrapper .nav-menu .main-menu > ul > li {  padding:0; }  .header-style6 {  position:relative; } .header-style6 .header-top {  margin:0;  padding:0 50px;  background-color:transparent;  background:var(--dark-color); } @media (max-width:1399px) {  .header-style6 .header-top {   padding:0 24px;  } } @media (max-width:991px) {  .header-style6 .header-top {   display:none;  } } .header-style6 .header-top .inner-container {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:space-between;  background:transparent;  width:100%; } .header-style6 .header-top .top-left {  display:flex;  align-items:center; } .header-style6 .header-top .outer-box {  min-width:315px;  position:relative;  z-index:1; } .header-style6 .header-top .list-style-1 {  position:relative;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:start;  padding:17px 0; } .header-style6 .header-top .list-style-1 li {  font-size:14px;  color:var(--gray-color2);  padding-left:0; } .header-style6 .header-top .list-style-1 li + li {  margin-left:35px; } .header-style6 .header-top .list-style-1 li a {  color:var(--gray-color2); } .header-style6 .header-top .list-style-1 li a:hover {  color:var(--white-color); } .header-style6 .header-top .list-style-1 li .icon {  color:var(--theme-color2);  margin-right:10px; } .header-style6 .social-icon-one {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:end;  flex-wrap:wrap; } .header-style6 .social-icon-one li a {  color:var(--gray-color2);  font-size:14px; } .header-style6 .social-icon-one li a:hover {  color:var(--theme-color2); } .header-style6 .social-icon-one li + li + li a {  margin-left:20px; } .header-style6 .social-icon-one .menu-follow_title {  color:var(--gray-color2);  font-size:14px;  text-transform:uppercase;  margin-right:15px; } .header-style6 .main-wrapper {  background-color:var(--theme-color3);  border-bottom:1px solid var(--bs-border-color10);  padding:0 50px;  } @media (min-width:992px) and (max-width:1024px) {  .header-style6 .main-wrapper {   padding:0 24px;  } } @media (max-width:991px) {  .header-style6 .main-wrapper {   background-color:var(--light-color);   padding:0 12px;  } } .header-style6 .main-wrapper .menu-area {  margin-top:0;  border-radius:0;  background-color:transparent;  padding:0;  box-shadow:none;  } @media (max-width:991px) {  .header-style6 .main-wrapper .menu-area {   background-color:var(--light-color);  } } .header-style6 .main-wrapper .logo {  flex:inherit;  min-width:250px;  } @media (max-width:1299px) {  .header-style6 .main-wrapper .logo {   min-width:240px;  } } .header-style6 .main-wrapper .nav-menu {  flex:0 0 auto; } .header-style6 .main-wrapper .nav-menu .main-menu > ul > li {  padding:10px 0; } .header-style6 .main-wrapper .nav-menu .main-menu > ul > li.active > a {  color:var(--theme-color); } .header-style6 .main-wrapper .nav-menu .main-menu > ul > li > a {  color:var(--dark-color); } .header-style6 .main-wrapper .nav-menu .main-menu > ul > li > a:hover {  color:var(--theme-color); } .header-style6 .main-wrapper .nav-menu .main-menu > ul > li.menu-item-has-children > a::before {  opacity:0.4; } .header-style6 .main-wrapper .nav-menu .main-menu > ul > li.menu-item-has-children > a:hover::before {  opacity:1; } .header-style6 .main-wrapper .nav-menu .main-menu > ul > li.active > a::before {  opacity:1; } .header-style6 .main-wrapper .nav-menu .main-menu ul.sub-menu li a {  color:var(--dark-color); } .header-style6 .main-wrapper .nav-menu .main-menu ul.sub-menu li.active a {  color:var(--theme-color); } .header-style6 .main-wrapper .nav-menu .main-menu ul.sub-menu li:hover a {  color:var(--white-color); } .header-style6 .main-wrapper .nav-menu .main-menu ul.sub-menu li ul.sub-menu li a {  color:var(--dark-color); } .header-style6 .main-wrapper .nav-menu .main-menu ul.sub-menu li ul.sub-menu li:hover a {  color:var(--white-color); } .header-style6 .main-wrapper .header-right-wrapper {  flex:1;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-end; } @media (max-width:1024px) {  .header-style6 .main-wrapper .header-right-wrapper {   display:none;  } } .header-style6 .main-wrapper .header-right-wrapper .header-right {  gap:20px;  } @media (max-width:1500px) {  .header-style6 .main-wrapper .header-right-wrapper .header-right .header-btn {   display:none;  } } .header-style6 .main-wrapper .header-right-wrapper .header-right .search-btn {  background-color:transparent;  border:1px solid var(--bs-border-color12);  color:var(--dark-color); } .header-style6 .main-wrapper .header-right-wrapper .header-right .search-btn:hover {  color:var(--theme-color); } .header-style6 .main-wrapper .header-right-wrapper .header-right .theme-btn {  padding:13px 40px; } .header-style6 .header-sticky .main-wrapper {  box-shadow:0 0 20px var(--white-color); } .header-style6 .header-sticky .main-wrapper .nav-menu .main-menu > ul > li {  padding:0; } .dark-mode .header-style6 .main-wrapper {  border-top:1px solid var(--bs-border-color);  border-bottom:1px solid var(--bs-border-color);  background-color:var(--dark-color); } .dark-mode .header-style6 .main-wrapper .menu-area .main-menu > ul > li {  padding:10px 0; } .dark-mode .header-style6 .main-wrapper .menu-area .main-menu > ul > li.active > a {  color:var(--theme-color); } .dark-mode .header-style6 .main-wrapper .menu-area .main-menu > ul > li > a {  color:var(--white-color); } .dark-mode .header-style6 .main-wrapper .menu-area .main-menu > ul > li > a:hover {  color:var(--theme-color); } .dark-mode .header-style6 .main-wrapper .menu-area .main-menu > ul > li.menu-item-has-children > a::before {  opacity:0.4; } .dark-mode .header-style6 .main-wrapper .menu-area .main-menu > ul > li.menu-item-has-children > a:hover::before {  opacity:1; } .dark-mode .header-style6 .main-wrapper .menu-area .main-menu > ul > li.active > a::before {  opacity:1; } .dark-mode .header-style6 .main-wrapper .menu-area .main-menu ul.sub-menu li a {  color:var(--dark-color); } .dark-mode .header-style6 .main-wrapper .menu-area .main-menu ul.sub-menu li.active a {  color:var(--theme-color); } .dark-mode .header-style6 .main-wrapper .menu-area .main-menu ul.sub-menu li:hover a {  color:var(--white-color); } .dark-mode .header-style6 .main-wrapper .menu-area .main-menu ul.sub-menu li ul.sub-menu li a {  color:var(--dark-color); } .dark-mode .header-style6 .main-wrapper .menu-area .main-menu ul.sub-menu li ul.sub-menu li:hover a {  color:var(--white-color); } .dark-mode .header-style6 .main-wrapper .header-right-wrapper .header-right a {  color:var(--white-color); }  .header-style7 {  position:absolute; } .header-style7 .header-top {  margin:0;  padding:0 50px;  background-color:transparent;  background:var(--dark-color); } @media (max-width:1399px) {  .header-style7 .header-top {   padding:0 24px;  } } @media (max-width:991px) {  .header-style7 .header-top {   display:none;  } } .header-style7 .header-top .inner-container {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:space-between;  background:transparent;  width:100%; } .header-style7 .header-top .top-left {  display:flex;  align-items:center; } .header-style7 .header-top .outer-box {  min-width:315px;  position:relative;  z-index:1; } .header-style7 .header-top .list-style-1 {  position:relative;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:start;  padding:17px 0; } .header-style7 .header-top .list-style-1 li {  font-size:14px;  color:var(--gray-color2);  padding-left:0; } .header-style7 .header-top .list-style-1 li + li {  margin-left:35px; } .header-style7 .header-top .list-style-1 li a {  color:var(--gray-color2); } .header-style7 .header-top .list-style-1 li a:hover {  color:var(--white-color); } .header-style7 .header-top .list-style-1 li .icon {  color:var(--theme-color2);  margin-right:10px; } .header-style7 .social-icon-one {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:end;  flex-wrap:wrap; } .header-style7 .social-icon-one li a {  color:var(--gray-color2);  font-size:14px; } .header-style7 .social-icon-one li a:hover {  color:var(--theme-color2); } .header-style7 .social-icon-one li + li + li a {  margin-left:20px; } .header-style7 .social-icon-one .menu-follow_title {  color:var(--gray-color2);  font-size:14px;  text-transform:uppercase;  margin-right:15px; } .header-style7 .main-wrapper {  background-color:transparent;  border-bottom:1px solid var(--bs-border-color);  padding:0 40px;  margin:30px 30px 0; } @media (max-width:1199px) {  .header-style7 .main-wrapper {   margin:0;  } } @media (min-width:992px) and (max-width:1024px) {  .header-style7 .main-wrapper {   padding:0 24px;   margin:0;  } } @media (max-width:991px) {  .header-style7 .main-wrapper {   background-color:var(--light-color);   padding:0 12px;   margin:0;  } } .header-style7 .main-wrapper .menu-area {  margin-top:0;  border-radius:0;  background-color:transparent;  padding:0;  box-shadow:none;  } @media (max-width:991px) {  .header-style7 .main-wrapper .menu-area {   background-color:var(--light-color);  } } .header-style7 .main-wrapper .logo {  flex:inherit;  min-width:250px;  } @media (max-width:1299px) {  .header-style7 .main-wrapper .logo {   min-width:240px;  } } .header-style7 .main-wrapper .nav-menu {  flex:0 0 auto; } .header-style7 .main-wrapper .nav-menu .main-menu > ul > li {  padding:10px 0; } .header-style7 .main-wrapper .nav-menu .main-menu > ul > li.active > a {  color:var(--theme-color); } .header-style7 .main-wrapper .nav-menu .main-menu > ul > li > a {  color:var(--white-color); } .header-style7 .main-wrapper .nav-menu .main-menu > ul > li > a:hover {  color:var(--theme-color); } .header-style7 .main-wrapper .nav-menu .main-menu > ul > li.menu-item-has-children > a::before {  opacity:0.4; } .header-style7 .main-wrapper .nav-menu .main-menu > ul > li.menu-item-has-children > a:hover::before {  opacity:1; } .header-style7 .main-wrapper .nav-menu .main-menu > ul > li.active > a::before {  opacity:1; } .header-style7 .main-wrapper .nav-menu .main-menu ul.sub-menu li a {  color:var(--dark-color); } .header-style7 .main-wrapper .nav-menu .main-menu ul.sub-menu li.active a {  color:var(--theme-color); } .header-style7 .main-wrapper .nav-menu .main-menu ul.sub-menu li:hover a {  color:var(--white-color); } .header-style7 .main-wrapper .nav-menu .main-menu ul.sub-menu li ul.sub-menu li a {  color:var(--dark-color); } .header-style7 .main-wrapper .nav-menu .main-menu ul.sub-menu li ul.sub-menu li:hover a {  color:var(--white-color); } .header-style7 .main-wrapper .header-right-wrapper {  flex:1;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-end; } @media (max-width:1024px) {  .header-style7 .main-wrapper .header-right-wrapper {   display:none;  } } .header-style7 .main-wrapper .header-right-wrapper .header-right {  gap:20px;  } @media (max-width:1500px) {  .header-style7 .main-wrapper .header-right-wrapper .header-right .header-btn {   display:none;  } } .header-style7 .main-wrapper .header-right-wrapper .header-right .search-btn {  background-color:var(--bs-border-color13);  border:inherit;  color:var(--white-color);  height:44px;  width:44px; } .header-style7 .main-wrapper .header-right-wrapper .header-right .search-btn:hover {  color:var(--theme-color); } .header-style7 .main-wrapper .header-right-wrapper .header-right .theme-btn {  padding:13px 40px; } .header-style7 .header-sticky .main-wrapper {  box-shadow:0 0 20px var(--white-color); } .header-style7 .header-sticky .main-wrapper .nav-menu .main-menu > ul > li {  padding:0; }  .footer-section {  overflow:hidden; } .footer-section .footer-brand {  position:relative;  display:flex;  flex-direction:column;  justify-content:space-between;  } @media (max-width:767px) {  .footer-section .footer-brand {   margin-bottom:47px;  } } .footer-section .footer-brand::before {  position:absolute;  content:"";  top:-100%;  right:0;  width:1px;  height:100rem;  background-color:var(--bs-border-color); } @media (max-width:1024px) {  .footer-section .footer-brand::before {   right:40px;  } } @media (max-width:912px) {  .footer-section .footer-brand::before {   display:none;  } } .footer-section .footer-brand .text {  color:var(--gray-color2); } .footer-section .footer-social {  line-height:1; } .footer-section .footer-social .social-link {  font-size:16px;  line-height:1.66;  color:var(--white-color);  font-weight:500;  margin-right:14px; } .footer-section .footer-social .social-link:hover {  color:var(--theme-color2); } .footer-section .footer-bottom {  border-top:1px solid var(--bs-border-color);  padding:23px 0;  background-color:var(--dark-color);  position:relative;  overflow:hidden;  } @media (max-width:767px) {  .footer-section .footer-bottom {   text-align:center;  } } .footer-section .footer-bottom p {  color:var(--gray-color2);  font-size:15px;  line-height:1.66;  margin:0;  } @media (max-width:767px) {  .footer-section .footer-bottom p {   color:var(--white-color);  } } .footer-section .footer-bottom p a {  color:var(--theme-color2); } .footer-section .footer-bottom p a:hover {  color:var(--theme-color); } .footer-section .footer-bottom .footer-policy a {  color:var(--gray-color2);  font-size:15px;  line-height:1.66;  margin-right:15px;  position:relative;  } @media (max-width:767px) {  .footer-section .footer-bottom .footer-policy a {   color:var(--white-color);  } } .footer-section .footer-bottom .footer-policy a:hover {  color:var(--theme-color); } .footer-section .footer-bottom .footer-policy a:last-child {  margin-right:0; } .footer-section .footer-bottom .footer-policy a + a::before {  position:absolute;  content:"";  left:-10px;  top:50%;  transform:translateY(-50%);  width:2px;  height:15px;  background:var(--gray-color2); }  .footer-section.style-2 {  } @media (max-width:991px) {  .footer-section.style-2.br_bl-30.br_br-30 {   border-radius:0 !important;  } } .footer-section.style-2 .footer-widget .big-title {  font-size:47px;  line-height:1.2;  color:var(--white-color);  margin-bottom:38px; } @media (max-width:1399px) {  .footer-section.style-2 .footer-widget .big-title {   font-size:40px;  } } @media (max-width:767px) {  .footer-section.style-2 .footer-widget .big-title {   font-size:32px;  } } .footer-section.style-2 .footer-widget.social .hello-title {  font-size:24px;  color:var(--white-color);  font-weight:500;  margin-bottom:21px; } .footer-section.style-2 .footer-widget.social p + p {  margin-top:17px;  margin-bottom:0; } .footer-section.style-2 .footer-widget.social p a {  color:var(--white-color); } .footer-section.style-2 .footer-widget.social p a.number {  font-size:20px;  line-height:26px;  font-weight:500; } .footer-section.style-2 .footer-widget.social p a:hover {  color:var(--theme-color2); } .footer-section.style-2 .footer-widget.social hr {  border:none;  border-top:1px solid var(--white-color);  margin:25px 0; } .footer-section.style-2 .footer-widget .social-links {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-start; } .footer-section.style-2 .footer-widget .social-links a {  display:inline-block;  width:40px;  height:40px;  color:var(--white-color);  text-align:center;  line-height:40px;  border-radius:50%;  margin-right:0;  background-color:var(--bs-bg-color12);  overflow:hidden;  position:relative;  z-index:1; } .footer-section.style-2 .footer-widget .social-links a + a {  margin-left:10px; } .footer-section.style-2 .footer-widget .social-links a svg {  width:16px;  height:16px;  fill:var(--white-color);  transition:all 0.4s ease 0s; } .footer-section.style-2 .footer-widget .social-links a.active, .footer-section.style-2 .footer-widget .social-links a:hover {  color:var(--dark-color); } .footer-section.style-2 .footer-widget .social-links a.active svg, .footer-section.style-2 .footer-widget .social-links a:hover svg {  fill:var(--dark-color); } .footer-section.style-2 .footer-widget .social-links a.active::before, .footer-section.style-2 .footer-widget .social-links a:hover::before {  left:0;  width:100%; } .footer-section.style-2 .footer-widget .social-links a::before {  content:"";  position:absolute;  top:0;  right:0;  width:0;  height:100%;  background-color:var(--theme-color2);  z-index:-1;  transition:all 0.4s ease 0s; } .footer-section.style-2 .newsletter-form .form-group input[type=email] {  color:var(--white-color);  background-color:var(--bs-bg-color10); }  .breadcrumb-section {  position:relative;  z-index:2;  background-repeat:no-repeat;  background-position:center;  background-size:cover;  padding:300px 0 150px;  min-height:250px; } @media (max-width:991px) {  .breadcrumb-section {   padding:150px 0;  } } @media (max-width:575px) {  .breadcrumb-section {   padding:100px 0;  } } .breadcrumb-section .bg::before {  position:absolute;  content:"";  left:0;  top:0;  width:100%;  height:100%;  background:var(--bs-bg-color3); } .breadcrumb-section .title-outer {  display:flex;  justify-content:space-between;  align-items:center;  } @media (max-width:575px) {  .breadcrumb-section .title-outer {   flex-direction:column;   text-align:center;   gap:30px;  } } .breadcrumb-section .title-outer .title {  position:relative;  font-size:56px;  color:var(--white-color);  font-weight:600;  margin-bottom:20px; } @media (max-width:767px) {  .breadcrumb-section .title-outer .title {   font-size:46px;  } } @media (max-width:575px) {  .breadcrumb-section .title-outer .title {   font-size:35px;  } } .breadcrumb-section .title-outer .text {  position:relative;  display:flex;  gap:15px;  display:none;  } @media (max-width:767px) {  .breadcrumb-section .title-outer .text {   display:none;  } } @media (max-width:390px) {  .breadcrumb-section .title-outer .text .icon {   display:none;  } } .breadcrumb-section .title-outer .text .icon i {  filter:brightness(0) saturate(100%) invert(91%) sepia(12%) saturate(1224%) hue-rotate(31deg) brightness(104%) contrast(75%); } .breadcrumb-section .title-outer .text p {  font-size:16px;  color:var(--gray-color2);  font-weight:400;  margin:-5px 0 0;  max-width:520px; } @media (max-width:430px) {  .breadcrumb-section .title-outer .text p br {   display:none;  } } .page-breadcrumb {  position:relative;  margin-top:5px; } .page-breadcrumb li {  position:relative;  display:inline-block;  margin-right:7px;  padding-right:46px;  font-size:16px;  color:var(--white-color);  font-weight:500;  text-transform:capitalize; } .page-breadcrumb li:last-child {  color:var(--white-color);  padding-right:0;  margin-right:0; } .page-breadcrumb li:last-child::after {  display:none; } .page-breadcrumb li:after {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  right:0;  width:36px;  height:10px;  background:url(/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/breadcrumb-arrow.png.webp); } .page-breadcrumb li a {  color:var(--white-color);  font-size:16px;  font-weight:500;  text-transform:capitalize;  -webkit-transition:all 300ms ease;  transition:all 300ms ease; } .page-breadcrumb li a:hover {  color:var(--theme-color2); } .page-breadcrumb li:hover:first-child::before {  color:var(--white-color); }  .pagination-menu li {  display:inline-block;  margin-right:8px; } .pagination-menu li a {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:50px;  height:50px;  border-radius:50%;  background-color:var(--white-color);  border:1px solid var(--bs-border-color7);  font-size:18px;  color:var(--dark-color);  font-weight:500;  position:relative;  overflow:hidden;  z-index:1;  transition:all 0.4s ease 0s; } .pagination-menu li a:hover {  color:var(--white-color); } .pagination-menu li a:hover:before {  left:0;  width:100%; } .pagination-menu li a:before {  position:absolute;  content:"";  z-index:-1;  left:50%;  right:0;  width:0;  height:100%;  background:var(--theme-color);  -webkit-transition:all 300ms ease;  transition:all 300ms ease; } .pagination-menu li a.current {  color:var(--white-color); } .pagination-menu li a.current:before {  left:0;  width:100%; }  .error-section {  position:relative;  z-index:1;  height:100vh;  display:flex;  align-items:center;  overflow:hidden;  } .error-section .bg-path__shape::before {  position:absolute;  content:"";  width:150px;  height:150px;  background:#d0eaa7;  transition:all 0.4s ease-in-out;  right:0;  bottom:0;  z-index:-1; } .error-section .bg-path__shape::after {  position:absolute;  content:"";  width:70px;  height:70px;  background:#d0eaa7;  transition:all 0.4s ease-in-out;  right:150px;  bottom:150px;  z-index:-1; } @media (max-width:1500px) {  .error-section .error-thumb { } } @media (max-width:1500px) and (max-width:991px) {  .error-section .error-thumb {   display:none;  } } @media (max-width:1500px) {  .error-section .error-thumb div {   height:100%;  }  .error-section .error-thumb div img {   max-width:95%;   height:100%;   object-fit:cover;   } } @media (max-width:1500px) and (max-width:1399px) {  .error-section .error-thumb div img {   max-width:90%;  } } @media (max-width:1500px) and (max-width:1299px) {  .error-section .error-thumb div img {   max-width:85%;  } } @media (max-width:1500px) and (max-width:1199px) {  .error-section .error-thumb div img {   max-width:70%;  } } @media (max-width:1500px) and (min-width:992px) and (max-width:1024px) {  .error-section .error-thumb div img {   max-width:60%;  } } .error-section .error-inner {  } @media (max-width:991px) {  .error-section .error-inner {   text-align:center;  } } .error-section .error-inner .error {  font-size:150px;  line-height:1;  color:var(--dark-color);  font-weight:600;  margin-bottom:14px; } .error-section .error-inner .error-title {  font-size:46px;  line-height:1;  color:var(--dark-color);  font-weight:500;  margin-bottom:21px;  } @media (max-width:1199px) {  .error-section .error-inner .error-title {   font-size:42px;  } } @media (max-width:430px) {  .error-section .error-inner .error-title {   font-size:32px;  } } .error-section .error-inner .error-description {  font-size:16px;  color:var(--gray-color);  font-weight:400;  margin-bottom:36px; } @media (min-width:992px) and (max-width:1024px) {  .error-section .error-inner .error-description br {   display:none;  } } @media (max-width:767px) {  .error-section .error-inner .error-description br {   display:none;  } } @media (max-width:991px) {  .error-section .error-inner .error-description {   margin:0 auto 36px;  } } .error-section .error-inner .search-form {  display:flex;  justify-content:baseline;  align-items:center;  } @media (max-width:991px) {  .error-section .error-inner .search-form {   justify-content:center;  } } .error-section .error-inner .search-form input {  max-width:504px;  width:100%;  height:60px;  border-radius:30px;  background-color:var(--white-color);  border-top-left-radius:4px;  border-bottom-left-radius:4px;  flex-shrink:0; } @media (max-width:1399px) {  .error-section .error-inner .search-form input {   max-width:400px;  } } @media (max-width:430px) {  .error-section .error-inner .search-form input {   max-width:300px;  } } @media (max-width:375px) {  .error-section .error-inner .search-form input {   max-width:250px;  } } .error-section .error-inner .search-form .search-btn {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:60px;  height:60px;  border-radius:30px;  background-color:var(--theme-color);  font-size:16px;  color:var(--white-color);  flex-shrink:0; } .error-section .error-inner .theme-btn i {  color:var(--theme-color2); }  .hero-section {  position:relative; } .hero-section .hero-img {  overflow:hidden;  } @media (max-width:767px) {  .hero-section .hero-img {   display:none;  } } .hero-section .hero-img img { } @media (max-width:1500px) {  .hero-section .hero-img img {   filter:brightness(70%);  } } @media (max-width:1399px) {  .hero-section .hero-img img {   max-width:700px;   height:752px;   object-fit:cover;  } } @media (max-width:1199px) {  .hero-section .hero-img img {   height:684px;  } } @media (max-width:991px) {  .hero-section .hero-img img {   max-width:690px;   height:auto;  } } .hero-section .hero-scroll {  position:absolute;  left:-4px;  bottom:183px;  transform:rotate(90deg);  z-index:9; } .hero-section .hero-scroll a {  font-size:18px;  color:#fff;  display:flex;  gap:15px; } .hero-info-wrapper {  position:absolute;  bottom:0;  right:0;  max-width:1064px;  width:100%;  display:flex;  align-items:center;  z-index:5; } @media (max-width:1024px) {  .hero-info-wrapper {   max-width:864px;  } } @media (max-width:1399px) {  .hero-info-wrapper {   position:relative;   margin-left:auto;  } } @media (max-width:991px) {  .hero-info-wrapper {   padding:0 12px 80px;  } } .hero-info-wrapper .review-block {  flex:1;  padding:90px 70px;  background-color:var(--dark-color3); }  .hero-social-proof {  display:flex;  align-items:center;  gap:20px; } .hero-social-proof .social {  display:flex;  align-items:center; } .hero-social-proof img {  display:flex;  width:68px;  height:68px;  border-radius:50%;  margin-left:-30px;  background-color:var(--dark-color3);  border:3px solid var(--dark-color); } .hero-social-proof img:first-child {  margin-left:0; } .hero-social-proof .happy-customers .text {  font-size:22px;  font-weight:500;  color:var(--white-color);  margin-bottom:7px; } .hero-social-proof .happy-customers .rating-viewers i {  color:#fdaf08; } .hero-social-proof .happy-customers .rating-viewers .rating {  color:var(--light-color);  font-weight:500; } .hero-social-proof .happy-customers .rating-viewers .count {  color:var(--gray-color2); } .client-count-box {  background-color:var(--theme-color);  padding:32px;  max-width:240px;  text-align:center;  clip-path:polygon(40px 0, 100% 0, 100% 50%, 100% 100%, 0 100%, 0 40px); } .client-count-box .count-box {  display:grid;  place-items:center;  place-content:center;  width:88px;  height:88px;  border-radius:50%;  background-color:var(--theme-color);  border:1px solid rgba(255, 255, 255, 0.5);  margin:auto; } .client-count-box .count-box .inner-count {  display:flex;  justify-content:center;  align-items:center;  font-size:26px;  color:var(--dark-color);  font-weight:700;  width:70px;  height:70px;  line-height:70px;  border-radius:50%;  text-align:center;  background-color:var(--white-color); } .client-count-box .text {  color:var(--white-color);  font-weight:500;  margin:12px 0 6px; } .client-count-box i {  color:var(--white-color);  transform:rotate(45deg);  font-size:20px; } .client-count-box svg {  fill:var(--white-color);  width:22px;  height:auto; } @media (max-width:767px) {  .client-count-box {   padding:20px;   max-width:180px;  } } @media (max-width:575px) {  .client-count-box {   padding:16px;   max-width:150px;  } } .hero-content {  padding:300px 0 190px 0;  position:relative;  z-index:5;  } @media (max-width:991px) {  .hero-content {   padding:80px 0 100px 0;  } } .hero-content .popup-video {  display:inline-block;  margin-bottom:34px; } .hero-content .popup-video .icon {  display:inline-flex;  align-items:center;  justify-content:center;  width:60px;  height:60px;  border-radius:50%;  background-color:transparent;  color:var(--theme-color2);  border:2px solid var(--theme-color2);  margin-right:20px;  transition:all 0.3s ease;  animation:ripple-video 1.5s linear infinite; } .hero-content .popup-video .icon:not(:hover) {  animation:ripple-video 1.5s linear infinite; } .hero-content .popup-video .icon svg {  fill:var(--theme-color2);  width:18px;  height:auto; } .hero-content .popup-video p {  color:var(--light-color2);  font-size:16px;  line-height:24px;  margin-bottom:0; } .hero-content .title {  color:var(--white-color);  font-size:85px;  line-height:1.02;  font-weight:400;  margin-bottom:38px;  letter-spacing:3px; } .hero-content .title span {  font-weight:700; } .hero-content .title br {  display:block; } @media (max-width:991px) {  .hero-content .title {   font-size:60px;  } } @media (max-width:767px) {  .hero-content .title {   font-size:30px;  } } .hero-content .theme-btn svg {  fill:var(--dark-color); } .hero-content .theme-btn svg.style-2 .hero-content .theme-btn svg {  fill:var(--white-color); }  @media (max-width:1399px) {  .hero-content {   padding:230px 0 120px 0;  }  .hero-content .title {   font-size:70px;  } } @media (max-width:1199px) {  .hero-content {   padding:190px 0 80px;  }  .hero-content .title {   font-size:68px;   line-height:1.1;  }  .hero-section .hero-scroll {   display:none;  } } @media (max-width:767px) {  .hero-content {   padding:150px 0 80px;  }  .hero-info-wrapper .review-block {   padding:82px 40px;  }  .client-count-box {   padding:24px;   max-width:200px;  }  .hero-content .popup-video .icon {   width:50px;   height:50px;  } } @media (max-width:575px) {  .hero-info-wrapper {   flex-direction:column;  }  .hero-info-wrapper .review-block {   width:100%;  }  .client-count-box {   max-width:100%;   width:100%;   margin-bottom:30px;  } } @media (max-width:430px) {  .hero-info-wrapper .review-block {   padding:25px 40px;  }  .hero-info-wrapper .review-block .hero-social-proof {   flex-direction:column;   justify-content:center;   text-align:center;  } } @media (max-width:575px) {  .hero-content .title {   font-size:55px;   line-height:1.1;  }  .hero-content .title br {   display:none;  } } @media (max-width:430px) {  .hero-content .title {   font-size:40px;  } } @media (max-width:360px) {  .hero-content .title {   font-size:35px;  } } .hero-section.style-2 {  background-color:var(--dark-color);  } @media (max-width:991px) {  .hero-section.style-2 {   padding:80px 0 0;  } } .hero-section.style-2 .outer-box {  padding:0 48px;  position:relative;  } @media (max-width:1399px) {  .hero-section.style-2 .outer-box {   padding:0 12px;  } } @media (max-width:390px) {  .hero-section.style-2 .outer-box {   padding:0;  } } .hero-section.style-2 .hero-content {  padding:115px 100px;  border-radius:10px;  background-color:var(--theme-color3);  overflow:hidden; } @media (max-width:1500px) {  .hero-section.style-2 .hero-content {   padding:95px 80px;  } } @media (max-width:1399px) {  .hero-section.style-2 .hero-content {   padding:80px 40px;  } } @media (max-width:540px) {  .hero-section.style-2 .hero-content {   padding:80px 30px;  } } @media (max-width:390px) {  .hero-section.style-2 .hero-content {   padding:50px 15px;  } } .hero-section.style-2 .hero-content .popup-video {  margin-bottom:23px; } .hero-section.style-2 .hero-content .popup-video .icon {  color:var(--theme-color);  border:2px solid var(--theme-color); } .hero-section.style-2 .hero-content .popup-video p {  color:var(--dark-color); } .hero-section.style-2 .hero-content .title {  font-size:56px;  line-height:1.18;  color:var(--dark-color);  font-weight:700;  letter-spacing:normal;  margin-bottom:0;  } @media (max-width:1399px) {  .hero-section.style-2 .hero-content .title {   font-size:48px;  } } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-2 .hero-content .title {   font-size:38px;  } } @media (max-width:430px) {  .hero-section.style-2 .hero-content .title {   font-size:36px;  } } @media (max-width:414px) {  .hero-section.style-2 .hero-content .title {   font-size:32px;  } } .hero-section.style-2 .hero-content .title .orange-dot {  display:inline-block;  width:36px;  height:36px;  line-height:36px;  text-align:center;  border-radius:50%;  background-color:var(--theme-color);  position:relative; } @media (max-width:414px) {  .hero-section.style-2 .hero-content .title .orange-dot {   width:30px;   height:30px;   line-height:30px;  } } .hero-section.style-2 .hero-content .title .orange-dot i {  position:absolute;  content:"";  left:50%;  top:50%;  transform:translate(-50%, -50%);  transition:all 0.4s ease 0s; } .hero-section.style-2 .hero-content .border::before {  position:absolute;  content:"";  width:200px;  height:1px;  background:var(--theme-color);  transition:all 0.4s ease-in-out; } .hero-section.style-2 .hero-content .text {  font-size:20px;  line-height:1.5;  color:var(--dark-color);  margin:-3px 0 36px;  } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-2 .hero-content .text {   font-size:16px;  } } @media (max-width:575px) {  .hero-section.style-2 .hero-content .text br {   display:none;  } } @media (max-width:414px) {  .hero-section.style-2 .hero-content .text {   font-size:16px;  } } .hero-section.style-2 .hero-content .since {  position:absolute;  right:40px;  bottom:40px;  padding:3px 20px;  padding-left:40px;  text-align:center;  border-radius:18px;  background-color:var(--white-color);  border:1px solid rgba(3, 31, 23, 0.1); } @media (max-width:414px) {  .hero-section.style-2 .hero-content .since {   right:30px;   bottom:30px;  } } @media (max-width:390px) {  .hero-section.style-2 .hero-content .since {   right:15px;   bottom:10px;  } } .hero-section.style-2 .hero-content .since::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:20px;  width:8px;  height:8px;  border-radius:4px;  background-color:rgba(6, 50, 50, 0.2); } .hero-section.style-2 .hero-content .since span {  font-size:14px;  color:var(--dark-color);  font-weight:500; } .hero-section.style-2 .circle-box {  position:absolute;  content:"";  left:50%;  top:50%;  transform:translate(-50%, -50%);  transition:all 0.4s ease 0s;  z-index:5;  width:184px;  height:184px;  background-color:var(--theme-color2);  margin-top:0;  } @media (max-width:991px) {  .hero-section.style-2 .circle-box {   top:46%;  } } @media (max-width:853px) {  .hero-section.style-2 .circle-box {   top:50%;  } } .hero-section.style-2 .circle-box .logo-box img {  filter:brightness(0) saturate(100%) invert(12%) sepia(97%) saturate(556%) hue-rotate(135deg) brightness(92%) contrast(95%); } .hero-section.style-2 .circle-box .text-inner svg {  width:110px; } .hero-section.style-2 .hero-img {  height:100%;  } @media (max-width:767px) {  .hero-section.style-2 .hero-img {   display:inherit;  } } .hero-section.style-2 .hero-img img {  height:100%;  object-fit:cover; } @media (max-width:1500px) {  .hero-section.style-2 .hero-img img {   filter:brightness(1);  } } @media (max-width:991px) {  .hero-section.style-2 .hero-img img {   max-width:100%;   width:100%;  } } .hero-section.style-2 .hero-info-wrap {  background-color:var(--dark-color);  color:var(--white-color);  } .hero-section.style-2 .hero-info-wrap h4 {  font-size:24px;  line-height:1;  color:var(--white-color);  font-weight:500;  margin-bottom:27px; } .hero-section.style-2 .hero-info-wrap .consulation-form {  position:relative; } .hero-section.style-2 .hero-info-wrap .consulation-form input {  padding:10px 30px;  border:none;  width:100%;  height:60px;  border-radius:5px 0 0 5px;  background-color:var(--bs-border-color); } .hero-section.style-2 .hero-info-wrap .consulation-form button {  border-radius:0 5px 5px 0;  padding:0 25px;  background-color:var(--bs-border-color);  color:var(--theme-color2);  border:none;  position:relative; } .hero-section.style-2 .hero-info-wrap .consulation-form button svg {  width:20px;  fill:var(--theme-color2); } .hero-section.style-2 .hero-info-wrap .consulation-form button::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  width:1px;  height:24px;  background-color:rgba(255, 255, 255, 0.2); } .hero-section.style-2 .hero-info-wrap .consulation-form button i {  font-size:16px; } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-2 .hero-info-wrap .hero-social-proof {   gap:5px;   flex-direction:column;  } } @media (max-width:767px) {  .hero-section.style-2 .hero-info-wrap .hero-social-proof.pl-25 {   padding-left:0 !important;  } } @media (max-width:360px) {  .hero-section.style-2 .hero-info-wrap .hero-social-proof {   gap:5px;  } } .hero-section.style-2 .hero-info-wrap .success-rate-wrapper {  display:flex;  align-items:center;  gap:25px; } @media (max-width:390px) {  .hero-section.style-2 .hero-info-wrap .success-rate-wrapper {   gap:15px;  } } .hero-section.style-2 .hero-info-wrap .success-rate-wrapper .rate-circle {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  flex-shrink:0;  width:107px;  height:107px;  background-color:var(--bs-border-color);  border-radius:50%;  font-size:30px;  color:var(--theme-color2);  font-weight:600; } .hero-section.style-2 .hero-info-wrap .success-rate-wrapper .text {  font-size:16px;  color:var(--gray-color2);  margin-bottom:0; }  @media (max-width:767px) {  .hero-info-wrapper .rate-circle {   width:60px;   height:60px;  }  .hero-info-wrapper .rate-circle span {   font-size:1.25rem;  } } @media (max-width:767px) {  .hero-section.style-2 .content-area {   padding:30px;  }  .hero-section.style-2 .section-title {   font-size:2rem;  } } .hero-section.style-3 {  background-color:var(--dark-color);  } @media (max-width:991px) {  .hero-section.style-3 {   padding:60px 0 0;  } } .hero-section.style-3 .outer-box {  position:relative;  } @media (max-width:1399px) {  .hero-section.style-3 .outer-box {   padding:0 12px;  } } @media (max-width:390px) {  .hero-section.style-3 .outer-box {   padding:0;  } } .hero-section.style-3 .content-area {  position:relative;  z-index:1;  overflow:hidden;  border-radius:30px;  padding:100px 0; } @media (max-width:1199px) {  .hero-section.style-3 .content-area {   padding:80px 0;  } } @media (max-width:375px) {  .hero-section.style-3 .content-area {   padding:60px 0;  } } .hero-section.style-3 .hero-content {  padding:0; } .hero-section.style-3 .hero-content .sub-title {  font-size:18px;  color:var(--dark-color);  font-weight:500;  } @media (max-width:430px) {  .hero-section.style-3 .hero-content .sub-title {   font-size:16px;  } } @media (max-width:375px) {  .hero-section.style-3 .hero-content .sub-title {   flex-direction:column;   align-items:baseline;  } } .hero-section.style-3 .hero-content .title {  font-size:56px;  line-height:1.18;  color:var(--dark-color);  font-weight:700;  letter-spacing:normal;  margin-bottom:0; } @media (max-width:1399px) {  .hero-section.style-3 .hero-content .title {   font-size:48px;  } } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-3 .hero-content .title {   font-size:38px;  } } @media (max-width:575px) {  .hero-section.style-3 .hero-content .title {   font-size:45px;  } } @media (max-width:540px) {  .hero-section.style-3 .hero-content .title {   font-size:42px;  } } @media (max-width:430px) {  .hero-section.style-3 .hero-content .title {   font-size:34px;  } } @media (max-width:414px) {  .hero-section.style-3 .hero-content .title {   font-size:32px;  } } @media (max-width:360px) {  .hero-section.style-3 .hero-content .title {   font-size:30px;  } } .hero-section.style-3 .hero-content .border::before {  position:absolute;  content:"";  width:60px;  height:2px;  background:var(--theme-color);  transition:all 0.4s ease-in-out;  animation:moveBorder 10s linear infinite; } .hero-section.style-3 .hero-content .text {  font-size:16px;  line-height:26px;  color:var(--gray-color);  margin:-3px 0 41px;  } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-3 .hero-content .text br {   display:none;  } } @media (max-width:575px) {  .hero-section.style-3 .hero-content .text br {   display:none;  } } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-3 .hero-content .hero-btn {   flex-direction:column;   align-items:start !important;  } } @media (max-width:430px) {  .hero-section.style-3 .hero-content .hero-btn {   flex-direction:column;   align-items:start !important;  } } .hero-section.style-3 .hero-content .contact-info {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-start;  gap:10px; } .hero-section.style-3 .hero-content .contact-info:hover .number {  color:var(--theme-color); } .hero-section.style-3 .hero-content .contact-info .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:56px;  height:56px;  border-radius:50%;  background-color:var(--theme-color);  font-size:24px;  color:var(--white-color); } .hero-section.style-3 .hero-content .contact-info .icon i {  filter:brightness(0) invert(1); } .hero-section.style-3 .hero-content .contact-info .number {  font-size:16px;  line-height:26px;  color:var(--dark-color);  font-weight:600;  transition:all 0.4s ease 0s; } .hero-section.style-3 .hero-right {  position:relative;  padding-left:38px;  } @media (max-width:1199px) {  .hero-section.style-3 .hero-right {   padding-left:0;  } } .hero-section.style-3 .hero-right .image-box {  position:relative; } .hero-section.style-3 .hero-right .image-box .image-group .image2 {  display:flex;  justify-content:end;  margin-top:-140px;  margin-right:-50px; } @media (max-width:1500px) {  .hero-section.style-3 .hero-right .image-box .image-group .image2 {   margin-right:-20px;  } } @media (max-width:1399px) {  .hero-section.style-3 .hero-right .image-box .image-group .image2 {   margin-right:-40px;  } } @media (max-width:1299px) {  .hero-section.style-3 .hero-right .image-box .image-group .image2 {   margin-right:10px;  } } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-3 .hero-right .image-box .image-group .image2 {   margin-right:0;  } } @media (max-width:991px) {  .hero-section.style-3 .hero-right .image-box .image-group .image2 {   margin-right:270px;  } } @media (max-width:853px) {  .hero-section.style-3 .hero-right .image-box .image-group .image2 {   margin-right:121px;  } } @media (max-width:540px) {  .hero-section.style-3 .hero-right .image-box .image-group .image2 {   margin-right:0;   justify-content:center;  } } @media (max-width:430px) {  .hero-section.style-3 .hero-right .image-box .image-group .image2 {   margin-top:30px;  } } .hero-section.style-3 .hero-right .image-box .image-group .image2 .inner-box {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  align-items:flex-end;  width:300px;  height:350px;  border-radius:10px;  background-color:var(--dark-color3);  position:relative;  z-index:1;  overflow:hidden; } @media (max-width:430px) {  .hero-section.style-3 .hero-right .image-box .image-group .image2 .inner-box {   width:100%;  } } .hero-section.style-3 .hero-right .image-box .image-group .image2 .inner-box .img {  width:260px;  height:212px;  object-fit:cover; } .hero-section.style-3 .hero-right .image-box .image-group .image2 .inner-box .ellipse-path {  position:absolute;  content:"";  width:453px;  height:453px;  background:rgba(255, 255, 255, 0.07);  transition:all 0.4s ease-in-out;  border-radius:50%;  bottom:-285px;  z-index:-1; } .hero-section.style-3 .hero-right .image-box .image-group .image2 .inner-box .downloads-card {  position:absolute;  content:"";  left:50%;  transform:translateX(-50%);  transition:all 0.4s ease 0s;  top:45px;  text-align:center; } .hero-section.style-3 .hero-right .image-box .image-group .image2 .inner-box .downloads-card .download {  font-size:14px;  color:var(--white-color);  font-weight:400;  margin-bottom:13px; } .hero-section.style-3 .hero-right .image-box .image-group .image2 .inner-box .downloads-card .count-box {  font-size:50px;  color:var(--theme-color2);  font-weight:600;  display:flex;  align-items:center;  gap:15px; } .hero-section.style-3 .hero-right .image-box .image-group .image2 .inner-box .downloads-card .count-box .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:42px;  height:42px;  border-radius:50%;  background-color:var(--theme-color2);  font-size:24px;  color:var(--dark-color); } .hero-section.style-3 .hero-right .image-box .info-box {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  gap:15px;  width:310px;  height:120px;  border-radius:10px;  filter:drop-shadow(0px 20px 25px rgba(204, 219, 219, 0.3));  background-color:var(--white-color);  position:absolute;  bottom:40px;  } @media (max-width:1299px) {  .hero-section.style-3 .hero-right .image-box .info-box {   bottom:70px;   z-index:1;  } } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-3 .hero-right .image-box .info-box {   display:none;  } } @media (max-width:991px) {  .hero-section.style-3 .hero-right .image-box .info-box {   bottom:40px;  } } @media (max-width:575px) {  .hero-section.style-3 .hero-right .image-box .info-box {   display:none;  } } .hero-section.style-3 .hero-right .image-box .info-box .img {  border-radius:50%; } .hero-section.style-3 .hero-right .image-box .info-box .info .name {  font-size:20px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0; } .hero-section.style-3 .hero-right .image-box .info-box .info .position {  font-size:15px;  color:var(--gray-color);  margin-bottom:0; } .hero-section.style-3 .hero-right .agency-info {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  flex-direction:column;  width:140px;  height:150px;  border-radius:10px;  background-color:var(--theme-color2);  position:absolute;  top:120px;  right:-140px;  z-index:2;  } @media (max-width:1500px) {  .hero-section.style-3 .hero-right .agency-info {   top:48px;   right:-20px;  } } @media (max-width:1299px) {  .hero-section.style-3 .hero-right .agency-info {   right:10px;  } } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-3 .hero-right .agency-info {   display:none;  } } @media (max-width:991px) {  .hero-section.style-3 .hero-right .agency-info {   right:171px;   top:120px;  } } @media (max-width:853px) {  .hero-section.style-3 .hero-right .agency-info {   right:33px;  } } @media (max-width:430px) {  .hero-section.style-3 .hero-right .agency-info {   display:none;  } } .hero-section.style-3 .hero-right .agency-info:hover .icon i {  animation:mirrorEffect 0.5s forwards ease-in-out 0s; } .hero-section.style-3 .hero-right .agency-info .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:48px;  height:48px;  font-size:25px;  color:var(--theme-color2);  background-color:var(--dark-color);  border-radius:50%;  margin-bottom:15px; } .hero-section.style-3 .hero-right .agency-info p {  font-size:15px;  line-height:20px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0;  text-align:center; } .hero-section.style-3 .hero-right .dot-shape {  position:absolute;  top:119px;  right:20px; } @media (max-width:991px) {  .hero-section.style-3 .hero-right .dot-shape {   right:333px;  } } @media (max-width:853px) {  .hero-section.style-3 .hero-right .dot-shape {   right:195px;  } } @media (max-width:575px) {  .hero-section.style-3 .hero-right .dot-shape {   display:none;  } } .hero-section.style-3 .hero-right .circle-path_shape {  position:absolute;  content:"";  left:277px;  top:220px;  width:258px;  height:258px;  border-radius:50%;  background-color:var(--theme-color);  z-index:-1;  } @media (max-width:430px) {  .hero-section.style-3 .hero-right .circle-path_shape {   top:150px;  } } @media (max-width:375px) {  .hero-section.style-3 .hero-right .circle-path_shape {   top:125px;  } }  .hero-section.style-4 {  position:relative;  z-index:1;  overflow:hidden;  border-radius:30px;  } @media (max-width:991px) {  .hero-section.style-4 {   border-radius:0;  } } .hero-section.style-4 .hero-content {  padding:150px 0 153px; } @media (max-width:1199px) {  .hero-section.style-4 .hero-content {   padding:80px 0;  } } @media (max-width:375px) {  .hero-section.style-4 .hero-content {   padding:60px 0;  } } .hero-section.style-4 .hero-content .sub-title {  font-size:18px;  color:var(--dark-color);  font-weight:500;  } @media (max-width:430px) {  .hero-section.style-4 .hero-content .sub-title {   font-size:16px;  } } @media (max-width:375px) {  .hero-section.style-4 .hero-content .sub-title {   flex-direction:column;   align-items:baseline;  } } .hero-section.style-4 .hero-content .title {  font-size:56px;  line-height:1.18;  color:var(--dark-color);  font-weight:700;  letter-spacing:normal;  margin-bottom:0; } @media (max-width:1399px) {  .hero-section.style-4 .hero-content .title {   font-size:48px;  } } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-4 .hero-content .title {   font-size:38px;  } } @media (max-width:575px) {  .hero-section.style-4 .hero-content .title {   font-size:45px;  }  .hero-section.style-4 .hero-content .title br {   display:block;  } } @media (max-width:540px) {  .hero-section.style-4 .hero-content .title {   font-size:42px;  } } @media (max-width:430px) {  .hero-section.style-4 .hero-content .title {   font-size:34px;  } } @media (max-width:414px) {  .hero-section.style-4 .hero-content .title {   font-size:32px;  } } @media (max-width:360px) {  .hero-section.style-4 .hero-content .title {   font-size:30px;  } } .hero-section.style-4 .hero-content .border::before {  position:absolute;  content:"";  width:60px;  height:2px;  background:var(--theme-color);  transition:all 0.4s ease-in-out;  animation:moveBorder 10s linear infinite; } .hero-section.style-4 .hero-content .text {  font-size:16px;  line-height:26px;  color:var(--dark-color);  margin:-3px 0 41px;  } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-4 .hero-content .text br {   display:none;  } } @media (max-width:575px) {  .hero-section.style-4 .hero-content .text br {   display:none;  } } .hero-section.style-4 .hero-content .feature-list {  display:flex;  align-items:center;  gap:40px;  margin-top:69px;  } @media (max-width:375px) {  .hero-section.style-4 .hero-content .feature-list {   align-items:flex-start;   flex-direction:column;   gap:10px;   margin-top:40px;  } } .hero-section.style-4 .hero-content .feature-list li {  color:var(--dark-color);  position:relative;  padding-left:30px; } .hero-section.style-4 .hero-content .feature-list li::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  content:"\f00c";  font-weight:300;  font-size:23px;  font-family:var(--icon-font);  color:var(--theme-color); } .hero-section.style-4 .hero-content .contact-info {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-start;  gap:10px; } .hero-section.style-4 .hero-content .contact-info:hover .number {  color:var(--theme-color); } .hero-section.style-4 .hero-content .contact-info .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:56px;  height:56px;  border-radius:50%;  background-color:var(--theme-color);  font-size:24px;  color:var(--white-color); } .hero-section.style-4 .hero-content .contact-info .icon i {  filter:brightness(0) invert(1); } .hero-section.style-4 .hero-content .contact-info .number {  font-size:16px;  line-height:26px;  color:var(--dark-color);  font-weight:600;  transition:all 0.4s ease 0s; } .hero-section.style-4 .hero-right {  padding-left:50px; } @media (max-width:1199px) {  .hero-section.style-4 .hero-right {   padding-left:0;  } } @media (max-width:991px) {  .hero-section.style-4 .hero-right {   display:none;  } } .hero-section.style-4 .hero-right .image-box {  position:absolute;  bottom:-20px; } .hero-section.style-4 .hero-right .image-box img {  max-width:inherit; } .hero-section.style-4 .hero-right .thumb-info {  position:absolute;  background-color:var(--bs-bg-color5);  backdrop-filter:blur(10px);  bottom:18%;  right:32.5%;  border-radius:10px; } @media (max-width:1500px) {  .hero-section.style-4 .hero-right .thumb-info {   right:24%;  } } @media (max-width:1199px) {  .hero-section.style-4 .hero-right .thumb-info {   display:none;  } } .hero-section.style-4 .hero-right .agency-info {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  flex-direction:column;  width:140px;  height:150px;  border-radius:10px;  border:2px solid var(--white-color);  background-color:var(--bs-bg-color5);  backdrop-filter:blur(10px);  position:absolute;  top:12%;  right:7%;  z-index:2;  } @media (max-width:1500px) {  .hero-section.style-4 .hero-right .agency-info {   display:none;  } } .hero-section.style-4 .hero-right .agency-info:hover .icon i {  animation:mirrorEffect 0.5s forwards ease-in-out 0s; } .hero-section.style-4 .hero-right .agency-info .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:48px;  height:48px;  font-size:25px;  color:var(--theme-color2);  background-color:var(--dark-color);  border-radius:50%;  margin-bottom:15px; } .hero-section.style-4 .hero-right .agency-info p {  font-size:15px;  line-height:20px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0;  text-align:center; } .hero-section.style-4 .hero-right .dot-shape {  position:absolute;  top:119px;  right:20px; } @media (max-width:991px) {  .hero-section.style-4 .hero-right .dot-shape {   right:333px;  } } @media (max-width:853px) {  .hero-section.style-4 .hero-right .dot-shape {   right:195px;  } } @media (max-width:575px) {  .hero-section.style-4 .hero-right .dot-shape {   display:none;  } } .hero-section.style-4 .swiper-slide {  } @media (max-width:1399px) {  .hero-section.style-4 .swiper-slide {   overflow:hidden;  } } @media (max-width:1500px) {  .hero-section.style-4 .swiper-button-prev,  .hero-section.style-4 .swiper-button-next {   opacity:0;   visibility:hidden;  } } .hero-section.style-4:hover .swiper-button-prev, .hero-section.style-4:hover .swiper-button-next {  opacity:1;  visibility:visible; } .hero-section.style-4 .hero-content > * {  transition-timing-function:ease;  transition-duration:1s;  transition-property:all;  opacity:0; } .hero-section.style-4 .hero-content > *:nth-child(1) {  transition-delay:1000ms;  transform:translateY(-50px); } .hero-section.style-4 .hero-content > *:nth-child(2) {  transition-delay:700ms;  transform:translateY(50px); } .hero-section.style-4 .hero-content > *:nth-child(3) {  transition-delay:1000ms;  transform:translateY(50px); } .hero-section.style-4 .hero-content > *:nth-child(4) {  transition-delay:1300ms;  transform:translateY(50px); } .hero-section.style-4 .hero-content > *:nth-child(5) {  transition-delay:1500ms;  transform:translateY(50px); } .hero-section.style-4 .hero-right > * {  transition-timing-function:ease;  transition-duration:1s;  transition-property:all;  opacity:0; } .hero-section.style-4 .hero-right > *:nth-child(1) {  transition-delay:1000ms;  transform:translateY(50px); } .hero-section.style-4 .hero-right > *:nth-child(2) {  transition-delay:700ms;  transform:translateY(-50px); } .hero-section.style-4 .swiper-slide-active .hero-content > * {  transform:translateX(0);  opacity:1; } .hero-section.style-4 .swiper-slide-active .hero-right > * {  transform:translateX(0);  opacity:1; }  .hero-section.style-5 {  background-color:var(--dark-color); } .hero-section.style-5 .hero-content {  padding:150px 0 150px;  } @media (max-width:991px) {  .hero-section.style-5 .hero-content {   padding:100px 0 0;  } } .hero-section.style-5 .hero-content .sub-title {  font-size:18px;  color:var(--dark-color);  font-weight:500;  } @media (max-width:430px) {  .hero-section.style-5 .hero-content .sub-title {   font-size:16px;  } } @media (max-width:375px) {  .hero-section.style-5 .hero-content .sub-title {   flex-direction:column;   align-items:baseline;  } } .hero-section.style-5 .hero-content .title {  font-size:80px;  line-height:1.18;  color:var(--dark-color);  font-weight:700;  font-family:var(--title-font);  letter-spacing:normal;  margin-bottom:0; } @media (max-width:1399px) {  .hero-section.style-5 .hero-content .title {   font-size:48px;  } } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-5 .hero-content .title {   font-size:38px;  } } @media (max-width:575px) {  .hero-section.style-5 .hero-content .title {   font-size:45px;  } } @media (max-width:540px) {  .hero-section.style-5 .hero-content .title {   font-size:42px;  } } @media (max-width:430px) {  .hero-section.style-5 .hero-content .title {   font-size:34px;  } } @media (max-width:414px) {  .hero-section.style-5 .hero-content .title {   font-size:32px;  } } @media (max-width:360px) {  .hero-section.style-5 .hero-content .title {   font-size:30px;  } } .hero-section.style-5 .hero-content .title .hero-title_shape {  display:inline-block;  position:relative;  top:-10px; } .hero-section.style-5 .hero-content .border::before {  position:absolute;  content:"";  width:60px;  height:2px;  background:var(--theme-color);  transition:all 0.4s ease-in-out;  animation:moveBorder 10s linear infinite; } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-5 .hero-content .hero-btn {   flex-direction:column;   align-items:start !important;  } } @media (max-width:430px) {  .hero-section.style-5 .hero-content .hero-btn {   flex-direction:column;   align-items:start !important;  } } .hero-section.style-5 .hero-content .contact-info {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-start;  gap:10px; } .hero-section.style-5 .hero-content .contact-info:hover .number {  color:var(--theme-color); } .hero-section.style-5 .hero-content .contact-info .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:56px;  height:56px;  border-radius:50%;  background-color:var(--theme-color);  font-size:24px;  color:var(--white-color); } .hero-section.style-5 .hero-content .contact-info .icon i {  filter:brightness(0) invert(1); } .hero-section.style-5 .hero-content .contact-info .number {  font-size:16px;  line-height:26px;  color:var(--dark-color);  font-weight:600;  transition:all 0.4s ease 0s; } .hero-section.style-5 .hero-social-proof img {  border-color:var(--theme-color3); } .hero-section.style-5 .hero-social-proof .happy-customers .text {  color:var(--dark-color); } .hero-section.style-5 .hero-social-proof .happy-customers .rating-viewers .rating {  color:var(--dark-color); } .hero-section.style-5 .hero-social-proof .happy-customers .rating-viewers .count {  color:var(--gray-color2); } .hero-section.style-5 .hero-right {  position:relative; } .hero-section.style-5 .hero-right .info-box {  position:absolute;  bottom:0;  left:-43%;  padding:50px 0 50px 60px;  max-width:472px;  width:100%;  } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-5 .hero-right .info-box {   padding:50px 0 50px 30px;  } } @media (max-width:991px) {  .hero-section.style-5 .hero-right .info-box {   left:0;  } } .hero-section.style-5 .hero-right .info-box .title {  font-size:24px;  line-height:34px;  color:var(--white-color);  font-weight:500;  margin-bottom:5px; } .hero-section.style-5 .hero-right .circle-path_shape {  position:absolute;  content:"";  left:-135px;  bottom:86px;  width:280px;  height:280px;  border-radius:50%;  background-color:var(--theme-color);  z-index:-1;  clip-path:polygon(0 0, 50% 0, 50% 50%, 0 50%); }  .hero-section.style-6 {  position:relative;  z-index:1;  overflow:hidden;  border-radius:20px;  border-bottom-right-radius:0;  } .hero-section.style-6::before {  position:absolute;  content:"";  width:100%;  height:100%;  background:var(--bs-bg-color19);  transition:all 0.4s ease-in-out;  top:0;  left:0;  z-index:0;  mix-blend-mode:hard-light; } @media (max-width:1199px) {  .hero-section.style-6 {   border-radius:0;  } } .hero-section.style-6 .hero-scroll {  position:absolute;  left:-15px;  bottom:173px;  transform:rotate(90deg);  z-index:9; } @media (max-width:1500px) {  .hero-section.style-6 .hero-scroll {   bottom:344px;   left:0px;  } } @media (max-width:1299px) {  .hero-section.style-6 .hero-scroll {   bottom:344px;   left:-48px;  } } .hero-section.style-6 .hero-content {  padding:210px 0 120px;  } @media (max-width:1199px) {  .hero-section.style-6 .hero-content {   padding:180px 0;  } } @media (max-width:1024px) {  .hero-section.style-6 .hero-content {   padding:180px 0 130px;  } } @media (max-width:575px) {  .hero-section.style-6 .hero-content {   padding:120px 0;  } } @media (max-width:375px) {  .hero-section.style-6 .hero-content {   padding:120px 0;  } } .hero-section.style-6 .hero-content .theme-btn {  } @media (max-width:575px) {  .hero-section.style-6 .hero-content .theme-btn {   margin-bottom:70px;  } } .hero-section.style-6 .hero-content .sub-title {  font-size:18px;  color:var(--dark-color);  font-weight:500;  } @media (max-width:430px) {  .hero-section.style-6 .hero-content .sub-title {   font-size:16px;  } } @media (max-width:375px) {  .hero-section.style-6 .hero-content .sub-title {   flex-direction:column;   align-items:baseline;  } } .hero-section.style-6 .hero-content .title {  font-size:56px;  line-height:1.18;  color:var(--white-color);  font-weight:700;  letter-spacing:normal;  margin-bottom:170px;  } .hero-section.style-6 .hero-content .title span {  color:var(--gray-color2); } @media (max-width:1399px) {  .hero-section.style-6 .hero-content .title {   font-size:48px;  } } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-6 .hero-content .title {   font-size:38px;   margin-bottom:40px;  } } @media (max-width:991px) {  .hero-section.style-6 .hero-content .title {   margin-bottom:80px;  } } @media (max-width:430px) {  .hero-section.style-6 .hero-content .title {   margin-bottom:40px;  } } @media (max-width:575px) {  .hero-section.style-6 .hero-content .title {   font-size:45px;  }  .hero-section.style-6 .hero-content .title br {   display:block;  } } @media (max-width:540px) {  .hero-section.style-6 .hero-content .title {   font-size:42px;  } } @media (max-width:430px) {  .hero-section.style-6 .hero-content .title {   font-size:32px;  } } @media (max-width:414px) {  .hero-section.style-6 .hero-content .title {   font-size:28px;  } } @media (max-width:360px) {  .hero-section.style-6 .hero-content .title {   font-size:28px;  } } .hero-section.style-6 .hero-content .text {  display:flex;  align-items:center;  gap:15px;  margin-bottom:40px; } .hero-section.style-6 .hero-content .text .icon {  flex-shrink:0; } .hero-section.style-6 .hero-content .text .icon img {  display:inline-block; } @media (max-width:540px) {  .hero-section.style-6 .hero-content .text .icon {   display:none;  } } .hero-section.style-6 .hero-content .text p {  font-size:16px;  line-height:26px;  color:var(--gray-color2);  font-weight:400;  margin:0; } @media (max-width:1024px) {  .hero-section.style-6 .hero-content .text p br {   display:none;  } } .hero-section.style-6 .hero-content .feature-list {  display:flex;  align-items:center;  gap:40px;  margin-top:69px;  } @media (max-width:375px) {  .hero-section.style-6 .hero-content .feature-list {   align-items:flex-start;   flex-direction:column;   gap:10px;   margin-top:40px;  } } .hero-section.style-6 .hero-content .feature-list li {  color:var(--dark-color);  position:relative;  padding-left:30px; } .hero-section.style-6 .hero-content .feature-list li::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  content:"\f00c";  font-weight:300;  font-size:23px;  font-family:var(--icon-font);  color:var(--theme-color); } .hero-section.style-6 .hero-content .contact-info {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-start;  gap:10px; } .hero-section.style-6 .hero-content .contact-info:hover .number {  color:var(--theme-color); } .hero-section.style-6 .hero-content .contact-info .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:56px;  height:56px;  border-radius:50%;  background-color:var(--theme-color);  font-size:24px;  color:var(--white-color); } .hero-section.style-6 .hero-content .contact-info .icon i {  filter:brightness(0) invert(1); } .hero-section.style-6 .hero-content .contact-info .number {  font-size:16px;  line-height:26px;  color:var(--dark-color);  font-weight:600;  transition:all 0.4s ease 0s; } .hero-section.style-6 .hero-right {  padding-left:50px; } @media (max-width:1199px) {  .hero-section.style-6 .hero-right {   padding-left:0;  } } @media (max-width:991px) {  .hero-section.style-6 .hero-right {   display:none;  } } .hero-section.style-6 .hero-right .image-box {  margin-bottom:-124px; } .hero-section.style-6 .hero-right .image-box img {  max-width:inherit; } @media (max-width:1024px) {  .hero-section.style-6 .hero-right .image-box img {   max-width:100%;  } } .hero-section.style-6 .hero-right .thumb-info {  position:absolute;  background-color:var(--bs-bg-color5);  backdrop-filter:blur(10px);  bottom:18%;  right:32.5%;  border-radius:10px; } @media (max-width:1500px) {  .hero-section.style-6 .hero-right .thumb-info {   right:24%;  } } @media (max-width:1199px) {  .hero-section.style-6 .hero-right .thumb-info {   display:none;  } } .hero-section.style-6 .hero-right .dot-shape {  position:absolute;  top:119px;  right:20px; } @media (max-width:991px) {  .hero-section.style-6 .hero-right .dot-shape {   right:333px;  } } @media (max-width:853px) {  .hero-section.style-6 .hero-right .dot-shape {   right:195px;  } } @media (max-width:575px) {  .hero-section.style-6 .hero-right .dot-shape {   display:none;  } } .hero-section.style-6 .swiper-slide {  } @media (max-width:1399px) {  .hero-section.style-6 .swiper-slide {   overflow:hidden;  } } @media (max-width:1500px) {  .hero-section.style-6 .swiper-button-prev,  .hero-section.style-6 .swiper-button-next {   opacity:0;   visibility:hidden;  } } .hero-section.style-6:hover .swiper-button-prev, .hero-section.style-6:hover .swiper-button-next {  opacity:1;  visibility:visible; } .hero-section.style-6 .hero-content > * {  transition-timing-function:ease;  transition-duration:1s;  transition-property:all;  opacity:0; } .hero-section.style-6 .hero-content > *:nth-child(1) {  transition-delay:1000ms;  transform:translateY(-50px); } .hero-section.style-6 .hero-content > *:nth-child(2) {  transition-delay:700ms;  transform:translateY(50px); } .hero-section.style-6 .hero-content > *:nth-child(3) {  transition-delay:1000ms;  transform:translateY(50px); } .hero-section.style-6 .hero-content > *:nth-child(4) {  transition-delay:1300ms;  transform:translateY(50px); } .hero-section.style-6 .hero-content > *:nth-child(5) {  transition-delay:1500ms;  transform:translateY(50px); } .hero-section.style-6 .hero-right > * {  transition-timing-function:ease;  transition-duration:1s;  transition-property:all;  opacity:0; } .hero-section.style-6 .hero-right > *:nth-child(1) {  transition-delay:1000ms;  transform:translateY(50px); } .hero-section.style-6 .swiper-slide-active .hero-content > * {  transform:translateX(0);  opacity:1; } .hero-section.style-6 .swiper-slide-active .hero-right > * {  transform:translateX(0);  opacity:1; } .hero-section.style-6 .info-box.style-2 {  position:absolute;  bottom:0;  right:0;  border-top-left-radius:16px;  padding:30px 0 0 30px;  max-width:454px;  width:100%;  } @media (max-width:575px) {  .hero-section.style-6 .info-box.style-2 {   padding:0;   border-radius:0;  } } .hero-section.style-6 .info-box.style-2::before {  position:absolute;  left:-16px;  bottom:0;  content:"";  height:16px;  width:16px;  background:url('data:image/svg+xml,<svg viewBox="0 0 11 11" fill="none" xmlns="http://www.w3.org/2000/svg" class="w-11 h-11"><path d="M11 1.54972e-06L0 0L2.38419e-07 11C1.65973e-07 4.92487 4.92487 1.62217e-06 11 1.54972e-06Z" fill="%23ecf8f8"></path></svg>');  transform:rotate(180deg);  } @media (max-width:575px) {  .hero-section.style-6 .info-box.style-2::before {   content:inherit;  } } .hero-section.style-6 .info-box.style-2::after {  position:absolute;  right:0;  top:-16px;  content:"";  height:16px;  width:16px;  background:url('data:image/svg+xml,<svg viewBox="0 0 11 11" fill="none" xmlns="http://www.w3.org/2000/svg" class="w-11 h-11"><path d="M11 1.54972e-06L0 0L2.38419e-07 11C1.65973e-07 4.92487 4.92487 1.62217e-06 11 1.54972e-06Z" fill="%23ecf8f8"></path></svg>');  transform:rotate(180deg);  } @media (max-width:575px) {  .hero-section.style-6 .info-box.style-2::after {   content:inherit;  } } .hero-section.style-6 .info-box.style-2 .inner-box {  padding:40px 0 40px 40px;  width:100%;  border-radius:16px;  background:var(--dark-color);  position:relative;  z-index:2;  } @media (max-width:575px) {  .hero-section.style-6 .info-box.style-2 .inner-box {   border-radius:0;  } } .hero-section.style-6 .info-box.style-2 .inner-box .content p {  font-size:20px;  line-height:26px;  color:var(--white-color);  font-weight:500;  margin:0; } .hero-section.style-6 .info-box.style-2 .inner-box .content .awards .count-number {  font-size:70px;  line-height:1;  color:var(--theme-color2);  font-weight:500; } .hero-section.style-6 .info-box.style-2 .inner-box .content .awards .plus {  font-size:40px;  color:var(--theme-color2); }  .hero-section.style-7 {  position:relative;  z-index:1;  overflow:hidden;  border-radius:0px;  } @media (max-width:991px) {  .hero-section.style-7 {   border-radius:0;  } } .hero-section.style-7 .hero-content {  padding:240px 0 153px; } @media (max-width:1299px) {  .hero-section.style-7 .hero-content {   padding:150px 0 70px;  } } @media (max-width:375px) {  .hero-section.style-7 .hero-content {   padding:150px 0 70px;  } } .hero-section.style-7 .hero-content .title {  font-size:56px;  line-height:1.2;  color:var(--dark-color);  font-weight:700;  margin-bottom:28px;  } @media (max-width:1399px) {  .hero-section.style-7 .hero-content .title {   font-size:48px;  } } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-7 .hero-content .title {   font-size:38px;  } } @media (max-width:575px) {  .hero-section.style-7 .hero-content .title {   font-size:45px;  }  .hero-section.style-7 .hero-content .title br {   display:none;  } } @media (max-width:540px) {  .hero-section.style-7 .hero-content .title {   font-size:42px;  } } @media (max-width:430px) {  .hero-section.style-7 .hero-content .title {   font-size:28px;  } } @media (max-width:414px) {  .hero-section.style-7 .hero-content .title {   font-size:32px;  } } @media (max-width:375px) {  .hero-section.style-7 .hero-content .title {   font-size:30px;  } } .hero-section.style-7 .hero-content .text {  display:flex;  align-items:center;  gap:15px;  margin-top:50px; } .hero-section.style-7 .hero-content .text .icon {  display:inline-block;  flex-shrink:0; } @media (max-width:390px) {  .hero-section.style-7 .hero-content .text .icon {   display:none;  } } .hero-section.style-7 .hero-content .text p {  margin:0;  font-size:16px;  line-height:26px;  color:var(--dark-color);  font-weight:400; } @media (min-width:992px) and (max-width:1024px) {  .hero-section.style-7 .hero-content .text p br {   display:none;  } } @media (max-width:390px) {  .hero-section.style-7 .hero-content .text p br {   display:none;  } } .hero-section.style-7 .hero-content .feature-list {  display:flex;  align-items:center;  gap:40px;  margin-top:69px;  } @media (max-width:375px) {  .hero-section.style-7 .hero-content .feature-list {   align-items:flex-start;   flex-direction:column;   gap:10px;   margin-top:40px;  } } .hero-section.style-7 .hero-content .feature-list li {  color:var(--dark-color);  position:relative;  padding-left:30px; } .hero-section.style-7 .hero-content .feature-list li::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  content:"\f00c";  font-weight:300;  font-size:23px;  font-family:var(--icon-font);  color:var(--theme-color); } .hero-section.style-7 .hero-content .contact-info {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-start;  gap:10px; } .hero-section.style-7 .hero-content .contact-info:hover .number {  color:var(--theme-color); } .hero-section.style-7 .hero-content .contact-info .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:56px;  height:56px;  border-radius:50%;  background-color:var(--theme-color);  font-size:24px;  color:var(--white-color); } .hero-section.style-7 .hero-content .contact-info .icon i {  filter:brightness(0) invert(1); } .hero-section.style-7 .hero-content .contact-info .number {  font-size:16px;  line-height:26px;  color:var(--dark-color);  font-weight:600;  transition:all 0.4s ease 0s; } .hero-section.style-7 .hero-right {  } @media (max-width:991px) {  .hero-section.style-7 .hero-right {   text-align:center;  } } .hero-section.style-7 .hero-right .image-box {  position:relative;  margin-left:-165px;  margin-top:81px;  } @media (max-width:991px) {  .hero-section.style-7 .hero-right .image-box {   margin-top:0px;   margin-left:0px;  } } .hero-section.style-7 .hero-right .image-box img {  max-width:inherit;  } @media (max-width:575px) {  .hero-section.style-7 .hero-right .image-box img {   max-width:100%;  } } .hero-section.style-7 .hero-right .thumb-info {  position:absolute;  background-color:var(--bs-bg-color5);  backdrop-filter:blur(10px);  bottom:18%;  right:32.5%;  border-radius:10px; } @media (max-width:1500px) {  .hero-section.style-7 .hero-right .thumb-info {   right:24%;  } } @media (max-width:1199px) {  .hero-section.style-7 .hero-right .thumb-info {   display:none;  } } .hero-section.style-7 .hero-right .counter-info {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  align-items:start;  flex-direction:column;  width:280px;  height:300px;  padding:40px;  border-radius:10px;  border:2px solid var(--white-color);  background-color:var(--bs-bg-color5);  backdrop-filter:blur(10px);  position:absolute;  top:32%;  right:-9%;  z-index:2;  } @media (max-width:1299px) {  .hero-section.style-7 .hero-right .counter-info {   display:none;  } } .hero-section.style-7 .hero-right .counter-info .count-box {  font-size:60px;  line-height:1;  color:var(--dark-color);  font-weight:600;  display:flex;  align-items:center; } .hero-section.style-7 .hero-right .counter-info img {  margin-top:50px;  -webkit-animation:emgSwing 1s ease-in-out 1s forwards infinite alternate;  animation:emgSwing 1s ease-in-out 1s forwards infinite alternate;  -webkit-transform-origin:top right;  -ms-transform-origin:top right;  transform-origin:top right; } .hero-section.style-7 .hero-right .counter-info .icon-box {  display:flex;  align-items:center;  gap:15px;  margin-top:16px; } .hero-section.style-7 .hero-right .counter-info .icon-box .icon {  flex-shrink:0;  display:flex;  align-items:center;  justify-content:center;  height:42px;  width:42px;  border-radius:50%;  background:var(--theme-color);  color:var(--white-color); } .hero-section.style-7 .hero-right .counter-info .icon-box .text p {  margin:0;  font-size:17px;  line-height:24px;  color:var(--dark-color);  font-weight:500; } .hero-section.style-7 .hero-right .dot-shape {  position:absolute;  top:119px;  right:20px; } @media (max-width:991px) {  .hero-section.style-7 .hero-right .dot-shape {   right:333px;  } } @media (max-width:853px) {  .hero-section.style-7 .hero-right .dot-shape {   right:195px;  } } @media (max-width:575px) {  .hero-section.style-7 .hero-right .dot-shape {   display:none;  } } .dark-mode .hero-section .hero-content .sub-title, .dark-mode .hero-section .hero-content .title {  color:var(--white-color) !important; } .dark-mode .hero-section .hero-content .text p {  color:var(--gray-color2); }  .about-middle-wrap .circle-box {  margin:46px 0 40px; } .about-middle-wrap .about-info .since {  margin-bottom:11px; } .about-middle-wrap .about-info p span {  text-decoration:underline; } .circle-box {  position:relative;  width:142px;  height:142px;  border-radius:50%;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  background:var(--white-color); } .circle-box .logo-box {  position:absolute; } .circle-box .text-inner svg {  width:120px;  max-width:100%;  height:auto;  overflow:visible;  word-spacing:20px;  transform:rotate(0) scaleX(1) scaleY(1); } .circle-box .text-inner path {  fill:transparent;  stroke:transparent;  stroke-width:1px;  -webkit-transition:0.3s stroke, 0.3s fill;  -o-transition:0.3s stroke, 0.3s fill;  transition:0.3s stroke, 0.3s fill; } .circle-box .text-inner text {  fill:var(--dark-color);  direction:ltr;  -webkit-transition:0.3s stroke, 0.3s stroke-width, 0.3s fill;  -o-transition:0.3s stroke, 0.3s stroke-width, 0.3s fill;  transition:0.3s stroke, 0.3s stroke-width, 0.3s fill;  font-size:26px;  font-weight:600;  font-family:var(--title-font); } @media (max-width:430px) {  .about-right-wrap {   flex:1;  } } .about-right-wrap .experience-card {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:space-between;  flex-wrap:wrap;  margin-bottom:42px;  } @media (max-width:767px) {  .about-right-wrap .experience-card {   margin-bottom:30px;  } } .about-right-wrap .experience-card .years {  font-size:80px;  line-height:1;  font-weight:700;  color:var(--white-color);  display:inline-block;  position:relative;  text-shadow:-2px -2px 0 var(--dark-color), 2px -2px 0 var(--dark-color), -2px 2px 0 var(--dark-color), 2px 2px 0 var(--dark-color); } .about-right-wrap .experience-card .years::before {  position:absolute;  content:"+";  top:-4px;  right:-26px;  font-size:18px;  line-height:24px;  color:var(--white-color);  font-weight:500;  text-shadow:none;  width:24px;  height:24px;  text-align:center;  border-radius:12px;  background-color:var(--theme-color); } .about-right-wrap .experience-card .text {  font-size:24px;  line-height:30px;  color:var(--dark-color); } .about-right-wrap .experience-card .text span {  position:relative; } .about-right-wrap .experience-card .text span::before span.fw-semibold::before {  position:absolute;  content:"";  right:-70%;  top:50%;  width:58px;  height:1px;  background-color:#e3572b; } .about-right-wrap .profile-card {  background:var(--white-color);  border-radius:10px;  box-shadow:0 4px 8px rgba(0, 0, 0, 0.1);  overflow:hidden;  text-align:center;  position:relative; } .about-right-wrap .profile-card::before {  position:absolute;  content:"";  width:100%;  height:100%;  background:none;  transition:all 0.4s ease-in-out;  left:0;  bottom:0;  background-image:linear-gradient(0deg, rgb(9, 73, 73) 0%, rgb(9, 73, 73) 10%, rgba(9, 73, 73, 0) 58%, rgba(9, 73, 73, 0) 100%); } @media (max-width:430px) {  .about-right-wrap .profile-card img {   width:100%;  } } .about-right-wrap .profile-card .profile-details {  position:absolute;  width:100%;  bottom:13px;  left:50%;  transform:translateX(-50%); } .about-right-wrap .profile-card .profile-details .name {  font-size:18px;  line-height:24px;  color:var(--light-color2);  font-weight:600;  margin-bottom:3px; } .about-right-wrap .profile-card .profile-details .title {  opacity:0.6;  font-size:14px;  line-height:24px;  color:var(--light-color2); } @media (max-width:1024px) {  .about-middle-wrap {   height:100%;   display:flex;   flex-direction:column;   justify-content:flex-end;  } } @media (max-width:991px) {  .about-middle-wrap .circle-box {   margin:0 0 40px;  }  .about-content-wrap .about-img img {   width:100%;  } } .about-section.style-2 .experience-wrapper {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  flex-direction:column;  gap:50px;  padding:50px 0;  max-width:350px;  border-radius:175px;  filter:drop-shadow(0px 20px 20px var(--bs-border-color4));  background-color:var(--white-color); } .about-section.style-2 .experience-wrapper .experience-years {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:194px;  height:194px;  border-radius:50%;  background-color:var(--theme-color3); } .about-section.style-2 .experience-wrapper .experience-years .inner {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:148px;  height:148px;  border-radius:50%;  background-color:var(--theme-color3);  border:1px solid var(--dark-color); } .about-section.style-2 .experience-wrapper .experience-years .inner span {  font-size:80px;  line-height:1;  color:var(--dark-color);  font-weight:600; } .about-section.style-2 .experience-wrapper .text {  display:flex;  align-items:center;  gap:15px; } .about-section.style-2 .experience-wrapper .text p {  font-size:22px;  line-height:30px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0; } .about-section.style-2 .experience-wrapper .popup-video {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:100px;  height:100px;  border-radius:50%;  background-color:var(--white-color);  border:1px solid var(--theme-color);  transition:all 0.4s ease 0s; } .about-section.style-2 .experience-wrapper .popup-video:hover {  transform:scale(1.1);  background-color:var(--theme-color);  border-color:var(--white-color); } .about-section.style-2 .experience-wrapper .popup-video:hover .inner-popup {  background-color:var(--white-color); } .about-section.style-2 .experience-wrapper .popup-video:hover .inner-popup .icon {  color:var(--theme-color); } .about-section.style-2 .experience-wrapper .popup-video .inner-popup {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:60px;  height:60px;  border-radius:50%;  background-color:var(--theme-color);  transition:background-color 0.3s ease-in-out; } .about-section.style-2 .experience-wrapper .popup-video .inner-popup .icon {  color:var(--white-color); } .about-section.style-2 .experience-wrapper .popup-video .inner-popup .icon svg {  fill:var(--white-color);  width:24px;  height:auto; } .about-section.style-2 .about-content-wrap .features-list li {  font-size:16px;  line-height:28px;  color:var(--dark-color);  position:relative;  padding-left:25px; } .about-section.style-2 .about-content-wrap .features-list li + li {  margin-top:7px; } .about-section.style-2 .about-content-wrap .features-list li::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  width:18px;  height:18px;  background:url(/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/check-circle.png.webp); } .about-section.style-2 .about-right-wrap { } @media (max-width:991px) {  .about-section.style-2 .about-right-wrap {   display:flex;   gap:24px;  } } @media (max-width:575px) {  .about-section.style-2 .about-right-wrap {   flex-direction:column;  } } .about-section.style-2 .about-right-wrap .image-box {  margin-bottom:24px;  } @media (max-width:991px) {  .about-section.style-2 .about-right-wrap .image-box {   flex:1;   margin-bottom:0;  } } .about-section.style-2 .about-right-wrap .achievement-box {  position:relative;  z-index:1;  overflow:hidden;  padding:42px 50px 50px;  } .about-section.style-2 .about-right-wrap .achievement-box:hover .content .icon i {  animation:mirrorEffect 0.5s forwards ease-in-out 0s; } @media (min-width:992px) and (max-width:1024px) {  .about-section.style-2 .about-right-wrap .achievement-box {   padding:32px 20px 40px;  } } @media (max-width:991px) {  .about-section.style-2 .about-right-wrap .achievement-box {   flex:1;  } } .about-section.style-2 .about-right-wrap .achievement-box .awards {  position:relative;  line-height:1;  display:inline-block; } .about-section.style-2 .about-right-wrap .achievement-box .awards .count-number {  font-size:60px;  color:var(--dark-color);  font-weight:500; } .about-section.style-2 .about-right-wrap .achievement-box .awards .plus {  font-size:30px;  position:absolute;  top:0;  right:-20px;  color:var(--dark-color); } .about-section.style-2 .about-right-wrap .achievement-box .content {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:space-between; } .about-section.style-2 .about-right-wrap .achievement-box .content p {  font-size:18px;  line-height:24px;  color:var(--dark-color);  margin-bottom:0; } .about-section.style-2 .about-right-wrap .achievement-box .content .icon {  font-size:40px;  color:var(--dark-color); }  .about-section.style-3 .bg-path__shape::before {  position:absolute;  content:"";  width:150px;  height:150px;  background:#e0f1f1;  transition:all 0.4s ease-in-out;  right:0;  bottom:0; } .about-section.style-3 .bg-path__shape::after {  position:absolute;  content:"";  width:70px;  height:70px;  background:#e0f1f1;  transition:all 0.4s ease-in-out;  right:150px;  bottom:150px; } .about-section.style-3 .about-thumb {  direction:rtl;  margin:-120px 35px; } @media (max-width:1500px) {  .about-section.style-3 .about-thumb {   margin:-120px 15px;  } } @media (max-width:991px) {  .about-section.style-3 .about-thumb {   display:none;  } } .about-section.style-3 .about-thumb img {  max-width:inherit; } .about-section.style-3 .since-box {  right:77px;  bottom:-91px; } .about-section.style-3 .features-list {  margin-top:35px; } .about-section.style-3 .features-list li {  font-size:16px;  line-height:28px;  color:var(--dark-color);  position:relative;  padding-left:25px; } @media (max-width:360px) {  .about-section.style-3 .features-list li {   padding-left:20px;  } } .about-section.style-3 .features-list li + li {  margin-top:7px; } .about-section.style-3 .features-list li::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  width:18px;  height:18px;  background:url(/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/check-circle.png.webp); }  .about-section.style-4 .about-image-wrapper {  display:flex;  align-items:end;  position:relative; } .about-section.style-4 .about-image-wrapper.direction-rtl {  } @media (max-width:1199px) {  .about-section.style-4 .about-image-wrapper.direction-rtl {   direction:ltr;  } } @media (min-width:992px) and (max-width:1024px) {  .about-section.style-4 .about-image-wrapper.direction-rtl {   direction:rtl;  } } .about-section.style-4 .about-image-wrapper .about-image {  } @media (max-width:991px) {  .about-section.style-4 .about-image-wrapper .about-image {   width:100%;  }  .about-section.style-4 .about-image-wrapper .about-image img {   width:100%;  } } .about-section.style-4 .about-image-wrapper .shape {  position:absolute;  top:12px;  left:-77px; } .about-section.style-4 .about-image-wrapper .about-single-card {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  flex-shrink:0;  position:relative;  z-index:1;  max-width:330px;  width:100%;  height:max-content;  padding:16px;  border-radius:10px;  background-color:var(--white-color);  margin:0 -135px 68px 0; } @media (max-width:1500px) {  .about-section.style-4 .about-image-wrapper .about-single-card {   margin:0 -205px 68px 0;  } } @media (max-width:1399px) {  .about-section.style-4 .about-image-wrapper .about-single-card {   display:none;  } } .about-section.style-4 .about-image-wrapper .about-single-card .inner {  display:inline-block;  position:relative;  max-width:290px;  width:100%;  flex-shrink:0;  z-index:1;  padding:40px 37px;  border-radius:5px;  background-color:var(--theme-color2);  overflow:hidden; } .about-section.style-4 .about-image-wrapper .about-single-card .inner:hover .icon {  transform:rotate(360deg); } .about-section.style-4 .about-image-wrapper .about-single-card .inner .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:70px;  height:70px;  border-radius:10px;  background-color:var(--dark-color);  font-size:30px;  color:var(--theme-color2);  transition:all 0.4s ease 0s; } .about-section.style-4 .about-image-wrapper .about-single-card .inner .title {  font-size:20px;  line-height:28px;  color:var(--dark-color);  font-weight:500;  margin:30px 0 24px; } .about-section.style-4 .about-image-wrapper .about-single-card .inner .members {  display:flex;  align-items:center;  gap:5px; } .about-section.style-4 .about-image-wrapper .about-single-card .inner .members .social {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center; } .about-section.style-4 .about-image-wrapper .about-single-card .inner .members .social img {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:50px;  height:50px;  border-radius:50%;  margin-left:-20px;  border:3px solid var(--theme-color2); } .about-section.style-4 .about-image-wrapper .about-single-card .inner .members .social img:first-child {  margin-left:0; } .about-section.style-4 .about-image-wrapper .about-single-card .inner .members .text {  font-size:15px;  color:var(--dark-color);  font-weight:500; } .about-section.style-4 .about-image-wrapper .about-image img {  max-width:inherit;  border-radius:10px; } .about-section.style-4 .circle-box {  position:absolute;  bottom:37px;  right:-92px;  width:184px;  height:184px;  background-color:var(--theme-color3);  } @media (max-width:991px) {  .about-section.style-4 .circle-box {   bottom:30px;   right:30px;  } } @media (max-width:430px) {  .about-section.style-4 .circle-box {   display:none;  } } .about-section.style-4 .feature-list {  display:flex;  gap:25px;  } @media (max-width:575px) {  .about-section.style-4 .feature-list {   flex-direction:column;  } } .about-section.style-4 .feature-list .feature-item {  display:flex;  align-items:center;  gap:20px; } @media (min-width:992px) and (max-width:1024px) {  .about-section.style-4 .feature-list .feature-item {   flex-direction:column;   align-items:flex-start;  } } .about-section.style-4 .feature-list .feature-item:hover .icon i {  animation:mirror_effect 0.8s forwards ease-in-out 0s; } .about-section.style-4 .feature-list .feature-item .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  flex-shrink:0;  width:60px;  height:60px;  border-radius:50%;  background-color:var(--theme-color3);  font-size:30px;  color:var(--dark-color); } .about-section.style-4 .feature-list .feature-item p {  font-size:18px;  line-height:26px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0; } .about-section.style-4 .features-list li {  font-size:16px;  line-height:28px;  color:var(--dark-color);  position:relative;  padding-left:25px; } @media (max-width:360px) {  .about-section.style-4 .features-list li {   padding-left:20px;  } } .about-section.style-4 .features-list li + li {  margin-top:7px; } .about-section.style-4 .features-list li::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  width:18px;  height:18px;  background:url(/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/check-circle.png.webp); }  .about-section.style-5 .features-list li {  font-size:16px;  line-height:28px;  color:var(--dark-color);  position:relative;  padding-left:25px; } @media (max-width:360px) {  .about-section.style-5 .features-list li {   padding-left:20px;  } } .about-section.style-5 .features-list li + li {  margin-top:7px; } .about-section.style-5 .features-list li::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  width:18px;  height:18px;  background:url(/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/check-circle.png.webp); } .about-section.style-5 .about-right-wrapper {  display:flex;  align-items:center;  gap:50px;  background:var(--light-color3);  padding:20px;  padding-left:50px;  margin-right:-246px;  } @media (max-width:1500px) {  .about-section.style-5 .about-right-wrapper {   margin-right:-74px;  } } @media (max-width:1280px) {  .about-section.style-5 .about-right-wrapper {   margin-right:0;  } } .about-section.style-5 .about-right-wrapper .left {  flex:1; } .about-section.style-5 .about-right-wrapper .stat-box {  display:flex;  align-items:center;  gap:25px; } .about-section.style-5 .about-right-wrapper .stat-box:hover .icon img {  animation:mirror_effect 1s forwards ease-in-out 0s; } .about-section.style-5 .about-right-wrapper .stat-box .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  flex-shrink:0;  width:90px;  height:90px;  border-radius:50%;  background:var(--dark-color);  font-size:48px;  color:var(--white-color); } .about-section.style-5 .about-right-wrapper .stat-box .icon img {  transition:all 0.4s ease 0s; } .about-section.style-5 .about-right-wrapper .stat-box .icon svg {  fill:var(--white-color);  width:40px;  height:40px; } .about-section.style-5 .about-right-wrapper .stat-box .title {  font-size:50px;  line-height:1;  color:var(--dark-color);  font-weight:500;  margin-bottom:5px; } .about-section.style-5 .about-right-wrapper .skills .skill-item {  margin-bottom:23px; } .about-section.style-6 .about-thumb-area {  position:relative;  margin-left:-130px;  } @media (max-width:1500px) {  .about-section.style-6 .about-thumb-area {   margin-left:0;  } } .about-section.style-6 .about-thumb-area .about-slider {  border-radius:16px; } @media (max-width:430px) {  .about-section.style-6 .about-thumb-area .about-slider {   border-radius:0;  } } .about-section.style-6 .about-thumb-area .about-slider .about-slide_thumb {  border-radius:16px; } @media (max-width:430px) {  .about-section.style-6 .about-thumb-area .about-slider .about-slide_thumb {   border-radius:0;  } } .about-section.style-6 .about-thumb-area .about-slider .about-slide_thumb img {  max-width:inherit;  border-radius:30px;  } @media (max-width:430px) {  .about-section.style-6 .about-thumb-area .about-slider .about-slide_thumb img {   border-radius:0;  } } @media (max-width:991px) {  .about-section.style-6 .about-thumb-area .about-slider .about-slide_thumb img {   width:100%;  } } .about-section.style-6 .about-thumb-area .customar-box {  padding:40px 30px;  background:var(--dark-color);  max-width:220px;  width:100%;  border-radius:8px;  position:absolute;  bottom:-60px;  right:50px;  z-index:2; } @media (min-width:992px) and (max-width:1024px) {  .about-section.style-6 .about-thumb-area .customar-box {   right:30px;  } } @media (max-width:430px) {  .about-section.style-6 .about-thumb-area .customar-box {   position:inherit;   max-width:inherit;   width:100%;   border-radius:0px;   right:0;   bottom:-20px;  } } .about-section.style-6 .about-thumb-area .customar-box .box-top {  display:flex;  align-items:center;  justify-content:space-between;  margin-bottom:48px; } .about-section.style-6 .about-thumb-area .customar-box .box-top .awards {  display:flex;  align-items:center; } .about-section.style-6 .about-thumb-area .customar-box .box-top .awards .count-number {  font-size:50px;  line-height:1;  color:var(--theme-color2);  font-weight:500; } .about-section.style-6 .about-thumb-area .customar-box .box-top .awards .plus {  font-size:50px;  line-height:1;  color:var(--theme-color2);  font-weight:500; } .about-section.style-6 .about-thumb-area .customar-box .box-top .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  height:44px;  width:44px;  border-radius:22px;  border:1px solid var(--bs-border-color2); } .about-section.style-6 .about-thumb-area .customar-box .box-top .icon i {  color:var(--theme-color2);  font-size:18px; } .about-section.style-6 .about-thumb-area .customar-box .box-bottom h6 {  font-size:20px;  line-height:28px;  color:var(--white-color);  font-weight:500;  margin:0; } .about-section.style-6 .about-thumb-area .about-slider .array-button {  position:absolute;  bottom:0;  left:0;  z-index:999;  background:var(--theme-color3);  padding:28px 50px 17px;  max-width:220px;  width:100%;  border-top-right-radius:16px; } @media (max-width:430px) {  .about-section.style-6 .about-thumb-area .about-slider .array-button {   background:inherit;   position:inherit;   padding:0;   margin-top:20px;  } } .about-section.style-6 .about-thumb-area .about-slider .array-button::before {  position:absolute;  left:0;  top:-16px;  content:"";  height:16px;  width:16px;  background:url('data:image/svg+xml,<svg viewBox="0 0 11 11" fill="none" xmlns="http://www.w3.org/2000/svg" class="w-11 h-11"><path d="M11 1.54972e-06L0 0L2.38419e-07 11C1.65973e-07 4.92487 4.92487 1.62217e-06 11 1.54972e-06Z" fill="%23ecf8f8"></path></svg>');  transform:rotate(-90deg); } .about-section.style-6 .about-thumb-area .about-slider .array-button::after {  position:absolute;  right:-16px;  bottom:0;  content:"";  height:16px;  width:16px;  background:url('data:image/svg+xml,<svg viewBox="0 0 11 11" fill="none" xmlns="http://www.w3.org/2000/svg" class="w-11 h-11"><path d="M11 1.54972e-06L0 0L2.38419e-07 11C1.65973e-07 4.92487 4.92487 1.62217e-06 11 1.54972e-06Z" fill="%23ecf8f8"></path></svg>');  transform:rotate(-90deg); } .about-section.style-6 .about-thumb-area .about-slider .array-button .array-prev, .about-section.style-6 .about-thumb-area .about-slider .array-button .array-next {  background:var(--dark-color);  border:none; } .about-section.style-6 .about-thumb-area .about-slider .array-button .array-prev:hover, .about-section.style-6 .about-thumb-area .about-slider .array-button .array-prev.active, .about-section.style-6 .about-thumb-area .about-slider .array-button .array-next:hover, .about-section.style-6 .about-thumb-area .about-slider .array-button .array-next.active {  background:var(--theme-color); } .about-section.style-6 .about-content-wrapper .feature-list {  display:flex;  gap:25px;  } @media (max-width:575px) {  .about-section.style-6 .about-content-wrapper .feature-list {   flex-direction:column;  } } .about-section.style-6 .about-content-wrapper .feature-list .feature-item {  display:flex;  align-items:center;  gap:20px; } .about-section.style-6 .about-content-wrapper .feature-list .feature-item .icon {  display:flex;  justify-content:center;  align-items:center;  flex-shrink:0;  width:60px;  height:60px;  border-radius:50%;  background-color:var(--theme-color3);  font-size:30px;  color:var(--dark-color);  border:1px solid var(--bs-border-color12); } .about-section.style-6 .about-content-wrapper .feature-list .feature-item p {  font-size:18px;  line-height:26px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0; } .about-section.style-6 .about-content-wrapper .feature-list .feature-item:hover .icon i {  animation:mirror_effect 0.8s forwards ease-in-out 0s; } .about-section.style-6 .about-content-wrapper .features-list li {  font-size:16px;  line-height:28px;  color:var(--dark-color);  position:relative;  padding-left:27px; } @media (max-width:360px) {  .about-section.style-6 .about-content-wrapper .features-list li {   padding-left:20px;  } } .about-section.style-6 .about-content-wrapper .features-list li::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  width:18px;  height:18px;  background:url(/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/check-circle.png.webp); }  .about-section.style-7 .about-left {  position:relative; } .about-section.style-7 .about-left .image-box {  position:relative; } @media (max-width:1299px) {  .about-section.style-7 .about-left .image-box {   margin-right:-80px;  } } @media (min-width:992px) and (max-width:1024px) {  .about-section.style-7 .about-left .image-box {   margin-right:-170px;  } } @media (max-width:991px) {  .about-section.style-7 .about-left .image-box {   margin-right:0;  } } .about-section.style-7 .about-left .image-box .image-group .image1 {  margin-right:160px;  direction:rtl;  } @media (max-width:991px) {  .about-section.style-7 .about-left .image-box .image-group .image1 {   direction:inherit;   margin-right:0;  } } @media (max-width:430px) {  .about-section.style-7 .about-left .image-box .image-group .image1 img {   max-width:100% !important;  } } .about-section.style-7 .about-left .image-box .image-group .image2 {  display:flex;  justify-content:end;  margin-top:-140px;  margin-right:0px;  } @media (max-width:1500px) {  .about-section.style-7 .about-left .image-box .image-group .image2 {   margin-right:-20px;  } } @media (max-width:1399px) {  .about-section.style-7 .about-left .image-box .image-group .image2 {   margin-right:30px;  } } @media (max-width:1299px) {  .about-section.style-7 .about-left .image-box .image-group .image2 {   margin-right:100px;  } } @media (min-width:992px) and (max-width:1024px) {  .about-section.style-7 .about-left .image-box .image-group .image2 {   margin-right:180px;  } } @media (max-width:991px) {  .about-section.style-7 .about-left .image-box .image-group .image2 {   margin-right:400px;  } } @media (max-width:853px) {  .about-section.style-7 .about-left .image-box .image-group .image2 {   margin-right:300px;  } } @media (max-width:575px) {  .about-section.style-7 .about-left .image-box .image-group .image2 {   margin-right:150px;  } } @media (max-width:540px) {  .about-section.style-7 .about-left .image-box .image-group .image2 {   margin-right:0;   justify-content:center;  } } @media (max-width:430px) {  .about-section.style-7 .about-left .image-box .image-group .image2 {   margin-top:30px;  } } .about-section.style-7 .about-left .image-box .image-group .image2 .inner-box {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  align-items:flex-end;  width:300px;  height:350px;  border-radius:10px;  background-color:var(--dark-color3);  position:relative;  z-index:1;  overflow:hidden; } @media (max-width:430px) {  .about-section.style-7 .about-left .image-box .image-group .image2 .inner-box {   width:100%;  } } .about-section.style-7 .about-left .image-box .image-group .image2 .inner-box .img {  width:260px;  height:212px;  object-fit:cover; } .about-section.style-7 .about-left .image-box .image-group .image2 .inner-box .ellipse-path {  position:absolute;  content:"";  width:453px;  height:453px;  background:rgba(255, 255, 255, 0.07);  transition:all 0.4s ease-in-out;  border-radius:50%;  bottom:-285px;  z-index:-1; } .about-section.style-7 .about-left .image-box .image-group .image2 .inner-box .downloads-card {  position:absolute;  content:"";  left:50%;  transform:translateX(-50%);  transition:all 0.4s ease 0s;  top:45px;  text-align:center; } .about-section.style-7 .about-left .image-box .image-group .image2 .inner-box .downloads-card .download {  font-size:14px;  color:var(--white-color);  font-weight:400;  margin-bottom:13px; } .about-section.style-7 .about-left .image-box .image-group .image2 .inner-box .downloads-card .count-box {  font-size:50px;  color:var(--theme-color2);  font-weight:600;  display:flex;  align-items:center;  gap:15px; } .about-section.style-7 .about-left .image-box .image-group .image2 .inner-box .downloads-card .count-box .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:42px;  height:42px;  border-radius:50%;  background-color:var(--theme-color2);  font-size:24px;  color:var(--dark-color); } .about-section.style-7 .about-left .image-box .info-box {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  gap:15px;  width:310px;  height:120px;  border-radius:10px;  filter:drop-shadow(0px 20px 25px rgba(204, 219, 219, 0.3));  background-color:var(--white-color);  position:absolute;  bottom:40px;  left:-80px; } @media (max-width:1399px) {  .about-section.style-7 .about-left .image-box .info-box {   left:-50px;  } } @media (max-width:1299px) {  .about-section.style-7 .about-left .image-box .info-box {   bottom:70px;   z-index:1;   display:none;  } } @media (min-width:992px) and (max-width:1024px) {  .about-section.style-7 .about-left .image-box .info-box {   display:none;  } } @media (max-width:991px) {  .about-section.style-7 .about-left .image-box .info-box {   bottom:40px;  } } @media (max-width:575px) {  .about-section.style-7 .about-left .image-box .info-box {   display:none;  } } .about-section.style-7 .about-left .image-box .info-box .img {  border-radius:50%; } .about-section.style-7 .about-left .image-box .info-box .info .name {  font-size:20px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0; } .about-section.style-7 .about-left .image-box .info-box .info .position {  font-size:15px;  color:var(--gray-color);  margin-bottom:0; } .about-section.style-7 .about-left .dot-shape {  position:absolute;  top:50px;  right:10px; } @media (min-width:1024px) and (max-width:1399px) {  .about-section.style-7 .about-left .dot-shape {   display:none;  } } @media (max-width:991px) {  .about-section.style-7 .about-left .dot-shape {   right:320px;  } } @media (max-width:912px) {  .about-section.style-7 .about-left .dot-shape {   right:250px;  } } @media (max-width:820px) {  .about-section.style-7 .about-left .dot-shape {   right:150px;  } } @media (max-width:575px) {  .about-section.style-7 .about-left .dot-shape {   display:none;  } } .about-section.style-7 .about-left .circle-path_shape {  position:absolute;  content:"";  left:147px;  top:220px;  width:258px;  height:258px;  border-radius:50%;  background-color:var(--theme-color);  z-index:-1; } @media (max-width:430px) {  .about-section.style-7 .about-left .circle-path_shape {   top:150px;  } } @media (min-width:992px) and (max-width:1024px) {  .about-section.style-7 .about-left .circle-path_shape {   left:60px;  } } @media (max-width:991px) {  .about-section.style-7 .about-left .circle-path_shape {   left:220px;  } } @media (max-width:767px) {  .about-section.style-7 .about-left .circle-path_shape {   left:100px;  } } @media (max-width:540px) {  .about-section.style-7 .about-left .circle-path_shape {   display:none;  } } .about-section.style-7 .about-content-wrapper .sec-text {  max-width:90%; } .about-section.style-7 .about-content-wrapper .feature-list {  display:flex;  gap:25px;  } @media (max-width:575px) {  .about-section.style-7 .about-content-wrapper .feature-list {   flex-direction:column;  } } .about-section.style-7 .about-content-wrapper .feature-list .feature-item {  display:flex;  align-items:center;  gap:20px; } .about-section.style-7 .about-content-wrapper .feature-list .feature-item:hover .icon i {  animation:mirror_effect 0.8s forwards ease-in-out 0s; } .about-section.style-7 .about-content-wrapper .feature-list .feature-item .icon {  background-color:var(--white-color);  display:flex;  justify-content:center;  align-items:center;  flex-shrink:0;  width:60px;  height:60px;  border-radius:50%;  font-size:30px;  color:var(--dark-color); } .about-section.style-7 .about-content-wrapper .feature-list .feature-item p {  font-size:18px;  line-height:26px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0; } .about-section.style-7 .about-content-wrapper .features-list li {  font-size:16px;  line-height:28px;  color:var(--dark-color);  position:relative;  padding-left:25px; } @media (max-width:360px) {  .about-section.style-7 .about-content-wrapper .features-list li {   padding-left:20px;  } } .about-section.style-7 .about-content-wrapper .features-list li + li {  margin-top:7px; } .about-section.style-7 .about-content-wrapper .features-list li::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  width:18px;  height:18px;  background:url(/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/check-circle.png.webp); } .dark-mode .about-section .about-left .image-box .info-box {  filter:inherit;  background-color:var(--dark-color3); } .dark-mode .about-section .about-left .image-box .info-box .info .name {  color:var(--white-color); } .dark-mode .about-section .about-left .image-box .info-box .info .position {  color:var(--gray-color2); } .dark-mode .about-section .about-content-wrapper .sec-text {  max-width:90%;  color:var(--gray-color2) !important; } .dark-mode .about-section .about-content-wrapper .feature-list .feature-item .icon {  background-color:var(--dark-color3);  color:var(--white-color); } .dark-mode .about-section .about-content-wrapper .feature-list .feature-item p {  color:var(--white-color); } .dark-mode .about-section .about-content-wrapper .features-list li {  color:var(--white-color); }  .brands-section {  position:relative;  z-index:2; } .brands-section .sponsors-outer {  border-top:1px solid var(--bs-border-color5);  border-bottom:1px solid var(--bs-border-color5); } .brands-section .sponsors-outer .trusted-partners {  font-size:18px;  color:var(--dark-color); } .brands-slider {  position:relative;  padding:58px 0;  } @media (max-width:575px) {  .brands-slider {   padding:35px 0;  } } .brands-slider .brand-item {  position:relative;  overflow:hidden;  text-align:center;  display:flex; } .brands-slider .brand-item .image {  display:inline-block;  width:100%;  position:relative;  overflow:hidden; } .brands-slider .brand-item .image:hover img {  opacity:1; } .brands-slider .brand-item .image:hover img:first-child {  transform:translateX(0) scaleX(1);  opacity:1;  filter:blur(0) grayscale(0) brightness(100%);  transition:all 0.4s ease 0s; } .brands-slider .brand-item .image:hover img:nth-child(2) {  transform:translateX(-50%) scaleX(2);  opacity:0;  filter:blur(10px); } .brands-slider .brand-item .image img {  display:inline-block;  max-width:100%;  width:auto;  height:auto;  transition:all 0.4s ease 0s; } .brands-slider .brand-item .image img:first-child {  position:absolute;  left:0;  right:0;  top:0;  bottom:0;  z-index:1;  margin:auto;  transform:translateX(50%) scaleX(2);  opacity:0;  filter:blur(10px); }  .service-section {  position:relative; } .service-btn-wrapper {  display:flex;  align-items:center;  gap:40px; } .service-btn-wrapper .array-button {  gap:10px; } .service-btn-wrapper .array-button .s-prev, .service-btn-wrapper .array-button .s-next {  width:60px;  height:60px;  border:none !important;  background:var(--dark-color3);  color:var(--theme-color2); } .service-btn-wrapper .array-button .s-prev:hover, .service-btn-wrapper .array-button .s-next:hover {  color:var(--white-color);  background:var(--theme-color); } .service-btn-wrapper .array-button .s-next.active {  color:var(--white-color);  background:var(--theme-color);  border-color:var(--theme-color); } .service-btn-wrapper .service-btn a {  color:var(--white-color);  transition:all 0.4s ease 0s;  background:linear-gradient(var(--white-color) 0%, var(--white-color) 98%);  background-repeat:no-repeat;  background-size:87% 1px;  background-position:left 100%; } .service-btn-wrapper .service-btn a:hover {  background-size:0 1px; } .service-btn-wrapper .service-btn svg {  fill:var(--dark-color); } .service-single-box {  padding:50px 40px 50px;  border-radius:10px;  position:relative;  z-index:1;  overflow:hidden; } @media (max-width:1024px) {  .service-single-box {   padding:50px 30px 50px;  } } @media (min-width:992px) and (max-width:1024px) {  .service-single-box {   padding:50px 24px 50px;  } } .service-single-box:hover .service-btn {  padding:8px 25px;  max-width:170px;  gap:10px; } .service-single-box:hover .service-btn .link-text {  animation:typing 1s steps(20) forwards;  visibility:visible; } .service-single-box:hover .service-btn svg {  fill:var(--theme-color2); } .service-single-box:hover .icon i {  animation:mirrorWave 0.5s forwards ease-in-out 0s; } .service-single-box.white .icon {  filter:brightness(0) invert(1); } .service-single-box .icon {  font-size:60px;  color:var(--dark-color);  transition:all 0.4s ease 0s; } .service-single-box .title {  font-size:26px;  font-weight:600;  transition:all 0.4s ease 0s; } .service-single-box .text {  font-size:16px;  line-height:1.66;  color:var(--dark-color);  margin-bottom:23px;  transition:all 0.4s ease 0s; } .service-single-box .service-btn {  border:1px solid var(--dark-color);  padding:8px 14px;  background:transparent;  overflow:hidden;  max-width:45px;  gap:0;  display:flex;  align-items:center; } .service-single-box .service-btn svg {  fill:var(--dark-color); } .service-single-box .service-btn .link-text {  opacity:0;  visibility:hidden;  transition:all 300ms ease;  position:relative;  display:block;  height:26px;  white-space:nowrap;  overflow:hidden;  width:0; } .service-single-box .serial {  position:absolute;  top:35px;  right:35px;  color:var(--dark-color);  font-size:20px;  font-weight:500; } .service-single-box.white .serial, .service-single-box.white .icon, .service-single-box.white .title, .service-single-box.white .text {  color:var(--white-color); } .service-single-box.white .service-btn {  color:var(--white-color);  border-color:var(--white-color); } .service-contact {  padding:40px 60px 40px 50px;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:space-between;  background-color:var(--dark-color3);  clip-path:polygon(30px 0, 100% 0, 100% 50%, 100% 100%, 0 100%, 0 30px);  } @media (max-width:912px) {  .service-contact {   flex-direction:column;  } } @media (max-width:575px) {  .service-contact {   padding:40px 30px 50px;   margin-bottom:80px;  } } .service-contact .social-proof {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  gap:25px;  } @media (max-width:575px) {  .service-contact .social-proof {   gap:15px;   flex-direction:column;   margin-bottom:15px;  } } .service-contact .social-proof .social img {  width:57px;  height:57px;  border-radius:50%;  margin-left:-30px; } .service-contact .social-proof .social img:first-child {  margin-left:0; } .service-contact .social-proof .text {  font-size:18px;  color:var(--white-color);  margin-bottom:0; } @media (max-width:540px) {  .service-contact .social-proof .text {   width:80%;   text-align:center;  } } @media (max-width:430px) {  .service-contact .social-proof .text {   width:100%;  } }  .service-section.style-2 .service-single-box {  background-color:var(--theme-color3);  transition:background-color 0.4s ease-in-out; } .service-section.style-2 .service-single-box:hover {  background-color:var(--dark-color); } .service-section.style-2 .service-single-box:hover .icon {  color:var(--theme-color2);  filter:brightness(0) saturate(100%) invert(91%) sepia(12%) saturate(1224%) hue-rotate(31deg) brightness(104%) contrast(75%); } .service-section.style-2 .service-single-box:hover .title {  color:var(--white-color); } .service-section.style-2 .service-single-box:hover .text {  color:var(--gray-color2); } .service-section.style-2 .service-single-box:hover .serial {  color:var(--theme-color2); } .service-section.style-2 .service-single-box:hover .service-btn {  color:var(--theme-color2);  border-color:var(--theme-color2); } .service-section.style-2 .service-single-box:hover .border::before {  left:0;  width:100%; } .service-section.style-2 .service-single-box:hover .path__shape {  opacity:1; } .service-section.style-2 .service-single-box:hover .path__shape::after {  right:50px;  bottom:50px; } .service-section.style-2 .service-single-box .border::before {  position:absolute;  content:"";  width:0;  height:1px;  background:var(--theme-color2);  transition:all 0.4s ease-in-out;  left:50%; } .service-section.style-2 .service-single-box .path__shape {  opacity:0;  transition:opacity 0.4s ease-in-out; } .service-section.style-2 .service-single-box .path__shape::before {  position:absolute;  content:"";  width:50px;  height:50px;  background:var(--bs-border-color);  transition:all 0.4s ease-in-out;  right:0;  bottom:0; } .service-section.style-2 .service-single-box .path__shape::after {  position:absolute;  content:"";  width:40px;  height:40px;  background:var(--bs-border-color);  transition:all 0.4s ease-in-out;  right:0;  bottom:0; }  .service-section.style-3 .service-btn-inner {  gap:30px; } .service-section.style-3 .service-btn-inner .line {  width:100%;  height:1px;  background:var(--bs-border-color); } .service-section.style-3 .service-btn-inner .array-prev, .service-section.style-3 .service-btn-inner .array-next {  border-color:var(--bs-border-color);  background-color:var(--bs-border-color);  color:rgba(255, 255, 255, 0.5);  transition:all 0.4s ease 0s; } .service-section.style-3 .service-btn-inner .array-prev:hover, .service-section.style-3 .service-btn-inner .array-next:hover {  color:var(--white-color); } .service-section.style-3 .service-single-box {  background-color:var(--theme-color3);  transition:background-color 0.4s ease-in-out; } .service-section.style-3 .service-single-box:hover {  background-color:var(--dark-color3); } .service-section.style-3 .service-single-box:hover .icon {  color:var(--theme-color2);  filter:brightness(0) saturate(100%) invert(91%) sepia(12%) saturate(1224%) hue-rotate(31deg) brightness(104%) contrast(75%); } .service-section.style-3 .service-single-box:hover .title {  color:var(--white-color); } .service-section.style-3 .service-single-box:hover .text {  color:var(--gray-color2); } .service-section.style-3 .service-single-box:hover .serial {  color:var(--theme-color2); } .service-section.style-3 .service-single-box:hover .service-btn {  color:var(--theme-color2);  border-color:var(--theme-color2); } .service-section.style-3 .service-single-box:hover .border::before {  left:0;  width:100%; } .service-section.style-3 .service-single-box:hover .path__shape {  opacity:1; } .service-section.style-3 .service-single-box:hover .path__shape::after {  right:50px;  bottom:50px; } .service-section.style-3 .service-single-box .border::before {  position:absolute;  content:"";  width:0;  height:1px;  background:var(--theme-color2);  transition:all 0.4s ease-in-out;  left:50%; } .service-section.style-3 .service-single-box .path__shape {  opacity:0;  transition:opacity 0.4s ease-in-out; } .service-section.style-3 .service-single-box .path__shape::before {  position:absolute;  content:"";  width:50px;  height:50px;  background:var(--bs-border-color);  transition:all 0.4s ease-in-out;  right:0;  bottom:0; } .service-section.style-3 .service-single-box .path__shape::after {  position:absolute;  content:"";  width:40px;  height:40px;  background:var(--bs-border-color);  transition:all 0.4s ease-in-out;  right:0;  bottom:0; } @media (min-width:991.99px) {  .service-section.style-3 .swiper-slide-active .service-single-box {   background-color:var(--dark-color3);  }  .service-section.style-3 .swiper-slide-active .service-single-box .icon {   color:var(--theme-color2);   filter:brightness(0) saturate(100%) invert(91%) sepia(12%) saturate(1224%) hue-rotate(31deg) brightness(104%) contrast(75%);  }  .service-section.style-3 .swiper-slide-active .service-single-box .title {   color:var(--white-color);  }  .service-section.style-3 .swiper-slide-active .service-single-box .text {   color:var(--gray-color2);  }  .service-section.style-3 .swiper-slide-active .service-single-box .serial {   color:var(--theme-color2);  }  .service-section.style-3 .swiper-slide-active .service-single-box .service-btn {   color:var(--theme-color2);   border-color:var(--theme-color2);  }  .service-section.style-3 .swiper-slide-active .service-single-box .border::before {   left:0;   width:100%;  }  .service-section.style-3 .swiper-slide-active .service-single-box .path__shape {   opacity:1;  }  .service-section.style-3 .swiper-slide-active .service-single-box .path__shape::after {   right:50px;   bottom:50px;  } }  .service-section.style-4 .service-tabs .service-tab {  border-bottom:2px solid var(--bs-border-color);  cursor:pointer;  position:relative; } .service-section.style-4 .service-tabs .service-tab.active::before, .service-section.style-4 .service-tabs .service-tab:hover::before {  width:90%;  } @media (max-width:991px) {  .service-section.style-4 .service-tabs .service-tab.active::before, .service-section.style-4 .service-tabs .service-tab:hover::before {   width:100%;  } } .service-section.style-4 .service-tabs .service-tab::before {  position:absolute;  content:"";  left:0;  bottom:0;  width:0;  height:2px;  background-color:var(--theme-color2);  transition:all 0.4s ease 0s; } .service-section.style-4 .service-tabs .service-tab h5 {  font-size:20px;  line-height:28px;  color:var(--white-color);  font-weight:500;  margin-bottom:19px;  transition:all 0.4s ease 0s; } .service-section.style-4 .service-tab-wrapper {  display:none; } .service-section.style-4 .service-tab-wrapper.active {  display:block; } .service-section.style-4 .service-image-wrapper .image-box {  display:inline-block;  position:relative; } .service-section.style-4 .service-content-wrap {  margin-right:63px;  } @media (max-width:991px) {  .service-section.style-4 .service-content-wrap {   margin-right:0;  } } .service-section.style-4 .service-content-wrap .features-list li {  font-size:16px;  line-height:28px;  color:var(--white-color);  position:relative;  padding-left:25px; } .service-section.style-4 .service-content-wrap .features-list li + li {  margin-top:7px; } .service-section.style-4 .service-content-wrap .features-list li::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  width:18px;  height:18px;  background:url(/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/check-circle.png.webp);  filter:brightness(0) saturate(100%) invert(91%) sepia(12%) saturate(1224%) hue-rotate(31deg) brightness(104%) contrast(75%); } .service-section.style-4 .service-tab-wrapper {  display:none;  opacity:0;  transition:opacity 0.3s ease; } .service-section.style-4 .service-tab-wrapper.active {  display:block;  opacity:1; } .service-bottom .social-proof {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  gap:20px;  } @media (max-width:575px) {  .service-bottom .social-proof {   gap:15px;   flex-direction:column;   align-items:flex-start;   margin-bottom:15px;   margin-bottom:0;  } } .service-bottom .social-proof .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:60px;  height:60px;  border-radius:50%;  background-color:var(--dark-color);  font-size:34px;  color:var(--theme-color2);  flex-shrink:0; } .service-bottom .social-proof .icon svg {  width:34px;  fill:var(--theme-color2); } .service-bottom .social-proof .text {  font-size:18px;  color:var(--dark-color);  margin-bottom:0; } @media (max-width:540px) {  .service-bottom .social-proof .text {   width:80%;   text-align:center;  } } @media (max-width:430px) {  .service-bottom .social-proof .text {   width:100%;  } } @media (max-width:540px) {  .service-bottom .social-proof .text {   text-align:left;  } }  .service-box-five {  position:relative;  z-index:1;  margin-bottom:10px; } .service-box-five::before {  position:absolute;  content:"";  left:50%;  transform:translateX(-50%);  transition:all 0.4s ease 0s;  top:10px;  width:90%;  height:100%;  border-radius:20px;  background:var(--light-color4);  z-index:-1;  transition:all 0.4s ease 0s; } .service-box-five:hover .inner-box {  transform:translateY(10px); } .service-box-five:hover .inner-box::before {  left:0;  width:100%; } .service-box-five:hover .inner-box .border {  border-color:var(--bs-border-color2) !important; } .service-box-five:hover .inner-box .title a {  color:var(--white-color); } .service-box-five:hover .inner-box .text {  color:var(--gray-color2); } .service-box-five:hover .inner-box .service-btn {  padding-left:237px;  color:var(--theme-color2); } @media (min-width:992px) and (max-width:1024px) {  .service-box-five:hover .inner-box .service-btn {   padding-left:160px;  } } .service-box-five:hover .inner-box .service-btn::before {  width:67%;  background:var(--bs-border-color2); } @media (min-width:992px) and (max-width:1024px) {  .service-box-five:hover .inner-box .service-btn::before {   width:57%;  } } .service-box-five:hover .inner-box .icon img {  animation:wobble_vertical 1s forwards ease-in-out 0s; } .service-box-five .inner-box {  background:var(--white-color);  padding:40px 40px 40px;  border-radius:20px;  position:relative;  z-index:1;  overflow:hidden;  transition:all 0.4s ease 0s; } @media (max-width:1024px) {  .service-box-five .inner-box {   padding:50px 30px 50px;  } } @media (min-width:992px) and (max-width:1024px) {  .service-box-five .inner-box {   padding:50px 24px 50px;  } } .service-box-five .inner-box::before {  content:"";  position:absolute;  right:0;  top:0;  width:0;  height:100%;  background:var(--dark-color);  z-index:-1;  transition:all 0.4s ease 0s; } .service-box-five .inner-box.white .icon {  filter:brightness(0) invert(1); } .service-box-five .inner-box .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:70px;  height:70px;  border-radius:50%;  background:var(--theme-color3);  font-size:30px;  color:var(--dark-color);  transition:all 0.4s ease 0s; } .service-box-five .inner-box .icon svg {  fill:var(--dark-color);  width:30px;  height:30px; } .service-box-five .inner-box .title {  font-size:22px;  font-weight:500;  margin-bottom:5px;  transition:all 0.4s ease 0s; } .service-box-five .inner-box .title:hover a {  color:var(--theme-color2); } .service-box-five .inner-box .text {  font-size:16px;  line-height:1.66;  margin-bottom:21px;  transition:all 0.4s ease 0s; } .service-box-five .inner-box .border {  transition:all 0.4s ease 0s; } .service-box-five .inner-box .service-btn {  font-size:16px;  color:var(--dark-color);  font-weight:500;  position:relative;  z-index:1; } .service-box-five .inner-box .service-btn::before {  content:"";  position:absolute;  left:0;  top:10px;  width:0;  height:1px;  background:var(--dark-color);  z-index:-1;  transition:all 0.4s ease 0s; } .service-box-five .inner-box .serial {  position:absolute;  top:40px;  right:40px;  font-size:18px;  color:var(--gray-color);  font-weight:400; } .dark-mode .service-box-five:before {  background:var(--bs-bg-color20); } .dark-mode .service-box-five .inner-box {  background:var(--dark-color3); } .dark-mode .service-box-five .inner-box::before {  background:var(--dark-color3); } .dark-mode .service-box-five .inner-box .p-top-left {  opacity:0;  transition:all 0.4s ease 0s; } .dark-mode .service-box-five .inner-box .icon {  background:var(--bs-bg-color10); } .dark-mode .service-box-five .inner-box .icon img {  filter:brightness(0) saturate(100%) invert(91%) sepia(12%) saturate(1224%) hue-rotate(31deg) brightness(104%) contrast(75%); } .dark-mode .service-box-five .inner-box .title a {  color:var(--white-color); } .dark-mode .service-box-five .inner-box .text {  color:var(--gray-color2); } .dark-mode .service-box-five .inner-box a {  color:var(--gray-color2); } .dark-mode .service-box-five .inner-box span {  color:var(--gray-color2); } .dark-mode .service-box-five:hover .inner-box .p-top-left {  opacity:1;  transition:all 0.4s ease 0s; } .dark-mode .service-box-five:hover .inner-box .icon {  background:var(--theme-color2); } .dark-mode .service-box-five:hover .inner-box .icon img {  filter:brightness(0) saturate(100%) invert(12%) sepia(97%) saturate(556%) hue-rotate(135deg) brightness(92%) contrast(95%); }  .service-section.style-6 .service-title-area {  } @media (max-width:575px) {  .service-section.style-6 .service-title-area {   flex-direction:column;   align-items:start;  } } .service-section.style-6 .service-title-area .service-btn {  display:flex;  justify-content:center;  align-items:center; } .service-section.style-6 .service-wrapper {  display:flex;  flex-direction:column; } .service-section.style-6 .service-wrapper .service-single-item {  display:flex;  align-items:center;  border-top:1px solid var(--bs-border-color6);  padding:38px 40px;  position:relative;  overflow:hidden; } @media (max-width:1024px) {  .service-section.style-6 .service-wrapper .service-single-item {   flex-direction:column;   align-items:start;  } } @media (max-width:853px) {  .service-section.style-6 .service-wrapper .service-single-item {   padding:38px 0px;  } } .service-section.style-6 .service-wrapper .service-single-item:last-child {  border-bottom:1px solid var(--bs-border-color6); } .service-section.style-6 .service-wrapper .service-single-item::before {  content:"";  position:absolute;  inset:0;  background:var(--theme-color3);  transform:scaleY(0);  transform-origin:var(--hover-origin);  border-radius:20px;  transition:transform 0.5s cubic-bezier(0.645, 0.045, 0.355, 1);  z-index:-1; } .service-section.style-6 .service-wrapper .service-single-item.hover-active::before {  transform:scaleY(1); } .service-section.style-6 .service-wrapper .service-single-item.exit-top::before {  transform-origin:top;  transform:scaleY(0); } .service-section.style-6 .service-wrapper .service-single-item.exit-bottom::before {  transform-origin:bottom;  transform:scaleY(0); } .service-section.style-6 .service-wrapper .service-single-item .item-left {  flex-shrink:0; } .service-section.style-6 .service-wrapper .service-single-item .item-left .image {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:-275px;  border-radius:20px;  overflow:hidden;  opacity:0;  visibility:hidden; } @media (max-width:1024px) {  .service-section.style-6 .service-wrapper .service-single-item .item-left .image {   position:relative;   overflow:auto;   transform:translateY(0);   border-radius:0;   left:0;   opacity:1;   visibility:visible;  } } .service-section.style-6 .service-wrapper .service-single-item .item-left .image img {  opacity:0;  transform:translateX(-5%);  clip-path:inset(0 100% 0 0);  transition:clip-path 0.8s cubic-bezier(0.645, 0.045, 0.355, 1), transform 0.8s cubic-bezier(0.645, 0.045, 0.355, 1), opacity 0.8s ease; } @media (max-width:1024px) {  .service-section.style-6 .service-wrapper .service-single-item .item-left .image img {   opacity:1;   transform:inherit;   clip-path:inherit;   transition:inherit;   margin-bottom:20px;  } } .service-section.style-6 .service-wrapper .service-single-item .item-left .item-wrap {  display:flex;  align-items:center;  gap:20px;  transition:all 0.4s ease 0s;  } @media (max-width:375px) {  .service-section.style-6 .service-wrapper .service-single-item .item-left .item-wrap {   gap:10px;  } } .service-section.style-6 .service-wrapper .service-single-item .item-left .item-wrap .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  height:70px;  width:70px;  border-radius:50%;  background:var(--theme-color3);  position:relative;  z-index:1; } .service-section.style-6 .service-wrapper .service-single-item .item-left .item-wrap .icon::before {  content:"";  position:absolute;  z-index:-1;  left:0;  top:0;  width:100%;  border-radius:50%;  transform:scale(0);  height:100%;  background:var(--theme-color);  transition:all 0.5s ease 0s; } .service-section.style-6 .service-wrapper .service-single-item .item-left .item-wrap .text {  margin:0;  font-size:28px;  line-height:1;  color:var(--dark-color);  font-weight:600;  } @media (max-width:375px) {  .service-section.style-6 .service-wrapper .service-single-item .item-left .item-wrap .text {   font-size:22px;  } } .service-section.style-6 .service-wrapper .service-single-item .item-right .item-right-inner {  display:flex;  align-items:center;  gap:60px;  justify-content:flex-end; } @media (max-width:1024px) {  .service-section.style-6 .service-wrapper .service-single-item .item-right .item-right-inner {   flex-direction:column;   align-items:start;   gap:20px;  } } .service-section.style-6 .service-wrapper .service-single-item .item-right .item-right-inner p {  margin:0;  max-width:50%; } @media (max-width:1024px) {  .service-section.style-6 .service-wrapper .service-single-item .item-right .item-right-inner p {   max-width:100%;   margin-top:20px;  } } .service-section.style-6 .service-wrapper .service-single-item .item-right .item-right-inner .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  height:30px;  width:30px;  background:transparent;  border-radius:50%;  border:1px solid var(--bs-border-color7);  transition:all 0.5s ease 0s;  flex-shrink:0; } .service-section.style-6 .service-wrapper .service-single-item:hover .item-left .image {  opacity:1;  visibility:visible;  left:0px; } .service-section.style-6 .service-wrapper .service-single-item:hover .item-left .image img {  opacity:1;  transform:translateX(0);  clip-path:inset(0 0 0 0); } .service-section.style-6 .service-wrapper .service-single-item:hover .item-left .item-wrap {  transform:translateX(270px);  } @media (max-width:1199px) {  .service-section.style-6 .service-wrapper .service-single-item:hover .item-left .item-wrap {   transform:translateX(250px);  } } .service-section.style-6 .service-wrapper .service-single-item:hover .item-left .item-wrap .icon::before {  transform:scale(1); } .service-section.style-6 .service-wrapper .service-single-item:hover .item-left .item-wrap .icon img {  filter:brightness(0) invert(1); } .service-section.style-6 .service-wrapper .service-single-item:hover .item-right .icon {  color:var(--theme-color);  border-color:var(--theme-color); } @media (max-width:1024px) {  .service-section.style-6 .service-wrapper .service-single-item:hover {   display:none;  } }  .service-section.style-7 .service-title-area {  } @media (max-width:575px) {  .service-section.style-7 .service-title-area {   flex-direction:column;   align-items:start;  } } .service-section.style-7 .service-title-area .service-btn {  display:flex;  justify-content:center;  align-items:center; } .service-section.style-7 .service-wrapper {  display:flex;  flex-direction:column; } .service-section.style-7 .service-wrapper .service-single-item {  display:flex;  align-items:center;  border-top:1px solid var(--bs-border-color2);  padding:38px 40px;  position:relative;  overflow:hidden; } @media (max-width:1024px) {  .service-section.style-7 .service-wrapper .service-single-item {   flex-direction:column;   align-items:start;  } } @media (max-width:853px) {  .service-section.style-7 .service-wrapper .service-single-item {   padding:38px 0px;  } } .service-section.style-7 .service-wrapper .service-single-item:last-child {  border-bottom:1px solid var(--bs-border-color2); } .service-section.style-7 .service-wrapper .service-single-item::before {  content:"";  position:absolute;  inset:0;  background:var(--dark-color3);  transform:scaleY(0);  transform-origin:var(--hover-origin);  border-radius:20px;  transition:transform 0.5s cubic-bezier(0.645, 0.045, 0.355, 1);  z-index:-1; } .service-section.style-7 .service-wrapper .service-single-item.hover-active::before {  transform:scaleY(1); } .service-section.style-7 .service-wrapper .service-single-item.exit-top::before {  transform-origin:top;  transform:scaleY(0); } .service-section.style-7 .service-wrapper .service-single-item.exit-bottom::before {  transform-origin:bottom;  transform:scaleY(0); } .service-section.style-7 .service-wrapper .service-single-item .item-left {  flex-shrink:0; } .service-section.style-7 .service-wrapper .service-single-item .item-left .image {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:-275px;  border-radius:20px;  overflow:hidden;  opacity:0;  visibility:hidden; } @media (max-width:1024px) {  .service-section.style-7 .service-wrapper .service-single-item .item-left .image {   position:relative;   overflow:auto;   transform:translateY(0);   border-radius:0;   left:0;   opacity:1;   visibility:visible;  } } .service-section.style-7 .service-wrapper .service-single-item .item-left .image img {  opacity:0;  transform:translateX(-5%);  clip-path:inset(0 100% 0 0);  transition:clip-path 0.8s cubic-bezier(0.645, 0.045, 0.355, 1), transform 0.8s cubic-bezier(0.645, 0.045, 0.355, 1), opacity 0.8s ease; } @media (max-width:1024px) {  .service-section.style-7 .service-wrapper .service-single-item .item-left .image img {   opacity:1;   transform:inherit;   clip-path:inherit;   transition:inherit;   margin-bottom:20px;  } } .service-section.style-7 .service-wrapper .service-single-item .item-left .item-wrap {  display:flex;  align-items:center;  gap:20px;  transition:all 0.4s ease 0s;  } @media (max-width:375px) {  .service-section.style-7 .service-wrapper .service-single-item .item-left .item-wrap {   gap:10px;  } } .service-section.style-7 .service-wrapper .service-single-item .item-left .item-wrap .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  height:70px;  width:70px;  border-radius:50%;  background:var(--dark-color3);  position:relative;  z-index:1; } .service-section.style-7 .service-wrapper .service-single-item .item-left .item-wrap .icon img {  filter:brightness(0) saturate(100%) invert(91%) sepia(12%) saturate(1224%) hue-rotate(31deg) brightness(104%) contrast(75%); } .service-section.style-7 .service-wrapper .service-single-item .item-left .item-wrap .icon::before {  content:"";  position:absolute;  z-index:-1;  left:0;  top:0;  width:100%;  border-radius:50%;  transform:scale(0);  height:100%;  background:var(--theme-color);  transition:all 0.5s ease 0s; } .service-section.style-7 .service-wrapper .service-single-item .item-left .item-wrap .text {  margin:0;  font-size:28px;  line-height:1;  color:var(--white-color);  font-weight:600; } .service-section.style-7 .service-wrapper .service-single-item .item-left .item-wrap .text a {  color:var(--white-color); } .service-section.style-7 .service-wrapper .service-single-item .item-left .item-wrap .text a:hover {  color:var(--theme-color); } @media (max-width:414px) {  .service-section.style-7 .service-wrapper .service-single-item .item-left .item-wrap .text {   font-size:22px;  } } .service-section.style-7 .service-wrapper .service-single-item .item-right .item-right-inner {  display:flex;  align-items:center;  gap:60px;  justify-content:flex-end; } @media (max-width:1024px) {  .service-section.style-7 .service-wrapper .service-single-item .item-right .item-right-inner {   flex-direction:column;   align-items:start;   gap:20px;  } } .service-section.style-7 .service-wrapper .service-single-item .item-right .item-right-inner p {  margin:0;  max-width:50%;  color:var(--gray-color2); } @media (max-width:1024px) {  .service-section.style-7 .service-wrapper .service-single-item .item-right .item-right-inner p {   max-width:100%;   margin-top:20px;  } } .service-section.style-7 .service-wrapper .service-single-item .item-right .item-right-inner .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  height:30px;  width:30px;  background:transparent;  border-radius:50%;  border:1px solid var(--gray-color2);  color:var(--gray-color2);  transition:all 0.5s ease 0s;  flex-shrink:0; } .service-section.style-7 .service-wrapper .service-single-item:hover .item-left .image {  opacity:1;  visibility:visible;  left:0px; } .service-section.style-7 .service-wrapper .service-single-item:hover .item-left .image img {  opacity:1;  transform:translateX(0);  clip-path:inset(0 0 0 0); } .service-section.style-7 .service-wrapper .service-single-item:hover .item-left .item-wrap {  transform:translateX(270px);  } @media (max-width:1199px) {  .service-section.style-7 .service-wrapper .service-single-item:hover .item-left .item-wrap {   transform:translateX(250px);  } } .service-section.style-7 .service-wrapper .service-single-item:hover .item-left .item-wrap .icon::before {  transform:scale(1); } .service-section.style-7 .service-wrapper .service-single-item:hover .item-left .item-wrap .icon img {  filter:brightness(0) invert(1); } .service-section.style-7 .service-wrapper .service-single-item:hover .item-right .icon {  color:var(--theme-color2);  border-color:var(--theme-color2); } @media (max-width:1024px) {  .service-section.style-7 .service-wrapper .service-single-item:hover {   display:none;  } }  .service-details {  position:relative; } .service-sidebar {  position:sticky;  top:100px;  display:block;  max-width:392px;  width:100%;  } @media (max-width:991px) {  .service-sidebar {   max-width:100%;   margin-bottom:40px;  } } .service-sidebar .service-sidebar-single {  position:relative;  display:block; } .widget.service-details-help {  position:relative;  z-index:1;  overflow:hidden;  padding:40px 35px 40px;  text-align:center;  background-color:var(--dark-color); } .widget.service-details-help:hover .icon img {  animation:wobble_vertical 0.8s forwards ease-in-out 0s; } .widget.service-details-help .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:90px;  height:90px;  border-radius:10px;  background-color:var(--theme-color2);  margin:0 auto 34px; } .widget.service-details-help .icon img {  transition:all 0.4s ease 0s;  width:54px;  height:auto;  object-fit:cover; } .widget.service-details-help .help-title {  font-size:30px;  color:var(--white-color);  font-weight:500;  margin-bottom:20px; } @media (min-width:1024px) and (max-width:1280px) {  .widget.service-details-help .help-title {   font-size:20px;   margin-bottom:20px;  } } @media (max-width:767px) {  .widget.service-details-help .help-title {   margin-bottom:20px;  } } @media (max-width:375px) {  .widget.service-details-help .help-title br {   display:none;  } } .widget.service-details-help .text {  color:var(--bs-text-color2);  margin-bottom:38px; } .service-download-btn {  margin-bottom:10px; } .service-download-btn:last-child {  margin-bottom:0; } .service-download-btn .theme-btn {  text-align:left;  justify-content:start;  border-radius:7px;  padding:17px 25px;  } @media (min-width:1024px) and (max-width:1280px) {  .service-download-btn .theme-btn {   padding:13px 10px !important;  } } @media (max-width:375px) {  .service-download-btn .theme-btn {   padding-right:0;   padding-left:10px;  } } .service-download-btn .theme-btn i {  font-size:20px;  color:var(--white-color); } .service-download-btn .theme-btn svg {  width:20px;  max-height:20px;  fill:var(--white-color); } .service-download-btn .theme-btn.bg-dark {  color:var(--white-color); } .service-download-btn .theme-btn.bg-dark:hover {  color:var(--white-color); } .services-details__content > .image img {  width:100%; } .services-details__content h3 {  font-size:32px; } @media (max-width:375px) {  .services-details__content h3 {   font-size:25px;  } } @media (max-width:767px) {  .services-details__content h3 br {   display:none;  } } .services-details__content .title-two {  margin-top:33px; } .services-details__content p {  font-size:16px; } .service-details-block {  padding:30px;  background-color:var(--light-color);  border-radius:7px;  margin-bottom:40px; } .service-details-block .inner-box .icon {  display:inline-block;  width:60px;  height:60px;  line-height:60px;  text-align:center;  background:var(--theme-color);  border-radius:50%;  flex-shrink:0; } .service-details-block .inner-box .icon img {  width:31px;  height:auto;  object-fit:cover;  transition:all 0.4s ease 0s; } @media (min-width:1024px) and (max-width:1280px) {  .service-details-block .inner-box .title {   font-size:16px;  } } .service-details-block:hover .inner-box .icon img {  transform:scaleX(-1); } .featured-list-box .featured-list h4 {  font-size:28px;  margin-bottom:10px;  margin-top:0;  letter-spacing:0.4px; } .featured-list-box .featured-list .text {  font-size:16px;  margin-bottom:13px; } .featured-list-box .list-style-2 li span {  position:absolute;  left:0;  top:50%;  -webkit-transform:translateY(-50%);  -ms-transform:translateY(-50%);  transform:translateY(-50%); } .stat-container {  display:flex;  position:absolute; } @media (max-width:430px) {  .stat-container {   flex-direction:column;   gap:30px;  } } .stat-container .stat-box {  padding:35px;  flex:1;  display:flex;  flex-direction:column;  justify-content:center; } @media (max-width:375px) {  .stat-container .stat-box {   padding:30px;  } } @media (max-width:991px) {  .stat-container .stat-box:first-child {   border-bottom-left-radius:10px;  }  .stat-container .stat-box:nth-child(2) {   border-top-right-radius:10px;  } } @media (max-width:430px) {  .stat-container .stat-box {   border-radius:10px;  } } .stat-container .stat-box .count-box {  font-size:46px;  line-height:0.7;  color:var(--dark-color);  font-weight:600;  margin-bottom:10px;  display:flex;  align-items:center; } .stat-container .stat-box .text {  font-size:18px;  margin:0; } .stat-container .stat-box.white .count-box, .stat-container .stat-box.white .text {  color:var(--white-color); } .stat-container .stat-box.dark .count-box {  color:var(--dark-color); } .stat-container .stat-box.dark .text {  color:var(--gray-color); } .block-info-box {  position:relative; } .block-info-box .stat-container {  position:absolute;  right:0;  bottom:0;  max-width:649px;  width:100%; } .service-post_navigation {  display:flex;  justify-content:space-between;  align-items:center;  margin-top:30px; } .service-post_navigation .prev-post a, .service-post_navigation .next-post a {  font-size:16px;  color:var(--dark-color);  font-family:var(--title-font);  font-weight:500;  display:flex;  align-items:center;  gap:10px;  transition:all 0.4s ease 0s; } @media (max-width:430px) {  .service-post_navigation .prev-post a,  .service-post_navigation .next-post a {   font-size:16px;  } } .service-post_navigation .prev-post a:hover, .service-post_navigation .next-post a:hover {  color:var(--theme-color); } .service-post_navigation .prev-post a:hover i, .service-post_navigation .next-post a:hover i {  color:var(--theme-color); } .service-post_navigation .prev-post a i, .service-post_navigation .next-post a i {  font-size:20px;  color:var(--dark-color);  transition:all 0.4s ease 0s; } .service-post_navigation .prev-post {  margin-right:auto;  padding-left:20px; } .service-post_navigation .next-post {  margin-left:auto;  padding-right:20px; } .help-contact .theme-btn {  padding:12px 40px !important; }  .choose-thumb {  direction:rtl;  margin:-120px 46px -120px 0; } @media (max-width:1500px) {  .choose-thumb {   margin:-90px 15px -90px 0;  } } @media (max-width:991px) {  .choose-thumb {   display:none;  } } .choose-thumb img {  max-width:inherit; } .since-box {  padding:30px 35px 32px;  max-width:280px;  text-align:center;  position:absolute;  right:57px;  bottom:-121px;  background:var(--bs-bg-color4);  backdrop-filter:blur(10px);  } @media (max-width:1500px) {  .since-box {   right:26px;  } } @media (max-width:1399px) {  .since-box {   bottom:0;  } } @media (max-width:991px) {  .since-box {   display:none;  } } .since-box:hover .icon-box .icon i {  animation:wobble_spatial 1s forwards ease-in-out 0s; } .since-box .icon-box {  display:flex;  justify-content:center;  align-items:center;  width:114px;  height:114px;  border-radius:50%;  background-color:transparent;  border:1px solid var(--bs-border-color2);  margin:auto; } .since-box .icon-box .icon {  display:flex;  justify-content:center;  align-items:center;  font-size:31px;  color:var(--dark-color);  font-weight:700;  width:90px;  height:90px;  line-height:90px;  border-radius:50%;  text-align:center;  background-color:var(--theme-color2); } .since-box .icon-box .icon i {  background-size:cover; } .since-box .icon-box .icon i::before {  display:none !important; } .since-box .since {  font-size:24px;  line-height:1.66;  color:var(--white-color);  font-weight:600;  margin:27px 0 8px; } .since-box .text {  opacity:0.8;  color:var(--white-color);  font-size:15px; } .choose-content-wrapper .title-area.two {  margin-bottom:calc(var(--section-title-space) - 34px); } .feature-grid {  display:grid;  grid-template-columns:repeat(auto-fit, minmax(50%, 1fr));  } @media (max-width:1399px) {  .feature-grid {   gap:20px;  } } @media (max-width:991px) {  .feature-grid {   gap:0;  } } @media (max-width:575px) {  .feature-grid {   gap:20px;  } } .feature-grid .feature-item {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-start;  gap:20px;  padding-right:35px;  } @media (max-width:912px) {  .feature-grid .feature-item {   padding-right:0;  } } @media (max-width:767px) {  .feature-grid .feature-item {   padding-right:20px;  } } @media (max-width:430px) {  .feature-grid .feature-item {   padding-right:0;  } } @media (max-width:414px) {  .feature-grid .feature-item {   gap:15px;  } } .feature-grid .feature-item:hover .checkmark .icon-checkmark {  animation:wobble_vertical 1s forwards ease-in-out 0s; } .feature-grid .feature-item .checkmark {  color:var(--theme-color);  font-size:22px;  width:46px;  height:46px;  line-height:46px;  text-align:center;  border-radius:50%;  border:1px solid var(--bs-border-color7);  flex-shrink:0; } .feature-grid .feature-item p {  font-size:20px;  line-height:1.4;  color:var(--dark-color);  font-weight:500;  margin:0; } @media (max-width:820px) {  .feature-grid .feature-item p {   font-size:19px;  } }  .choose-section.style-2 .choose-thumb {  margin:-120px 0; } .choose-section.style-2 .features-list li {  font-size:18px;  color:var(--gray-color2);  position:relative;  padding-left:45px;  transition:all 0.4s ease 0s; } @media (max-width:430px) {  .choose-section.style-2 .features-list li {   font-size:16px;   padding-left:35px;  } } .choose-section.style-2 .features-list li:hover {  padding-left:35px;  color:var(--white-color); } .choose-section.style-2 .features-list li + li {  margin-top:22px; } .choose-section.style-2 .features-list li::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  content:"\f00c";  left:0;  width:28px;  height:28px;  line-height:28px;  text-align:center;  border-radius:14px;  background-color:var(--bs-border-color);  font-size:16px;  font-weight:700;  font-family:var(--icon-font);  color:var(--theme-color2); } .choose-section.style-2 .since-box {  padding:40px 35px;  right:7px;  text-align:left;  background-color:var(--bs-bg-color5); } .choose-section.style-2 .since-box:hover .icon-box .icon i {  animation:wobble_vertical 1s forwards ease-in-out 0s; } .choose-section.style-2 .since-box .icon-box {  width:100px;  height:100px;  border-radius:50px;  background-color:var(--bs-bg-color6); } .choose-section.style-2 .since-box .icon-box .icon {  background-color:transparent; } .choose-section.style-2 .since-box .text p {  font-size:16px;  line-height:24px;  font-weight:600;  color:var(--dark-color);  margin:-5px 0 0;  opacity:1; }  .choose-section.style-3 .features-list li {  font-size:18px;  color:var(--dark-color);  position:relative;  padding-left:35px;  transition:all 0.4s ease 0s; } @media (max-width:430px) {  .choose-section.style-3 .features-list li {   font-size:16px;   padding-left:35px;  } } .choose-section.style-3 .features-list li:hover {  padding-left:25px;  color:var(--theme-color); } .choose-section.style-3 .features-list li + li {  margin-top:22px; } .choose-section.style-3 .features-list li::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  content:"\f00c";  left:0;  line-height:28px;  font-size:16px;  font-weight:700;  font-family:var(--icon-font);  color:var(--theme-color); } .choose-section.style-3 .choose-right-wrapper {  position:relative; } .choose-section.style-3 .choose-right-wrapper .audience-growth {  position:absolute;  z-index:1;  left:0;  top:0;  background-color:var(--theme-color2);  width:195px;  height:188px;  padding:40px 25px;  text-align:center;  display:flex;  flex-direction:column;  justify-content:space-between;  } @media (max-width:575px) {  .choose-section.style-3 .choose-right-wrapper .audience-growth {   width:175px;   height:171px;  } } @media (max-width:430px) {  .choose-section.style-3 .choose-right-wrapper .audience-growth {   display:none;  } } .choose-section.style-3 .choose-right-wrapper .audience-growth .percentage {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  font-size:44px;  line-height:1;  color:var(--dark-color);  font-weight:600; } .choose-section.style-3 .choose-right-wrapper .audience-growth .label {  font-size:14px;  color:var(--dark-color);  font-weight:500;  margin-top:5px; } .choose-section.style-3 .choose-right-wrapper .chart-container {  position:relative;  max-width:648px;  width:100%;  height:564px;  padding:30px;  background-color:var(--theme-color3); } @media (max-width:1199px) {  .choose-section.style-3 .choose-right-wrapper .chart-container {   height:500px;  } } @media (min-width:992px) and (max-width:1024px) {  .choose-section.style-3 .choose-right-wrapper .chart-container {   height:488px;  } } @media (max-width:991px) {  .choose-section.style-3 .choose-right-wrapper .chart-container {   height:564px;  } } @media (max-width:575px) {  .choose-section.style-3 .choose-right-wrapper .chart-container {   height:500px;  } } @media (max-width:430px) {  .choose-section.style-3 .choose-right-wrapper .chart-container {   height:400px;   padding:15px;  } } @media (max-width:375px) {  .choose-section.style-3 .choose-right-wrapper .chart-container {   height:350px;  } } .choose-section.style-3 .choose-right-wrapper .chart-container canvas {  width:100% !important;  height:100% !important;  display:block; } .choose-section.style-3 .choose-right-wrapper .chart-container img {  width:100%;  height:100%;  object-fit:cover; }  .choose-section.style-4 .milestone {  display:flex;  flex-direction:column;  gap:1rem;  position:relative;  z-index:1; } .choose-section.style-4 .milestone .milestone-item {  display:flex;  justify-content:space-between;  padding:25px 30px 0;  width:100%;  height:90px;  border-radius:10px;  background-color:var(--white-color);  font-size:18px;  color:var(--dark-color);  font-weight:500; } .choose-section.style-4 .milestone .milestone-item + .milestone-item {  margin-top:-30px; } @media (max-width:430px) {  .choose-section.style-4 .milestone .milestone-item {   width:100% !important;  } } .choose-section.style-4 .milestone .milestone-item.dark-green {  background-color:var(--dark-color);  color:var(--white-color);  width:88%; } .choose-section.style-4 .milestone .milestone-item.orange {  background-color:var(--theme-color);  color:var(--white-color);  width:76%; } .choose-section.style-4 .milestone .milestone-item.light-green {  background-color:var(--theme-color2);  color:var(--dark-color);  width:64%;  padding-top:0;  align-items:center; } .choose-section.style-4 .milestone .milestone-item .label {  font-weight:normal; } .choose-section.style-4 .milestone .milestone-item .value {  font-size:1.25rem; } .choose-section.style-4 .choose-image-wrapper {  position:relative;  display:contents;  } @media (max-width:991px) {  .choose-section.style-4 .choose-image-wrapper {   display:none;  } } .choose-section.style-4 .choose-image-wrapper .thumb-bg {  position:absolute;  top:0; } .choose-section.style-4 .choose-image-wrapper .thumb {  position:absolute;  bottom:0; } .choose-section.style-4 .expert-card {  width:330px;  height:200px;  padding:30px;  border-radius:10px;  filter:drop-shadow(0px 30px 15px var(--bs-bg-color11));  background-color:var(--bs-bg-color6);  border:2px solid var(--white-color);  backdrop-filter:blur(10px);  position:absolute;  right:11%;  top:25%; } @media (max-width:1500px) {  .choose-section.style-4 .expert-card {   right:20px;  } } @media (max-width:1299px) {  .choose-section.style-4 .expert-card {   display:none;  } } .choose-section.style-4 .expert-card .expert-info {  display:flex;  align-items:center;  gap:15px;  margin-bottom:1rem; } .choose-section.style-4 .expert-card .expert-info .social {  display:flex; } .choose-section.style-4 .expert-card .expert-info .social img {  width:55px;  height:55px;  border-radius:50%;  border:2px solid var(--white-color); } .choose-section.style-4 .expert-card .expert-info .social img + img {  margin-left:-20px; } .choose-section.style-4 .expert-card .expert-info .count {  font-size:30px;  color:var(--dark-color);  font-weight:600; } .choose-section.style-4 .expert-card .expert-text {  display:flex;  gap:10px; } .choose-section.style-4 .expert-card .expert-text .arrow {  color:var(--theme-color);  font-size:50px;  transform:rotate(-90deg);  display:inline-block; } .choose-section.style-4 .expert-card .expert-text p {  font-size:18px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0; }  @media (max-width:991px) {  .wrapper-section.br-30 {   border-radius:0;  } } .choose-section.style-5 .milestone {  display:flex;  flex-direction:column;  gap:1rem;  position:relative;  z-index:1; } .choose-section.style-5 .milestone .milestone-item {  display:flex;  justify-content:space-between;  padding:25px 30px 0;  width:100%;  height:90px;  border-radius:10px;  background-color:var(--white-color);  font-size:18px;  color:var(--dark-color);  font-weight:500; } .choose-section.style-5 .milestone .milestone-item + .milestone-item {  margin-top:-30px; } .choose-section.style-5 .milestone .milestone-item.dark-green {  background-color:var(--dark-color);  color:var(--white-color);  width:88%; } .choose-section.style-5 .milestone .milestone-item.orange {  background-color:var(--theme-color);  color:var(--white-color);  width:76%; } .choose-section.style-5 .milestone .milestone-item.light-green {  background-color:var(--theme-color2);  color:var(--dark-color);  width:64%;  padding-top:0;  align-items:center; } .choose-section.style-5 .milestone .milestone-item .label {  font-weight:normal; } .choose-section.style-5 .milestone .milestone-item .value {  font-size:1.25rem; } .choose-section.style-5 .choose-image-wrapper {  position:relative;  display:contents;  } @media (max-width:991px) {  .choose-section.style-5 .choose-image-wrapper {   display:none;  } } .choose-section.style-5 .choose-image-wrapper .thumb-bg {  position:absolute;  top:0; } .choose-section.style-5 .choose-image-wrapper .thumb {  position:absolute;  bottom:0; } .choose-section.style-5 .expert-card {  width:330px;  height:200px;  padding:30px;  border-radius:10px;  filter:drop-shadow(0px 30px 15px var(--bs-bg-color11));  background-color:var(--bs-bg-color6);  border:2px solid var(--white-color);  backdrop-filter:blur(10px);  position:absolute;  right:11%;  top:25%; } @media (max-width:1500px) {  .choose-section.style-5 .expert-card {   right:20px;  } } @media (max-width:1299px) {  .choose-section.style-5 .expert-card {   display:none;  } } .choose-section.style-5 .expert-card .expert-info {  display:flex;  align-items:center;  gap:15px;  margin-bottom:1rem; } .choose-section.style-5 .expert-card .expert-info .social {  display:flex; } .choose-section.style-5 .expert-card .expert-info .social img {  width:55px;  height:55px;  border-radius:50%;  border:2px solid var(--white-color); } .choose-section.style-5 .expert-card .expert-info .social img + img {  margin-left:-20px; } .choose-section.style-5 .expert-card .expert-info .count {  font-size:30px;  color:var(--dark-color);  font-weight:600; } .choose-section.style-5 .expert-card .expert-text {  display:flex;  gap:10px; } .choose-section.style-5 .expert-card .expert-text .arrow {  color:var(--theme-color);  font-size:50px;  transform:rotate(-90deg);  display:inline-block; } .choose-section.style-5 .expert-card .expert-text p {  font-size:18px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0; } .choose-section.style-5 .choose-content-wrapper .info-box {  display:flex;  align-items:center;  gap:20px; } .choose-section.style-5 .choose-content-wrapper .info-box:hover .icon img {  animation:mirror_effect 1s forwards ease-in-out 0s; } .choose-section.style-5 .choose-content-wrapper .info-box .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:80px;  height:80px;  border-radius:50%;  background:var(--dark-color);  font-size:36px;  color:var(--white-color);  flex-shrink:0; } .choose-section.style-5 .choose-content-wrapper .info-box .icon img {  transition:all 0.4s ease 0s; } .choose-section.style-5 .choose-content-wrapper .info-box .icon svg {  fill:var(--white-color);  width:36px;  height:36px; } .choose-section.style-5 .choose-content-wrapper .info-box .text {  font-size:20px;  line-height:30px;  color:var(--dark-color);  font-weight:400; } .choose-section.style-5 .choose-content-wrapper .features-list li {  font-size:18px;  line-height:26px;  color:var(--dark-color);  position:relative;  padding-left:30px; } @media (max-width:360px) {  .choose-section.style-5 .choose-content-wrapper .features-list li {   padding-left:20px;  } } .choose-section.style-5 .choose-content-wrapper .features-list li + li {  margin-top:22px; } .choose-section.style-5 .choose-content-wrapper .features-list li::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  content:"\f058";  font-family:var(--icon-font);  font-size:20px;  color:var(--dark-color);  font-weight:900; }  @media (max-width:991px) {  .wrapper-section.br-30 {   border-radius:0;  } } .dark-mode .choose-section.style-5 .choose-content-wrapper .info-box .icon {  background:var(--bs-bg-color10); } .dark-mode .choose-section.style-5 .choose-content-wrapper .features-list li {  color:var(--white-color); } .dark-mode .choose-section.style-5 .choose-content-wrapper .features-list li::before {  color:var(--theme-color2); }  .choose-section.style-6 .choose-content-wrapper .title-area .sec-title br { } @media (max-width:1500px) {  .choose-section.style-6 .choose-content-wrapper .title-area .sec-title br {   display:none;  } } @media (max-width:991px) {  .choose-section.style-6 .choose-content-wrapper .title-area .sec-title br {   display:inline;  } } @media (max-width:540px) {  .choose-section.style-6 .choose-content-wrapper .title-area .sec-text br {   display:none;  } } .choose-section.style-6 .choose-content-wrapper .features-list li {  font-size:18px;  line-height:26px;  color:var(--dark-color);  position:relative;  padding-left:30px; } @media (max-width:360px) {  .choose-section.style-6 .choose-content-wrapper .features-list li {   padding-left:20px;  } } .choose-section.style-6 .choose-content-wrapper .features-list li + li {  margin-top:22px; } .choose-section.style-6 .choose-content-wrapper .features-list li::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  width:18px;  height:18px;  background:url(/wp-content/uploads/w3-webp/themes/bentol/assets/images/icons/check-circle.png.webp); } .choose-section.style-6 .choose-image-wrapper {  position:relative;  display:contents; } .choose-section.style-6 .choose-image-wrapper .thumb-bg {  position:absolute;  top:50px;  left:50%;  transform:translateX(-50%);  z-index:-1; } .choose-section.style-6 .choose-image-wrapper .thumb {  margin-bottom:-120px;  text-align:center; } .choose-section.style-6 .choose-right-wrapper .right-top {  display:flex;  align-items:center;  gap:20px; } @media (max-width:360px) {  .choose-section.style-6 .choose-right-wrapper .right-top {   gap:5px;  } } .choose-section.style-6 .choose-right-wrapper .right-top .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  height:60px;  width:60px;  background:var(--theme-color);  border-radius:50%; } .choose-section.style-6 .choose-right-wrapper .right-top .icon i {  font-size:25px;  color:var(--white-color); } .choose-section.style-6 .choose-right-wrapper .right-top .text {  font-size:24px;  line-height:30px;  color:var(--dark-color);  font-weight:600;  margin:0; } .choose-section.style-6 .choose-right-wrapper .featured-box {  display:flex;  align-items:center;  gap:30px;  } @media (max-width:375px) {  .choose-section.style-6 .choose-right-wrapper .featured-box {   flex-direction:column;  } } .choose-section.style-6 .choose-right-wrapper .featured-box .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  height:80px;  width:80px;  border:1px solid var(--bs-border-color12);  border-radius:10px;  flex-shrink:0;  position:relative;  transition:all 0.4s ease 0s; } .choose-section.style-6 .choose-right-wrapper .featured-box .icon::before {  content:"";  position:absolute;  z-index:-1;  left:0;  top:0;  width:100%;  border-radius:10px;  transform:scale(0);  height:100%;  background:var(--dark-color);  transition:all 0.5s ease 0s; } .choose-section.style-6 .choose-right-wrapper .featured-box .icon img {  transition:all 0.4s ease 0s; } .choose-section.style-6 .choose-right-wrapper .featured-box .content {  } @media (max-width:375px) {  .choose-section.style-6 .choose-right-wrapper .featured-box .content {   text-align:center;  } } .choose-section.style-6 .choose-right-wrapper .featured-box .content h4 {  font-size:22px;  line-height:30px;  color:var(--dark-color);  font-weight:500;  margin:0; } .choose-section.style-6 .choose-right-wrapper .featured-box .content p {  margin:0; } .choose-section.style-6 .choose-right-wrapper .featured-box:hover .icon::before {  transform:scale(1); } .choose-section.style-6 .choose-right-wrapper .featured-box:hover .icon img {  filter:brightness(0) saturate(100%) invert(91%) sepia(12%) saturate(1224%) hue-rotate(31deg) brightness(104%) contrast(75%);  animation:mirror_effect 0.5s forwards ease-in-out 0s; }  .choose-section.style-7 .choose-title-area {  display:flex;  align-items:center;  justify-content:space-between; } @media (max-width:912px) {  .choose-section.style-7 .choose-title-area {   flex-direction:column;   align-items:start;   gap:30px;  } } .choose-section.style-7 .choose-title-area .choose-counter {  padding:30px 40px;  background:var(--theme-color3);  border-radius:10px;  max-width:535px;  width:100%; } @media (max-width:430px) {  .choose-section.style-7 .choose-title-area .choose-counter {   padding:20px 20px;  } } .choose-section.style-7 .choose-title-area .choose-counter .choose-counter-box {  display:flex;  align-items:center;  gap:20px; } .choose-section.style-7 .choose-title-area .choose-counter .choose-counter-box .count-box {  font-size:80px;  line-height:1;  color:var(--dark-color);  font-weight:600;  display:flex;  align-items:center; } .choose-section.style-7 .choose-title-area .choose-counter .choose-counter-box .plus {  font-size:45px;  margin-top:-30px; } .choose-section.style-7 .choose-title-area .choose-counter .choose-counter-box p {  font-size:18px;  line-height:28px;  color:var(--dark-color);  font-weight:400;  margin:0; } @media (max-width:430px) {  .choose-section.style-7 .choose-title-area .choose-counter .choose-counter-box p {   font-size:16px;  } } .choose-section.style-7 .choose-left {  position:relative; } .choose-section.style-7 .choose-left img {  width:100%;  height:auto;  opacity:0;  border-radius:16px;  position:absolute;  top:0;  transform:translateY(50px);  transition:all 0.4s ease 0s;  transition-duration:1s; } .choose-section.style-7 .choose-left img.active {  opacity:1;  transform:translateY(0); } .choose-section.style-7 .choose-right .title-box {  display:flex;  gap:10px;  cursor:pointer;  transition:all 0.5s ease-in-out;  margin-top:55px; } @media (min-width:992px) and (max-width:1024px) {  .choose-section.style-7 .choose-right .title-box:first-child {   margin-top:0;  } } .choose-section.style-7 .choose-right .title-box .icon {  width:50px;  height:50px;  display:flex;  align-items:center;  border:1px solid var(--bs-border-color7);  justify-content:center;  border-radius:50%;  transition:background-color 0.5s ease-in-out;  flex-shrink:0;  position:relative; } .choose-section.style-7 .choose-right .title-box .icon::before {  content:"";  position:absolute;  left:50%;  width:1px;  top:49px;  height:95px;  background-color:var(--bs-border-color7);  transform:translateX(-50%); } @media (max-width:414px) {  .choose-section.style-7 .choose-right .title-box .icon::before {   height:122px;  } } .choose-section.style-7 .choose-right .title-box .icon.border-none::before {  display:none; } .choose-section.style-7 .choose-right .title-box.active {  font-weight:bold; } .choose-section.style-7 .choose-right .title-box:hover .icon, .choose-section.style-7 .choose-right .title-box.active .icon {  background-color:var(--theme-color);  color:white; } .choose-section.style-7 .choose-right .title-box .title {  font-size:24px;  line-height:28px;  color:var(--dark-color);  font-weight:600;  margin:0; } .choose-section.style-7 .choose-right .title-box .description {  font-size:16px;  line-height:26px;  color:var(--gray-color);  font-weight:400;  margin:10px 0 0; } .dark-mode .choose-section .choose-title-area .choose-counter .choose-counter-box p {  color:var(--gray-color2); } .dark-mode .choose-section .choose-right .title-box .icon {  border:1px solid var(--bs-border-color13); } .dark-mode .choose-section .choose-right .title-box .icon::before {  content:"";  position:absolute;  left:50%;  width:1px;  top:49px;  height:95px;  background-color:var(--bs-border-color13);  transform:translateX(-50%); } @media (max-width:414px) {  .dark-mode .choose-section .choose-right .title-box .icon::before {   height:122px;  } } .dark-mode .choose-section .choose-right .title-box .icon.border-none::before {  display:none; } .dark-mode .choose-section .choose-right .title-box.active {  font-weight:bold; } .dark-mode .choose-section .choose-right .title-box:hover .icon, .dark-mode .choose-section .choose-right .title-box.active .icon {  background-color:var(--theme-color);  color:var(--white-color); } .dark-mode .choose-section .choose-right .title-box .title {  font-size:24px;  line-height:28px;  color:var(--white-color);  font-weight:600;  margin:0; } .dark-mode .choose-section .choose-right .title-box .description {  font-size:16px;  line-height:26px;  color:var(--gray-color2);  font-weight:400;  margin:10px 0 0; }  .process-single-box {  position:relative;  padding:50px 42px 44px;  background-color:var(--theme-color3);  margin-bottom:30px;  } @media (max-width:1399px) {  .process-single-box {   padding:50px 35px 44px;  } } @media (max-width:1199px) {  .process-single-box {   padding:50px 25px 44px;  } } @media (max-width:991px) {  .process-single-box {   margin-bottom:0;  } } .process-single-box .header {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-start;  gap:30px;  margin-bottom:100px;  } @media (min-width:992px) and (max-width:1024px) {  .process-single-box .header {   gap:15px;   margin-bottom:50px;  } } .process-single-box .header .icon {  font-size:60px;  color:var(--dark-color);  flex-shrink:0; } @media (min-width:992px) and (max-width:1024px) {  .process-single-box .header .icon {   font-size:40px;  }  .process-single-box .header .icon .icon-comercial {   width:40px;   height:40px;  } } @media (min-width:992px) and (max-width:1024px) {  .process-single-box .header .title {   font-size:22px;  } } @media (max-width:375px) {  .process-single-box .header .title {   font-size:20px;  } } @media (max-width:360px) {  .process-single-box .header .title {   font-size:19px;  } } .process-single-box:hover .header .icon {  animation:wobble_vertical 1s forwards ease-in-out 0s; } .process-single-box .box-count {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  position:absolute;  left:50%;  transform:translateX(-50%);  bottom:-32px;  width:64px;  height:64px;  background:var(--white-color);  border-radius:50%;  font-size:20px;  font-weight:500;  color:var(--dark-color); } .process-single-box .box-count::before {  position:absolute;  content:"";  left:50%;  top:50%;  transform:translate(-50%, -50%);  width:10px;  height:10px;  border-radius:50%;  background-color:var(--dark-color);  opacity:0;  visibility:hidden;  transition:all 0.5s ease;  } @media (max-width:991px) {  .process-single-box .box-count::before {   display:none;  } } .process-single-box .box-count::after {  position:absolute;  content:"";  left:50%;  top:32px;  transform:translateX(-50%);  width:2px;  height:0;  background:var(--dark-color);  transition:all 0.5s ease;  transition-duration:0.5s;  } @media (max-width:991px) {  .process-single-box .box-count::after {   display:none;  } } .process-single-box .box-count span {  transform:translateY(0);  transition:all 0.5s ease; } .process-single-box.current .box-count::before, .process-single-box:hover .box-count::before {  opacity:1;  visibility:visible; } .process-single-box.current .box-count::after, .process-single-box:hover .box-count::after {  height:50px; } .process-single-box.current .box-count span, .process-single-box:hover .box-count span {  transform:translateY(73px);  } @media (max-width:991px) {  .process-single-box.current .box-count span, .process-single-box:hover .box-count span {   transform:translateY(0);  } }  .process-section.style-2 .row {  } @media (max-width:991px) {  .process-section.style-2 .row {   flex-direction:column-reverse;  } } .process-section.style-2 .process-thumb {  position:relative; } .process-section.style-2 .process-thumb .image-box {  direction:rtl;  position:relative; } .process-section.style-2 .process-thumb .image-box img {  max-width:inherit;  } @media (max-width:991px) {  .process-section.style-2 .process-thumb .image-box img {   max-width:100%;   width:100%;  } } .process-section.style-2 .process-thumb .video-box {  position:absolute;  bottom:0;  right:0;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:260px;  height:260px;  background-color:var(--bs-bg-color5);  backdrop-filter:blur(10px);  } @media (max-width:575px) {  .process-section.style-2 .process-thumb .video-box {   width:200px;   height:200px;  } } .process-section.style-2 .process-thumb .video-box .circle-box {  width:170px;  height:170px;  border-radius:50%;  background-color:var(--dark-color); } .process-section.style-2 .process-thumb .video-box .circle-box .popup-video {  position:absolute;  z-index:1;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:66px;  height:66px;  border-radius:50%;  background-color:var(--theme-color2);  font-size:16px;  color:var(--dark-color);  font-family:var(--icon-font); } .process-section.style-2 .process-thumb .video-box .circle-box .text-inner svg {  width:114px;  word-spacing:10px; } .process-section.style-2 .process-thumb .video-box .circle-box .text-inner text {  fill:var(--white-color);  font-size:25px; } .process-section.style-2 .process-list {  position:relative;  display:grid;  grid-template-columns:repeat(2, 1fr);  border-radius:10px;  border:1px solid var(--bs-border-color6); } @media (max-width:430px) {  .process-section.style-2 .process-list {   grid-template-columns:repeat(1, 1fr);  } } .process-section.style-2 .process-list::before {  position:absolute;  content:"";  width:100%;  height:1px;  background:var(--bs-border-color6);  transition:all 0.4s ease-in-out;  top:50%; } @media (max-width:430px) {  .process-section.style-2 .process-list::before {   display:none;  } } .process-section.style-2 .process-list::after {  position:absolute;  content:"";  width:1px;  height:100%;  background:var(--bs-border-color6);  transition:all 0.4s ease-in-out;  left:50%; } @media (max-width:430px) {  .process-section.style-2 .process-list::after {   display:none;  } } .process-section.style-2 .process-list .process-item {  padding:30px;  } @media (min-width:992px) and (max-width:1024px) {  .process-section.style-2 .process-list .process-item {   padding:15px;  } } @media (max-width:575px) {  .process-section.style-2 .process-list .process-item {   padding:25px;  } } @media (max-width:540px) {  .process-section.style-2 .process-list .process-item {   padding:15px;  } } @media (max-width:430px) {  .process-section.style-2 .process-list .process-item {   padding:30px;   border-bottom:1px solid var(--bs-border-color6);  }  .process-section.style-2 .process-list .process-item:last-child {   border-bottom:none;  } } .process-section.style-2 .process-list .process-item .number {  font-size:18px;  color:var(--dark-color);  font-weight:500;  width:50px;  height:50px;  line-height:50px;  border-radius:50%;  text-align:center;  background-color:var(--theme-color3);  transition:all 0.4s ease 0s;  margin-bottom:20px; } .process-section.style-2 .process-list .process-item .title {  font-size:22px;  color:var(--dark-color);  font-weight:600;  margin-bottom:5px; } .process-section.style-2 .process-list .process-item .description {  font-size:16px;  color:var(--gray-color);  margin-bottom:0; } .process-section.style-2 .process-list .process-item:hover .number {  background-color:var(--theme-color);  color:var(--white-color); } .process-section.style-2.bg-dark .process-list {  border:1px solid rgba(255, 255, 255, 0.1); } .process-section.style-2.bg-dark .process-list::before, .process-section.style-2.bg-dark .process-list::after {  background:rgba(255, 255, 255, 0.1); } .process-section.style-2.bg-dark .process-list .process-item .number {  color:var(--white-color);  background-color:var(--dark-color3); } .process-section.style-2.bg-dark .process-list .process-item .title {  color:var(--white-color); } .process-section.style-2.bg-dark .process-list .process-item .description {  color:var(--gray-color2); } .process-section.style-2.bg-dark .process-list .process-item:hover .number {  background-color:var(--theme-color); }  .process-all {  display:flex;  } @media (max-width:991px) {  .process-all {   flex-wrap:wrap;  } } .process-all .process-step {  text-align:center; } @media (max-width:991px) {  .process-all .process-step {   max-width:50%;  } } @media (max-width:575px) {  .process-all .process-step {   max-width:100%;  } } .process-all .process-step .serial {  font-size:16px;  color:var(--dark-color);  font-weight:500;  margin-bottom:15px; } .process-all .process-step .line {  position:relative;  border-top:3px solid var(--bs-bg-color7) !important;  text-align:center; } .process-all .process-step .line .circle {  position:absolute;  content:"";  left:50%;  transform:translateX(-50%);  transition:all 0.4s ease 0s;  z-index:1;  top:-10px;  width:20px;  height:20px;  border-radius:50%;  background-color:var(--light-color2);  border:3px solid var(--bs-border-color8);  transition:all 0.4s ease 0s; } .process-all .process-step .content .title {  margin:15px 0 13px; } .process-all .process-step .content .text {  width:83%;  margin:auto; } .process-all .process-step:hover .line .circle {  background-color:var(--theme-color); }  .process-section.style-4 .process-single-box {  background-color:var(--white-color); } .process-section.style-4 .process-single-box .box-count {  background:var(--theme-color3); }  .testi-content-wrap {  } @media (max-width:991px) {  .testi-content-wrap {   margin-bottom:50px;  } } .testi-slider {  position:relative; } .testi-slider .array-button {  position:absolute;  z-index:1;  bottom:60px;  right:60px;  gap:10px; } .testi-slider .array-button .array-next.active {  color:var(--white-color);  background:var(--theme-color);  border-color:var(--theme-color); } @media (max-width:414px) {  .testi-slider .array-button {   right:20px;  } } .testimonial-card {  background-color:var(--dark-color3);  color:var(--white-color);  padding:60px;  padding-left:50px;  border-radius:10px;  position:relative;  } @media (max-width:540px) {  .testimonial-card {   padding:40px;  } } @media (max-width:375px) {  .testimonial-card {   padding:30px;  } } .testimonial-card:hover .content .quote-icon {  animation:wobble_vertical 1s forwards ease-in-out 0s; } .testimonial-card .content {  display:flex;  gap:30px;  } @media (min-width:912px) and (max-width:1023px) {  .testimonial-card .content {   flex-direction:column;  } } @media (max-width:575px) {  .testimonial-card .content {   flex-direction:column;  } } .testimonial-card .content .quote-icon {  font-size:58px;  color:var(--theme-color); } .testimonial-card .content .text {  font-size:18px;  line-height:30px;  color:var(--white-color);  margin:-6px 0 0; } .testimonial-card .content .rating {  margin:25px 0 45px; } @media (max-width:540px) {  .testimonial-card .content .rating {   margin:25px 0 30px;  } } .testimonial-card .content .rating i {  color:var(--orange-color);  font-size:20px;  margin-right:2px; } .testimonial-card .content .rating i:last-child {  margin-right:0; } .testimonial-card .user-info {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-start;  gap:20px; } .testimonial-card .user-info .user-image {  width:70px;  height:70px;  border-radius:50%; } .testimonial-card .user-info .user-name {  font-size:21px;  line-height:34px;  color:var(--white-color);  font-weight:500;  margin:0; } .testimonial-card .user-info .user-title {  color:var(--gray-color2);  margin:0; } .stats-container {  display:flex;  position:relative; } @media (max-width:430px) {  .stats-container {   flex-direction:column;   gap:30px;  } } .stats-container::before {  position:absolute;  content:"";  width:100%;  height:100%;  background:var(--white-color);  transition:all 0.4s ease-in-out;  right:-99%;  bottom:0;  z-index:-1;  } @media (max-width:991px) {  .stats-container::before {   display:none;  } } .stats-container .stat-box {  padding:45px;  flex:1;  display:flex;  flex-direction:column;  justify-content:center; } @media (min-width:992px) and (max-width:1024px) {  .stats-container .stat-box {   padding:35px;  } } @media (max-width:540px) {  .stats-container .stat-box {   padding:40px;  } } @media (max-width:375px) {  .stats-container .stat-box {   padding:30px;  } } @media (max-width:991px) {  .stats-container .stat-box:first-child {   border-bottom-left-radius:10px;  }  .stats-container .stat-box:nth-child(2) {   border-top-right-radius:10px;  } } @media (max-width:430px) {  .stats-container .stat-box {   border-radius:10px;  } } .stats-container .stat-box .count-box {  font-size:50px;  line-height:1.4;  font-weight:600;  margin-bottom:10px;  display:flex;  align-items:center; } .stats-container .stat-box .text {  font-size:18px;  margin:0; } .stats-container .stat-box.white .count-box, .stats-container .stat-box.white .text {  color:var(--white-color); } .stats-container .stat-box.dark .count-box {  color:var(--dark-color); } .stats-container .stat-box.dark .text {  color:var(--gray-color); }  .testimonial-section.style-2 {  overflow:hidden; } .testimonial-section.style-2 .testi-thumb {  direction:rtl;  margin:-120px 58px -120px 0; } @media (max-width:1500px) {  .testimonial-section.style-2 .testi-thumb {   margin:-120px 0;  } } @media (max-width:991px) {  .testimonial-section.style-2 .testi-thumb {   display:none;  } } .testimonial-section.style-2 .testi-thumb img {  max-width:inherit; } .testimonial-card.style-2 {  background-color:transparent;  padding:0;  border-radius:0; } .testimonial-card.style-2:hover .content .quote-icon {  animation:none; } .testimonial-card.style-2:hover .content .quote-icon i {  animation:wobble_vertical 1s forwards ease-in-out 0s; } .testimonial-card.style-2 .content {  padding:40px 0 35px;  border-bottom:1px solid rgba(6, 50, 50, 0.1);  border-top:1px solid rgba(6, 50, 50, 0.1);  margin-bottom:30px; } @media (max-width:390px) {  .testimonial-card.style-2 .content {   padding:30px 0 30px;  } } .testimonial-card.style-2 .content .quote-icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:70px;  height:70px;  border-radius:50%;  background-color:var(--theme-color3);  font-size:29px;  color:var(--dark-color);  flex-shrink:0; } .testimonial-card.style-2 .content .quote-icon svg {  fill:var(--dark-color);  width:20px; } .testimonial-card.style-2 .content .text {  font-size:18px;  line-height:30px;  color:var(--gray-color); } @media (max-width:430px) {  .testimonial-card.style-2 .content .text {   font-size:16px;  } } .testimonial-card.style-2 .content .rating {  margin:25px 0 0; } .testimonial-card.style-2 .user-info .user-name {  color:var(--dark-color); } .testimonial-card.style-2 .user-info .user-title {  color:var(--gray-color); } .testi-slider-2 {  position:relative; } .testi-slider-2 .array-button {  position:absolute;  z-index:2;  bottom:15px;  right:0;  gap:10px; } @media (max-width:390px) {  .testi-slider-2 .array-button {   bottom:135px;  } } .testi-slider-2 .array-button .array-prev, .testi-slider-2 .array-button .array-next {  width:48px;  height:48px;  border-radius:50%;  border:1px solid rgba(6, 50, 50, 0.1);  background-color:var(--white-color);  color:var(--dark-color); } .testi-slider-2 .array-button .array-prev:hover, .testi-slider-2 .array-button .array-next:hover {  color:var(--white-color);  background-color:var(--theme-color);  border-color:var(--theme-color); } .testi-slider-2 .array-button .array-next.active {  color:var(--white-color);  background-color:var(--theme-color);  border-color:var(--theme-color); }  .testimonial-section.style-3 .testi-title-wrap {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  align-items:flex-end;  justify-content:space-between;  } @media (max-width:575px) {  .testimonial-section.style-3 .testi-title-wrap {   align-items:flex-start;   flex-direction:column;   gap:20px;  } } .testimonial-section.style-3 .testi-btn {  text-align:center; } #loader {  margin:20px 0;  display:none;  text-align:center; } #loader i {  font-size:24px; } .theme-btn.i-none > i {  display:none; } .review-card {  display:flex;  gap:10px;  padding:25px 30px;  border-radius:10px;  background-color:var(--theme-color2);  border:1px solid var(--dark-color); } .review-card.style-2 {  padding:0;  border:none; } .review-card .review-content .text {  font-size:15px;  color:var(--dark-color);  font-weight:500;  margin-bottom:6px; } .review-card .rating-inner {  display:flex;  flex-direction:column;  gap:10px; } .review-card .rating-inner .stars {  color:var(--theme-color); } .review-card .rating-inner .stars i {  font-size:16px; } .review-card .rating-inner .rating-text {  font-size:16px;  color:var(--dark-color);  font-weight:500; } .destination-card-ld {  display:none; } .testimonial-card.style-3 {  background-color:var(--theme-color2);  border-radius:10px;  border:1px solid var(--dark-color);  padding:0; } .testimonial-card.style-3 .content-inner {  padding:35px; } @media (min-width:992px) and (max-width:1024px) {  .testimonial-card.style-3 .content-inner {   padding:20px;  } } @media (min-width:767px) and (max-width:852px) {  .testimonial-card.style-3 .content-inner {   padding:25px;  } } @media (max-width:390px) {  .testimonial-card.style-3 .content-inner {   padding:20px;  } } .testimonial-card.style-3 .content-inner .card-header {  display:flex;  align-items:center;  margin-bottom:22px; } .testimonial-card.style-3 .content-inner .card-header .user-image {  width:70px;  height:70px;  border-radius:35px;  background-color:var(--white-color);  border:1px solid var(--dark-color);  margin-right:20px;  flex-shrink:0; } .testimonial-card.style-3 .content-inner .card-header .user-details .user-name {  font-size:22px;  color:var(--dark-color);  font-weight:500;  margin-bottom:4px; } .testimonial-card.style-3 .content-inner .card-header .user-details .user-title {  font-size:16px;  color:var(--gray-color);  margin-bottom:0; } .testimonial-card.style-3 .content-inner .user-review {  font-size:18px;  color:var(--dark-color);  margin-bottom:-8px; } @media (max-width:390px) {  .testimonial-card.style-3 .content-inner .user-review {   font-size:16px;  } } .testimonial-card.style-3 .rating-inner {  display:flex;  align-items:center;  border-top:1px solid var(--dark-color);  padding:25px 35px; } @media (min-width:992px) and (max-width:1024px) {  .testimonial-card.style-3 .rating-inner {   padding:15px 20px;  } } @media (min-width:767px) and (max-width:852px) {  .testimonial-card.style-3 .rating-inner {   padding:25px 25px;  } } @media (max-width:390px) {  .testimonial-card.style-3 .rating-inner {   padding:20px;  } } .testimonial-card.style-3 .rating-inner .stars {  color:var(--dark-color);  margin-right:10px; } .testimonial-card.style-3 .rating-inner .stars i {  font-size:16px; } .testimonial-card.style-3 .rating-inner .rating-text {  font-size:16px;  color:var(--dark-color);  font-weight:500; }  .style-4 .testimonial-card {  padding:0;  overflow:hidden;  filter:drop-shadow(0px 20px 25px rgba(214, 232, 232, 0.4));  background-color:var(--bs-bg-color6);  border:1px solid var(--bs-border-color7); } .style-4 .testimonial-card .inner-box {  display:flex;  } @media (max-width:575px) {  .style-4 .testimonial-card .inner-box {   flex-direction:column;  } } .style-4 .testimonial-card .inner-box .image-box {  flex-shrink:0; } .style-4 .testimonial-card .inner-box .image-box img {  height:100%;  object-fit:cover; } @media (max-width:540px) {  .style-4 .testimonial-card .inner-box .image-box img {   width:100%;  } } .style-4 .testimonial-card .inner-box .content {  flex-direction:column;  padding:50px 45px 50px;  } @media (max-width:1199px) {  .style-4 .testimonial-card .inner-box .content {   padding:50px 30px 50px;  } } .style-4 .testimonial-card .inner-box .content .rating {  margin:0; } .style-4 .testimonial-card .inner-box .content .quote-icon {  font-size:40px;  transform:rotate(180deg);  color:var(--dark-color); } .style-4 .testimonial-card .inner-box .content .text {  color:var(--dark-color); } .style-4 .testimonial-card .inner-box .content .user-info {  display:inline-block; } .style-4 .testimonial-card .inner-box .content .user-info .user-name {  color:var(--dark-color); } .style-4 .testimonial-card .inner-box .content .user-info .user-title {  color:var(--gray-color); } .testi-slider-5 {  position:relative; } .testi-slider-5 .array-button {  position:absolute;  z-index:1;  bottom:44px;  right:44px;  gap:10px; } .testi-slider-5 .array-button .array-next, .testi-slider-5 .array-button .array-prev {  color:var(--dark-color);  border-color:var(--bs-border-color7); } .testi-slider-5 .array-button .array-next:hover, .testi-slider-5 .array-button .array-prev:hover, .testi-slider-5 .array-button .array-next.active {  color:var(--white-color);  background:var(--theme-color);  border-color:var(--theme-color); } @media (max-width:414px) {  .testi-slider-5 .array-button {   right:20px;  } }  .testimonial-section.style-5 {  position:relative; } .testimonial-section.style-5 .array-button {  gap:10px; } .testimonial-section.style-5 .array-button .array-next, .testimonial-section.style-5 .array-button .array-prev {  font-size:16px;  width:44px;  height:44px;  color:var(--dark-color);  border-color:var(--bs-border-color6);  background:var(--white-color); } .testimonial-section.style-5 .array-button .array-next:hover, .testimonial-section.style-5 .array-button .array-prev:hover, .testimonial-section.style-5 .array-button .array-next.active {  color:var(--white-color);  background:var(--theme-color);  border-color:var(--theme-color); } @media (max-width:414px) {  .testimonial-section.style-5 .array-button {   right:20px;  } } .review-card-three {  display:flex;  align-items:center;  gap:15px;  padding:15px 0;  border-top:1px solid var(--bs-border-color10);  border-bottom:1px solid var(--bs-border-color10); } .review-card-three span.avarage-rating {  font-size:44px;  line-height:1;  color:var(--dark-color);  font-weight:600; } .review-card-three .rating-inner {  display:flex;  flex-direction:column;  gap:5px; } .review-card-three .rating-inner .stars {  color:var(--orange-color); } .review-card-three .rating-inner .stars i {  font-size:16px; } .review-card-three .rating-inner .rating-text {  font-size:16px;  color:var(--dark-color);  font-weight:500; } .testimonial-card-five {  position:relative;  z-index:1;  margin-bottom:10px; } .testimonial-card-five::before {  position:absolute;  content:"";  left:50%;  transform:translateX(-50%);  transition:all 0.4s ease 0s;  top:10px;  width:90%;  height:100%;  border-radius:20px;  background:var(--light-color4);  z-index:-1;  transition:all 0.4s ease 0s; } .testimonial-card-five:hover .inner-box {  transform:translateY(10px); } .testimonial-card-five .inner-box {  background:var(--white-color);  padding:45px 40px 60px;  border-radius:20px;  position:relative;  z-index:1;  overflow:hidden;  transition:all 0.4s ease 0s; } @media (max-width:1024px) {  .testimonial-card-five .inner-box {   padding:50px 30px 50px;  } } @media (min-width:992px) and (max-width:1024px) {  .testimonial-card-five .inner-box {   padding:50px 24px 50px;  } } .testimonial-card-five .inner-box.white .icon {  filter:brightness(0) invert(1); } .testimonial-card-five .inner-box .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:70px;  height:70px;  border-radius:50%;  background:var(--theme-color3);  font-size:30px;  color:var(--dark-color);  transition:all 0.4s ease 0s; } .testimonial-card-five .inner-box .icon svg {  fill:var(--dark-color);  width:30px;  height:30px; } .testimonial-card-five .inner-box .title {  display:flex;  align-items:center;  gap:10px;  font-size:22px;  font-weight:500;  margin-bottom:9px;  transition:all 0.4s ease 0s; } .testimonial-card-five .inner-box .title i {  font-size:30px; } .testimonial-card-five .inner-box .rating {  margin-bottom:28px; } .testimonial-card-five .inner-box .rating i {  color:var(--orange-color); } .testimonial-card-five .inner-box .rating span {  font-size:16px;  color:var(--dark-color);  font-weight:500; } .testimonial-card-five .inner-box .text {  font-size:16px;  line-height:1.66;  margin-bottom:0;  transition:all 0.4s ease 0s; } .testimonial-card-five .inner-box .border {  transition:all 0.4s ease 0s; } .testimonial-card-five .inner-box .user-info {  display:flex;  align-items:center;  gap:20px; } .testimonial-card-five .inner-box .user-info .user-image {  width:66px;  height:66px;  border-radius:50%; } .testimonial-card-five .inner-box .user-info .user-name {  font-size:21px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0; } .testimonial-card-five .inner-box .user-info .user-title {  margin-bottom:0; } .dark-mode .testi-content-wrap .testi-clutch .review-card-three {  border-top:1px solid var(--bs-border-color13);  border-bottom:1px solid var(--bs-border-color13); } .dark-mode .testi-content-wrap .testi-btn-wrapper .array-button .array-prev {  color:var(--white-color);  background:var(--bs-bg-color10);  border:1px solid var(--bs-border-color6); } .dark-mode .testi-slider-6 .testimonial-card-five::before {  background:var(--bs-bg-color20); } .dark-mode .testi-slider-6 .testimonial-card-five .inner-box {  background:var(--dark-color3); } .dark-mode .testi-slider-6 .testimonial-card-five .inner-box .content .title {  color:var(--white-color); } .dark-mode .testi-slider-6 .testimonial-card-five .inner-box .content .rating span {  color:var(--white-color); } .dark-mode .testi-slider-6 .testimonial-card-five .inner-box .content .text {  color:var(--gray-color2); } .dark-mode .testi-slider-6 .testimonial-card-five .inner-box .border {  background-color:var(--bs-bg-color10); } .dark-mode .testi-slider-6 .testimonial-card-five .inner-box .user-info .user-name {  color:var(--white-color); } .dark-mode .testi-slider-6 .testimonial-card-five .inner-box .user-info .user-title {  color:var(--gray-color2); }  .testimonial-section.style-6 {  position:relative; } .testimonial-section.style-6 .array-button {  gap:10px; } .testimonial-section.style-6 .array-button .array-next, .testimonial-section.style-6 .array-button .array-prev {  font-size:16px;  width:44px;  height:44px;  color:var(--white-color);  border-color:var(--bs-border-color6);  background:var(--dark-color3); } .testimonial-section.style-6 .array-button .array-next:hover, .testimonial-section.style-6 .array-button .array-prev:hover, .testimonial-section.style-6 .array-button .array-next.active {  color:var(--white-color);  background:var(--theme-color);  border-color:var(--theme-color); } @media (max-width:414px) {  .testimonial-section.style-6 .array-button {   right:20px;  } } .testimonial-section.style-6 .review-card-three {  border-top:1px solid var(--bs-border-color13);  border-bottom:1px solid var(--bs-border-color13); } .testimonial-card-five.style-6 {  position:relative;  z-index:1;  margin-bottom:10px; } .testimonial-card-five.style-6::before {  position:absolute;  content:"";  left:50%;  transform:translateX(-50%);  transition:all 0.4s ease 0s;  top:10px;  width:90%;  height:100%;  border-radius:20px;  background:var(--bs-bg-color20);  z-index:-1;  transition:all 0.4s ease 0s; } .testimonial-card-five.style-6:hover .inner-box {  transform:translateY(10px); } .testimonial-card-five.style-6 .inner-box {  background:var(--dark-color3);  padding:45px 40px 60px;  border-radius:20px;  position:relative;  z-index:1;  overflow:hidden;  transition:all 0.4s ease 0s; } @media (max-width:1024px) {  .testimonial-card-five.style-6 .inner-box {   padding:50px 30px 50px;  } } @media (min-width:992px) and (max-width:1024px) {  .testimonial-card-five.style-6 .inner-box {   padding:50px 24px 50px;  } } .testimonial-card-five.style-6 .inner-box.white .icon {  filter:brightness(0) invert(1); } .testimonial-card-five.style-6 .inner-box .title {  color:var(--white-color); } .testimonial-card-five.style-6 .inner-box .title i {  color:var(--theme-color2); } .testimonial-card-five.style-6 .inner-box .rating i {  color:var(--orange-color); } .testimonial-card-five.style-6 .inner-box .rating span {  color:var(--white-color); } .testimonial-card-five.style-6 .inner-box .text {  font-size:16px;  line-height:1.66;  margin-bottom:0;  color:var(--gray-color2);  transition:all 0.4s ease 0s; } .testimonial-card-five.style-6 .inner-box .border {  transition:all 0.4s ease 0s;  border-color:var(--bs-border-color2) !important; } .testimonial-card-five.style-6 .inner-box .user-info {  display:flex;  align-items:center;  gap:20px; } .testimonial-card-five.style-6 .inner-box .user-info .user-image {  width:66px;  height:66px;  border-radius:50%; } .testimonial-card-five.style-6 .inner-box .user-info .user-name {  color:var(--white-color); } .testimonial-card-five.style-6 .inner-box .user-info .user-title {  margin-bottom:0;  color:var(--gray-color2); } @media (max-width:991px) {  .service-section.style-4 .service-tabs {   display:flex;   flex-wrap:nowrap;   overflow-x:auto;  }  .service-section.style-4 .service-tabs::-webkit-scrollbar-thumb {   background-color:#09ACEB;  }  .service-section.style-4 .service-tabs::-webkit-scrollbar {   height:3px;  }  .service-section.style-4 .service-tabs::-webkit-scrollbar-track {   background-color:#f0f0f0;  }  .service-section.style-4 .service-tabs .col-lg-3 {   max-width:220px;  }  .service-section.style-4 .service-tabs .service-tab.active h5 {   color:#09ACEB;  }  .service-section.style-4 .service-tabs .service-tab::before {   display:none;  } } .appointment-form br {  display:none; } .appointment-form .header {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:space-between;  margin-bottom:30px; } @media (max-width:430px) {  .appointment-form .header {   flex-direction:column;   gap:10px;  } } .appointment-form .header .title {  font-size:30px;  line-height:1.09;  margin-bottom:0; } @media (max-width:414px) {  .appointment-form .header .title {   font-size:24px;  } } .appointment-form .header .availability {  font-size:16px;  color:var(--gray-color); } .appointment-form form .form-grid {  display:flex;  gap:25px;  } @media (max-width:575px) {  .appointment-form form .form-grid {   gap:0;   flex-direction:column;  } } .appointment-form form .form-grid input, .appointment-form form .form-grid select, .appointment-form form .form-grid textarea {  padding:12px 25px;  padding-left:52px;  border-radius:28px;  color:var(--dark-color);  background-color:var(--white-color);  outline:none;  border:1px solid var(--bs-border-color6);  transition:border-color 0.3s ease; } .appointment-form form .form-grid input::placeholder, .appointment-form form .form-grid select::placeholder, .appointment-form form .form-grid textarea::placeholder {  opacity:0.5; } .appointment-form form .form-grid input:focus, .appointment-form form .form-grid select:focus, .appointment-form form .form-grid textarea:focus {  border-color:var(--theme-color); } .appointment-form form .form-group {  flex:1;  } .appointment-form form .form-group p {  margin:0; } @media (max-width:575px) {  .appointment-form form .form-group {   flex:0 0 100%;  } } .appointment-form form .form-group .icon {  position:absolute;  top:14px;  left:26px;  margin:0;  color:var(--theme-color);  z-index:2; } .appointment-form form .form-group textarea {  padding:12px 25px;  border-radius:28px;  color:var(--dark-color);  background-color:var(--white-color);  outline:none;  border:1px solid var(--bs-border-color6);  transition:border-color 0.3s ease;  resize:none;  height:130px;  border-radius:30px; } .appointment-form form .form-group textarea::placeholder {  opacity:0.5; } .appointment-form form .form-group .select2-container--default .select2-selection--single .select2-selection__arrow {  color:var(--theme-color); } .appointment-form form .terms {  display:flex;  align-items:center;  height:18px;  margin-bottom:30px; } .appointment-form form .terms input[type=checkbox] {  margin-right:10px;  width:15px; } .appointment-form form .terms label {  display:flex;  align-items:center;  font-size:14px;  color:var(--gray-color);  left:0; } .appointment-form form .theme-btn.bg-dark {  width:100%; } .appointment-form form .theme-btn.bg-dark br {  display:none; } .appointment-form .wpcf7-form-control.wpcf7-select {  line-height:1; } .appointment-form select {  background:var(--white-color);  color:var(--dark-color);  border:1px solid var(--bs-border-color6);  border-radius:28px; } .appointment-form select option {  color:var(--dark-color); } .contact-content-wrap {  } @media (max-width:991px) {  .contact-content-wrap {   margin-top:35px;  } } .contact-content-wrap .contact-img {  position:relative;  overflow:hidden;  display:inline-block;  } @media (max-width:767px) {  .contact-content-wrap .contact-img {   width:100%;  }  .contact-content-wrap .contact-img img {   width:100%;  } } .contact-content-wrap .contact-img:hover .contact-info .icon {  animation:wobble_vertical 1s forwards ease-in-out 0s; } .contact-content-wrap .contact-img::before {  position:absolute;  content:"";  width:100%;  height:100%;  background:none;  left:0;  bottom:0;  background-image:linear-gradient(0deg, rgb(9, 73, 73) 0%, rgb(9, 73, 73) 10%, rgba(9, 73, 73, 0) 58%, rgba(9, 73, 73, 0) 100%); } .contact-content-wrap .contact-img .contact-info {  position:absolute;  left:35px;  bottom:35px;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-start;  gap:10px; } .contact-content-wrap .contact-img .contact-info .icon {  font-size:34px;  color:var(--theme-color2); } .contact-content-wrap .contact-img .contact-info .number {  font-size:20px;  color:var(--white-color);  font-weight:500; }  .contact-section.style-2 .contact-content-wrap .contact-info {  padding:40px 0 35px;  border-top:1px solid var(--bs-border-color7);  border-bottom:1px solid var(--bs-border-color7); } .contact-section.style-2 .contact-content-wrap .contact-info .contact-item {  display:flex;  gap:20px;  margin-bottom:25px; } .contact-section.style-2 .contact-content-wrap .contact-info .contact-item:hover .icon {  background-color:var(--theme-color); } .contact-section.style-2 .contact-content-wrap .contact-info .contact-item:hover .icon svg, .contact-section.style-2 .contact-content-wrap .contact-info .contact-item:hover .icon i {  animation:wobble_vertical 1s forwards ease-in-out 0s; } .contact-section.style-2 .contact-content-wrap .contact-info .contact-item:hover .icon svg {  width:22px;  fill:var(--white-color); } .contact-section.style-2 .contact-content-wrap .contact-info .contact-item:last-child {  margin-bottom:0; } .contact-section.style-2 .contact-content-wrap .contact-info .contact-item .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:50px;  height:50px;  border-radius:50%;  font-size:24px;  color:var(--white-color);  background-color:var(--dark-color);  transition:all 0.4s ease 0s; } .contact-section.style-2 .contact-content-wrap .contact-info .contact-item .icon svg {  width:24px;  fill:var(--white-color); } .contact-section.style-2 .contact-content-wrap .contact-info .contact-item .info {  text-align:left; } .contact-section.style-2 .contact-content-wrap .contact-info .contact-item .info .title {  font-size:20px;  color:var(--dark-color);  font-weight:500;  margin-bottom:5px; } .contact-section.style-2 .contact-content-wrap .contact-info .contact-item .info p {  margin-bottom:0; } .contact-section.style-2 .contact-content-wrap .contact-info .contact-item .info .content {  color:var(--gray-color); } .contact-section.style-2 .contact-content-wrap .contact-info .contact-item .info .content a {  color:var(--gray-color); } .contact-section.style-2 .contact-content-wrap .contact-info .contact-item .info .content a:hover {  color:var(--theme-color); } .contact-form {  padding:70px 50px 70px;  background-color:var(--white-color);  border-radius:10px;  } @media (max-width:575px) {  .contact-form {   padding:50px 30px;  } } .contact-form .title {  font-size:30px;  color:var(--dark-color);  font-weight:600;  line-height:1.09;  margin-bottom:0; } @media (max-width:414px) {  .contact-form .title {   font-size:24px;  } } .contact-form form .form-grid {  display:flex;  gap:25px;  } @media (max-width:575px) {  .contact-form form .form-grid {   gap:0;   flex-direction:column;  } } .contact-form form .form-grid input, .contact-form form .form-grid textarea {  padding:12px 25px;  padding-left:52px;  border-radius:28px;  color:var(--dark-color);  background-color:var(--white-color);  outline:none;  border:1px solid var(--bs-border-color6);  transition:border-color 0.3s ease; } .contact-form form .form-grid input::placeholder, .contact-form form .form-grid textarea::placeholder {  opacity:0.5; } .contact-form form .form-grid input:focus, .contact-form form .form-grid textarea:focus {  border-color:var(--theme-color); } .contact-form form .form-grid .wpcf7-form-control.wpcf7-select {  line-height:1; } .contact-form form .form-grid select {  background:var(--white-color);  color:var(--dark-color);  border:1px solid var(--bs-border-color6);  border-radius:28px; } .contact-form form .form-group {  flex:1;  } @media (max-width:575px) {  .contact-form form .form-group {   flex:0 0 100%;  } } .contact-form form .form-group .icon {  position:absolute;  top:14px;  left:26px;  margin:0;  color:var(--theme-color);  z-index:1; } .contact-form form .form-group textarea {  padding:12px 25px;  border-radius:28px;  color:var(--dark-color);  background-color:var(--white-color);  outline:none;  border:1px solid var(--bs-border-color6);  transition:border-color 0.3s ease;  resize:none;  height:170px;  border-radius:30px; } .contact-form form .form-group textarea::placeholder {  opacity:0.5; } .contact-form form .form-group .select2-container--default .select2-selection--single .select2-selection__arrow {  color:var(--theme-color); } .contact-form form .terms {  height:18px;  margin-bottom:0; } .contact-form form .terms input[type=checkbox] {  margin-right:10px;  width:15px;  height:15px; } .contact-form form .terms label {  display:flex;  align-items:center;  font-size:14px;  color:var(--gray-color);  left:0;  margin-bottom:0; } .contact-form form .theme-btn br {  display:none; } .contact-form .contact_form br {  display:none; } .contact-form .contact_form p {  margin:0; } .social-links {  margin-top:25px; } .social-links a {  display:inline-block;  font-size:16px;  font-weight:500;  color:var(--dark-color);  margin-right:40px; } .social-links a:last-child {  margin-right:0; } .social-links a:hover {  color:var(--theme-color); } .dark-mode .contact-form form .form-grid input::placeholder, .dark-mode .contact-form form .form-group textarea::placeholder {  color:var(--white-color); } .dark-mode .contact-form form .form-group textarea, .dark-mode .contact-form form .form-grid input, .dark-mode .contact-form form .form-grid textarea {  background-color:rgba(255, 255, 255, 0.0784313725);  color:var(--white-color); } .dark-mode .contact-form form .form-grid select {  background:rgba(255, 255, 255, 0.0784313725);  color:rgba(255, 255, 255, 0.4588235294); } .dark-mode .theme-btn.bg-dark {  background-color:var(--theme-color) !important; }  .contact-section.style-3 .overlay {  } @media (max-width:991px) {  .contact-section.style-3 .overlay {   background:var(--bs-bg-color3);  } } .contact-section.style-3::before {  content:"";  z-index:0;  position:absolute;  left:-20%;  bottom:-40%;  width:1165px;  height:722px;  background:var(--dark-color3);  border-radius:50%;  mix-blend-mode:multiply;  filter:blur(80px); } .contact-section.style-3::after {  content:"";  z-index:-1;  position:absolute;  right:-30%;  top:-40%;  width:1165px;  height:722px;  background:#80dbc1;  border-radius:50%;  mix-blend-mode:color;  filter:blur(80px); } .contact-section.style-3 .contact-content .text {  display:flex;  align-items:center; } .contact-section.style-3 .contact-content .text .icon {  color:var(--theme-color2);  margin-right:10px; } .contact-section.style-3 .contact-content .text p {  opacity:0.702;  font-size:18px;  line-height:26px;  color:var(--white-color);  font-weight:400;  margin:0; } .contact-section.style-3 .appointment-area {  padding:57px 50px 57px 40px;  border-radius:20px 20px 0 0;  background:rgba(255, 255, 255, 0.71);  backdrop-filter:blur(20px);  } @media (max-width:991px) {  .contact-section.style-3 .appointment-area {   max-width:575px;  } } .contact-section.style-3 .appointment-area .header {  text-align:center;  margin-bottom:30px; } .contact-section.style-3 .appointment-area .header .title {  font-size:30px;  line-height:1;  color:var(--dark-color);  font-weight:600; } .contact-section.style-3 .appointment-area .header span {  opacity:0.8;  font-size:16px;  line-height:26px;  color:var(--dark-color);  font-weight:400; } .contact-section.style-3 .appointment-area .appointment-form .form-group {  margin-bottom:25px;  position:relative; } .contact-section.style-3 .appointment-area .appointment-form .form-group .icon {  position:absolute;  top:14px;  left:26px;  margin:0;  color:var(--theme-color); } .contact-section.style-3 .appointment-area .appointment-form .form-group input, .contact-section.style-3 .appointment-area .appointment-form .form-group select, .contact-section.style-3 .appointment-area .appointment-form .form-group textarea {  padding:12px 25px;  padding-left:52px;  border-radius:28px;  color:var(--dark-color);  background-color:transparent;  outline:none;  border:1px solid var(--bs-border-color6);  transition:border-color 0.3s ease; } .contact-section.style-3 .appointment-area .appointment-form .form-group input:focus, .contact-section.style-3 .appointment-area .appointment-form .form-group select:focus, .contact-section.style-3 .appointment-area .appointment-form .form-group textarea:focus {  border-color:var(--theme-color); } .contact-section.style-3 .appointment-area .appointment-form .form-group textarea {  padding:12px 25px;  border-radius:28px;  color:var(--dark-color);  background-color:transparent;  outline:none;  border:1px solid var(--bs-border-color6);  transition:border-color 0.3s ease;  resize:none;  height:120px;  border-radius:30px; } .contact-section.style-3 .appointment-area .appointment-form .form-group select {  width:100%;  color:var(--gray-color);  padding:12px 25px;  background-image:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' width='20' height='20'%3E%3Cpath fill='%23063232' d='M7 10l5 5 5-5z'/%3E%3C/svg%3E");  background-repeat:no-repeat;  background-position:right 15px center;  background-size:16px 16px; } .contact-section.style-3 .appointment-area .appointment-form .select2-selection--single {  background:transparent; } .contact-section.style-3 .appointment-area .appointment-form button {  width:100%; } .contact-section.style-3 .appointment-area form .terms label {  display:flex;  align-items:center;  font-size:14px;  color:var(--gray-color);  left:0;  margin-bottom:0; } .contact-section.style-3 .appointment-area form .terms input[type=checkbox] {  margin-right:10px;  width:15px;  height:15px; } .contact-section.style-3 .appointment-area p {  margin:0; }  .contact-wrapper {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  gap:50px;  } @media (max-width:767px) {  .contact-wrapper {   gap:22px;   flex-direction:column-reverse;  } } .contact-wrapper .contact-option, .contact-wrapper .social-option {  display:flex;  align-items:center;  } @media (max-width:375px) {  .contact-wrapper .contact-option,  .contact-wrapper .social-option {   flex-direction:column;   justify-content:center;  } } .contact-wrapper .contact-option i, .contact-wrapper .social-option i {  font-size:20px;  margin-right:10px;  color:var(--dark-color); } .contact-wrapper .contact-option svg, .contact-wrapper .social-option svg {  fill:var(--dark-color);  width:18px;  height:auto;  margin-right:5px; } .contact-wrapper .contact-option span, .contact-wrapper .social-option span {  font-size:20px;  line-height:1.66;  color:var(--dark-color);  font-weight:500;  margin-right:15px;  } @media (max-width:375px) {  .contact-wrapper .contact-option span,  .contact-wrapper .social-option span {   margin-right:0;  } } .contact-wrapper .contact-option a, .contact-wrapper .social-option a {  font-size:20px;  line-height:1.66;  color:var(--dark-color);  font-weight:500;  transition:all 0.4s ease 0s;  background:linear-gradient(var(--dark-color) 0%, var(--dark-color) 98%);  background-repeat:no-repeat;  background-size:100% 2px;  background-position:left 100%; } .contact-wrapper .contact-option a:hover, .contact-wrapper .social-option a:hover {  color:var(--theme-color);  background-size:0 2px; } .dark-mode .contact-wrapper {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  gap:50px;  } @media (max-width:767px) {  .dark-mode .contact-wrapper {   gap:22px;   flex-direction:column-reverse;  } } .dark-mode .contact-wrapper .contact-option, .dark-mode .contact-wrapper .social-option {  display:flex;  align-items:center;  } @media (max-width:375px) {  .dark-mode .contact-wrapper .contact-option,  .dark-mode .contact-wrapper .social-option {   flex-direction:column;   justify-content:center;  } } .dark-mode .contact-wrapper .contact-option i, .dark-mode .contact-wrapper .social-option i {  font-size:20px;  margin-right:10px;  color:var(--gray-color2); } .dark-mode .contact-wrapper .contact-option span, .dark-mode .contact-wrapper .social-option span {  font-size:20px;  line-height:1.66;  color:var(--white-color);  font-weight:500;  margin-right:15px;  } @media (max-width:375px) {  .dark-mode .contact-wrapper .contact-option span,  .dark-mode .contact-wrapper .social-option span {   margin-right:0;  } } .dark-mode .contact-wrapper .contact-option a, .dark-mode .contact-wrapper .social-option a {  font-size:20px;  line-height:1.66;  color:var(--theme-color2);  font-weight:500;  transition:all 0.4s ease 0s;  background:linear-gradient(var(--theme-color2) 0%, var(--theme-color2) 98%);  background-repeat:no-repeat;  background-size:100% 2px;  background-position:left 100%; } .dark-mode .contact-wrapper .contact-option a:hover, .dark-mode .contact-wrapper .social-option a:hover {  color:var(--gray-color2);  background-size:0 2px; }  .map-box {  line-height:0; } .map-box .map-canvas {  height:600px;  transition:all 0.4s ease 0s; } @media (max-width:767px) {  .map-box .map-canvas {   height:520px;  } } @media (max-width:575px) {  .map-box .map-canvas {   height:420px;  } }  .pricing-content-wrap {  position:relative;  height:100%;  display:flex;  align-content:space-between;  flex-wrap:wrap;  } @media (max-width:991px) {  .pricing-content-wrap {   display:block;  }  .pricing-content-wrap .title-area {   margin-bottom:20px;  } } .pricing-content-wrap > .text {  display:flex;  gap:14px; } .pricing-content-wrap > .text p {  font-size:18px;  color:var(--dark-color);  margin:-5px 0 0; } .pricing-card {  background-color:var(--white-color);  padding:50px 40px;  border-radius:10px;  text-align:center;  position:relative;  z-index:1; } .pricing-card.current .pricing-plan .path, .pricing-card:hover .pricing-plan .path {  background-color:var(--dark-color); } .pricing-card.current .pricing-plan .plan, .pricing-card:hover .pricing-plan .plan {  color:var(--theme-color2); } .pricing-card.current .pricing-plan .price, .pricing-card:hover .pricing-plan .price {  color:var(--white-color); } .pricing-card.current .pricing-plan .billing-cycle, .pricing-card:hover .pricing-plan .billing-cycle {  color:var(--gray-color2); } .pricing-card.current .theme-btn.bg-white, .pricing-card:hover .theme-btn.bg-white {  color:var(--white-color);  background-color:var(--dark-color) !important; } .pricing-card.current .theme-btn.bg-white svg, .pricing-card:hover .theme-btn.bg-white svg {  fill:var(--white-color);  width:20px;  height:auto; } .pricing-card .pricing-plan .path {  background-color:var(--light-color2);  border-radius:0 0 50% 50%;  width:230px;  height:222px;  position:absolute;  content:"";  z-index:-1;  top:0;  left:50%;  transform:translateX(-50%);  border-top:18px solid var(--theme-color2);  transition:all 0.4s ease 0s; } .pricing-card .pricing-plan .path::before {  position:absolute;  right:-15px;  top:-18px;  content:"";  height:15px;  width:15px;  background:url('data:image/svg+xml,<svg viewBox="0 0 11 11" fill="none" xmlns="http://www.w3.org/2000/svg" class="w-11 h-11"><path d="M11 1.54972e-06L0 0L2.38419e-07 11C1.65973e-07 4.92487 4.92487 1.62217e-06 11 1.54972e-06Z" fill="%23c2df93"></path></svg>');  transform:rotate(0); } .pricing-card .pricing-plan .path::after {  position:absolute;  left:-15px;  top:-18px;  content:"";  height:15px;  width:15px;  background:url('data:image/svg+xml,<svg viewBox="0 0 11 11" fill="none" xmlns="http://www.w3.org/2000/svg" class="w-11 h-11"><path d="M11 1.54972e-06L0 0L2.38419e-07 11C1.65973e-07 4.92487 4.92487 1.62217e-06 11 1.54972e-06Z" fill="%23c2df93"></path></svg>');  transform:rotate(90deg); } .pricing-card .pricing-plan .plan {  color:var(--dark-color);  font-weight:500;  margin:0; } .pricing-card .pricing-plan .price {  font-size:50px;  line-height:1;  color:var(--dark-color);  font-weight:600;  margin:16px 0 12px; } .pricing-card .pricing-plan .billing-cycle {  margin:0;  font-size:16px;  color:var(--dark-color); } .pricing-card .features {  margin:72px 0 46px 40px;  color:var(--dark-color); } @media (min-width:992px) and (max-width:1024px) {  .pricing-card .features {   margin:72px 0 46px 0;  } } @media (min-width:576px) and (max-width:767px) {  .pricing-card .features {   margin:72px 0 46px 0;  } } @media (max-width:390px) {  .pricing-card .features {   margin:72px 0 46px 0;  } } .pricing-card .features li {  display:flex;  align-items:center;  font-size:16px;  line-height:1.4;  margin-bottom:17px; } .pricing-card .features li:last-child {  margin-bottom:0; } .pricing-card .features li .checkmark {  color:var(--theme-color);  font-size:16px;  margin-right:10px; } .pricing-card .features li.disabled {  color:var(--gray-color);  opacity:0.5; } .pricing-card .theme-btn {  padding:13px 40px; } .pricing-card .recommended-badge {  position:absolute;  top:77px;  right:-17px;  display:flex;  align-items:center;  font-size:15px;  color:var(--dark-color);  font-weight:500;  transform:rotate(90deg);  gap:8px; } @media (min-width:992px) and (max-width:1024px) {  .pricing-card .recommended-badge {   right:-43px;  } } @media (min-width:576px) and (max-width:767px) {  .pricing-card .recommended-badge {   right:-34px;  } } @media (max-width:575px) {  .pricing-card .recommended-badge {   right:13px;  } } @media (max-width:540px) {  .pricing-card .recommended-badge {   right:7px;  } } @media (max-width:430px) {  .pricing-card .recommended-badge {   right:-21px;  } } @media (max-width:414px) {  .pricing-card .recommended-badge {   right:-25px;  } } @media (max-width:390px) {  .pricing-card .recommended-badge {   right:-31px;  } } @media (max-width:375px) {  .pricing-card .recommended-badge {   right:-35px;  } } @media (max-width:360px) {  .pricing-card .recommended-badge {   right:-40px;  } } .pricing-card .recommended-badge i {  color:var(--theme-color); }  .pricing-section.style-2 .pricing-table table {  width:100%;  border-collapse:collapse;  border:hidden; } .pricing-section.style-2 .pricing-table table .table-header {  border-top:hidden;  } @media (max-width:575px) {  .pricing-section.style-2 .pricing-table table .table-header {   display:flex;  } } @media (max-width:540px) {  .pricing-section.style-2 .pricing-table table .table-header {   flex-direction:column;  } } .pricing-section.style-2 .pricing-table table .table-header .features-header {  font-size:20px;  padding-left:0;  padding-top:0;  color:var(--white-color);  font-weight:500;  vertical-align:baseline;  } @media (max-width:575px) {  .pricing-section.style-2 .pricing-table table .table-header .features-header {   padding:15px 20px;   font-size:18px;  } } .pricing-section.style-2 .pricing-table table .table-header .pricing-header {  padding-top:0;  width:250px;  text-align:center;  } @media (max-width:1024px) {  .pricing-section.style-2 .pricing-table table .table-header .pricing-header {   width:220px;  } } @media (max-width:853px) {  .pricing-section.style-2 .pricing-table table .table-header .pricing-header {   width:190px;  } } @media (max-width:767px) {  .pricing-section.style-2 .pricing-table table .table-header .pricing-header {   width:170px;  } } @media (max-width:575px) {  .pricing-section.style-2 .pricing-table table .table-header .pricing-header {   width:100%;  } } @media (max-width:575px) {  .pricing-section.style-2 .pricing-table table .table-header .pricing-header {   padding:15px 20px;  } } .pricing-section.style-2 .pricing-table table .table-header .pricing-header .pricing-type {  font-size:20px;  color:var(--white-color);  font-weight:500;  text-align:center;  display:block;  margin-bottom:10px; } .pricing-section.style-2 .pricing-table table .table-header .pricing-header .pricing-amount .price {  font-size:30px;  color:var(--white-color);  font-weight:600;  position:relative;  } @media (max-width:575px) {  .pricing-section.style-2 .pricing-table table .table-header .pricing-header .pricing-amount .price {   font-size:25px;  } } .pricing-section.style-2 .pricing-table table .table-header .pricing-header .pricing-amount .price::before {  position:absolute;  content:"$";  left:-14px;  top:0;  font-size:16px;  font-weight:500; } .pricing-section.style-2 .pricing-table table .table-header .pricing-header .pricing-amount .duration {  font-size:15px;  color:var(--gray-color2);  font-weight:400; } .pricing-section.style-2 .pricing-table table .features-header {  text-align:left; } .pricing-section.style-2 .pricing-table table .feature-row {  } @media (max-width:575px) {  .pricing-section.style-2 .pricing-table table .feature-row {   display:flex;   flex-direction:column;  } } .pricing-section.style-2 .pricing-table table .feature-row th, .pricing-section.style-2 .pricing-table table .feature-row td {  padding:15px 20px;  border-bottom:1px solid var(--bs-border-color);  text-align:center; } .pricing-section.style-2 .pricing-table table .feature-row:last-child td {  padding:30px 0 0;  } @media (max-width:575px) {  .pricing-section.style-2 .pricing-table table .feature-row:last-child td {   padding:15px 20px;  } } .pricing-section.style-2 .pricing-table table .feature-row .feature-name {  text-align:left;  font-size:18px;  color:var(--white-color);  font-weight:400;  position:relative; } @media (max-width:853px) {  .pricing-section.style-2 .pricing-table table .feature-row .feature-name {   font-size:16px;  } } .pricing-section.style-2 .pricing-table table .feature-row .feature-name::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  width:6px;  height:6px;  border-radius:50%;  background-color:rgba(244, 248, 236, 0.2); } .pricing-section.style-2 .pricing-table table .feature-row .available, .pricing-section.style-2 .pricing-table table .feature-row .unavailable {  font-size:16px;  color:var(--white-color);  width:250px; } @media (max-width:1024px) {  .pricing-section.style-2 .pricing-table table .feature-row .available,  .pricing-section.style-2 .pricing-table table .feature-row .unavailable {   width:220px;  } } @media (max-width:853px) {  .pricing-section.style-2 .pricing-table table .feature-row .available,  .pricing-section.style-2 .pricing-table table .feature-row .unavailable {   width:190px;  } } @media (max-width:767px) {  .pricing-section.style-2 .pricing-table table .feature-row .available,  .pricing-section.style-2 .pricing-table table .feature-row .unavailable {   width:170px;  } } @media (max-width:575px) {  .pricing-section.style-2 .pricing-table table .feature-row .available,  .pricing-section.style-2 .pricing-table table .feature-row .unavailable {   width:100%;  } } .pricing-section.style-2 .pricing-table table .feature-row .available:hover i {  animation:wobble_vertical 1s forwards ease-in-out 0s; } .pricing-section.style-2 .pricing-table table .feature-row .unavailable:hover i {  animation:wobble_bell 1s forwards ease-in-out 0s; } .pricing-section.style-2 .pricing-table table .feature-row .guarantee-text {  font-size:15px;  color:var(--gray-color2);  font-weight:400;  text-align:left;  padding-left:0; } .pricing-section.style-2 .pricing-table table .feature-row .guarantee-text i {  font-size:16px;  color:var(--theme-color2);  padding-right:10px; } .pricing-section.style-2 .pricing-table table .feature-row .theme-btn {  } @media (max-width:1024px) {  .pricing-section.style-2 .pricing-table table .feature-row .theme-btn {   padding:12px 20px;  } } @media (max-width:767px) {  .pricing-section.style-2 .pricing-table table .feature-row .theme-btn {   padding:12px 15px;  } }  .pricing-section.style-3 .pricing-content-wrapper {  position:sticky;  top:100px; } .pricing-section.style-3 .pricing-single-box {  background:var(--white-color);  padding:40px 0 40px 40px;  border-radius:10px;  display:flex;  overflow:hidden;  position:relative;  } @media (max-width:430px) {  .pricing-section.style-3 .pricing-single-box {   flex-direction:column;   align-items:center;  } } @media (min-width:992px) and (max-width:1024px) {  .pricing-section.style-3 .pricing-single-box {   padding:40px 0 40px 30px;  } } @media (max-width:991px) {  .pricing-section.style-3 .pricing-single-box {   max-width:767px;  } } .pricing-section.style-3 .pricing-single-box::before {  content:"";  position:absolute;  top:0;  left:50%;  width:0%;  height:100%;  background:var(--dark-color3);  transition:0.4s ease-in-out;  transform:translateX(-50%);  z-index:1; } .pricing-section.style-3 .pricing-single-box .pricing-box-left {  border-right:1px solid var(--bs-border-color7);  transition:all 0.4s ease-in-out;  padding-right:30px;  margin-right:30px;  z-index:2; } @media (min-width:992px) and (max-width:1024px) {  .pricing-section.style-3 .pricing-single-box .pricing-box-left {   padding-right:20px;   margin-right:20px;  } } @media (max-width:430px) {  .pricing-section.style-3 .pricing-single-box .pricing-box-left {   border-right:inherit;   text-align:center;  } } .pricing-section.style-3 .pricing-single-box .pricing-box-left .pricing-title {  transition:all 0.4s ease-in-out; } .pricing-section.style-3 .pricing-single-box .pricing-box-left .pricing-title p {  font-size:14px;  line-height:1;  color:var(--dark-color);  font-weight:500;  display:inline-block;  padding:10px 20px;  border:1px solid var(--bs-border-color7);  background:var(--bs-bg-color4);  border-radius:17px;  transition:all 0.4s ease-in-out;  margin:0; } .pricing-section.style-3 .pricing-single-box .pricing-box-left .pricing-title h2 {  font-size:48px;  line-height:1;  color:var(--dark-color);  font-weight:600;  transition:all 0.4s ease-in-out;  margin:0; } .pricing-section.style-3 .pricing-single-box .pricing-box-left .pricing-title h2 sup {  font-size:20px;  line-height:90px;  color:var(--dark-color);  font-weight:500;  transition:all 0.4s ease-in-out;  top:-20px; } .pricing-section.style-3 .pricing-single-box .pricing-box-left .pricing-title h2 sub {  font-size:16px;  line-height:28px;  color:var(--gray-color);  transition:all 0.4s ease-in-out;  font-weight:400;  bottom:0; } .pricing-section.style-3 .pricing-single-box .pricing-box-left .theme-btn {  padding:12px 30px; } .pricing-section.style-3 .pricing-single-box .pricing-box-right {  z-index:5; } @media (max-width:430px) {  .pricing-section.style-3 .pricing-single-box .pricing-box-right {   margin-top:20px;  } } .pricing-section.style-3 .pricing-single-box .pricing-box-right .pricing-list li {  font-size:16px;  line-height:28px;  color:var(--gray-color);  font-weight:400;  margin-bottom:8px;  transition:all 0.4s ease-in-out; } .pricing-section.style-3 .pricing-single-box .pricing-box-right .pricing-list li.color-0 {  opacity:0.702; } .pricing-section.style-3 .pricing-single-box .pricing-box-right .pricing-list li.color-0 i {  color:inherit; } .pricing-section.style-3 .pricing-single-box .pricing-box-right .pricing-list li:last-child {  margin-bottom:0; } .pricing-section.style-3 .pricing-single-box .pricing-box-right .pricing-list li i {  margin-right:10px;  color:var(--theme-color);  transition:all 0.4s ease-in-out; } .pricing-section.style-3 .pricing-single-box:hover::before, .pricing-section.style-3 .pricing-single-box.current::before {  width:100%; } .pricing-section.style-3 .pricing-single-box:hover .theme-btn.bg-theme3, .pricing-section.style-3 .pricing-single-box.current .theme-btn.bg-theme3 {  background-color:var(--theme-color) !important;  color:var(--white-color); } .pricing-section.style-3 .pricing-single-box:hover .pricing-box-left, .pricing-section.style-3 .pricing-single-box.current .pricing-box-left {  border-right:1px solid var(--bs-border-color13); } .pricing-section.style-3 .pricing-single-box:hover .pricing-box-left .pricing-title p, .pricing-section.style-3 .pricing-single-box.current .pricing-box-left .pricing-title p {  color:var(--white-color);  background:transparent;  border:1px solid var(--bs-border-color13); } .pricing-section.style-3 .pricing-single-box:hover .pricing-box-left .pricing-title h2, .pricing-section.style-3 .pricing-single-box.current .pricing-box-left .pricing-title h2 {  color:var(--white-color); } .pricing-section.style-3 .pricing-single-box:hover .pricing-box-left .pricing-title h2 sup, .pricing-section.style-3 .pricing-single-box.current .pricing-box-left .pricing-title h2 sup {  color:var(--white-color); } .pricing-section.style-3 .pricing-single-box:hover .pricing-box-left .pricing-title h2 sub, .pricing-section.style-3 .pricing-single-box.current .pricing-box-left .pricing-title h2 sub {  color:var(--gray-color2); } .pricing-section.style-3 .pricing-single-box:hover .pricing-box-right .pricing-list li, .pricing-section.style-3 .pricing-single-box.current .pricing-box-right .pricing-list li {  color:var(--gray-color2); } .pricing-section.style-3 .pricing-single-box:hover .pricing-box-right .pricing-list li i, .pricing-section.style-3 .pricing-single-box.current .pricing-box-right .pricing-list li i {  color:var(--theme-color2); }  .pricing-section.inner-page .pricing-card.current .pricing-plan .path, .pricing-section.inner-page .pricing-card:hover .pricing-plan .path {  background-color:var(--dark-color); } .pricing-section.inner-page .pricing-card.current .pricing-plan .plan, .pricing-section.inner-page .pricing-card:hover .pricing-plan .plan {  color:var(--theme-color2); } .pricing-section.inner-page .pricing-card.current .pricing-plan .price, .pricing-section.inner-page .pricing-card:hover .pricing-plan .price {  color:var(--white-color); } .pricing-section.inner-page .pricing-card.current .pricing-plan .billing-cycle, .pricing-section.inner-page .pricing-card:hover .pricing-plan .billing-cycle {  color:var(--gray-color2); } .pricing-section.inner-page .pricing-card .pricing-plan .path {  background-color:var(--white-color);  border:1px solid rgba(6, 50, 50, 0.1);  border-top:none; } .pricing-section.inner-page .pricing-card .pricing-plan .path::before, .pricing-section.inner-page .pricing-card .pricing-plan .path::after {  display:none; } .pricing-section.inner-page .pricing-card .features {  margin:72px 0 46px 40px;  color:var(--dark-color); } @media (min-width:992px) and (max-width:1024px) {  .pricing-section.inner-page .pricing-card .features {   margin:72px 0 46px 0;  } } @media (min-width:576px) and (max-width:767px) {  .pricing-section.inner-page .pricing-card .features {   margin:72px 0 46px 0;  } } @media (max-width:390px) {  .pricing-section.inner-page .pricing-card .features {   margin:72px 0 46px 0;  } } .pricing-section.inner-page .pricing-card .features li {  display:flex;  align-items:center;  font-size:16px;  line-height:1.4;  margin-bottom:17px; } .pricing-section.inner-page .pricing-card .features li:last-child {  margin-bottom:0; } .pricing-section.inner-page .pricing-card .features li .checkmark {  color:var(--theme-color);  font-size:16px;  margin-right:10px; } .pricing-section.inner-page .pricing-card .features li.disabled {  color:var(--gray-color);  opacity:0.5; } .pricing-section.inner-page .pricing-card .recommended-badge {  position:absolute;  background:var(--theme-color3);  top:66px;  right:-34px;  padding:5px 20px;  border-top-right-radius:20px;  border-bottom-right-radius:20px; } @media (max-width:1399px) {  .pricing-section.inner-page .pricing-card .recommended-badge {   right:-41px;  } } @media (min-width:992px) and (max-width:1024px) {  .pricing-section.inner-page .pricing-card .recommended-badge {   background:transparent;   padding:0;  } } @media (max-width:767px) {  .pricing-section.inner-page .pricing-card .recommended-badge {   right:-50px;  } } @media (max-width:360px) {  .pricing-section.inner-page .pricing-card .recommended-badge {   background:transparent;   padding:0;  } }  .pricing-toggle-wrapper {  margin-bottom:30px; } .toggle-labels {  display:flex;  align-items:center;  justify-content:center;  gap:15px; } .toggle-labels span {  font-weight:500;  opacity:0.7;  transition:all 0.3s ease; } .toggle-labels span.active {  opacity:1;  font-weight:700; }  .switch {  position:relative;  display:inline-block;  width:60px;  height:34px;  margin-bottom:0; } .switch input {  opacity:0;  width:0;  height:0; } .slider {  position:absolute;  cursor:pointer;  top:0;  left:0;  right:0;  bottom:0;  background-color:#ccc;  transition:0.4s; } .slider:before {  position:absolute;  content:"";  height:26px;  width:26px;  left:4px;  bottom:4px;  background-color:white;  transition:0.4s; } input:checked + .slider {  background-color:var(--theme-color, #2196F3); } input:focus + .slider {  box-shadow:0 0 1px var(--theme-color, #2196F3); } input:checked + .slider:before {  transform:translateX(26px); } .slider.round {  border-radius:34px; } .slider.round:before {  border-radius:50%; }  .segment-toggle-wrapper {  margin-bottom:40px; } .segment-buttons {  display:flex;  justify-content:center;  gap:10px;  flex-wrap:wrap;  margin-bottom:30px; } .segment-btn {  padding:10px 20px;  border:2px solid var(--theme-color, #2196F3);  background-color:transparent;  color:var(--theme-color, #2196F3);  border-radius:30px;  font-weight:600;  cursor:pointer;  transition:all 0.3s ease; } .segment-btn.active {  background-color:var(--theme-color, #2196F3);  color:white; }  .pricing-tables-container {  display:none; } .pricing-tables-container.active {  display:block; } .pricing-tables {  display:none; } .pricing-tables.active {  display:block; }  @media (max-width:767px) {  .segment-buttons {   flex-direction:column;   align-items:center;  }  .segment-btn {   width:100%;   max-width:250px;  } } .pricing-section.inner-page .pricing-card .pricing-plan .path {  display:none; } .pricing-section.inner-page .pricing-card.current .pricing-plan .billing-cycle, .pricing-section.inner-page .pricing-card:hover .pricing-plan .billing-cycle, .pricing-section.inner-page .pricing-card.current .pricing-plan .price, .pricing-section.inner-page .pricing-card:hover .pricing-plan .price, .pricing-section.inner-page .pricing-card.current .pricing-plan .plan, .pricing-section.inner-page .pricing-card:hover .pricing-plan .plan {  color:var(--dark-color); }  .marquee-wrap {  background:var(--dark-color);  border:1px solid rgba(255, 255, 255, 0.1);  border-left:0;  border-right:0;  padding:40px 0; } .marquee-wrap .marquee__group .m-item {  margin-right:35px;  font-size:24px;  color:var(--light-color2);  font-weight:600;  text-transform:uppercase;  display:inline-flex;  align-items:center; } .marquee-wrap .marquee__group .m-item .icon {  display:inline-block;  margin-right:33px;  animation:spin 20s infinite linear; } .marquee-wrap .marquee__group .m-item .icon:hover {  animation-play-state:paused; }  .marquee-section.style-2 .marquee-wrap {  background:var(--theme-color2);  border:none; } .marquee-section.style-2 .marquee-wrap .marquee__group .m-item {  color:var(--dark-color); } .marquee-section.style-2 .marquee-wrap .marquee__group .m-item .icon {  filter:brightness(0) saturate(100%) invert(12%) sepia(97%) saturate(556%) hue-rotate(135deg) brightness(92%) contrast(95%); }  .marquee-section.style-3 {  position:relative;  z-index:1; } .marquee-section.style-3 .marquee-wrap {  background:transparent;  border:none;  padding:80px 0; } .marquee-section.style-3 .marquee-wrap .marquee__group .m-item {  color:var(--white-color);  font-size:44px;  text-transform:uppercase;  font-weight:700; }  .blog-single-box {  background-color:var(--white-color);  border-radius:10px;  overflow:hidden;  padding:20px; } .blog-single-box:hover .blog-image img {  transform:scale(1.1);  filter:brightness(80%); } .blog-single-box:hover .blog-image .category-tag {  background-color:var(--theme-color); } .blog-single-box:hover .blog-content .border::before {  width:100%;  left:0; } .blog-single-box .blog-image {  position:relative;  border-radius:10px;  overflow:hidden; } .blog-single-box .blog-image img {  display:block;  width:100%;  transition:transform 0.4s ease, filter 0.4s ease;  object-fit:cover; } .blog-single-box .blog-image .category-tag {  position:absolute;  left:20px;  bottom:20px; } .blog-single-box .blog-image .category-tag a {  color:var(--white-color); } .blog-single-box .blog-content {  padding:25px 15px 15px; } @media (min-width:992px) and (max-width:1024px) {  .blog-single-box .blog-content {   padding:25px 0 15px;  } } @media (max-width:390px) {  .blog-single-box .blog-content {   padding:25px 0 15px;  } } .blog-single-box .blog-content .author {  display:flex;  align-items:center; } .blog-single-box .blog-content .author img {  width:36px;  height:36px;  object-fit:cover;  border-radius:50%;  margin-right:10px;  flex-shrink:0; } .blog-single-box .blog-content .author .name {  font-size:16px;  line-height:1.66;  color:var(--dark-color);  font-weight:500; } .blog-single-box .blog-content .author .name span {  color:var(--gray-color);  font-weight:400; } .blog-single-box .blog-content .border::before {  position:absolute;  content:"";  left:50%;  top:0;  width:0;  height:1px;  background:var(--theme-color);  transition:all 0.4s ease 0s; } @media (min-width:992px) and (max-width:1024px) {  .blog-single-box .blog-content .title {   font-size:22px;  } } .blog-single-box .blog-content .title a {  background:linear-gradient(var(--dark-color) 0%, var(--dark-color) 98%);  background-size:0 2px;  background-repeat:no-repeat;  background-position:left 100%;  transition:all 0.4s ease 0s; } .blog-single-box .blog-content .title a:hover {  color:var(--dark-color);  background-size:100% 2px; } .blog-single-box .blog-content .text {  color:var(--gray-color); } .blog-single-box .blog-content .continue-reading {  font-size:16px;  color:var(--dark-color);  font-weight:500;  display:inline-flex;  align-items:center;  gap:10px;  margin-top:10px; } .blog-single-box .blog-content .continue-reading:hover {  color:var(--theme-color);  gap:5px; } .blog-single-box .blog-content .continue-reading::before {  content:"\f178";  font-family:var(--icon-font);  font-size:20px;  font-weight:400; } .dark-mode .blog-single-box {  background-color:var(--dark-color3); } .dark-mode .blog-single-box:hover .blog-image img {  transform:scale(1.1);  filter:brightness(80%); } .dark-mode .blog-single-box:hover .blog-image .category-tag {  background-color:var(--theme-color); } .dark-mode .blog-single-box:hover .blog-content .border::before {  width:100%;  left:0; } .dark-mode .blog-single-box .blog-image {  position:relative;  border-radius:10px;  overflow:hidden; } .dark-mode .blog-single-box .blog-image img {  display:block;  width:100%;  transition:transform 0.4s ease, filter 0.4s ease;  object-fit:cover; } .dark-mode .blog-single-box .blog-image .category-tag {  position:absolute;  left:20px;  bottom:20px; } .dark-mode .blog-single-box .blog-content {  padding:25px 15px 15px; } @media (min-width:992px) and (max-width:1024px) {  .dark-mode .blog-single-box .blog-content {   padding:25px 0 15px;  } } @media (max-width:390px) {  .dark-mode .blog-single-box .blog-content {   padding:25px 0 15px;  } } .dark-mode .blog-single-box .blog-content .author {  display:flex;  align-items:center; } .dark-mode .blog-single-box .blog-content .author img {  width:36px;  height:36px;  object-fit:cover;  border-radius:50%;  margin-right:10px;  flex-shrink:0; } .dark-mode .blog-single-box .blog-content .author .name {  color:var(--gray-color2); } .dark-mode .blog-single-box .blog-content .author .name span {  color:var(--gray-color2); } .dark-mode .blog-single-box .blog-content .border::before {  position:absolute;  content:"";  left:50%;  top:0;  width:0;  height:1px;  background:var(--theme-color2);  transition:all 0.4s ease 0s; } @media (min-width:992px) and (max-width:1024px) {  .dark-mode .blog-single-box .blog-content .title {   font-size:22px;  } } .dark-mode .blog-single-box .blog-content .title a {  background:linear-gradient(var(--white-color) 0%, var(--white-color) 98%);  color:var(--white-color);  background-size:0 2px;  background-repeat:no-repeat;  background-position:left 100%;  transition:all 0.4s ease 0s; } .dark-mode .blog-single-box .blog-content .title a:hover {  color:var(--white-color);  background-size:100% 2px; } .dark-mode .blog-single-box .blog-content .text {  color:var(--gray-color2); } .dark-mode .blog-single-box .blog-content .continue-reading {  color:var(--gray-color2); } .dark-mode .blog-single-box .blog-content .continue-reading:hover {  color:var(--theme-color2); } .dark-mode .blog-single-box .blog-content .continue-reading::before {  content:"\f178";  font-family:var(--icon-font);  font-size:20px;  font-weight:400; }  .sidebar-newsletter .newsletter-form .form-group input[type=email] {  height:56px;  border-radius:28px; } .blog-list-card {  padding:20px;  border-radius:10px;  border:1px solid var(--bs-border-color7);  margin-bottom:30px;  } @media (max-width:375px) {  .blog-list-card {   padding:15px;  } } @media (max-width:360px) {  .blog-list-card {   padding:10px;  } } .blog-list-card:last-child {  margin-bottom:0; } .blog-list-card .image {  overflow:hidden;  border-radius:5px; } .blog-list-card .image img {  width:100%; } .blog-list-card .card-content {  padding:30px 15px 20px;  } @media (max-width:575px) {  .blog-list-card .card-content {   padding:30px 0 20px;  } } @media (max-width:360px) {  .blog-list-card .card-content {   padding:20px 0 10px;  } } .blog-list-card .card-content .category {  display:inline-block;  font-size:14px;  color:var(--dark-color);  font-weight:500;  height:40px;  line-height:40px;  padding:0 22px;  border-radius:20px;  background-color:var(--theme-color3); } .blog-list-card .card-content .wp-block-heading, .blog-list-card .card-content .title {  font-size:30px;  color:var(--dark-color);  font-weight:600;  margin:15px 0;  } @media (max-width:575px) {  .blog-list-card .card-content .wp-block-heading,  .blog-list-card .card-content .title {   font-size:22px;  } } .blog-list-card .card-content .wp-block-heading a, .blog-list-card .card-content .title a {  background:linear-gradient(var(--dark-color) 0%, var(--dark-color) 98%);  background-size:0 2px;  background-repeat:no-repeat;  background-position:left 100%;  transition:all 0.4s ease 0s; } .blog-list-card .card-content .wp-block-heading a:hover, .blog-list-card .card-content .title a:hover {  color:var(--dark-color);  background-size:100% 2px; } .blog-list-card .card-content .author-info {  display:flex;  align-items:center; } @media (max-width:390px) {  .blog-list-card .card-content .author-info {   flex-direction:column;   align-items:start;   gap:10px;  } } @media (max-width:360px) {  .blog-list-card .card-content .author-info {   justify-content:start;   flex-wrap:wrap;  } } .blog-list-card .card-content .author-info .author {  display:flex;  align-items:center; } .blog-list-card .card-content .author-info .author .name {  font-size:16px;  color:var(--dark-color);  font-weight:400;  margin-left:15px;  } @media (max-width:430px) {  .blog-list-card .card-content .author-info .author .name {   margin-left:10px;  } } @media (max-width:375px) {  .blog-list-card .card-content .author-info .author .name {   margin-left:5px;  } } .blog-list-card .card-content .author-info .author .name span {  color:var(--gray-color);  font-weight:400; } .blog-list-card .card-content .author-info .date {  display:flex;  align-items:center;  gap:10px;  color:var(--gray-color);  margin-left:30px;  } @media (max-width:430px) {  .blog-list-card .card-content .author-info .date {   margin-left:15px;  } } @media (max-width:414px) {  .blog-list-card .card-content .author-info .date {   margin-left:5px;  } } @media (max-width:375px) {  .blog-list-card .card-content .author-info .date {   gap:5px;  } } .blog-list-card .card-content .description {  font-size:16px;  color:var(--gray-color);  margin:0; } .blog-list-card .card-content .continue-reading {  font-size:16px;  color:var(--dark-color);  font-weight:500;  display:inline-flex;  align-items:center;  gap:10px;  margin-top:25px; } .blog-list-card .card-content .continue-reading:hover {  color:var(--theme-color);  gap:5px; } .blog-list-card .card-content .continue-reading::before {  content:"\f178";  font-family:var(--icon-font);  font-size:20px;  font-weight:400; } .blog-details-left ul li {  margin-bottom:12px; }  .blog-details {  position:relative;  display:block; } .blog-details .featured-list-box {  padding:0 0 0; } .blog-details .featured-list .list-style-2 li {  color:var(--dark-color); } .blog-details__left {  position:relative;  display:block;  padding-right:25px;  } @media (min-width:1024px) and (max-width:1280px) {  .blog-details__left {   padding-right:0;  } } @media (max-width:991px) {  .blog-details__left {   padding-right:0;  } } .blog-list-card.style-2 {  margin-bottom:53px; } .blog-list-card.style-2 .wp-block-list li, .blog-list-card.style-2 .featured-list li {  font-size:16px;  color:var(--gray-color);  font-weight:400;  padding-left:25px;  position:relative; } .blog-list-card.style-2 .wp-block-list li + li, .blog-list-card.style-2 .featured-list li + li {  margin-top:13px; } .blog-list-card.style-2 .wp-block-list li::before, .blog-list-card.style-2 .featured-list li::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  content:"\f00c";  left:0;  font-size:18px;  color:var(--dark-color);  font-family:var(--icon-font);  font-weight:900; } .blog-list-card.style-2 .wp-block-list .list-style-2 li::before, .blog-list-card.style-2 .featured-list .list-style-2 li::before {  content:"\f058";  color:var(--gray-color); } .blog-list-card.style-2 .wp-block-list li::before {  content:"\f058";  color:var(--gray-color); } .blog-list-card.style-2 .card-content {  padding:30px 15px 10px;  } @media (max-width:575px) {  .blog-list-card.style-2 .card-content {   padding:30px 0 20px;  } } .blog-list-card.style-2 .card-content .wp-block-image {  border-radius:10px;  overflow:hidden; } @media (max-width:360px) {  .blog-list-card.style-2 p {   text-align:justify;  } } .wp-block-quote, .blogs-quote {  padding:35px 35px;  border-radius:10px;  background-color:var(--theme-color3);  margin:0 0 30px;  border-left:0; } @media (max-width:540px) {  .wp-block-quote,  .blogs-quote {   padding:20px;  } } .wp-block-quote cite, .wp-block-quote span, .blogs-quote cite, .blogs-quote span {  font-size:18px;  color:var(--dark-color);  font-weight:500;  position:relative;  padding-left:60px; } .wp-block-quote cite::before, .wp-block-quote span::before, .blogs-quote cite::before, .blogs-quote span::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  width:50px;  height:1px;  background-color:var(--theme-color); } .wp-block-quote p, .blogs-quote p {  font-size:18px;  color:var(--dark-color);  font-weight:500;  position:relative;  } @media (max-width:575px) {  .wp-block-quote p,  .blogs-quote p {   font-size:16px;  } } .blog-details__tag-box {  display:flex;  align-items:center;  justify-content:space-between;  margin:40px 0 30px; } .blog-details__tag-box .tags {  display:flex;  gap:10px;  } .blog-details__tag-box .tags strong {  color:var(--dark-color); } @media (max-width:575px) {  .blog-details__tag-box .tags {   flex-direction:column;  } } .blog-details__bottom {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:space-between;  flex-wrap:wrap;  padding:30px 0 0;  margin-top:56px;  border-top:1px solid var(--bs-border-color7); } @media (max-width:540px) {  .blog-details__bottom {   gap:20px;  } } .blog-details__tags {  display:flex;  align-items:center; } .blog-details__tags li {  display:inline-block;  font-size:12px;  color:var(--dark-color);  font-weight:500;  height:34px;  line-height:34px;  border-radius:17px;  background-color:transparent;  border:1px solid var(--bs-border-color7);  padding:0 20px;  margin-right:6px;  margin-bottom:0 !important;  cursor:pointer;  transition:all 0.4s ease 0s; } .blog-details__tags li a {  color:var(--dark-color); } .blog-details__tags li:hover {  background:var(--theme-color); } .blog-details__tags li:hover a {  color:var(--white-color); } .blog-details__tags li:last-child {  margin-right:0; } .blog-details__social-list, .blog-details__tags {  } .blog-details__social-list span, .blog-details__tags span {  font-size:18px;  color:var(--dark-color);  font-weight:500;  margin-right:10px; } @media (max-width:375px) {  .blog-details__social-list,  .blog-details__tags {   flex-wrap:wrap;   gap:0;  } } .blog-details__social-list {  display:flex;  align-items:center; } .blog-details__social-list a {  position:relative;  height:34px;  width:34px;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  color:var(--dark-color);  background-color:transparent;  border:1px solid var(--bs-border-color7);  font-size:14px;  border-radius:50%;  overflow:hidden;  transition:all 0.4s ease 0s;  z-index:1; } .blog-details__social-list a:hover {  color:var(--white-color); } .blog-details__social-list a:hover:after {  height:100%;  opacity:1; } .blog-details__social-list a:after {  position:absolute;  content:"";  width:100%;  height:0;  background:var(--theme-color);  transition:all 0.4s ease-in-out;  top:0;  left:0;  opacity:0;  z-index:-1;  transition:all 0.4s ease 0s; } .blog-details__social-list a + a {  margin-left:10px; } .comment-one .comment-one__title {  font-size:24px;  color:var(--dark-color);  font-weight:600;  margin-bottom:25px; } .comment-one .comment-one__single {  display:flex;  gap:30px;  padding:40px 35px;  background:var(--theme-color3);  border-radius:10px;  margin-bottom:53px;  } @media (max-width:575px) {  .comment-one .comment-one__single {   padding:40px 20px;  } } @media (max-width:540px) {  .comment-one .comment-one__single {   gap:20px;  } } @media (max-width:540px) {  .comment-one .comment-one__single {   flex-direction:column;  } } .comment-one .comment-one__single .comment-one__image {  position:relative;  border-radius:50%;  flex-shrink:0; } .comment-one .comment-one__single .comment-one__image img {  border-radius:50%; } .comment-one .comment-one__content {  position:relative; } .comment-one .comment-one__content .title {  display:flex;  align-items:center;  margin-bottom:17px; } @media (max-width:390px) {  .comment-one .comment-one__content .title {   flex-direction:column;   align-items:self-start;  } } .comment-one .comment-one__content h5 {  display:inline-block;  font-size:18px;  font-weight:500;  color:var(--dark-color);  margin-bottom:0;  position:relative;  padding-right:32px;  margin-right:10px; } .comment-one .comment-one__content h5::before {  position:absolute;  content:"";  width:20px;  height:1px;  background:var(--dark-color);  transition:all 0.4s ease-in-out;  right:0;  top:50%; } .comment-one .comment-one__content p {  font-size:16px;  width:95%;  margin-bottom:0; } .comment-one .comment-one__btn {  position:absolute;  top:0;  right:0;  font-size:15px;  font-weight:500;  text-transform:uppercase;  color:var(--dark-color); } .comment-one .comment-one__btn i {  color:var(--theme-color);  transform:scaleX(-1);  margin-right:9px;  font-size:16px; } .comment-form textarea.form-control, .comment-form textarea {  min-height:180px; } .comment-form select, .comment-form .single-select, .comment-form .form-control, .comment-form .form-select, .comment-form textarea, .comment-form input {  border:1px solid var(--bs-border-color7);  background-color:transparent;  color:var(--dark-color); } .comment-form select ::placeholder, .comment-form .single-select ::placeholder, .comment-form .form-control ::placeholder, .comment-form .form-select ::placeholder, .comment-form textarea ::placeholder, .comment-form input ::placeholder {  color:var(--gray-color); } .comment-form .remember-check {  display:flex;  align-items:center; } .comment-form .remember-check label {  font-size:15px;  color:var(--gray-color);  margin-bottom:0; } .comment-form .remember-check input[type=checkbox] ~ label {  padding-left:24px; } .comment-form .remember-check input[type=checkbox] ~ label:before {  border-color:var(--theme-color);  height:14px;  width:14px;  line-height:14px;  border-radius:2px; }  .newsletter-section {  position:relative;  background-image:linear-gradient(var(--theme-color3) 50%, var(--dark-color) 50%); } .newsletter-section.bg-white {  background-image:linear-gradient(var(--white-color) 50%, var(--dark-color) 50%); } .page-id-1134 .newsletter-section, .page-id-1308 .newsletter-section {  background-image:linear-gradient(transparent 50%, var(--dark-color) 50%); } .page-id-1252 .newsletter-section {  background-image:linear-gradient(var(--theme-color2) 50%, var(--dark-color) 50%); } .blog .newsletter-section, .single-post .newsletter-section {  background-image:linear-gradient(var(--white-color) 50%, var(--dark-color) 50%); } .page-id-1373 .newsletter-section, .page-id-1421 .newsletter-section {  background-image:linear-gradient(var(--white-color) 50%, var(--dark-color) 50%); } .bg-image2 {  background-image:linear-gradient(var(--theme-color2) 50%, var(--dark-color) 50%); } .bg-image3 {  background-image:linear-gradient(transparent 50%, var(--dark-color) 50%); } .newsletter {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:space-between;  justify-content:space-between;  padding:35px 190px 35px 60px;  border-radius:10px;  background-color:var(--theme-color);  position:relative;  z-index:1;  overflow:hidden;  } @media (max-width:1024px) {  .newsletter {   padding:35px 60px 35px 60px;  } } @media (max-width:853px) {  .newsletter {   padding:35px;  } } @media (max-width:575px) {  .newsletter {   flex-direction:column;  } } @media (max-width:414px) {  .newsletter {   padding:35px 25px;  } } .newsletter .text h3 {  font-size:28px;  line-height:1.66;  color:var(--white-color);  font-weight:600;  margin:0; } @media (max-width:853px) {  .newsletter .text h3 {   font-size:24px;  } } @media (max-width:430px) {  .newsletter .text h3 {   font-size:22px;  } } @media (max-width:390px) {  .newsletter .text h3 {   font-size:20px;  } } @media (max-width:360px) {  .newsletter .text h3 {   font-size:19px;  } } .newsletter .contact-info {  display:flex;  align-items:center;  transition:all 0.4s ease 0s;  } @media (max-width:575px) {  .newsletter .contact-info {   margin-top:12px;  } } .newsletter .contact-info:hover .email-icon i {  animation:mirror_effect 0.5s forwards ease-in-out 0s; } .newsletter .contact-info .email-icon {  background-color:var(--white-color);  border-radius:50%;  width:80px;  height:80px;  margin-right:25px;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center; } @media (max-width:767px) {  .newsletter .contact-info .email-icon {   width:70px;   height:70px;  } } @media (max-width:575px) {  .newsletter .contact-info .email-icon {   width:60px;   height:60px;   margin-right:15px;  } } .newsletter .contact-info .email-icon i {  color:var(--theme-color);  font-size:28px;  } @media (max-width:575px) {  .newsletter .contact-info .email-icon i {   font-size:24px;  } } .newsletter .contact-info .email-icon svg {  width:32px;  fill:var(--theme-color); } .newsletter .contact-info .email-details p {  opacity:0.8;  color:var(--white-color);  margin-bottom:5px;  } @media (max-width:575px) {  .newsletter .contact-info .email-details p {   display:none;  } } .newsletter .contact-info .email-details a {  font-size:24px;  line-height:1.66;  color:var(--white-color);  font-weight:500; } @media (max-width:430px) {  .newsletter .contact-info .email-details a {   font-size:20px;  } } @media (max-width:390px) {  .newsletter .contact-info .email-details a {   font-size:18px;  } }  .case-filter-buttons {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center; } .case-filter-buttons .menu-filtering {  display:flex;  justify-content:center;  padding:15px;  max-width:529px;  border-radius:35px;  border:1px solid var(--bs-border-color6);  } @media (max-width:540px) {  .case-filter-buttons .menu-filtering {   flex-wrap:wrap;   gap:10px;  } } @media (max-width:375px) {  .case-filter-buttons .menu-filtering {   border-radius:65px;  } } .case-filter-buttons .menu-filtering li {  display:inline-block;  color:var(--dark-color);  font-size:16px;  font-weight:500;  padding:0 23px;  height:38px;  line-height:37px;  border-radius:19px;  background-color:transparent;  border:1px solid var(--dark-color);  background-color:transparent;  transition:all 0.4s ease 0s;  cursor:pointer; } .case-filter-buttons .menu-filtering li + li {  margin-left:10px; } @media (max-width:540px) {  .case-filter-buttons .menu-filtering li + li {   margin-left:0;  } } .case-filter-buttons .menu-filtering li.active, .case-filter-buttons .menu-filtering li:hover {  border-color:var(--theme-color);  color:var(--theme-color); } .case-single-item {  position:relative;  overflow:hidden; } .case-single-item::before {  position:absolute;  content:"";  width:100%;  height:100%;  background:linear-gradient(0deg, rgb(1, 18, 17) 0%, rgb(1, 18, 17) 0%, rgba(1, 17, 17, 0) 50%, rgba(1, 17, 17, 0) 0%);  transition:all 0.4s ease-in-out;  left:0;  bottom:0; } @media (min-width:992px) and (max-width:1024px) {  .case-single-item::before {   background:linear-gradient(0deg, rgb(1, 18, 17) 0%, rgb(1, 18, 17) 0%, rgba(1, 17, 17, 0) 100%, rgba(1, 17, 17, 0) 0%);  } } .case-single-item img {  width:100%;  height:477px;  object-fit:cover; } .case-single-item .case-info {  position:absolute;  left:40px;  bottom:-32px;  transition:all 0.4s ease 0s;  } @media (min-width:992px) and (max-width:1024px) {  .case-single-item .case-info {   left:20px;  } } @media (max-width:991px) {  .case-single-item .case-info {   left:30px;  } } .case-single-item .case-info .case-badge {  margin-bottom:13px; } .case-single-item .case-info .case-badge span {  display:inline-block;  font-size:12px;  color:var(--white-color);  font-weight:500;  height:30px;  line-height:30px;  padding:0 18px;  border-radius:15px;  background-color:var(--bs-border-color);  border:1px solid var(--bs-border-color9);  margin-right:5px; } .case-single-item .case-info .title {  font-size:24px;  color:var(--white-color);  font-weight:500;  margin-bottom:20px; } @media (min-width:992px) and (max-width:1024px) {  .case-single-item .case-info .title {   font-size:20px;  } } .case-single-item .case-info .title a {  color:var(--white-color); } .case-single-item .case-info .case-btn {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  gap:10px;  max-width:145px;  height:38px;  line-height:38px;  padding:0 20px;  border-radius:19px;  color:var(--white-color);  background:var(--theme-color);  overflow:hidden;  font-size:12px;  text-transform:uppercase;  font-weight:500;  transition:all 0.4s ease 0s;  opacity:0;  visibility:hidden; } .case-single-item .case-info .case-btn .link-effect {  height:19px; } .case-single-item .case-info .case-btn svg {  fill:var(--white-color);  width:10px; } .case-single-item:hover .case-info {  bottom:30px; } .case-single-item:hover .case-btn {  opacity:1;  visibility:visible; } .case-wrapper {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:space-between;  } @media (max-width:575px) {  .case-wrapper {   flex-direction:column;   gap:19px;  } } .case-wrapper .text {  display:flex;  gap:15px;  flex:1; } @media (max-width:360px) {  .case-wrapper .text {   gap:5px;  } } .case-wrapper .text p {  font-size:18px;  line-height:28px;  color:var(--dark-color); } @media (max-width:820px) {  .case-wrapper .text p br {   display:none;  } } @media (max-width:390px) {  .case-wrapper .text p {   font-size:16px;  } }  .case-studies-section.style-2 {  overflow:hidden; } .case-studies-section.style-2 .case-btn-inner {  gap:30px; } .case-studies-section.style-2 .case-btn-inner .line {  width:100%;  height:1px;  background:var(--bs-border-color); } .case-studies-section.style-2 .case-btn-inner .array-prev, .case-studies-section.style-2 .case-btn-inner .array-next {  border-color:var(--bs-border-color);  background-color:var(--bs-border-color);  color:var(--white-color);  transition:all 0.4s ease 0s; } .case-studies-section.style-2 .case-btn-inner .array-prev:hover, .case-studies-section.style-2 .case-btn-inner .array-next:hover {  color:var(--theme-color); } @media (min-width:1501px) {  .case-studies-section.style-2 .case-slider.swiper {   overflow:visible;  }  .case-studies-section.style-2 .case-slider.swiper .case-btn-inner {   display:none;  } } .case-studies-section.style-2 .case-single-item {  position:relative;  overflow:hidden; } .case-studies-section.style-2 .case-single-item:hover .image-box .overlay-btn {  right:0; } .case-studies-section.style-2 .case-single-item:hover .image-box img {  transform:scale(1.1) rotate(-2deg); } .case-studies-section.style-2 .case-single-item:hover .info-content .icon-box i {  animation:wobble_vertical 1s forwards ease-in-out 0s; } .case-studies-section.style-2 .case-single-item::before {  display:none; } .case-studies-section.style-2 .case-single-item .image-box {  position:relative;  background-color:var(--dark-color);  overflow:hidden;  border-radius:10px; } .case-studies-section.style-2 .case-single-item .image-box img {  width:100%;  height:auto;  transition:all 0.4s ease 0s; } .case-studies-section.style-2 .case-single-item .image-box .overlay-btn {  position:absolute;  bottom:62px;  right:-62px;  transition:all 0.4s ease 0s; } @media (max-width:390px) {  .case-studies-section.style-2 .case-single-item .image-box .overlay-btn {   bottom:30px;  } } .case-studies-section.style-2 .case-single-item .image-box .overlay-btn .case-btn {  background:var(--theme-color);  border-top-left-radius:10px;  width:60px;  height:60px;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  cursor:pointer;  font-size:25px;  color:var(--white-color); } .case-studies-section.style-2 .case-single-item .info-content {  max-width:540px;  padding:30px 42px;  background-color:var(--dark-color3);  border-radius:10px;  border-top-right-radius:0;  margin-left:auto;  margin-top:-62px;  position:relative;  display:flex;  align-items:center; } @media (max-width:430px) {  .case-studies-section.style-2 .case-single-item .info-content {   padding:30px;   border-top-left-radius:0;  } } @media (max-width:390px) {  .case-studies-section.style-2 .case-single-item .info-content {   padding:20px;   margin-top:-30px;  } } .case-studies-section.style-2 .case-single-item .info-content .border {  width:2px;  height:68px;  background-color:var(--bs-border-color);  margin:0 30px 0 40px;  } @media (max-width:430px) {  .case-studies-section.style-2 .case-single-item .info-content .border {   margin:0 20px;  } } @media (max-width:375px) {  .case-studies-section.style-2 .case-single-item .info-content .border {   margin:0 12px;  } } .case-studies-section.style-2 .case-single-item .info-content .info .category {  font-size:14px;  color:var(--white-color);  position:relative;  padding-left:46px;  margin-bottom:8px; } .case-studies-section.style-2 .case-single-item .info-content .info .category::before {  position:absolute;  content:"";  width:36px;  height:1px;  background:var(--theme-color2);  transition:all 0.4s ease-in-out;  left:0;  top:50%; } .case-studies-section.style-2 .case-single-item .info-content .info .title {  font-size:22px;  color:var(--white-color);  font-weight:500;  margin-bottom:0; } .case-studies-section.style-2 .case-single-item .info-content .info .title a {  color:var(--white-color); } @media (max-width:360px) {  .case-studies-section.style-2 .case-single-item .info-content .info .title {   font-size:20px;  } }  .case-studies-section.style-3 .case-single-item::before {  display:none; } .case-studies-section.style-3 .case-single-item .case-info {  position:static;  padding:22px 0 30px;  border-bottom:1px solid var(--bs-border-color10); } .case-studies-section.style-3 .case-single-item .case-info .case-badge {  margin-bottom:0; } .case-studies-section.style-3 .case-single-item .case-info .case-badge span {  color:var(--dark-color);  background-color:var(--bs-border-color);  border-color:var(--bs-border-color6);  cursor:pointer;  transition:all 0.4s ease 0s; } .case-studies-section.style-3 .case-single-item .case-info .case-badge span:hover {  color:var(--white-color);  background-color:var(--theme-color);  border-color:var(--theme-color); } .case-studies-section.style-3 .case-single-item .case-info .title {  margin-bottom:15px; } .case-studies-section.style-3 .case-single-item .case-info .title a {  color:var(--dark-color);  background:linear-gradient(var(--dark-color) 0%, var(--dark-color) 98%);  background-size:0 2px;  background-repeat:no-repeat;  background-position:left 100%;  transition:all 0.4s ease 0s; } .case-studies-section.style-3 .case-single-item .case-info .title a:hover {  color:var(--dark-color);  background-size:100% 2px; }  .style-4 .case-filter-buttons .menu-filtering {  border:1px solid var(--bs-border-color13); } .style-4 .case-filter-buttons .menu-filtering li {  color:var(--white-color);  border:1px solid var(--bs-border-color13); } .style-4 .case-filter-buttons .menu-filtering li.active, .style-4 .case-filter-buttons .menu-filtering li:hover {  border-color:var(--theme-color2);  background-color:var(--theme-color2);  color:var(--dark-color); }  .faq-section {  position:relative;  } .faq-section .bg-path__shape::before {  position:absolute;  content:"";  width:150px;  height:150px;  background:var(--theme-color3);  transition:all 0.4s ease-in-out;  right:0;  bottom:0; } .faq-section .bg-path__shape::after {  position:absolute;  content:"";  width:70px;  height:70px;  background:var(--theme-color3);  transition:all 0.4s ease-in-out;  right:150px;  bottom:150px; } @media (max-width:991px) {  .faq-section .contact-content-wrap {   margin-top:0;  } } .accordion-box {  position:relative; } .accordion-box .accordion {  position:relative;  background-color:transparent;  border-bottom:1px solid rgba(6, 50, 50, 0.1); } .accordion-box .accordion .acc-btn {  position:relative;  font-size:22px;  color:var(--dark-color);  font-weight:500;  cursor:pointer;  padding:19px 0 25px;  padding-right:20px;  background:transparent;  transition:all 0.4s ease 0s; } .accordion-box .accordion .acc-btn .icon {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  right:6px; } .accordion-box .accordion .acc-btn .icon::before {  position:absolute;  content:"";  left:50%;  top:50%;  transform:translate(-50%, -50%);  transition:all 0.4s ease 0s;  width:2px;  height:12px;  background-color:var(--dark-color); } .accordion-box .accordion .acc-btn .icon::after {  position:absolute;  content:"";  left:50%;  top:50%;  transform:translate(-50%, -50%);  transition:all 0.4s ease 0s;  width:12px;  height:2px;  background-color:var(--dark-color); } .accordion-box .accordion .acc-btn.active .icon::before {  height:0; } .accordion-box .accordion .acc-content {  position:relative;  display:none; } .accordion-box .accordion .acc-content .content {  position:relative;  padding:0 0 21px 0;  margin-top:-8px; } .accordion-box .accordion .acc-content .content .text {  display:block;  font-size:16px;  color:var(--gray-color);  margin-bottom:0; } .accordion-box .accordion .acc-content.active {  display:block; }  .faq-section.style-2 .title-area .sec-text br {  display:block; } @media (max-width:430px) {  .faq-section.style-2 .title-area .sec-text br {   display:none;  } } .accordion-box.style-2 {  position:relative; } .accordion-box.style-2 .accordion {  margin-bottom:20px;  border-bottom:none; } .accordion-box.style-2 .accordion:last-child {  margin-bottom:0; } .accordion-box.style-2 .accordion .acc-btn {  font-size:18px;  color:var(--dark-color);  border:1px solid rgba(6, 50, 50, 0.1);  padding:22px 75px 22px 30px;  border-radius:5px;  } @media (max-width:575px) {  .accordion-box.style-2 .accordion .acc-btn {   padding-left:20px;  } } .accordion-box.style-2 .accordion .acc-btn.active {  color:var(--white-color);  background-color:var(--dark-color);  border-bottom-left-radius:0;  border-bottom-right-radius:0; } .accordion-box.style-2 .accordion .acc-btn.active .icon {  color:var(--theme-color2);  border-color:rgba(255, 255, 255, 0.14); } .accordion-box.style-2 .accordion .acc-btn.active .icon i {  transform:rotate(90deg); } .accordion-box.style-2 .accordion .acc-btn.active .icon svg {  fill:var(--theme-color2); } .accordion-box.style-2 .accordion .acc-btn .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:70px;  height:100%;  text-align:center;  border-left:1px solid rgba(6, 50, 50, 0.1);  font-size:24px;  color:var(--dark-color); } .accordion-box.style-2 .accordion .acc-btn .icon::before, .accordion-box.style-2 .accordion .acc-btn .icon::after {  display:none; } .accordion-box.style-2 .accordion .acc-btn .icon i {  transition:all 0.4s ease 0s; } .accordion-box.style-2 .accordion .acc-btn .icon svg {  width:20px;  fill:var(--dark-color); } .accordion-box.style-2 .accordion .acc-content {  position:relative;  display:none; } .accordion-box.style-2 .accordion .acc-content .content {  padding:30px;  margin-top:0;  border-radius:5px;  filter:drop-shadow(0px 20px 25px rgba(190, 199, 199, 0.2));  background-color:var(--white-color);  border:1px solid rgba(6, 50, 50, 0.1);  border-top-left-radius:0;  border-top-right-radius:0;  } @media (max-width:575px) {  .accordion-box.style-2 .accordion .acc-content .content {   padding:20px;  } } .accordion-box.style-2 .accordion .acc-content .content .text {  display:block;  font-size:16px;  color:var(--gray-color);  margin-bottom:0; } .accordion-box.style-2 .accordion .acc-content.active {  display:block; }  .faq-section.style-3 .accordion-box {  position:relative; } .faq-section.style-3 .accordion-box .accordion {  margin-bottom:20px;  border-bottom:none; } .faq-section.style-3 .accordion-box .accordion .acc-btn {  position:relative;  font-size:18px;  color:var(--dark-color);  font-weight:500;  cursor:pointer;  padding-right:20px;  background:var(--theme-color3);  transition:all 0.4s ease 0s;  border:1px solid rgba(6, 50, 50, 0.1);  padding:22px 75px 22px 30px;  border-radius:5px; } .faq-section.style-3 .accordion-box .accordion .acc-btn.active {  color:var(--white-color);  background-color:var(--dark-color);  border-bottom-left-radius:0;  border-bottom-right-radius:0; } .faq-section.style-3 .accordion-box .accordion .acc-btn.active .icon::before {  height:0; } .faq-section.style-3 .accordion-box .accordion .acc-btn .icon {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  right:36px;  color:var(--bs-text-color2);  height:20px;  width:20px;  border:1px solid var(--bs-text-color2);  border-radius:50%; } .faq-section.style-3 .accordion-box .accordion .acc-btn .icon::before {  position:absolute;  content:"";  left:50%;  top:50%;  transform:translate(-50%, -50%);  transition:all 0.4s ease 0s;  width:2px;  height:12px;  background-color:var(--bs-text-color2); } .faq-section.style-3 .accordion-box .accordion .acc-btn .icon::after {  position:absolute;  content:"";  left:50%;  top:50%;  transform:translate(-50%, -50%);  transition:all 0.4s ease 0s;  width:12px;  height:2px;  background-color:var(--bs-text-color2); } .faq-section.style-3 .accordion-box .accordion .acc-content.active {  display:block; } .faq-section.style-3 .accordion-box .accordion .acc-content .content {  padding:30px;  margin-top:0;  border-radius:5px;  filter:drop-shadow(0px 20px 25px rgba(190, 199, 199, 0.2));  background-color:var(--white-color);  border:1px solid rgba(6, 50, 50, 0.1);  border-top-left-radius:0;  border-top-right-radius:0; } .faq-section.style-3 .about-image-wrapper {  display:flex;  align-items:end;  position:relative; } .faq-section.style-3 .about-image-wrapper.direction-rtl {  } @media (max-width:1199px) {  .faq-section.style-3 .about-image-wrapper.direction-rtl {   direction:ltr;  } } @media (min-width:992px) and (max-width:1024px) {  .faq-section.style-3 .about-image-wrapper.direction-rtl {   direction:rtl;  } } .faq-section.style-3 .about-image-wrapper .about-image {  } @media (max-width:991px) {  .faq-section.style-3 .about-image-wrapper .about-image {   width:100%;  }  .faq-section.style-3 .about-image-wrapper .about-image img {   width:100%;  } } .faq-section.style-3 .about-image-wrapper .shape {  position:absolute;  top:12px;  left:43px; } .faq-section.style-3 .about-image-wrapper .about-single-card {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  flex-shrink:0;  position:relative;  z-index:1;  max-width:330px;  width:100%;  height:max-content;  padding:16px;  border-radius:10px;  background-color:var(--white-color);  margin:0 -135px 68px 0; } @media (max-width:1500px) {  .faq-section.style-3 .about-image-wrapper .about-single-card {   margin:0 -205px 68px 0;  } } @media (max-width:1399px) {  .faq-section.style-3 .about-image-wrapper .about-single-card {   display:none;  } } .faq-section.style-3 .about-image-wrapper .about-single-card .inner {  display:inline-block;  position:relative;  max-width:290px;  width:100%;  flex-shrink:0;  z-index:1;  padding:40px 37px;  border-radius:5px;  background-color:var(--theme-color2);  overflow:hidden; } .faq-section.style-3 .about-image-wrapper .about-single-card .inner:hover .icon {  transform:rotate(360deg); } .faq-section.style-3 .about-image-wrapper .about-single-card .inner .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:70px;  height:70px;  border-radius:10px;  background-color:var(--dark-color);  font-size:30px;  color:var(--theme-color2);  transition:all 0.4s ease 0s; } .faq-section.style-3 .about-image-wrapper .about-single-card .inner .title {  font-size:20px;  line-height:28px;  color:var(--dark-color);  font-weight:500;  margin:30px 0 24px; } .faq-section.style-3 .about-image-wrapper .about-single-card .inner .members {  display:flex;  align-items:center;  gap:5px; } .faq-section.style-3 .about-image-wrapper .about-single-card .inner .members .social {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center; } .faq-section.style-3 .about-image-wrapper .about-single-card .inner .members .social img {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:50px;  height:50px;  border-radius:50%;  margin-left:-20px;  border:3px solid var(--theme-color2); } .faq-section.style-3 .about-image-wrapper .about-single-card .inner .members .social img:first-child {  margin-left:0; } .faq-section.style-3 .about-image-wrapper .about-single-card .inner .members .text {  font-size:15px;  color:var(--dark-color);  font-weight:500; } .faq-section.style-3 .about-image-wrapper .about-image img {  max-width:inherit;  border-radius:10px; } @media (max-width:1024px) {  .faq-section.style-3 .about-image-wrapper .about-image img {   max-width:100%;  } } .faq-section.style-3 .circle-box {  position:absolute;  bottom:37px;  right:-205px;  width:184px;  height:184px;  background-color:var(--theme-color3); } @media (max-width:1500px) {  .faq-section.style-3 .circle-box {   right:-75px;  } } @media (max-width:1399px) {  .faq-section.style-3 .circle-box {   right:-45px;  } } @media (max-width:1299px) {  .faq-section.style-3 .circle-box {   left:-45px;  } } @media (max-width:991px) {  .faq-section.style-3 .circle-box {   bottom:30px;   left:40px;  } } @media (max-width:430px) {  .faq-section.style-3 .circle-box {   display:none;  } } .dark-mode .faq-section.style-3 .accordion-box {  position:relative; } .dark-mode .faq-section.style-3 .accordion-box .accordion {  margin-bottom:20px;  border-bottom:none; } .dark-mode .faq-section.style-3 .accordion-box .accordion .acc-btn {  position:relative;  font-size:18px;  color:var(--white-color);  font-weight:500;  cursor:pointer;  padding-right:20px;  background:var(--dark-color3);  transition:all 0.4s ease 0s;  border:1px solid rgba(6, 50, 50, 0.1);  padding:22px 75px 22px 30px;  border-radius:5px 5px 0 0; } .dark-mode .faq-section.style-3 .accordion-box .accordion .acc-btn.active {  background-color:var(--dark-color3); } .dark-mode .faq-section.style-3 .accordion-box .accordion .acc-btn.active .icon::before {  height:0; } .dark-mode .faq-section.style-3 .accordion-box .accordion .acc-btn .icon {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  right:36px;  color:var(--bs-text-color2);  height:20px;  width:20px;  border:1px solid var(--bs-text-color2);  border-radius:50%; } .dark-mode .faq-section.style-3 .accordion-box .accordion .acc-btn .icon::before {  position:absolute;  content:"";  left:50%;  top:50%;  transform:translate(-50%, -50%);  transition:all 0.4s ease 0s;  width:2px;  height:12px;  background-color:var(--bs-text-color2); } .dark-mode .faq-section.style-3 .accordion-box .accordion .acc-btn .icon::after {  position:absolute;  content:"";  left:50%;  top:50%;  transform:translate(-50%, -50%);  transition:all 0.4s ease 0s;  width:12px;  height:2px;  background-color:var(--bs-text-color2); } .dark-mode .faq-section.style-3 .accordion-box .accordion .acc-content.active {  display:block; } .dark-mode .faq-section.style-3 .accordion-box .accordion .acc-content .content {  background-color:transparent;  border:1px solid var(--bs-border-color13);  border-top:none; } .dark-mode .faq-section.style-3 .accordion-box .accordion .acc-content .content .text {  color:var(--gray-color2); } .dark-mode .faq-section.style-3 .about-image-wrapper {  display:flex;  align-items:end;  position:relative; } .dark-mode .faq-section.style-3 .about-image-wrapper.direction-rtl {  } @media (max-width:1199px) {  .dark-mode .faq-section.style-3 .about-image-wrapper.direction-rtl {   direction:ltr;  } } @media (min-width:992px) and (max-width:1024px) {  .dark-mode .faq-section.style-3 .about-image-wrapper.direction-rtl {   direction:rtl;  } } .dark-mode .faq-section.style-3 .about-image-wrapper .about-image {  } @media (max-width:991px) {  .dark-mode .faq-section.style-3 .about-image-wrapper .about-image {   width:100%;  }  .dark-mode .faq-section.style-3 .about-image-wrapper .about-image img {   width:100%;  } } .dark-mode .faq-section.style-3 .about-image-wrapper .shape {  position:absolute;  top:12px;  left:43px; } .dark-mode .faq-section.style-3 .about-image-wrapper .about-single-card {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  flex-shrink:0;  position:relative;  z-index:1;  max-width:330px;  width:100%;  height:max-content;  padding:16px;  border-radius:10px;  background-color:var(--dark-color4);  margin:0 -135px 68px 0; } @media (max-width:1500px) {  .dark-mode .faq-section.style-3 .about-image-wrapper .about-single-card {   margin:0 -205px 68px 0;  } } @media (max-width:1399px) {  .dark-mode .faq-section.style-3 .about-image-wrapper .about-single-card {   display:none;  } } .dark-mode .faq-section.style-3 .about-image-wrapper .about-single-card .inner {  display:inline-block;  position:relative;  max-width:290px;  width:100%;  flex-shrink:0;  z-index:1;  padding:40px 37px;  border-radius:5px;  background-color:var(--theme-color2);  overflow:hidden; } .dark-mode .faq-section.style-3 .about-image-wrapper .about-single-card .inner:hover .icon {  transform:rotate(360deg); } .dark-mode .faq-section.style-3 .about-image-wrapper .about-single-card .inner .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:70px;  height:70px;  border-radius:10px;  background-color:var(--dark-color);  font-size:30px;  color:var(--theme-color2);  transition:all 0.4s ease 0s; } .dark-mode .faq-section.style-3 .about-image-wrapper .about-single-card .inner .title {  font-size:20px;  line-height:28px;  color:var(--dark-color);  font-weight:500;  margin:30px 0 24px; } .dark-mode .faq-section.style-3 .about-image-wrapper .about-single-card .inner .members {  display:flex;  align-items:center;  gap:5px; } .dark-mode .faq-section.style-3 .about-image-wrapper .about-single-card .inner .members .social {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center; } .dark-mode .faq-section.style-3 .about-image-wrapper .about-single-card .inner .members .social img {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:50px;  height:50px;  border-radius:50%;  margin-left:-20px;  border:3px solid var(--theme-color2); } .dark-mode .faq-section.style-3 .about-image-wrapper .about-single-card .inner .members .social img:first-child {  margin-left:0; } .dark-mode .faq-section.style-3 .about-image-wrapper .about-single-card .inner .members .text {  font-size:15px;  color:var(--dark-color);  font-weight:500; } .dark-mode .faq-section.style-3 .about-image-wrapper .about-image img {  max-width:inherit;  border-radius:10px; } @media (max-width:1024px) {  .dark-mode .faq-section.style-3 .about-image-wrapper .about-image img {   max-width:100%;  } } .dark-mode .faq-section.style-3 .circle-box {  position:absolute;  bottom:37px;  right:-205px;  width:184px;  height:184px;  background-color:var(--dark-color3); } @media (max-width:1500px) {  .dark-mode .faq-section.style-3 .circle-box {   right:-75px;  } } @media (max-width:1399px) {  .dark-mode .faq-section.style-3 .circle-box {   right:-45px;  } } @media (max-width:1299px) {  .dark-mode .faq-section.style-3 .circle-box {   left:-45px;  } } @media (max-width:991px) {  .dark-mode .faq-section.style-3 .circle-box {   bottom:30px;   left:40px;  } } @media (max-width:430px) {  .dark-mode .faq-section.style-3 .circle-box {   display:none;  } } .dark-mode .faq-section.style-3 .circle-box .text-inner text {  fill:var(--gray-color2); }  .faq-contact {  } @media (max-width:991px) {  .faq-contact .row {   flex-direction:column-reverse;  } } .faq-contact .contact-thumb .image-box {  position:relative;  max-width:590px; } .faq-contact .contact-thumb .image-box .image {  position:absolute;  content:"";  left:50%;  transform:translateX(-50%);  transition:all 0.4s ease 0s;  bottom:0;  height:100%; } .faq-contact .contact-thumb .image-box .image img {  max-width:inherit;  height:100%;  object-fit:cover; } .faq-contact .faq-content-wrapper {  padding-top:105px;  } @media (max-width:991px) {  .faq-contact .faq-content-wrapper {   padding-top:0;  } } .faq-contact .faq-content-wrapper .sec-text br {  display:block; } @media (max-width:430px) {  .faq-contact .faq-content-wrapper .sec-text br {   display:none;  } }  .team-title-wrap {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:space-between;  } @media (max-width:575px) {  .team-title-wrap {   align-items:flex-start;   flex-direction:column;   gap:10px;  } } .team-title-wrap .member-stats-box .count {  font-size:60px;  line-height:1;  color:var(--white-color);  font-weight:600; } .team-title-wrap .member-stats-box .borderY {  width:2px;  height:48px;  background-color:var(--bs-border-color); } .team-title-wrap .member-stats-box .text {  color:var(--gray-color2);  line-height:1.5;  margin-bottom:0; } .team-slide-wrapper {  position:relative; } .team-slide-wrapper .array-button {  position:absolute;  content:"";  left:50%;  top:50%;  transform:translate(-50%, -50%);  transition:all 0.4s ease 0s;  justify-content:space-between;  width:112%;  z-index:-1; } @media (max-width:1500px) {  .team-slide-wrapper .array-button {   width:107%;  } } @media (max-width:1299px) {  .team-slide-wrapper .array-button {   width:100%;   z-index:1;  } } .team-slide-wrapper .array-button .array-prev, .team-slide-wrapper .array-button .array-next {  width:40px;  height:40px;  border-radius:50%;  background:none;  border:none;  } @media (max-width:1299px) {  .team-slide-wrapper .array-button .array-prev,  .team-slide-wrapper .array-button .array-next {   background:var(--dark-color);  } } .team-slide-wrapper .array-button .array-prev:hover i, .team-slide-wrapper .array-button .array-next:hover i {  filter:brightness(0) saturate(100%) invert(91%) sepia(12%) saturate(1224%) hue-rotate(31deg) brightness(104%) contrast(75%); } .team-slide-wrapper .array-button .array-prev i, .team-slide-wrapper .array-button .array-next i {  transition:all 0.4s ease 0s;  } @media (max-width:1299px) {  .team-slide-wrapper .array-button .array-prev i,  .team-slide-wrapper .array-button .array-next i {   width:17px !important;   height:20px !important;  } } .team-single-box .image-box {  position:relative; } .team-single-box .image-box .image img {  width:100%; } .team-single-box .image-box::before {  position:absolute;  content:"";  width:100%;  height:100%;  background:none;  transition:all 0.4s ease-in-out;  bottom:0;  height:0;  background-color:rgba(6, 50, 50, 0.2);  opacity:0;  overflow:hidden; } .team-single-box .share-btn-wrap {  position:absolute;  right:20px;  bottom:20px;  z-index:5;  overflow:hidden; } .team-single-box .share-btn-wrap .share-icon span {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:48px;  height:48px;  border-radius:50%;  background-color:rgba(244, 248, 236, 0.4);  color:var(--white-color);  font-size:18px;  backdrop-filter:blur(10px);  cursor:pointer;  transition:all 0.4s ease 0s; } .team-single-box .share-btn-wrap .share-icon span:hover {  color:var(--theme-color);  background-color:var(--white-color); } .team-single-box .share-btn-wrap .social-link {  position:relative;  visibility:hidden;  height:0;  transition:all 0.4s ease 0s; } .team-single-box .share-btn-wrap .social-link li {  display:flex;  justify-content:center;  opacity:0;  visibility:hidden;  transition:all 0.4s ease 0s;  margin-bottom:10px; } .team-single-box .share-btn-wrap .social-link li a {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:44px;  height:44px;  border-radius:50%;  background-color:rgba(244, 248, 236, 0.5);  text-align:center;  color:var(--white-color);  font-size:16px; } .team-single-box .share-btn-wrap .social-link li a:hover {  background-color:var(--theme-color); } .team-single-box .share-btn-wrap .social-link li:nth-child(1) {  transition-delay:0s; } .team-single-box .share-btn-wrap .social-link li:nth-child(2) {  transition-delay:0.2s; } .team-single-box .share-btn-wrap .social-link li:nth-child(3) {  transition-delay:0.4s; } .team-single-box .share-btn-wrap .social-link li:nth-child(4) {  transition-delay:0.6s; } .team-single-box .share-btn-wrap:hover .social-link {  height:100%; } .team-single-box .share-btn-wrap:hover .social-link li {  opacity:1;  overflow:hidden;  visibility:visible; } .team-single-box .profile-info {  padding:29px 0 0;  text-align:center; } .team-single-box .profile-info .name {  font-size:24px;  color:var(--white-color);  margin-bottom:8px; } .team-single-box .profile-info .name a {  color:var(--white-color); } .team-single-box .profile-info .name a:hover {  color:var(--theme-color); } .team-single-box .profile-info .position {  color:var(--gray-color2);  margin-bottom:-4px; } .team-single-box:hover .image-box::before {  top:0;  height:100%;  opacity:1;  visibility:visible; }  .team-section.style-2 .team-title-wrap .member-stats-box .count {  color:var(--dark-color); } .team-section.style-2 .team-title-wrap .member-stats-box .borderY {  width:2px;  height:48px;  background-color:rgba(6, 50, 50, 0.1); } .team-section.style-2 .team-title-wrap .member-stats-box .text {  color:var(--dark-color); } .team-section.style-2 .team-single-box .profile-info .name {  color:var(--dark-color); } .team-section.style-2 .team-single-box .profile-info .name a {  color:var(--dark-color); } .team-section.style-2 .team-single-box .profile-info .name a:hover {  color:var(--theme-color); } .team-section.style-2 .team-single-box .profile-info .position {  color:var(--gray-color); } .team-section.style-2 .team-slide-wrapper .array-button .array-prev i, .team-section.style-2 .team-slide-wrapper .array-button .array-next i {  filter:brightness(0) saturate(100%) invert(12%) sepia(97%) saturate(556%) hue-rotate(135deg) brightness(92%) contrast(95%);  } @media (max-width:1299px) {  .team-section.style-2 .team-slide-wrapper .array-button .array-prev i,  .team-section.style-2 .team-slide-wrapper .array-button .array-next i {   filter:brightness(0) invert(1);  } } .team-section.style-2 .team-slide-wrapper .array-button .array-prev:hover i, .team-section.style-2 .team-slide-wrapper .array-button .array-next:hover i {  filter:brightness(0) saturate(100%) invert(39%) sepia(81%) saturate(1769%) hue-rotate(346deg) brightness(94%) contrast(89%); }  .team-box-three {  position:relative;  z-index:1; } .team-box-three::before {  content:"";  position:absolute;  z-index:-1;  left:0;  bottom:0;  width:100%;  height:50%;  background:var(--white-color);  border-radius:10px;  transition:all 0.4s ease 0s; } .team-box-three .image-box {  position:relative;  overflow:hidden;  border-radius:10px;  margin:0 30px;  overflow:hidden; } @media (min-width:992px) and (max-width:1024px) {  .team-box-three .image-box {   margin:0;  } } .team-box-three .image-box .image img {  width:100%; } .team-box-three .image-box::before {  content:"";  position:absolute;  bottom:0;  height:0;  width:100%;  background-image:linear-gradient(0deg, var(--bs-bg-color17) 0%, var(--bs-bg-color17) 10%, transparent 50%, transparent 100%);  opacity:0;  transition:all 0.4s ease 0s; } .team-box-three .share-btn-wrap {  position:absolute;  content:"";  left:50%;  transform:translateX(-50%);  transition:all 0.4s ease 0s;  bottom:30px;  z-index:5; } .team-box-three .share-btn-wrap .social-link {  position:relative;  display:flex;  gap:10px;  transition:all 0.4s ease 0s; } .team-box-three .share-btn-wrap .social-link li {  display:inline-block;  opacity:0;  transform:translateY(10px);  transition:all 0.4s ease 0s; } .team-box-three .share-btn-wrap .social-link li a {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:40px;  height:40px;  border-radius:50%;  background-color:var(--bs-bg-color16);  text-align:center;  color:var(--white-color);  font-size:16px; } .team-box-three .share-btn-wrap .social-link li a:hover {  background-color:var(--theme-color); } .team-box-three .share-btn-wrap .social-link li:nth-child(1) {  transition-duration:0s; } .team-box-three .share-btn-wrap .social-link li:nth-child(2) {  transition-duration:0.2s; } .team-box-three .share-btn-wrap .social-link li:nth-child(3) {  transition-duration:0.4s; } .team-box-three .share-btn-wrap .social-link li:nth-child(4) {  transition-duration:0.6s; } .team-box-three .profile-info {  padding:30px 0 40px;  text-align:center; } .team-box-three .profile-info .name {  font-size:26px;  font-weight:600;  color:var(--dark-color);  margin-bottom:17px; } .team-box-three .profile-info .position {  font-size:15px;  color:var(--dark-color);  width:145px;  height:34px;  line-height:34px;  border-radius:17px;  background-color:var(--theme-color3);  display:inline-block;  margin:0 auto;  transition:all 0.4s ease 0s; } .team-box-three:hover::before {  background:var(--dark-color); } .team-box-three:hover .image-box::before {  height:100%;  opacity:1; } .team-box-three:hover .profile-info .name a {  color:var(--white-color); } .team-box-three:hover .profile-info .name a:hover {  color:var(--theme-color); } .team-box-three:hover .profile-info .position {  background-color:var(--theme-color2); } .team-box-three:hover .share-btn-wrap .social-link li {  opacity:1;  transform:translateY(0); } .dark-mode .team-section.style-3 .team-box-three::before {  background-color:var(--dark-color3); } .dark-mode .team-section.style-3 .team-box-three .inner-box .profile-info .name a {  color:var(--white-color); } .dark-mode .team-section.style-3 .team-box-three .inner-box .profile-info .position {  background:var(--bs-bg-color10);  color:var(--gray-color2); } .dark-mode .team-section.style-3 .team-box-three:hover .inner-box .profile-info .position {  background:var(--theme-color2);  color:var(--title-color); }  .team-box-four {  position:relative;  z-index:1; } .team-box-four .inner-box {  position:relative; } .team-box-four .inner-box .image-box {  position:relative;  overflow:hidden;  border-radius:10px; } @media (min-width:992px) and (max-width:1024px) {  .team-box-four .inner-box .image-box {   margin:0;  } } .team-box-four .inner-box .image-box .image img {  width:100%; } .team-box-four .inner-box .image-box::before {  content:"";  position:absolute;  bottom:0;  height:85%;  width:100%;  mix-blend-mode:darken;  background-image:linear-gradient(0deg, rgb(5, 49, 49) 20%, rgba(5, 49, 49, 0.8762626831) 26%, rgba(5, 49, 49, 0) 55%, rgba(5, 49, 49, 0) 100%);  transition:all 0.4s ease 0s; } .team-box-four .inner-box .profile-info {  padding:30px 0 40px;  text-align:center;  position:absolute;  bottom:0;  left:50%;  transform:translateX(-50%);  width:100%; } .team-box-four .inner-box .profile-info .name {  font-size:25px;  font-weight:600;  color:var(--white-color);  margin-bottom:17px; } .team-box-four .inner-box .profile-info .name a {  color:var(--white-color); } .team-box-four .inner-box .profile-info .position {  font-size:15px;  color:var(--white-color);  width:145px;  height:34px;  line-height:34px;  border-radius:17px;  background-color:var(--bs-bg-color12);  mix-blend-mode:hard-light;  display:inline-block;  margin:0 auto;  transition:all 0.4s ease 0s; } .team-box-four .share-btn-wrap {  position:absolute;  content:"";  left:50%;  transform:translateX(-50%);  transition:all 0.4s ease 0s;  bottom:145px;  z-index:5;  } @media (max-width:1399px) {  .team-box-four .share-btn-wrap {   bottom:160px;  } } .team-box-four .share-btn-wrap .social-link {  position:relative;  display:flex;  gap:10px;  transition:all 0.4s ease 0s; } .team-box-four .share-btn-wrap .social-link li {  display:inline-block;  opacity:0;  transform:translateY(10px);  transition:all 0.4s ease 0s; } .team-box-four .share-btn-wrap .social-link li a {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:40px;  height:40px;  border-radius:50%;  background-color:var(--bs-bg-color5);  text-align:center;  color:var(--white-color);  font-size:16px; } .team-box-four .share-btn-wrap .social-link li a:hover {  background-color:var(--theme-color); } .team-box-four .share-btn-wrap .social-link li:nth-child(1) {  transition-duration:0s; } .team-box-four .share-btn-wrap .social-link li:nth-child(2) {  transition-duration:0.2s; } .team-box-four .share-btn-wrap .social-link li:nth-child(3) {  transition-duration:0.4s; } .team-box-four .share-btn-wrap .social-link li:nth-child(4) {  transition-duration:0.6s; } .team-box-four:hover .image-box::before {  height:100%; } .team-box-four:hover .share-btn-wrap .social-link li {  opacity:1;  transform:translateY(0); } .dark-mode .team-box-four .inner-box {  position:relative; } .dark-mode .team-box-four .inner-box .image-box {  position:relative;  overflow:hidden;  border-radius:10px; } @media (min-width:992px) and (max-width:1024px) {  .dark-mode .team-box-four .inner-box .image-box {   margin:0;  } } .dark-mode .team-box-four .inner-box .image-box .image img {  width:100%; } .dark-mode .team-box-four .inner-box .image-box::before {  content:"";  position:absolute;  bottom:0;  height:85%;  width:100%;  mix-blend-mode:darken;  background-image:linear-gradient(0deg, rgb(5, 40, 49) 0%, rgba(5, 49, 49, 0.8762626831) 26%, rgba(5, 30, 49, 0) 55%, rgba(5, 49, 40, 0) 90%);  transition:all 0.4s ease 0s; }  .team-details .row {  background-color:var(--white-color);  border-radius:10px; } .team-details .team-image img {  width:100%;  border-radius:10px; } .team-details .team-info .team-name {  font-size:30px;  color:var(--dark-color);  font-weight:600;  font-family:var(--title-font);  margin-bottom:8px; } .team-details .team-info .team-role {  display:inline-block;  background:var(--theme-color);  padding:3px 24px;  border-radius:16px;  font-size:15px;  color:var(--white-color);  font-weight:400;  font-family:var(--body-font);  text-align:center;  margin-bottom:26px; } .team-details .team-info .bio-title {  font-size:18px;  line-height:26px;  color:var(--dark-color);  font-weight:600;  font-family:var(--title-font);  margin-bottom:5px; } .team-details .team-info .bio-text {  width:90%;  margin-bottom:35px; } .team-details .team-info .team-meta li + li {  margin-top:6px; } .team-details .team-info .team-meta li strong {  display:inline-block;  font-weight:500;  color:var(--dark-color);  min-width:120px; } .team-details .team-info .team-meta li a {  color:var(--gray-color); } .team-details .team-info .team-meta li a:hover {  color:var(--theme-color); } .team-details .team-info .team-social {  display:flex;  align-items:center;  margin-top:23px; } .team-details .team-info .team-social a {  position:relative;  height:34px;  width:34px;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  color:var(--dark-color);  background-color:transparent;  border:1px solid var(--bs-border-color7);  font-size:14px;  border-radius:50%;  overflow:hidden;  transition:all 0.4s ease 0s;  z-index:1; } .team-details .team-info .team-social a:hover {  color:var(--white-color); } .team-details .team-info .team-social a:hover:after {  height:100%;  opacity:1; } .team-details .team-info .team-social a:after {  position:absolute;  content:"";  width:100%;  height:0;  background:var(--theme-color);  transition:all 0.4s ease-in-out;  top:0;  left:0;  opacity:0;  z-index:-1;  transition:all 0.4s ease 0s; } .team-details .team-info .team-social a + a {  margin-left:10px; } .team-skills .skill-stats {  display:flex;  gap:20px;  margin-bottom:54px;  } @media (max-width:375px) {  .team-skills .skill-stats {   flex-direction:column;  } } .team-skills .skill-stats .stat-box {  background-color:var(--white-color);  border-radius:10px;  width:100%;  padding:20px 35px 28px; } .team-skills .skill-stats .stat-box .stat-icon {  font-size:24px;  color:var(--theme-color);  margin-right:10px; } .team-skills .skill-stats .stat-box .stat-number {  font-size:44px;  font-weight:600;  color:var(--dark-color);  margin:0 0 -3px;  display:flex;  align-items:center; } .team-skills .team.skills .skill-item .skill-bar .bar-inner {  height:6px; } .team-skills .team.skills .skill-item .skill-bar .bar-inner .bar {  height:6px; } .team-skills .contact-form {  padding:50px;  } @media (max-width:375px) {  .team-skills .contact-form {   padding:30px;  } } .team-skills .contact-form .sec-title {  font-size:36px;  font-weight:600; } @media (max-width:1280px) {  .team-skills .contact-form .sec-title {   font-size:34px;  } } @media (max-width:540px) {  .team-skills .contact-form .sec-title {   font-size:30px;   letter-spacing:normal;  } } @media (max-width:430px) {  .team-skills .contact-form .sec-title {   font-size:28px;  } } @media (max-width:414px) {  .team-skills .contact-form .sec-title {   font-size:24px;  } } .team-skills .contact-form .form-group {  margin-bottom:20px; } .team-skills .contact-form .form-group:last-child {  margin-bottom:0;  position:relative; } .team-skills .contact-form .form-group span.wpcf7-spinner {  position:absolute;  top:100%;  left:0; } .team-skills .contact-form .form-group input, .team-skills .contact-form .form-group select, .team-skills .contact-form .form-group textarea {  height:54px;  padding:12px 25px;  border-radius:5px;  color:var(--dark-color);  background-color:var(--white-color);  outline:none;  border:1px solid var(--bs-border-color6);  transition:border-color 0.3s ease; } .team-skills .contact-form .form-group input::placeholder, .team-skills .contact-form .form-group select::placeholder, .team-skills .contact-form .form-group textarea::placeholder {  opacity:0.5; } .team-skills .contact-form .form-group input:focus, .team-skills .contact-form .form-group select:focus, .team-skills .contact-form .form-group textarea:focus {  border-color:var(--theme-color); } .team-skills .contact-form .form-group textarea {  height:130px; } .team-skills .contact-form .form-group input[type=submit] {  height:54px;  border-radius:30px;  color:var(--white-color);  transition:all 0.4s ease 0s; }  .join-section .join-thumb {  direction:rtl;  margin:-120px 90px -200px 0;  } @media (max-width:1500px) {  .join-section .join-thumb {   margin:-120px 15px -200px 0;  } } .join-section .join-thumb img {  max-width:inherit; } @media (max-width:430px) {  .join-section .join-content-wrapper .sec-text br {   display:none;  } }  .skills {  position:relative;  margin-top:-11px; } .skills .skill-item {  position:relative;  margin-bottom:16px; } .skills .skill-item:last-child {  margin-bottom:0; } .skills .skill-item .skill-header {  position:relative;  margin-bottom:0; } .skills .skill-item .skill-header .skill-title {  font-size:16px;  color:var(--dark-color);  font-weight:400;  margin-bottom:11px; } .skills .skill-item .skill-bar .bar-inner {  position:relative;  width:100%;  height:3px;  background-color:rgba(17, 79, 79, 0.2); } .skills .skill-item .skill-bar .bar-inner .bar {  width:0;  height:3px;  -webkit-transition:all 3000ms ease;  -o-transition:all 3000ms ease;  transition:all 3000ms ease;  background-color:var(--dark-color3); } .skills .skill-item .skill-bar .bar-inner .skill-percentage {  font-size:16px;  color:var(--dark-color);  font-weight:400;  position:absolute;  right:0;  bottom:12px; } .dark-mode .skills {  position:relative;  margin-top:-11px; } .dark-mode .skills .skill-item {  position:relative;  margin-bottom:16px; } .dark-mode .skills .skill-item:last-child {  margin-bottom:0; } .dark-mode .skills .skill-item .skill-header {  position:relative;  margin-bottom:0; } .dark-mode .skills .skill-item .skill-header .skill-title {  font-size:16px;  color:var(--dark-color);  font-weight:400;  margin-bottom:11px; } .dark-mode .skills .skill-item .skill-bar .bar-inner {  position:relative;  width:100%;  height:3px;  background-color:var(--bs-bg-color4); } .dark-mode .skills .skill-item .skill-bar .bar-inner .bar {  width:0;  height:3px;  -webkit-transition:all 3000ms ease;  -o-transition:all 3000ms ease;  transition:all 3000ms ease;  background-color:var(--theme-color2); } .dark-mode .skills .skill-item .skill-bar .bar-inner .skill-percentage {  font-size:16px;  color:var(--white-color);  font-weight:400;  position:absolute;  right:0;  bottom:12px; }  .counter-section .achievement-stats {  display:flex;  justify-content:space-around;  background-color:var(--theme-color2);  border:1px solid var(--dark-color);  border-radius:10px;  overflow:hidden; } @media (max-width:540px) {  .counter-section .achievement-stats {   flex-direction:column;  } } .counter-section .achievement-stats .stat-item {  padding:30px;  flex:1;  text-align:center;  } @media (min-width:992px) and (max-width:1024px) {  .counter-section .achievement-stats .stat-item {   padding:20px;  } } @media (max-width:575px) {  .counter-section .achievement-stats .stat-item {   padding:15px;  } } @media (max-width:540px) {  .counter-section .achievement-stats .stat-item {   padding:30px;  } } .counter-section .achievement-stats .stat-item:nth-child(2) {  border:1px solid var(--dark-color);  border-top:none;  border-bottom:none; } @media (max-width:540px) {  .counter-section .achievement-stats .stat-item:nth-child(2) {   border-top:inherit;   border-bottom:inherit;   border-left:none;   border-right:none;  } } .counter-section .achievement-stats .stat-item .count-box {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  font-size:60px;  line-height:1;  color:var(--dark-color);  font-weight:600;  } @media (min-width:992px) and (max-width:1024px) {  .counter-section .achievement-stats .stat-item .count-box {   font-size:50px;  } } @media (max-width:575px) {  .counter-section .achievement-stats .stat-item .count-box {   font-size:45px;  } } @media (max-width:540px) {  .counter-section .achievement-stats .stat-item .count-box {   font-size:60px;  } } @media (max-width:430px) {  .counter-section .achievement-stats .stat-item .count-box {   font-size:40px;  } } .counter-section .achievement-stats .stat-item .text {  font-size:18px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0; }  .counter-section.style-2 .counter-box {  display:flex;  align-items:center;  gap:15px; } .counter-section.style-2 .counter-box .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:70px;  height:70px;  border-radius:50%;  background-color:var(--bs-bg-color10);  font-size:36px;  color:var(--theme-color2); } .counter-section.style-2 .counter-box .title {  font-size:60px;  line-height:1;  color:var(--white-color);  font-weight:500;  display:flex;  align-items:center; }  .counter-section.style-3 .milestone {  display:flex;  flex-direction:column;  gap:1rem;  position:relative;  z-index:1; } .counter-section.style-3 .milestone .milestone-item {  display:flex;  justify-content:space-between;  padding:25px 30px 0;  width:100%;  height:90px;  border-radius:10px;  background-color:var(--theme-color3);  font-size:18px;  color:var(--dark-color);  font-weight:500; } @media (max-width:414px) {  .counter-section.style-3 .milestone .milestone-item {   padding:25px 10px 0;   font-size:16px;  } } .counter-section.style-3 .milestone .milestone-item + .milestone-item {  margin-top:-30px; } .counter-section.style-3 .milestone .milestone-item.dark-green {  background-color:var(--dark-color);  color:var(--white-color);  width:88%; } .counter-section.style-3 .milestone .milestone-item.orange {  background-color:var(--theme-color);  color:var(--white-color);  width:76%; } .counter-section.style-3 .milestone .milestone-item.light-green {  background-color:var(--theme-color2);  color:var(--dark-color);  width:64%;  padding-top:0;  align-items:center; } .counter-section.style-3 .milestone .milestone-item .label {  font-weight:normal; } .counter-section.style-3 .milestone .milestone-item .value {  font-size:1.25rem; } .counter-section.style-3 .counter-image-wrapper {  position:relative;  display:contents;  } @media (max-width:991px) {  .counter-section.style-3 .counter-image-wrapper {   display:none;  } } .counter-section.style-3 .counter-image-wrapper .thumb-bg {  position:absolute;  top:0; } .counter-section.style-3 .counter-image-wrapper .thumb {  position:absolute;  bottom:0; } .counter-section.style-3 .expert-card {  width:330px;  height:200px;  padding:30px;  border-radius:10px;  filter:drop-shadow(0px 30px 15px rgba(209, 219, 219, 0.3));  background-color:rgba(236, 248, 248, 0.5019607843);  border:2px solid var(--theme-color3);  backdrop-filter:blur(10px);  position:absolute;  right:14%;  top:28%; } @media (max-width:1500px) {  .counter-section.style-3 .expert-card {   right:20px;  } } @media (max-width:1299px) {  .counter-section.style-3 .expert-card {   display:none;  } } .counter-section.style-3 .expert-card .expert-info {  display:flex;  align-items:center;  gap:15px;  margin-bottom:1rem; } .counter-section.style-3 .expert-card .expert-info .social {  display:flex; } .counter-section.style-3 .expert-card .expert-info .social img {  width:55px;  height:55px;  border-radius:50%;  border:2px solid var(--white-color); } .counter-section.style-3 .expert-card .expert-info .social img + img {  margin-left:-20px; } .counter-section.style-3 .expert-card .expert-info .count {  font-size:30px;  color:var(--dark-color);  font-weight:600; } .counter-section.style-3 .expert-card .expert-text {  display:flex;  gap:10px; } .counter-section.style-3 .expert-card .expert-text .arrow {  color:var(--theme-color);  font-size:50px;  transform:rotate(-90deg);  display:inline-block; } .counter-section.style-3 .expert-card .expert-text p {  font-size:18px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0; }  @media (max-width:991px) {  .wrapper-section.br-30 {   border-radius:0;  } } .mission-single-box {  position:relative;  overflow:hidden;  z-index:1;  padding:50px 40px;  border-radius:10px; } @media (min-width:991px) and (max-width:1024px) {  .mission-single-box {   padding:50px 25px;  } } @media (max-width:390px) {  .mission-single-box {   padding:45px 30px;  } } @media (max-width:360px) {  .mission-single-box {   padding:40px 25px;  } } .mission-single-box .mission-content .title {  font-size:32px;  line-height:36px;  color:var(--dark-color);  font-weight:600;  margin:-10px 0 15px; } .mission-single-box .mission-content .text {  width:55%;  margin-bottom:0; } @media (max-width:1199px) {  .mission-single-box .mission-content .text {   width:58%;  } } @media (min-width:992px) and (max-width:1024px) {  .mission-single-box .mission-content .text {   width:65%;  } } @media (min-width:820px) and (max-width:912px) {  .mission-single-box .mission-content .text {   width:100%;  } } @media (max-width:575px) {  .mission-single-box .mission-content .text {   width:68%;  } } @media (max-width:430px) {  .mission-single-box .mission-content .text {   width:100%;  } } .mission-single-box .mission-content .theme-btn {  padding:12px 40px;  margin-top:140px;  } @media (max-width:1199px) {  .mission-single-box .mission-content .theme-btn {   margin-top:80px;  } } @media (min-width:991px) and (max-width:1024px) {  .mission-single-box .mission-content .theme-btn {   margin-top:40px;  } } @media (min-width:820px) and (max-width:912px) {  .mission-single-box .mission-content .theme-btn {   margin-top:40px;  } } @media (max-width:430px) {  .mission-single-box .mission-content .theme-btn {   margin-top:40px;  } } .mission-single-box .mission-image {  z-index:1; } @media (min-width:820px) and (max-width:912px) {  .mission-single-box .mission-image {   display:none;  } } @media (max-width:430px) {  .mission-single-box .mission-image {   display:none;  } } .mission-single-box .mission-image img {  } @media (max-width:1199px) {  .mission-single-box .mission-image img {   height:350px;  } } @media (min-width:991px) and (max-width:1024px) {  .mission-single-box .mission-image img {   height:280px;  } } @media (max-width:540px) {  .mission-single-box .mission-image img {   height:280px;  } }  .gallery-section {  position:relative;  z-index:1; } .gallery-single-box {  } @media (max-width:991px) {  .gallery-single-box {   height:100%;  } } .gallery-single-box .gallery-thumb {  position:relative;  } @media (max-width:991px) {  .gallery-single-box .gallery-thumb {   height:100%;  } } .gallery-single-box .gallery-thumb::before {  position:absolute;  content:"";  width:100%;  height:100%;  background:rgba(5, 49, 49, 0.5);  transition:all 0.4s ease-in-out;  left:0;  top:0;  backdrop-filter:blur(7px);  opacity:0;  visibility:hidden;  transition:all 0.4s ease 0s; } .gallery-single-box .gallery-thumb > img {  width:100%;  object-fit:cover;  } @media (max-width:991px) {  .gallery-single-box .gallery-thumb > img {   height:100%;  } } .gallery-single-box .gallery-thumb .gallery-thumb-view a {  position:absolute;  left:50%;  top:50%;  transform:translate(-50%, -50%) scale(1.2);  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:80px;  height:80px;  background-color:var(--white-color);  border-radius:50%;  opacity:0;  visibility:hidden;  transition:all 0.4s ease 0s; } .gallery-single-box .gallery-thumb:hover::before {  opacity:1;  visibility:visible; } .gallery-single-box .gallery-thumb:hover .gallery-thumb-view a {  transform:translate(-50%, -50%) scale(1);  opacity:1;  visibility:visible; }  .feature-single-box {  background-color:var(--white-color);  border-radius:10px;  transition:all 0.4s ease 0s;  padding:50px 50px;  text-align:center;  } @media (max-width:1199px) {  .feature-single-box {   padding:50px 30px 50px;  } } @media (min-width:992px) and (max-width:1024px) {  .feature-single-box {   padding:50px 15px 50px;  } } .feature-single-box .icon {  font-size:70px;  color:var(--dark-color);  margin-bottom:34px;  transition:all 0.4s ease 0s; } .feature-single-box .title {  font-size:20px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0; } .feature-single-box:hover {  background-color:var(--dark-color); } .feature-single-box:hover .icon {  filter:brightness(0) saturate(100%) invert(91%) sepia(12%) saturate(1224%) hue-rotate(31deg) brightness(104%) contrast(75%); } .feature-single-box:hover .icon i {  animation:mirror_effect 0.5s forwards ease-in-out 0s; } .feature-single-box:hover .title {  color:var(--white-color); }  .feature-section.style-2 .feature-single-box {  padding:50px 20px 50px;  } .feature-section.style-2 .feature-single-box:hover .text {  color:var(--gray-color2); } .feature-section.style-2 .feature-single-box:hover .icon {  color:var(--theme-color2); } @media (max-width:1199px) {  .feature-section.style-2 .feature-single-box {   padding:50px 15px 50px;  } } @media (min-width:992px) and (max-width:1024px) {  .feature-section.style-2 .feature-single-box {   padding:50px 15px 50px;  } } .feature-section.style-2 .feature-single-box .icon {  margin-bottom:28px;  font-size:60px;  color:var(--dark-color); } .feature-section.style-2 .feature-single-box .icon .icon-three-people {  width:60px !important;  height:60px !important; } .feature-section.style-2 .feature-single-box .title {  margin-bottom:10px; } .feature-section.style-2 .feature-single-box .text {  margin-bottom:0; } @media (max-width:991px) {  .feature-section.style-2 .feature-single-box .text {   width:68%;   margin:0 auto;  } } @media (max-width:767px) {  .feature-section.style-2 .feature-single-box .text {   width:90%;  } } @media (max-width:575px) {  .feature-section.style-2 .feature-single-box .text {   width:55%;  } } @media (max-width:430px) {  .feature-section.style-2 .feature-single-box .text {   width:70%;  } } @media (max-width:375px) {  .feature-section.style-2 .feature-single-box .text {   width:90%;  } }  .feature-section.style-3 .video-thumb {  position:relative; } .feature-section.style-3 .video-thumb .popup-video {  display:inline-block;  position:absolute;  content:"";  left:50%;  top:50%;  transform:translate(-50%, -50%);  transition:all 0.4s ease 0s; } .feature-section.style-3 .video-thumb .popup-video .icon {  display:inline-flex;  align-items:center;  justify-content:center;  width:100px;  height:100px;  border-radius:50%;  color:var(--dark-color);  background-color:var(--bs-bg-color6);  backdrop-filter:blur(10px);  border:1px solid var(--white-color);  margin-right:20px;  transition:all 0.3s ease;  position:relative;  z-index:1; } .feature-section.style-3 .video-thumb .popup-video .icon:hover {  transform:scale(1.01);  box-shadow:0 0 10px var(--bs-text-color2); } .feature-section.style-3 .video-thumb .popup-video .icon::before, .feature-section.style-3 .video-thumb .popup-video .icon::after {  content:"";  position:absolute;  z-index:-1;  top:50%;  left:50%;  width:100%;  height:100%;  border-radius:50%;  background-color:rgba(255, 255, 255, 0.2);  transform:translate(-50%, -50%) scale(1);  animation:rippleEffect 1.5s infinite ease-out; } .feature-section.style-3 .video-thumb .popup-video .icon::after {  animation-delay:0.5s; } .feature-section.style-3 .feature-item-box {  padding:40px 40px 40px;  border-radius:10px;  position:relative;  z-index:1;  overflow:hidden;  background-color:var(--bs-bg-color10);  } @media (max-width:1199px) {  .feature-section.style-3 .feature-item-box {   padding:40px 20px 40px;  } } .feature-section.style-3 .feature-item-box:hover .icon i {  animation:mirror_effect 0.8s forwards ease-in-out 0s; } @media (max-width:1024px) {  .feature-section.style-3 .feature-item-box {   padding:50px 30px 40px;  } } @media (min-width:992px) and (max-width:1024px) {  .feature-section.style-3 .feature-item-box {   padding:40px 24px 40px;  } } .feature-section.style-3 .feature-item-box .icon {  font-size:50px;  color:var(--theme-color2);  transition:all 0.4s ease 0s;  margin-bottom:20px; } .feature-section.style-3 .feature-item-box .title {  font-size:24px;  color:var(--white-color);  font-weight:500;  transition:all 0.4s ease 0s;  margin-bottom:6px; } .feature-section.style-3 .feature-item-box .text {  font-size:16px;  color:var(--gray-color2);  font-weight:400;  transition:all 0.4s ease 0s; } .feature-section.style-3 .feature-item-box .feature-btn {  font-size:16px;  color:var(--white-color);  font-weight:500;  display:inline-flex;  align-items:center;  gap:10px;  margin-top:10px; } .feature-section.style-3 .feature-item-box .feature-btn:hover {  color:var(--theme-color);  gap:5px; } .feature-section.style-3 .feature-item-box .feature-btn::after {  content:"\f178";  font-family:var(--icon-font);  font-size:20px;  font-weight:400; }  .feature-section.style-4 .feature-title-area .service-btn {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center; } .feature-box-four {  position:relative;  overflow:hidden; } .feature-box-four.current .image-box .thumb img, .feature-box-four:hover .image-box .thumb img {  transform:scale(1.1) rotate(-1deg); } .feature-box-four.current .image-box .service-icon, .feature-box-four:hover .image-box .service-icon {  color:var(--white-color); } .feature-box-four.current .image-box .service-icon::before, .feature-box-four:hover .image-box .service-icon::before {  width:100%; } .feature-box-four.current .image-box .service-icon img, .feature-box-four:hover .image-box .service-icon img {  filter:brightness(0) invert(1); } .feature-box-four.current .image-box .service-icon svg, .feature-box-four:hover .image-box .service-icon svg {  fill:var(--white-color); } .feature-box-four.current .content::before, .feature-box-four:hover .content::before {  width:100%; } .feature-box-four.current .content .service-btn, .feature-box-four:hover .content .service-btn {  padding-left:195px; } @media (min-width:992px) and (max-width:1024px) {  .feature-box-four.current .content .service-btn, .feature-box-four:hover .content .service-btn {   padding-left:152px;  } } .feature-box-four.current .content .service-btn::before, .feature-box-four:hover .content .service-btn::before {  width:190px; } @media (min-width:992px) and (max-width:1024px) {  .feature-box-four.current .content .service-btn::before, .feature-box-four:hover .content .service-btn::before {   width:144px;  } } .feature-box-four .image-box {  position:relative;  z-index:1; } .feature-box-four .image-box img {  transition:all 0.4s ease 0s; } .feature-box-four .image-box .thumb img {  width:100%; } .feature-box-four .image-box .service-icon {  position:absolute;  left:40px;  bottom:30px;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:90px;  height:90px;  background-color:var(--bs-bg-color14);  backdrop-filter:blur(30px);  font-size:46px;  color:var(--dark-color); } .feature-box-four .image-box .service-icon::before {  content:"";  position:absolute;  z-index:-1;  left:0;  top:0;  width:0;  height:100%;  background:var(--theme-color);  transition:all 0.4s ease 0s; } .feature-box-four .image-box .service-icon svg {  fill:var(--dark-color);  width:46px;  height:46px; } .feature-box-four .content {  margin-left:40px;  margin-top:-30px;  padding:43px 30px 43px 35px;  background:var(--white-color);  position:relative;  z-index:1;  } @media (max-width:1199px) {  .feature-box-four .content {   margin-left:0;  } } @media (min-width:992px) and (max-width:1024px) {  .feature-box-four .content {   padding:43px 20px 43px 20px;  } } .feature-box-four .content::before {  content:"";  position:absolute;  z-index:-1;  left:0;  top:0;  width:0;  height:100%;  background:var(--theme-color3);  transition:all 0.4s ease 0s; } .feature-box-four .content .title {  font-size:24px;  color:var(--dark-color);  font-weight:600; } .feature-box-four .content .service-btn {  font-size:16px;  color:var(--dark-color);  font-weight:500;  position:relative;  z-index:1; } .feature-box-four .content .service-btn::before {  content:"";  position:absolute;  left:0;  top:10px;  width:0;  height:1px;  background:var(--dark-color);  z-index:-1;  transition:all 0.4s ease 0s; } .dark-mode .feature-section {  background:var(--dark-color) !important; }  @media (min-width:992px) {  .cta-section.space-bottom {   padding-bottom:0 !important;  } } @media (min-width:992px) {  .cta-section .space-top {   padding-top:0 !important;  } } .cta-section .border-top {  position:relative;  border-top:1px solid rgba(6, 50, 50, 0.1) !important; } .cta-section .sec-text {  } @media (max-width:575px) {  .cta-section .sec-text br {   display:none;  } } .cta-section .image-grid {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  position:relative;  z-index:1;  max-width:650px;  width:100%;  height:495px; } .cta-section .image-grid .lines {  position:absolute;  top:0;  bottom:0;  z-index:-1;  display:flex;  justify-content:space-between;  width:100%; } .cta-section .image-grid .lines span {  width:1px;  height:100%;  background-color:var(--bs-bg-color7); } .cta-section .image-grid .lines2 {  position:absolute;  left:0;  right:0;  z-index:-1;  display:flex;  justify-content:space-between;  flex-direction:column;  height:100%; } .cta-section .image-grid .lines2 span {  width:100%;  height:1px;  background-color:var(--bs-bg-color7); } @media (min-width:992pxpx) {  .cta-section .image-grid .lines2 span:first-child {   background-color:transparent;  } } .cta-section .image-grid .image-box {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  flex-wrap:wrap;  gap:20px;  max-width:425px;  width:100%; } .cta-section .image-grid .image-box .image-item {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:127px;  height:128px;  background-color:var(--theme-color);  border-radius:50%;  overflow:hidden; } .cta-section .image-grid .image-box .image-item img {  width:127px;  height:127px;  object-fit:cover; } .cta-section .image-grid .image-box .image-item .icon {  font-size:56px;  color:var(--white-color); }  @media (min-width:992px) {  .cta-section.style-2.space {   padding-top:0 !important;   padding-bottom:0 !important;  } }  .cta-section.style-3 .overlay {  background-color:var(--bs-bg-color13);  z-index:-1;  border-radius:20px 20px 0 0; } .cta-section.style-3 .bg.image img {  width:100%;  height:100%; } .cta-section.style-3 .image-box {  display:contents;  position:relative;  } @media (max-width:991px) {  .cta-section.style-3 .image-box {   display:none;  } } .cta-section.style-3 .image-box .thumb {  position:absolute;  bottom:0; } .cta-section.style-3 .cta-text p {  font-size:18px;  color:var(--bs-text-color2);  margin-bottom:0; } .cta-section.style-3 .cta-text i {  color:var(--theme-color2);  margin-right:5px; } .cta-section.style-3 .cta-text svg {  width:16px;  height:16px;  fill:var(--theme-color2);  margin-right:5px; } .cta-section.style-3 .cta-button .cta-link {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  flex-direction:column;  gap:10px;  padding:15px 30px;  background-color:var(--theme-color2);  color:var(--dark-color);  font-size:16px;  font-weight:500;  width:150px;  height:150px;  border-radius:50%;  transition:all 0.4s ease 0s;  text-align:center; } .cta-section.style-3 .cta-button .cta-link:hover {  background-color:var(--theme-color2); }  .cta-section.style-4 .overlay {  background:var(--bs-bg-color18);  z-index:-1; } .cta-section.style-4 .social-proof {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:inherit;  gap:20px;  } @media (max-width:991px) {  .cta-section.style-4 .social-proof {   justify-content:start;  } } @media (max-width:430px) {  .cta-section.style-4 .social-proof {   gap:15px;   flex-direction:column;   align-items:flex-start;   margin-bottom:15px;   margin-bottom:0;  } } .cta-section.style-4 .social-proof .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:50px;  height:50px;  border-radius:50%;  background-color:var(--dark-color);  font-size:18px;  color:var(--white-color);  flex-shrink:0; } .cta-section.style-4 .social-proof .icon svg {  fill:var(--white-color);  width:18px;  height:18px; } .cta-section.style-4 .social-proof .text {  font-size:28px;  line-height:36px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0; } @media (max-width:430px) {  .cta-section.style-4 .social-proof .text br {   display:none;  } } @media (min-width:992px) and (max-width:1024px) {  .cta-section.style-4 .social-proof .text br {   display:none;  } }  .planning-section {  } @media (max-width:991px) {  .planning-section .row {   flex-direction:column-reverse;  } } .planning-image-box {  position:relative;  direction:rtl;  margin-right:85px; } @media (max-width:1500px) {  .planning-image-box {   margin-right:0;  } } @media (max-width:991px) {  .planning-image-box {   display:inline-block;  } } .planning-image-box .image {  max-width:inherit;  border-radius:10px;  } @media (max-width:1500px) {  .planning-image-box .image {   max-width:100%;  } } .planning-image-box .since-box {  right:0;  bottom:0;  border-radius:10px 0;  } @media (min-width:992px) and (max-width:1024px) {  .planning-image-box .since-box {   display:none;  } } @media (max-width:991px) {  .planning-image-box .since-box {   display:block;  } } @media (max-width:430px) {  .planning-image-box .since-box {   display:none;  } } .planning-content-wrapper .sec-text { } @media (max-width:991px) {  .planning-content-wrapper .sec-text {   width:67%;  } } @media (max-width:575px) {  .planning-content-wrapper .sec-text {   width:100%;  } } @media (max-width:430px) {  .planning-content-wrapper .planning-btn {   flex-direction:column;   align-items:start !important;  } } .planning-content-wrapper .contact-info {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-start;  gap:10px; } .planning-content-wrapper .contact-info .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:56px;  height:56px;  border-radius:50%;  background-color:var(--theme-color);  font-size:24px;  color:var(--white-color); } .planning-content-wrapper .contact-info .icon i {  filter:brightness(0) invert(1); } .planning-content-wrapper .contact-info .number {  font-size:16px;  line-height:26px;  color:var(--dark-color);  font-weight:600; } .planning-content-wrapper .feature-grid {  } @media (max-width:1399px) {  .planning-content-wrapper .feature-grid {   gap:0;  } } @media (max-width:430px) {  .planning-content-wrapper .feature-grid {   gap:20px;  } } .planning-content-wrapper .feature-grid .feature-item {  gap:10px; } @media (max-width:1199px) {  .planning-content-wrapper .feature-grid .feature-item {   padding-right:20px;  } } @media (min-width:992px) and (max-width:1024px) {  .planning-content-wrapper .feature-grid .feature-item {   padding-right:0;  } } @media (max-width:575px) {  .planning-content-wrapper .feature-grid .feature-item {   padding-right:0;  } } .planning-content-wrapper .feature-grid .feature-item p {  font-size:16px;  line-height:20px;  color:var(--dark-color);  font-weight:400;  margin:0; }  .video-section {  background-image:linear-gradient(var(--theme-color3) 50%, var(--white-color) 50%); } .video-section .video-box {  position:relative; } .video-section .video-box .video-thumb {  position:relative; } .video-section .video-box .video-thumb .popup-video {  position:absolute;  top:50px;  right:50px;  display:inline-block;  margin-bottom:0;  z-index:1;  } @media (max-width:375px) {  .video-section .video-box .video-thumb .popup-video {   top:30px;   right:30px;  } } .video-section .video-box .video-thumb .popup-video .icon {  display:inline-flex;  align-items:center;  justify-content:center;  width:60px;  height:60px;  border-radius:30px;  background-color:var(--theme-color);  font-size:18px;  color:var(--white-color);  margin-right:20px; } .video-section .video-box .video-thumb .popup-video .icon svg {  width:20px;  fill:var(--white-color); } .video-section .video-box .video-thumb .popup-video p {  color:var(--light-color2);  font-size:16px;  line-height:24px;  margin-bottom:0; } .video-section .video-box .video-thumb img {  border-radius:10px;  min-height:260px;  object-fit:cover; } .video-section .video-box .stats-container {  position:absolute;  right:0;  bottom:0;  max-width:650px;  width:100%; } @media (max-width:912px) {  .video-section .video-box .stats-container {   position:relative;   max-width:100%;   width:100%;   margin-top:30px;  } } .video-section .video-box .stats-container::before {  display:none; } .video-section .video-box .stats-container .stat-box .count-box {  line-height:1; } .video-section .video-box .stats-container .stat-box.dark .text {  color:var(--dark-color); }  .video-section.style-2 {  position:relative;  z-index:1;  background-image:none; } .video-section.style-2::before {  content:"";  position:absolute;  left:0;  top:0;  width:100%;  height:120px;  background-color:var(--white-color);  z-index:-1; } .video-section.style-2 .video-box {  position:absolute;  left:0;  top:0; } .video-section.style-2 .video-box a {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:120px;  height:120px;  background-color:var(--dark-color);  font-size:24px;  color:var(--white-color); } .video-section.style-2 .thumb img {  } @media (max-width:991px) {  .video-section.style-2 .thumb img {   width:100%;  } } .dark-mode .video-section.style-2::before {  display:none; } .dark-mode .video-section.style-2 .video-area .video-box a {  background-color:var(--theme-color); }  .video-section.style-3 {  position:relative;  z-index:1;  background-image:none; } .video-section.style-3 .video-area .video-box {  position:absolute;  left:50%;  transform:translate(-50%, -50%);  top:50%;  } @media (max-width:1299px) {  .video-section.style-3 .video-area .video-box {   top:40%;  } } @media (max-width:1024px) {  .video-section.style-3 .video-area .video-box {   top:50%;  } } .video-section.style-3 .video-area .video-box a {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:100px;  height:100px;  border-radius:50%;  background-color:var(--bs-bg-color14);  backdrop-filter:blur(15px);  font-size:24px;  color:var(--white-color); } .video-section.style-3 .video-area .video-box a i {  color:var(--theme-color); } .video-section.style-3 .video-area .thumb img {  width:100%; } .video-section.style-3 .stats-container {  display:flex;  position:absolute;  bottom:0;  right:0;  } @media (min-width:992px) and (max-width:1024px) {  .video-section.style-3 .stats-container {   display:none;  } } @media (max-width:991px) {  .video-section.style-3 .stats-container {   position:relative;  } } @media (max-width:430px) {  .video-section.style-3 .stats-container {   flex-direction:column;   gap:0px;  } } .video-section.style-3 .stats-container .stat-box {  padding:45px 0 48px 50px;  flex:inherit;  display:flex;  flex-direction:column;  justify-content:center;  width:324px;  } @media (min-width:992px) and (max-width:1024px) {  .video-section.style-3 .stats-container .stat-box {   padding:35px;  } } @media (max-width:991px) {  .video-section.style-3 .stats-container .stat-box {   width:100%;   border-radius:0;  } } @media (max-width:540px) {  .video-section.style-3 .stats-container .stat-box {   padding:40px;  } } @media (max-width:375px) {  .video-section.style-3 .stats-container .stat-box {   padding:30px;  } } @media (max-width:991px) {  .video-section.style-3 .stats-container .stat-box:first-child {   border-bottom-left-radius:0px;  }  .video-section.style-3 .stats-container .stat-box:nth-child(2) {   border-top-right-radius:0px;  } } @media (max-width:430px) {  .video-section.style-3 .stats-container .stat-box {   border-radius:0;  } } .video-section.style-3 .stats-container .stat-box .count-box {  font-size:50px;  line-height:1;  font-weight:600;  margin-bottom:0;  display:flex;  align-items:center; } .video-section.style-3 .stats-container .stat-box .text {  font-size:18px;  margin:0; } .video-section.style-3 .stats-container .stat-box.white .count-box, .video-section.style-3 .stats-container .stat-box.white .text {  color:var(--white-color); } .video-section.style-3 .stats-container .stat-box.dark .count-box {  color:var(--dark-color); } .video-section.style-3 .stats-container .stat-box.dark .text {  color:var(--gray-color); }  .benifits-section {  } @media (max-width:375px) {  .benifits-section .title-area {   text-align:center;  }  .benifits-section .title-area .sub-title {   justify-content:center;  } } .benifit-image-box {  margin-left:50px;  } @media (max-width:1500px) {  .benifit-image-box {   margin-left:0;  } } .benifit-image-box .image {  max-width:inherit;  border-radius:10px;  } @media (max-width:1500px) {  .benifit-image-box .image {   max-width:100%;  } } .benifit-item {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-start;  gap:22px;  margin-bottom:25px;  } @media (max-width:375px) {  .benifit-item {   text-align:center;   flex-direction:column;  } } .benifit-item:last-child {  margin-bottom:0; } .benifit-item:hover .checkmark {  background-color:var(--dark-color); } .benifit-item:hover .checkmark .icon-checkmark2 {  animation:wobble_vertical 1s forwards ease-in-out 0s;  filter:brightness(0) invert(1); } .benifit-item .checkmark {  font-size:18px;  color:var(--dark-color);  width:44px;  height:44px;  line-height:44px;  text-align:center;  border-radius:50%;  background-color:transparent;  border:1px solid var(--bs-border-color7);  flex-shrink:0;  transition:all 0.4s ease 0s; } .benifit-item .content .title {  font-size:22px;  color:var(--dark-color);  font-weight:500;  margin-bottom:9px; } .benifit-item .content .text {  margin-bottom:0;  } @media (min-width:992px) and (max-width:1024px) {  .benifit-item .content .text br {   display:none;  } } @media (max-width:540px) {  .benifit-item .content .text br {   display:none;  } } @media (max-width:375px) {  .benifit-item .content .text {   width:80%;   margin:0 auto;  } }  .project-section.style-5 {  position:relative;  z-index:1;  } .project-section.style-5::before {  position:absolute;  content:"";  width:100%;  height:100%;  background:var(--bs-bg-color15);  transition:all 0.4s ease-in-out;  top:0;  left:0;  z-index:0; } .project-section.style-5 .thumbs .thumb {  position:absolute;  width:100%;  height:100%;  top:0;  left:0;  opacity:0;  transition:opacity 0.5s ease-in-out;  pointer-events:none; } .project-section.style-5 .thumbs .thumb img {  width:100%;  height:100%;  object-fit:cover; } .project-section.style-5 .thumbs .thumb.active {  opacity:1;  z-index:1; } .project-box-five {  position:relative;  overflow:hidden;  z-index:2;  min-height:747px;  transition:all 0.4s ease 0s;  border-right:2px solid var(--bs-border-color14);  } @media (max-width:991px) {  .project-box-five {   border-bottom:2px solid var(--bs-border-color14);  } } .project-box-five::before {  position:absolute;  content:"";  width:100%;  height:100%;  background:transparent;  transition:all 0.4s ease-in-out;  backdrop-filter:blur(30px);  left:0;  bottom:0;  opacity:0;  transition:all 0.4s ease 0s; } .project-box-five .serial {  position:absolute;  top:50px;  left:40px;  font-size:26px;  line-height:38px;  color:var(--white-color);  font-weight:500; } .project-box-five .project-info {  position:absolute;  padding:0 40px;  left:0;  bottom:50px;  transition:all 0.4s ease 0s; } @media (max-width:1280px) {  .project-box-five .project-info {   padding:0 20px;  } } .project-box-five .project-info .project-badge {  margin-bottom:10px; } .project-box-five .project-info .project-badge a {  display:inline-block;  font-size:12px;  color:var(--white-color);  font-weight:500;  height:30px;  line-height:30px;  padding:0 18px;  border-radius:15px;  background-color:var(--bs-bg-color10);  border:1px solid var(--bs-border-color9);  margin-right:5px;  position:relative;  z-index:1; } .project-box-five .project-info .title {  font-size:32px;  color:var(--white-color);  font-weight:600;  margin-bottom:10px; } @media (max-width:1280px) {  .project-box-five .project-info .title {   font-size:25px;  } } .project-box-five .project-info .title a {  color:var(--white-color); } .project-box-five .project-info .title a:hover {  color:var(--theme-color); } @media (min-width:992px) and (max-width:1024px) {  .project-box-five .project-info .title {   font-size:20px;  } } .project-box-five .project-info .description {  --dur:0.6s;  --dur_half:calc(var(--dur) * 0.5);  --max-height:250px;  position:relative;  z-index:2;  overflow:hidden;  opacity:0;  max-height:0;  transition:all var(--dur), opacity var(--dur_half); } .project-box-five .project-info .text {  font-size:16px;  line-height:26px;  color:var(--bs-text-color2);  font-weight:400;  margin-bottom:32px; } @media (min-width:992px) and (max-width:1024px) {  .project-box-five .project-info .text {   font-size:14px;  } } .project-box-five .project-info .project-btn {  padding:0;  background:transparent;  overflow:hidden;  max-width:45px;  gap:0;  display:flex;  align-items:center; } .project-box-five .project-info .project-btn .link-text {  color:var(--white-color);  opacity:0;  visibility:hidden;  transition:all 300ms ease;  position:relative;  display:block;  height:26px;  white-space:nowrap;  overflow:hidden;  width:0; } .project-box-five .project-info .project-btn > i {  filter:brightness(0) saturate(100%) invert(91%) sepia(12%) saturate(1224%) hue-rotate(31deg) brightness(104%) contrast(75%); } .project-box-five:hover::before {  opacity:1; } .project-box-five:hover .title {  margin-bottom:15px; } .project-box-five:hover .description {  opacity:1;  max-height:var(--max-height);  transition:all var(--dur), opacity var(--dur_half) var(--dur_half); } .project-box-five:hover .project-btn {  padding:9px 25px;  max-width:158px;  gap:10px;  background:var(--theme-color); } .project-box-five:hover .project-btn .link-text {  animation:typing 1s steps(20) forwards;  visibility:visible; } .project-box-five:hover .project-btn > i {  filter:brightness(0) invert(1); } .project-box-five:hover .project-btn > i.icon-arrow-up-right {  width:10px !important;  height:10px !important; } .project-cta {  position:relative;  top:-60px; } .project-cta .overlay {  background:var(--bs-bg-color18);  z-index:-1; } .project-cta .social-proof {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  gap:20px; } @media (max-width:991px) {  .project-cta .social-proof {   justify-content:start;  } } @media (max-width:575px) {  .project-cta .social-proof {   gap:15px;   flex-direction:column;   align-items:flex-start;   margin-bottom:15px;   margin-bottom:0;  } } .project-cta .social-proof .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:50px;  height:50px;  border-radius:50%;  background-color:var(--dark-color);  font-size:18px;  color:var(--white-color);  flex-shrink:0; } .project-cta .social-proof .text {  font-size:28px;  line-height:36px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0; } @media (min-width:992px) and (max-width:1024px) {  .project-cta .social-proof .text br {   display:none;  } } .project-section.style-6 .project-title-area {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:space-between; } @media (max-width:540px) {  .project-section.style-6 .project-title-area {   flex-direction:column;   align-items:start;   margin-bottom:30px;  } } .project-section.style-6 .project-title-area .project-btn-wrapper {  display:flex;  justify-content:center;  align-items:center; } .project-section.style-6 .project-title-area .project-btn-wrapper .array-button .array-prev, .project-section.style-6 .project-title-area .project-btn-wrapper .array-button .array-next {  height:60px;  width:60px;  border:1px solid var(--bs-border-color12);  color:var(--dark-color); } .project-section.style-6 .project-title-area .project-btn-wrapper .array-button .array-prev:hover, .project-section.style-6 .project-title-area .project-btn-wrapper .array-button .array-next:hover {  background:var(--dark-color);  color:var(--white-color); } .project-section.style-6 .project-title-area .project-btn-wrapper .array-button .array-next.active {  background:var(--dark-color);  color:var(--white-color); } .project-section.style-6 .project-wrapper {  display:flex;  border-radius:20px;  overflow:hidden;  background:var(--dark-color3);  } @media (max-width:1299px) {  .project-section.style-6 .project-wrapper {   border-radius:0;  } } @media (max-width:853px) {  .project-section.style-6 .project-wrapper .project-thum {   display:none;  } } .project-section.style-6 .project-wrapper .project-thum img {  max-width:inherit;  } @media (max-width:1500px) {  .project-section.style-6 .project-wrapper .project-thum img {   max-width:100%;   height:100%;   object-fit:cover;  } } .project-section.style-6 .project-wrapper .project-content {  background:var(--dark-color3);  padding:110px 50px 110px 75px;  } @media (max-width:1399px) {  .project-section.style-6 .project-wrapper .project-content {   padding:80px 50px 80px 45px;  } } @media (max-width:430px) {  .project-section.style-6 .project-wrapper .project-content {   padding:50px 10px 50px 15px;  } } .project-section.style-6 .project-wrapper .project-content .project-box-title .sub-title {  font-size:12px;  line-height:1;  color:var(--white-color);  display:inline-block;  font-weight:500;  padding:10px 20px;  margin:0;  border-radius:20px;  border:1px solid var(--bs-border-color9); } .project-section.style-6 .project-wrapper .project-content .project-box-title .title {  font-size:40px;  line-height:48px;  color:var(--white-color);  font-weight:600;  margin:20px 0 25px; } .project-section.style-6 .project-wrapper .project-content p {  color:var(--gray-color2);  margin-bottom:30px;  max-width:90%; } .project-section.style-6 .project-wrapper .project-content .project-list li {  color:var(--gray-color2);  font-weight:400;  margin-top:12px; } .project-section.style-6 .project-wrapper .project-content .project-list li i {  color:var(--theme-color2); } .project-section.style-6 .project-wrapper .project-content .project-list li span {  font-size:15px;  line-height:1;  color:var(--white-color);  font-weight:400;  margin:0 10px; } .project-section.style-6 .project-wrapper .project-content .project-btn .theme-btn {  padding:12px 40px; } .project-content > * {  transition-timing-function:ease;  transition-duration:1s;  transition-property:all;  opacity:0; } .project-content > *:nth-child(1) {  transition-delay:1000ms;  transform:translateY(-50px); } .project-content > *:nth-child(2) {  transition-delay:700ms;  transform:translateY(50px); } .project-content > *:nth-child(3) {  transition-delay:1000ms;  transform:translateY(50px); } .project-content > *:nth-child(4) {  transition-delay:1000ms;  transform:translateY(50px); } .project-content > *:nth-child(5) {  transition-delay:1100ms;  transform:translateY(50px); } .project-thum > * {  transition-timing-function:ease;  transition-duration:1s;  transition-property:all;  opacity:0; } .project-thum > *:nth-child(1) {  transition-delay:1000ms;  transform:translateY(50px); }  .swiper-slide-active .project-content > * {  transform:translateX(0);  opacity:1; } .swiper-slide-active .project-thum > * {  transform:translateX(0);  opacity:1; }  .project-section.style-7 {  position:relative;  z-index:1;  } .project-section.style-7::before {  display:none; } .project-section.style-7 .thumbs {  } @media (max-width:991px) {  .project-section.style-7 .thumbs::before {   position:absolute;   content:"";   top:0;   left:0;   width:100%;   height:100%;   background:rgba(0, 0, 0, 0.6705882353);   z-index:2;  } } .project-section.style-7 .thumbs .thumb {  position:absolute;  width:100%;  height:100%;  top:0;  left:0;  opacity:0;  transition:opacity 0.5s ease-in-out;  pointer-events:none; } .project-section.style-7 .thumbs .thumb img {  width:100%;  height:100%;  object-fit:cover; } .project-section.style-7 .thumbs .thumb.active {  opacity:1;  z-index:1; } .project-box-five {  position:relative;  overflow:hidden;  z-index:2;  min-height:747px;  transition:all 0.4s ease 0s;  border-right:2px solid var(--bs-border-color14);  } @media (max-width:991px) {  .project-box-five {   border-bottom:2px solid var(--bs-border-color14);  } } .project-box-five::before {  position:absolute;  content:"";  width:100%;  height:100%;  background:transparent;  transition:all 0.4s ease-in-out;  backdrop-filter:blur(30px);  left:0;  bottom:0;  opacity:0;  transition:all 0.4s ease 0s; } .project-box-five .serial {  position:absolute;  top:50px;  left:40px;  font-size:26px;  line-height:38px;  color:var(--white-color);  font-weight:500; } .project-box-five .project-info {  position:absolute;  padding:0 40px;  left:0;  bottom:50px;  transition:all 0.4s ease 0s; } @media (max-width:1280px) {  .project-box-five .project-info {   padding:0 20px;  } } .project-box-five .project-info .project-badge {  margin-bottom:10px; } .project-box-five .project-info .project-badge a {  display:inline-block;  font-size:12px;  color:var(--white-color);  font-weight:500;  height:30px;  line-height:30px;  padding:0 18px;  border-radius:15px;  background-color:var(--bs-bg-color10);  border:1px solid var(--bs-border-color9);  margin-right:5px;  position:relative;  z-index:1; } .project-box-five .project-info .title {  font-size:32px;  color:var(--white-color);  font-weight:600;  margin-bottom:10px; } @media (max-width:1280px) {  .project-box-five .project-info .title {   font-size:25px;  } } .project-box-five .project-info .title a {  color:var(--white-color); } .project-box-five .project-info .title a:hover {  color:var(--theme-color); } @media (min-width:992px) and (max-width:1024px) {  .project-box-five .project-info .title {   font-size:20px;  } } .project-box-five .project-info .description {  --dur:0.6s;  --dur_half:calc(var(--dur) * 0.5);  --max-height:250px;  position:relative;  z-index:2;  overflow:hidden;  opacity:0;  max-height:0;  transition:all var(--dur), opacity var(--dur_half); } .project-box-five .project-info .text {  font-size:16px;  line-height:26px;  color:var(--bs-text-color2);  font-weight:400;  margin-bottom:32px; } @media (min-width:992px) and (max-width:1024px) {  .project-box-five .project-info .text {   font-size:14px;  } } .project-box-five .project-info .project-btn {  padding:0;  background:transparent;  overflow:hidden;  max-width:45px;  gap:0;  display:flex;  align-items:center; } .project-box-five .project-info .project-btn .link-text {  color:var(--white-color);  opacity:0;  visibility:hidden;  transition:all 300ms ease;  position:relative;  display:block;  height:26px;  white-space:nowrap;  overflow:hidden;  width:0; } .project-box-five .project-info .project-btn > i {  filter:brightness(0) saturate(100%) invert(91%) sepia(12%) saturate(1224%) hue-rotate(31deg) brightness(104%) contrast(75%); } .project-box-five:hover::before {  opacity:1; } .project-box-five:hover .title {  margin-bottom:15px; } .project-box-five:hover .description {  opacity:1;  max-height:var(--max-height);  transition:all var(--dur), opacity var(--dur_half) var(--dur_half); } .project-box-five:hover .project-btn {  padding:9px 25px;  max-width:158px;  gap:10px;  background:var(--theme-color); } .project-box-five:hover .project-btn .link-text {  animation:typing 1s steps(20) forwards;  visibility:visible; } .project-box-five:hover .project-btn > i {  filter:brightness(0) invert(1); } .project-box-five:hover .project-btn > i.icon-arrow-up-right {  width:10px !important;  height:10px !important; } .project-cta {  position:relative;  top:-60px; } .project-cta .overlay {  background:var(--bs-bg-color18);  z-index:-1; } .project-cta .social-proof {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  gap:20px; } @media (max-width:991px) {  .project-cta .social-proof {   justify-content:start;  } } @media (max-width:575px) {  .project-cta .social-proof {   gap:15px;   flex-direction:column;   align-items:flex-start;   margin-bottom:15px;   margin-bottom:0;  } } .project-cta .social-proof .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:50px;  height:50px;  border-radius:50%;  background-color:var(--dark-color);  font-size:18px;  color:var(--white-color);  flex-shrink:0; } .project-cta .social-proof .text {  font-size:28px;  line-height:36px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0; } @media (min-width:992px) and (max-width:1024px) {  .project-cta .social-proof .text br {   display:none;  } }  .project-sidebar {  position:sticky;  top:100px;  max-width:408px;  } @media (max-width:991px) {  .project-sidebar {   max-width:100%;  } } .project-sidebar .widget-box.project-details-box {  background-color:var(--theme-color3);  padding:0;  border-radius:10px; } .project-sidebar .widget-box.project-details-box .title {  font-size:22px;  color:var(--white-color);  font-weight:500;  text-align:center;  background-color:var(--dark-color);  padding:25px 0;  border-radius:10px 10px 0 0;  margin-bottom:0; } .project-sidebar .widget-box.project-details-box .content {  padding:10px 40px 22px;  } @media (min-width:992px) and (max-width:1024px) {  .project-sidebar .widget-box.project-details-box .content {   padding:10px 20px 22px;  } } @media (max-width:375px) {  .project-sidebar .widget-box.project-details-box .content {   padding:10px 20px 22px;  } } .project-sidebar .widget-box.project-details-box .content ul li {  font-size:15px;  color:var(--gray-color);  font-weight:400;  padding:13px 0;  border-bottom:1px dashed var(--dark-color); } .project-sidebar .widget-box.project-details-box .content ul li:last-child {  border-bottom:none; } .project-sidebar .widget-box.project-details-box .content ul li strong {  color:var(--dark-color); } .project-sidebar .widget-box.project-details-box .content ul li a {  color:var(--dark-color); } .project-sidebar .widget-box.project-details-box .content ul li a:hover {  text-decoration:underline; } .project-sidebar .widget-box.consulting-box {  background:url(/wp-content/themes/bentol/assets/images/project/consult01.jpg) center/cover;  padding:60px 40px;  border-radius:10px;  position:relative;  z-index:1;  overflow:hidden;  } @media (min-width:992px) and (max-width:1024px) {  .project-sidebar .widget-box.consulting-box {   padding:60px 20px;  } } @media (max-width:375px) {  .project-sidebar .widget-box.consulting-box {   padding:60px 20px;  } } .project-sidebar .widget-box.consulting-box::before {  position:absolute;  content:"";  width:100%;  height:100%;  background:var(--bs-bg-color8);  transition:all 0.4s ease-in-out;  left:0;  top:0;  z-index:-1; } .project-sidebar .widget-box.consulting-box .inner-box .title {  font-size:24px;  color:var(--white-color);  font-weight:500;  margin-bottom:7px; } .project-sidebar .widget-box.consulting-box .inner-box .text {  font-size:16px;  color:var(--gray-color2);  font-weight:400;  margin-bottom:0; } @media (min-width:992px) and (max-width:1024px) {  .project-sidebar .widget-box.consulting-box .inner-box .text {   font-size:15px;  } } .project-sidebar .widget-box.consulting-box .inner-box .border {  border-color:var(--bs-border-color11) !important; } .project-sidebar .widget-box.consulting-box .inner-box .contact-info .contact-item {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:flex-start;  gap:20px;  margin-bottom:20px; } .project-sidebar .widget-box.consulting-box .inner-box .contact-info .contact-item:last-child {  margin-bottom:0; } .project-sidebar .widget-box.consulting-box .inner-box .contact-info .contact-item .icon {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  width:50px;  height:50px;  border-radius:50%;  background-color:var(--bs-border-color);  font-size:20px;  color:var(--theme-color2); } .project-sidebar .widget-box.consulting-box .inner-box .contact-info .contact-item .icon svg {  width:20px;  fill:var(--theme-color2); } .project-sidebar .widget-box.consulting-box .inner-box .contact-info .contact-item .icon i {  fill:var(--theme-color2); } .project-sidebar .widget-box.consulting-box .inner-box .contact-info .contact-item .content p {  font-size:14px;  color:var(--gray-color2);  font-weight:400;  margin-bottom:0; } .project-sidebar .widget-box.consulting-box .inner-box .contact-info .contact-item .content a {  font-size:16px;  color:var(--white-color);  font-weight:500; } .project-sidebar .widget-box.consulting-box .inner-box .contact-info .contact-item .content a:hover {  color:var(--theme-color2); } .project-sidebar .widget-box.consulting-box .inner-box .theme-btn {  border:1px solid var(--bs-border-color11);  color:var(--white-color);  padding:12px 40px; } .project-sidebar .widget-box.consulting-box .inner-box .theme-btn > i {  color:var(--theme-color2); } .project-sidebar .widget-box.consulting-box .inner-box .theme-btn svg {  fill:var(--white-color); } .project-details__content img {  width:100%; } .project-details__content .title {  font-size:34px;  color:var(--dark-color);  font-weight:600;  margin-bottom:10px; } @media (max-width:1199px) {  .project-details__content .title {   font-size:30px;  } } @media (max-width:767px) {  .project-details__content .title {   font-size:26px;  } } .project-details__content p {  width:95%; } @media (max-width:575px) {  .project-details__content p {   width:100%;  } } @media (max-width:375px) {  .project-details__content p {   text-align:justify;  } } .project-details__content .featured-list li {  font-size:16px;  color:var(--gray-color);  font-weight:400;  padding-left:25px;  position:relative; } .project-details__content .featured-list li + li {  margin-top:13px; } .project-details__content .featured-list li::before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  content:"\f00c";  left:0;  font-size:18px;  color:var(--dark-color);  font-family:var(--icon-font);  font-weight:900; } .project-details__content .featured-list .list-style-2 li::before {  content:"\f058";  color:var(--gray-color); } .project-details__content .details-image-box {  position:relative;  overflow:hidden;  border-radius:10px; } .project-details__content .details-image-box .title {  font-size:22px;  color:var(--dark-color);  font-weight:500;  margin-bottom:0;  background:var(--theme-color3);  padding:25px 30px; } .details__pagination-box {  position:relative;  display:block; } .details__pagination-box .details__pagination {  position:relative;  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  justify-content:space-between; } .details__pagination-box .details__pagination li a {  font-size:22px;  color:var(--dark-color);  font-weight:500;  display:flex;  align-items:center;  gap:20px;  transition:all 0.4s ease 0s;  } @media (max-width:430px) {  .details__pagination-box .details__pagination li a {   font-size:16px;  } } @media (max-width:375px) {  .details__pagination-box .details__pagination li a {   gap:15px;  } } .details__pagination-box .details__pagination li a:hover {  color:var(--theme-color); } .details__pagination-box .details__pagination li a:hover i {  color:var(--white-color);  background-color:var(--dark-color); } .details__pagination-box .details__pagination li a i {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  flex-shrink:0;  font-size:20px;  color:var(--dark-color);  width:54px;  height:54px;  border-radius:50%;  background-color:var(--theme-color3);  transition:all 0.4s ease 0s; } @media (max-width:430px) {  .details__pagination-box .details__pagination li a i {   width:40px;   height:40px;  } }  .branch-section .sec-text {  } @media (max-width:575px) {  .branch-section .sec-text br {   display:none;  } } .branch-single-box {  padding:50px 0 45px;  background-color:var(--theme-color3);  border-radius:10px;  text-align:center;  transition:all 0.4s ease 0s; } .branch-single-box:hover {  background-color:var(--dark-color); } .branch-single-box:hover .image-box::before {  animation:spin2 15s linear infinite;  border-color:var(--theme-color2); } .branch-single-box:hover .branch-content .location-name {  color:var(--white-color); } .branch-single-box:hover .branch-content .location-type {  color:var(--theme-color2); } .branch-single-box:hover .branch-content .divider {  background-color:var(--theme-color2); } .branch-single-box:hover .branch-content .address, .branch-single-box:hover .branch-content .phone a, .branch-single-box:hover .branch-content .email a {  color:var(--gray-color2); } .branch-single-box .image-box {  display:-webkit-box;  display:-ms-flexbox;  display:flex;  -webkit-box-pack:center;  -ms-flex-pack:center;  justify-content:center;  -webkit-box-align:center;  -ms-flex-align:center;  align-items:center;  position:relative;  z-index:1;  width:230px;  height:230px;  margin:0 auto 30px; } .branch-single-box .image-box::before {  position:absolute;  content:"";  width:100%;  height:100%;  background:none;  transition:all 0.4s ease-in-out;  z-index:-1;  left:0;  top:0;  border-radius:50%;  border:2px dashed var(--dark-color);  transition:all 0.4s ease 0s; } .branch-single-box .image-box .image img {  width:200px;  height:200px;  border-radius:50%;  object-fit:cover; } .branch-single-box .branch-content .location-name {  color:var(--dark-color);  margin-bottom:4px;  transition:all 0.4s ease 0s; } .branch-single-box .branch-content .location-type {  font-size:14px;  color:var(--dark-color);  margin-bottom:19px;  transition:all 0.4s ease 0s; } .branch-single-box .branch-content .divider {  width:50px;  height:1px;  background-color:var(--theme-color);  margin:0 auto 18px;  transition:all 0.4s ease 0s; } .branch-single-box .branch-content .address, .branch-single-box .branch-content .phone a, .branch-single-box .branch-content .email a {  font-size:15px;  color:var(--gray-color); } .branch-single-box .branch-content .address, .branch-single-box .branch-content .phone, .branch-single-box .branch-content .email {  margin-bottom:5px; } .branch-single-box .branch-content .phone a:hover, .branch-single-box .branch-content .email a:hover {  color:var(--theme-color2); } .branch-single-box .branch-content .email {  margin-bottom:0; }  .award-section {  } @media (max-width:991px) {  .award-section .award-image.direction-rtl {   direction:ltr;  }  .award-section .award-image.direction-rtl img {   width:100%;  } } .award-section .award-image.direction-rtl.mt--120 {  margin-top:-132px !important; } .award-list {  padding:70px 90px;  background:var(--white-color);  margin:0 -196px 0 -114px; } @media (max-width:1500px) {  .award-list {   margin:0 0 0 -114px;  } } @media (min-width:992px) and (max-width:1024px) {  .award-list {   padding:30px 50px;  } } @media (max-width:991px) {  .award-list {   margin:0;  } } .award-list li {  display:flex;  align-items:center;  justify-content:space-between;  border-bottom:1px solid var(--bs-border-color6);  padding-bottom:30px;  margin-bottom:30px;  transition:all 0.4s ease 0s; } .award-list li:hover {  border-color:var(--dark-color); } .award-list li:hover .award-icon img {  animation:mirror_effect 0.8s forwards ease-in-out 0s; } .award-list li:last-child {  border-bottom:0;  padding-bottom:0;  margin-bottom:0; } .award-list li > .left {  display:flex;  align-items:center;  gap:90px; } @media (min-width:992px) and (max-width:1024px) {  .award-list li > .left {   gap:30px;  } } .award-list li .award-icon {  font-size:70px;  color:var(--gray-color);  flex-shrink:0; } .award-list li .award-icon svg {  width:70px;  height:70px;  fill:var(--gray-color);  transition:all 0.4s ease 0s; } .award-list li .award-text h4 {  font-size:24px;  color:var(--dark-color);  font-weight:500;  margin-bottom:3px; } .award-list li .award-text p {  margin-bottom:0; } .dark-mode .award-list {  background:var(--dark-color3); } .dark-mode .award-list li {  border-bottom:1px solid var(--bs-border-color2); } .dark-mode .award-list li:last-child {  border-bottom:0;  padding-bottom:0;  margin-bottom:0; } .dark-mode .award-list li .left .award-text h4 {  color:var(--white-color); } .dark-mode .award-list li .left .award-text p {  color:var(--gray-color2); } .dark-mode .award-list li .award-year {  color:var(--gray-color2); } .dark-mode .award-list li .award-icon img {  filter:brightness(0) invert(1); } .dark-mode .award-list li:hover {  border-color:var(--theme-color2); } .shop-section .shope-sidebar {  border:1px solid var(--bs-border-color7);  border-radius:10px;  padding:40px 30px 18px; } @media (max-width:991px) {  .shop-section .shope-sidebar {   max-width:400px;  } } @media (max-width:575px) {  .shop-section .shope-sidebar {   max-width:inherit;  } } .shop-section .shope-sidebar .filter-widget {  border-radius:4px;  margin-bottom:30px; } .shop-section .shope-sidebar .filter-widget .filter-title h4 {  font-size:22px;  font-weight:500;  color:var(--dark-color);  border-bottom:1px solid rgba(9, 59, 59, 0.1019607843);  padding:0 0 20px;  margin:0 0 30px;  position:relative; } .shop-section .shope-sidebar .filter-widget .filter-list {  list-style:none;  margin:0;  padding:0; } .shop-section .shope-sidebar .filter-widget .filter-list li {  margin-bottom:20px; } .shop-section .shope-sidebar .filter-widget .filter-list li .filter-option {  position:relative;  display:block;  padding-left:30px;  cursor:pointer;  font-size:15px;  user-select:none;  color:var(--gray-color); } .shop-section .shope-sidebar .filter-widget .filter-list li .filter-option input[type=checkbox] {  position:absolute;  opacity:0;  cursor:pointer;  height:0;  width:0; } .shop-section .shope-sidebar .filter-widget .filter-list li .filter-option input[type=checkbox]:checked ~ .custom-check {  background-color:var(--theme-color); } .shop-section .shope-sidebar .filter-widget .filter-list li .filter-option input[type=checkbox]:checked ~ .custom-check::after {  display:block; } .shop-section .shope-sidebar .filter-widget .filter-list li .filter-option .filter-name {  display:inline-block;  margin-right:5px; } .shop-section .shope-sidebar .filter-widget .filter-list li .filter-option .filter-name .full {  color:var(--orange-color); } .shop-section .shope-sidebar .filter-widget .filter-list li .filter-option .filter-name .empty {  color:rgba(124, 117, 117, 0.3); } .shop-section .shope-sidebar .filter-widget .filter-list li .filter-option .filter-count {  display:inline;  float:right;  font-size:15px;  color:var(--gray-color); } .shop-section .shope-sidebar .filter-widget .filter-list li .filter-option .custom-check {  position:absolute;  top:3px;  left:0;  height:18px;  width:18px;  border-radius:4px;  border:1px solid rgba(6, 36, 98, 0.1);  background-color:rgba(7, 72, 131, 0);  transition:0.3s ease; } .shop-section .shope-sidebar .filter-widget .filter-list li .filter-option .custom-check::after {  content:"";  position:absolute;  display:none;  left:4px;  top:2px;  width:6px;  height:10px;  border:solid var(--white-color);  border-width:0 3px 3px 0;  transform:rotate(45deg); } .shop-section .filter-widget .slider-labels {  margin-top:15px;  display:flex;  align-items:center;  justify-content:space-between; } .shop-section .filter-widget .text-right.caption {  display:inline-block; } .shop-section .filter-widget .caption {  display:inline-block; } .shop-section .filter-widget span#slider-range-value1, .shop-section .filter-widget span#slider-range-value2 {  font-size:16px;  font-weight:400;  color:var(--dark-color); } .shop-section .filter-widget .noUi-target, .shop-section .filter-widget .noUi-target * {  -webkit-touch-callout:none;  -webkit-user-select:none;  -ms-touch-action:none;  touch-action:none;  -ms-user-select:none;  -moz-user-select:none;  user-select:none;  -moz-box-sizing:border-box;  box-sizing:border-box; } .shop-section .filter-widget .noUi-target {  position:relative;  direction:ltr;  border-radius:4px; } .shop-section .filter-widget .noUi-base {  width:100%;  height:100%;  position:relative;  z-index:1;  -webkit-transform:translate3d(0, 0, 0);  transform:translate3d(0, 0, 0); } .shop-section .filter-widget .noUi-origin {  position:absolute;  right:0;  top:0;  left:0;  bottom:0;  border-radius:4px; } .shop-section .filter-widget .noUi-handle {  position:relative;  z-index:1;  cursor:default;  -webkit-box-sizing:content-box !important;  -moz-box-sizing:content-box !important;  box-sizing:content-box !important;  -webkit-transform:translate3d(0, 0, 0);  transform:translate3d(0, 0, 0); } .shop-section .filter-widget .noUi-handle:active {  border:8px solid rgba(59, 179, 216, 0.38);  -webkit-background-clip:padding-box;  background-clip:padding-box;  left:-14px;  top:-14px; } .shop-section .filter-widget .noUi-stacking .shop-section .filter-widget .noUi-handle {  z-index:10; } .shop-section .filter-widget .noUi-state-tap .shop-section .filter-widget .noUi-origin {  -webkit-transition:left 0.3s, top 0.3s;  transition:left 0.3s, top 0.3s; } .shop-section .filter-widget .noUi-state-drag * {  cursor:inherit !important; } .shop-section .filter-widget .noUi-horizontal {  height:8px; } .shop-section .filter-widget .noUi-horizontal .noUi-handle {  width:12px;  height:12px;  border-radius:50%;  left:0px;  top:-4px;  background-color:var(--white-color);  border:2px solid var(--dark-color); } .shop-section .filter-widget .noUi-horizontal .noUi-handle.noUi-handle-lower {  display:none !important; } .shop-section .filter-widget .noUi-background {  background:#ececec; } .shop-section .filter-widget .noUi-connect {  background:var(--dark-color);  -webkit-transition:background 450ms;  transition:background 450ms; } .shop-section .filter-widget .noUi-draggable {  cursor:w-resize; } .shop-section .filter-widget .noUi-vertical .shop-section .filter-widget .noUi-draggable {  cursor:n-resize; } .shop-section .filter-widget [disabled] .noUi-connect {  background:var(--light-color2); } .shop-section .filter-widget [disabled] .noUi-origin, .shop-section .filter-widget [disabled] .noUi-handle {  cursor:not-allowed; } .shop-section .product-wrapper {  display:none; } .shop-section .product-wrapper.current {  display:flex;  flex-wrap:wrap; } .shop-section .product-wrapper.list-view .single-product-card .product-inner {  display:flex;  gap:20px;  } @media (max-width:575px) {  .shop-section .product-wrapper.list-view .single-product-card .product-inner {   flex-direction:column;   align-items:start;  } } .shop-section .product-wrapper.list-view .single-product-card .product-inner .product-image img {  max-width:inherit;  width:280px;  } @media (max-width:575px) {  .shop-section .product-wrapper.list-view .single-product-card .product-inner .product-image img {   width:100%;  } } .shop-section .product-wrapper.list-view .single-product-card .product-inner .product-image .discount-badge, .shop-section .product-wrapper.list-view .single-product-card .product-inner .product-image .new-badge {  } @media (max-width:912px) {  .shop-section .product-wrapper.list-view .single-product-card .product-inner .product-image .discount-badge,  .shop-section .product-wrapper.list-view .single-product-card .product-inner .product-image .new-badge {   top:8px;  } } @media (max-width:767px) {  .shop-section .product-wrapper.list-view .single-product-card .product-inner .product-image .discount-badge,  .shop-section .product-wrapper.list-view .single-product-card .product-inner .product-image .new-badge {   top:22px;  } } @media (min-width:360px) and (max-width:575px) {  .shop-section .product-wrapper.list-view .single-product-card .product-inner .product-image .discount-badge,  .shop-section .product-wrapper.list-view .single-product-card .product-inner .product-image .new-badge {   top:0px;  } } .shop-section .product-wrapper.list-view .single-product-card .product-inner .product-image .product-actions {  } @media (max-width:767px) {  .shop-section .product-wrapper.list-view .single-product-card .product-inner .product-image .product-actions {   top:40px;  } } @media (min-width:360px) and (max-width:575px) {  .shop-section .product-wrapper.list-view .single-product-card .product-inner .product-image .product-actions {   top:20px;  } } .shop-filter-container {  display:flex;  justify-content:space-between;  align-items:center;  background-color:var(--theme-color3);  padding:16px 24px;  border-radius:8px;  font-family:sans-serif;  font-size:15px;  } @media (max-width:575px) {  .shop-filter-container {   justify-content:center;  } } .shop-filter-container .left-text {  font-size:16px;  line-height:26px;  color:var(--gray-color);  font-weight:500;  } @media (max-width:575px) {  .shop-filter-container .left-text {   display:none;  } } .shop-filter-container .left-text .woocommerce-result-count {  margin:0; } .shop-filter-container .right-controls {  display:flex;  align-items:center;  gap:10px; } .shop-filter-container .right-controls .woocommerce-ordering.woocommerce-topbar-ordering {  margin:0; } .shop-filter-container .right-controls .orderby.form-control, .shop-filter-container .right-controls .sort-select {  border:1px solid var(--bs-border-color7);  border-radius:6px;  background-color:transparent;  width:100%;  height:40px;  line-height:40px;  font-size:14px;  cursor:pointer;  outline:none;  background-position:right 10px center;  font-size:15px;  color:var(--dark-color4);  font-weight:500; } @media (max-width:390px) {  .shop-filter-container .right-controls .orderby.form-control,  .shop-filter-container .right-controls .sort-select {   padding-right:50px;  } } .shop-filter-container .right-controls .view-icons {  display:flex;  gap:10px; } .shop-filter-container .right-controls .view-icons .icon-btn {  background:transparent;  border:1px solid var(--bs-border-color7);  height:40px;  width:40px;  border-radius:4px;  cursor:pointer;  transition:all 0.3s ease;  display:flex;  align-items:center;  justify-content:center;  font-size:20px;  color:var(--gray-color2); } .shop-filter-container .right-controls .view-icons .icon-btn.active {  border:1px solid var(--dark-color);  color:var(--dark-color); } .single-product-card {  padding:20px 20px;  border-radius:10px;  border:1px solid var(--bs-border-color7);  transition:all 0.4s ease 0s; } .single-product-card .product-inner {  overflow:hidden;  background:var(--white-color);  transition:0.3s; } .single-product-card .product-inner .product-image {  position:relative;  display:flex;  justify-content:center;  align-items:center;  border-radius:6px; } .single-product-card .product-inner .product-image img {  border-radius:6px; } .single-product-card .product-inner .product-image .discount-badge {  position:absolute;  bottom:0px;  left:0px;  background:var(--orange-color2);  color:var(--dark-color4);  font-size:14px;  padding:0px 20px;  border-radius:0 6px; } .single-product-card .product-inner .product-image .new-badge {  position:absolute;  top:0px;  left:0px;  background:var(--theme-color);  color:var(--white-color);  font-size:14px;  padding:0px 20px;  border-radius:6px 0; } .single-product-card .product-inner .product-image .product-actions {  position:absolute;  right:15px;  top:20px; } .single-product-card .product-inner .product-image .product-actions .product-share .social-link, .single-product-card .product-inner .product-image .product-actions .product-share .love-icon {  display:flex;  flex-direction:column;  gap:8px;  margin-bottom:0; } .single-product-card .product-inner .product-image .product-actions .product-share .social-link li a, .single-product-card .product-inner .product-image .product-actions .product-share .love-icon li a {  background:var(--white-color);  border:none;  border-radius:4px;  width:36px;  height:36px;  display:flex;  justify-content:center;  align-items:center;  cursor:pointer;  box-shadow:0 1px 4px rgba(0, 0, 0, 0.1);  transition:all 0.4s ease 0s; } .single-product-card .product-inner .product-image .product-actions .product-share .social-link li a:hover, .single-product-card .product-inner .product-image .product-actions .product-share .love-icon li a:hover {  background:var(--theme-color);  color:var(--white-color); } .single-product-card .product-inner .product-image .product-actions .product-share .social-link {  position:relative;  visibility:hidden;  height:0;  transition:all 0.4s ease 0s; } .single-product-card .product-inner .product-image .product-actions .product-share .social-link li {  opacity:0;  visibility:hidden;  transition:all 0.4s ease 0s;  transform:translateY(20px); } .single-product-card .product-inner .product-image .product-actions .product-share .love-icon {  display:block;  margin-bottom:8px;  gap:0; } .single-product-card .product-inner .product-info .category {  font-size:15px;  color:var(--gray-color);  font-weight:400;  margin:20px 0 0; } .single-product-card .product-inner .product-info .product-name {  margin:0; } .single-product-card .product-inner .product-info .product-name a {  font-size:20px;  line-height:38px;  color:var(--dark-color4);  font-weight:500; } .single-product-card .product-inner .product-info .rating {  display:flex;  align-items:center;  font-size:16px; } .single-product-card .product-inner .product-info .rating .star {  color:var(--orange-color);  margin-right:5px;  font-size:14px; } .single-product-card .product-inner .product-info .rating .rating-value {  color:var(--gray-color); } .single-product-card .product-inner .product-info .price {  font-size:20px;  line-height:38px;  color:var(--dark-color4);  font-weight:500; } .single-product-card .product-inner .product-info .price del {  opacity:0.502;  font-weight:400;  color:var(--gray-color); } .single-product-card .product-inner .product-info .price ins {  text-decoration:none; } .single-product-card:hover {  transition:all 0.4s ease 0s;  filter:drop-shadow(0px 10px 60px rgba(166, 166, 166, 0.3));  background-color:var(--white-color);  border-color:var(--white-color); } .single-product-card:hover .product-inner .product-image .product-actions .product-share .social-link {  height:100%; } .single-product-card:hover .product-inner .product-image .product-actions .product-share .social-link li {  opacity:1;  overflow:hidden;  visibility:visible;  transform:translateY(0px); } .single-product-card span.yith-wcwl-add-to-wishlist-button__label {  display:none; } .single-product-card .yith-wcwl-add-to-wishlist-button.yith-wcwl-add-to-wishlist-button--anchor svg.yith-wcwl-icon-svg, .single-product-card .yith-wcwl-add-to-wishlist-button.yith-wcwl-add-to-wishlist-button--anchor img {  width:20px; } .single-product-card a.cart-button.added {  margin-bottom:8px; } .single-product-card a.cart-button.added i {  display:none; } .single-product-card a.cart-button.added::after {  margin-left:0 !important; } .single-product-card a.added_to_cart.wc-forward {  font-size:12px;  line-height:12px;  text-align:center; } .list-view {  display:none; } .list-view .single-product-card .product-inner {  display:flex;  gap:20px;  } @media (max-width:575px) {  .list-view .single-product-card .product-inner {   flex-direction:column;   align-items:start;  } } .list-view .single-product-card .product-inner .product-image img {  max-width:inherit;  width:280px;  } @media (max-width:575px) {  .list-view .single-product-card .product-inner .product-image img {   width:100%;  } } .list-view .single-product-card .product-inner .product-image .discount-badge, .list-view .single-product-card .product-inner .product-image .update {  } @media (max-width:912px) {  .list-view .single-product-card .product-inner .product-image .discount-badge,  .list-view .single-product-card .product-inner .product-image .update {   top:8px;  } } @media (max-width:767px) {  .list-view .single-product-card .product-inner .product-image .discount-badge,  .list-view .single-product-card .product-inner .product-image .update {   top:22px;  } } @media (min-width:360px) and (max-width:575px) {  .list-view .single-product-card .product-inner .product-image .discount-badge,  .list-view .single-product-card .product-inner .product-image .update {   top:0px;  } } .list-view .single-product-card .product-inner .product-image .product-actions {  } @media (max-width:767px) {  .list-view .single-product-card .product-inner .product-image .product-actions {   top:40px;  } } @media (min-width:360px) and (max-width:575px) {  .list-view .single-product-card .product-inner .product-image .product-actions {   top:20px;  } } .related.products .yith-add-to-wishlist-button-block {  margin:0; } .related.products .single-product-card .product-inner .product-image .product-actions .product-share .love-icon {  margin-bottom:0; } .related.products .single-product-card .product-info .rating .star {  margin:0; } .product-details-section .modal-content .modal-body .product-image-box {  position:relative;  display:flex;  flex-direction:column;  gap:10px; } .product-details-section .modal-content .modal-body .product-image-box .product-image-slider {  width:100%;  background:var(--light-color5);  border-radius:10px;  overflow:hidden; } .product-details-section .modal-content .modal-body .product-image-box .product-image-slider .swiper-wrapper {  border-radius:10px; } .product-details-section .modal-content .modal-body .product-image-box .product-image-slider .swiper-wrapper .swiper-slide .item {  position:relative;  border-radius:10px; } .product-details-section .modal-content .modal-body .product-image-box .product-image-slider .swiper-wrapper .swiper-slide .item .single-product-badge-left {  position:absolute;  z-index:1;  top:0px;  left:0px; } .product-details-section .modal-content .modal-body .product-image-box .product-image-slider .swiper-wrapper .swiper-slide .item .single-product-badge-left .single-product-badge-new {  background-color:var(--theme-color);  color:var(--white-color);  padding:8px 20px;  font-size:14px;  line-height:1;  border-radius:6px 0 6px;  display:inline-block;  text-transform:uppercase; } .product-details-section .modal-content .modal-body .product-image-box .product-image-slider .swiper-wrapper .swiper-slide .item .single-product-badge-right {  position:absolute;  z-index:1;  top:10px;  right:10px;  display:flex;  flex-direction:column;  gap:4px; } .product-details-section .modal-content .modal-body .product-image-box .product-image-slider .swiper-wrapper .swiper-slide .item .single-product-badge-right .single-product-badge-sale {  background-color:var(--theme-color);  color:var(--white-color);  padding:4px 8px;  font-size:12px;  text-transform:uppercase; } .product-details-section .modal-content .modal-body .product-image-box .product-image-slider .swiper-wrapper .swiper-slide .item .thumbnail-container {  position:relative;  width:100%;  height:100%;  float:left; } .product-details-section .modal-content .modal-body .product-image-box .product-image-slider .swiper-wrapper .swiper-slide .item .thumbnail-container img {  width:100%;  display:block; } .product-details-section .modal-content .modal-body .product-image-box .product-thumb-carousel {  width:100%;  padding-bottom:2px; } .product-details-section .modal-content .modal-body .product-image-box .product-thumb-carousel .swiper-wrapper .swiper-slide {  border:1px solid var(--bs-border-color10);  border-radius:10px;  overflow:hidden; } .product-details-section .modal-content .modal-body .product-image-box .product-thumb-carousel .swiper-wrapper .swiper-slide.swiper-slide-thumb-active {  background:var(--light-color5);  border-color:var(--theme-color); } .product-details-section .modal-content .modal-body .product-image-box .product-thumb-carousel .swiper-wrapper .swiper-slide img {  width:100%;  display:block;  cursor:grab; } .product-details-section .details-right .product-title h2 {  font-size:34px;  line-height:1;  color:var(--dark-color4);  font-weight:600; } .product-details-section .details-right .product-list-icon ul li {  display:inline-block;  font-size:15px;  line-height:1;  color:var(--gray-color);  font-weight:400; } .product-details-section .details-right .product-list-icon ul li i {  color:var(--orange-color); } .product-details-section .details-right .product-list-icon ul li:last-child {  margin-left:10px; } .product-details-section .details-right .product-price h4, .product-details-section .details-right .product-price .price {  font-size:24px;  line-height:38px;  color:var(--dark-color4);  font-weight:600;  margin:15px 0; } .product-details-section .details-right .product-description p {  font-size:15px;  line-height:26px;  color:var(--gray-color);  font-weight:400; } .product-details-section .details-right .product-count-button .title {  font-size:18px;  line-height:38px;  color:var(--dark-color4);  font-weight:500;  margin:0; } .product-details-section .details-right .product-count-button .quantity .title {  font-size:18px;  line-height:38px;  color:var(--dark-color4);  font-weight:500;  margin:0; } .product-details-section .details-right .product-count-button .quantity .cart-plus-minus {  position:relative;  width:140px;  text-align:left;  overflow:hidden;  border-radius:5px; } .product-details-section .details-right .product-count-button .quantity .cart-plus-minus .cart-plus-minus-box {  border:0;  height:54px;  text-align:center;  padding:0;  font-size:16px;  font-weight:600;  color:var(--dark-color4);  background-color:var(--white-color) !important; } .product-details-section .details-right .product-count-button .quantity .cart-plus-minus .ctnbutton {  cursor:pointer;  position:absolute;  text-align:center;  font-size:20px;  font-weight:600;  width:38px;  -webkit-box-align:center;  align-items:center;  vertical-align:middle;  color:var(--white-color);  -webkit-transition:0.5s;  transition:0.5s;  background:var(--dark-color4); } .product-details-section .details-right .product-count-button .quantity .cart-plus-minus .ctnbutton.dec {  top:50%;  left:0%;  transform:translateY(-50%);  display:flex;  justify-content:center;  height:40px;  width:40px;  border-radius:50%; } .product-details-section .details-right .product-count-button .quantity .cart-plus-minus .ctnbutton.inc {  top:50%;  right:0%;  -webkit-transform:translateY(-50%);  transform:translateY(-50%);  display:flex;  justify-content:center;  height:40px;  width:40px;  border-radius:50%; } .product-details-section .details-right .product-count-button .product-color-picker .title {  font-size:18px;  line-height:38px;  color:var(--dark-color4);  font-weight:500;  padding-bottom:16px;  margin:0; } .product-details-section .details-right .product-count-button .product-color-picker .color-options {  display:flex;  align-items:center;  gap:16px; } .product-details-section .details-right .product-count-button .product-color-picker .color-options .color-circle {  position:relative;  width:22px;  height:22px;  border-radius:50%;  display:flex;  align-items:center;  justify-content:center;  cursor:pointer; } .product-details-section .details-right .product-count-button .product-color-picker .color-options .color-circle input[type=radio] {  opacity:0;  position:absolute;  pointer-events:none; } .product-details-section .details-right .product-count-button .product-color-picker .color-options .color-circle input[type=radio]:checked + span::after {  content:"";  position:absolute;  top:-8px;  left:-8px;  width:38px;  height:38px;  border-radius:50%;  border:1px solid var(--bs-border-color10); } .product-details-section .details-right .product-meta {  display:flex;  align-items:start;  flex-direction:column;  gap:10px; } .product-details-section .details-right .product-meta .category {  line-height:1; } .product-details-section .details-right .product-meta .category .category-left {  font-size:16px;  line-height:1;  color:var(--dark-color4);  font-weight:500;  display:inline-block;  width:85px;  padding-right:20px;  position:relative; } .product-details-section .details-right .product-meta .category .category-left::before {  position:absolute;  content:":";  right:3px;  top:-3px;  font-size:20px;  color:var(--bs-bg-color2); } .product-details-section .details-right .product-meta .category a {  font-size:15px;  line-height:26px;  color:var(--gray-color);  transition:all 0.4s ease 0s;  font-weight:400; } .product-details-section .details-right .product-meta .category a:hover {  color:var(--theme-color); } .product-details-section .details-right .product-meta .category a i {  margin-right:18px;  color:var(--dark-color4);  transition:all 0.4s ease 0s; } .product-details-section .details-right .product-meta .category a i:hover {  color:var(--theme-color); } .product-details-section .details-right .product-actions {  max-width:720px;  margin:0 auto; } .product-details-section .details-right .product-actions .perks {  display:flex;  gap:32px; } .product-details-section .details-right .product-actions .perks .perk {  display:flex;  align-items:center;  gap:0.5rem;  margin:0;  font-size:15px;  line-height:26px;  color:var(--dark-color4);  font-weight:500; } .product-details-section .details-right .product-actions .buttons {  display:flex;  gap:16px;  flex-wrap:wrap; } .product-details-section .details-right .product-actions .buttons .btn {  display:flex;  align-items:center;  gap:8px;  padding:12px 40px;  font-size:16px;  line-height:26px;  font-weight:500;  color:var(--white-color);  border-radius:999px;  cursor:pointer;  transition:all 0.3s ease;  position:relative;  z-index:1;  overflow:hidden; } .product-details-section .details-right .product-actions .buttons .btn::before {  position:absolute;  z-index:-1;  content:"";  left:50%;  top:0;  width:0;  height:100%;  background:var(--theme-color);  transition:all 0.4s ease 0s; } .product-details-section .details-right .product-actions .buttons .btn.add-to-cart {  background-color:var(--theme-color);  color:var(--white-color);  border:none; } .product-details-section .details-right .product-actions .buttons .btn.add-to-cart:hover {  background-color:var(--theme-color); } .product-details-section .details-right .product-actions .buttons .btn.buy-now {  background-color:transparent;  color:var(--dark-color4);  border:1px solid var(--bs-border-color7); } .product-details-section .details-right .product-actions .buttons .btn.buy-now:hover {  border-color:var(--bs-border-color7);  color:var(--white-color); } .product-details-section .details-right .product-actions .buttons .btn.buy-now:hover::before {  left:0;  width:100%; } .cart .input-counter {  position:relative;  width:140px;  text-align:left;  overflow:hidden;  border-radius:5px; } .cart .input-counter .input-text {  border:0;  height:54px;  text-align:center;  padding:0;  font-size:16px;  font-weight:600;  color:var(--dark-color4);  background-color:var(--white-color) !important; } .cart .input-counter span {  cursor:pointer;  position:absolute;  text-align:center;  font-size:20px;  font-weight:600;  width:38px;  -webkit-box-align:center;  align-items:center;  vertical-align:middle;  color:var(--white-color);  -webkit-transition:0.5s;  transition:0.5s;  background:var(--dark-color4); } .cart .input-counter span.minus-btn {  top:50%;  left:0%;  transform:translateY(-50%);  display:flex;  justify-content:center;  height:40px;  width:40px;  border-radius:50%; } .cart .input-counter span.plus-btn {  top:50%;  right:0%;  -webkit-transform:translateY(-50%);  transform:translateY(-50%);  display:flex;  justify-content:center;  height:40px;  width:40px;  border-radius:50%; } .cart .input-counter span:hover {  background:var(--theme-color); } .cart .theme-btn {  padding:13px 40px; } .cart .theme-btn:hover i {  animation:wobble_vertical 1s forwards ease-in-out 0s; } .products_details .woocommerce-message a.button {  color:var(--white-color) !important; } .products_details .woocommerce-message a.button:hover {  background:var(--theme-color); } .products_details .single-product-badge-stock {  padding:8px 20px;  font-size:14px;  line-height:1;  border-radius:0 0 6px;  display:inline-block;  text-transform:uppercase; } .products_details .single-product-badge-stock.in-stock {  background-color:var(--success-color);  color:var(--white-color) !important; } .products_details .single-product-badge-stock.out-of-stock {  background-color:var(--error-color);  color:var(--white-color) !important; } .products_details table.woocommerce-product-attributes.shop_attributes {  margin-bottom:0; } .products_details table.woocommerce-product-attributes.shop_attributes th {  font-size:16px;  line-height:26px;  color:var(--dark-color);  font-weight:500;  width:150px; } .products_details table.woocommerce-product-attributes.shop_attributes th, .products_details table.woocommerce-product-attributes.shop_attributes td {  padding:15px;  border:1px solid var(--bs-border-color7) !important; } .products_details table.woocommerce-product-attributes.shop_attributes th p, .products_details table.woocommerce-product-attributes.shop_attributes td p {  margin:0;  padding:0; } .products_details table.woocommerce-product-attributes.shop_attributes tr:nth-child(even) td, .products_details table.woocommerce-product-attributes.shop_attributes tr:nth-child(even) th {  background:rgba(236, 248, 248, 0.5019607843); } .products-details-tabs .tab-content .tabs-item {  margin:0 !important; } .products-details-tabs .tab-content .tabs-item .comment_container p:last-child {  margin-bottom:0 !important; } @media (max-width:430px) {  .products-details-tabs .tabs {   display:flex;   flex-wrap:wrap;   gap:40px;   align-items:center;  } } .products-details-tabs .tabs li {  display:inline-block;  margin-right:50px; } .products-details-tabs .tabs li:last-child {  margin-right:0; } .products-details-tabs .tabs li a {  font-size:18px;  line-height:26px;  color:var(--dark-color4);  font-weight:500;  position:relative; } .products-details-tabs .tabs li a::before {  position:absolute;  content:"";  height:2px;  max-width:110px;  width:0%;  background:transparent;  bottom:-25px;  left:0;  transition:all 0.4s ease 0s; } .products-details-tabs .tabs li.current a::before {  width:100%;  background:var(--theme-color); } .products-details-tabs #comments {  margin:0;  padding:0; } .products-details-tabs .comments .comment-title {  font-size:22px;  line-height:32px;  color:var(--dark-color4);  font-weight:600;  margin:15px 0 30px; } .products-details-tabs .comment-post {  background:var(--theme-color3);  display:flex;  align-items:center;  gap:12px;  padding:30px;  border-radius:10px;  margin-bottom:30px; } .products-details-tabs .comment-post:last-child {  margin-bottom:0; } .products-details-tabs .comment-post .thumb-post {  flex-shrink:1; } .products-details-tabs .comment-post .thumb-post img {  width:36px;  height:36px;  border-radius:50%;  object-fit:cover; } .products-details-tabs .comment-post .content-post .post-title {  font-size:16px;  line-height:26px;  color:var(--dark-color4);  font-weight:500;  margin:0; } .products-details-tabs .comment-post .content-post .post-title span {  font-size:14px;  line-height:26px;  padding-left:30px;  color:var(--gray-color);  font-weight:400;  position:relative; } .products-details-tabs .comment-post .content-post .post-title span::before {  position:absolute;  content:"";  left:6px;  top:9px;  height:1px;  width:15px;  background:var(--dark-color4); } .products-details-tabs .comment-post .content-post p {  font-size:15px;  line-height:26px;  color:var(--gray-color);  font-weight:400;  margin:0; } .products-details-tabs .product-details-form {  background:var(--theme-color3);  padding:40px 30px;  margin-top:10px;  border-radius:10px; } .products-details-tabs .product-details-form .contact-form-box .form-title h2 {  font-size:22px;  line-height:1;  color:var(--dark-color4);  font-weight:600; } .products-details-tabs .product-details-form .contact-form-box .form-description p {  font-size:15px;  line-height:26px;  color:var(--dark-color4);  font-weight:400;  margin-bottom:10px; } .products-details-tabs .product-details-form .contact-form-box .form-description p span {  color:var(--theme-color); } .products-details-tabs .product-details-form .contact-form-box .rating-list p {  font-size:15px;  line-height:26px;  color:var(--dark-color4);  font-weight:500;  margin:0; } .products-details-tabs .product-details-form .contact-form-box .rating-list p span {  color:var(--theme-color); } .products-details-tabs .product-details-form .contact-form-box .rating-list ul li {  display:inline-block;  color:var(--dark-color4);  margin-bottom:20px; } .products-details-tabs .product-details-form .contact-form-box .comment-form-wrapper .comment-form .form-group .form-label span {  color:var(--theme-color); } .products-details-tabs .product-details-form .contact-form-box .comment-form-wrapper .comment-form .form-group input, .products-details-tabs .product-details-form .contact-form-box .comment-form-wrapper .comment-form .form-group textarea {  background:var(--white-color);  resize:none; } .products-details-tabs .product-details-form .contact-form-box .comment-form-wrapper .comment-form .form-submit button {  display:inline-block;  background:var(--dark-color4);  color:var(--white-color) !important;  border-radius:30px;  color:var(--white-color);  padding:12px 30px;  position:relative;  z-index:1;  overflow:hidden; } .products-details-tabs .product-details-form .contact-form-box .comment-form-wrapper .comment-form .form-submit button::before {  position:absolute;  z-index:-1;  content:"";  left:0;  top:50%;  width:100%;  height:0;  background:var(--theme-color);  transition:all 0.4s ease 0s; } .products-details-tabs .product-details-form .contact-form-box .comment-form-wrapper .comment-form .form-submit button:hover::before {  top:0;  height:100%; } .products-details-tabs .form-grid {  display:flex;  align-items:center;  justify-content:space-between;  gap:30px; } .products-details-tabs .form-grid .form-group {  width:100%;  flex:1;  margin-bottom:0; } body.woocommerce .products_details .comment_container {  background:var(--theme-color3);  display:flex;  align-items:center;  gap:12px;  padding:30px;  border-radius:10px; } body.woocommerce .products_details #reviews #comments ol.commentlist li img.avatar {  position:relative;  border:none;  padding:0;  width:36px;  border-radius:50%; } body.woocommerce .products_details #reviews #comments ol.commentlist li .comment-text {  all:unset; } body.woocommerce .products_details .star-rating {  position:absolute;  right:20px;  top:20px;  color:var(--orange-color); } body.woocommerce .products_details #reviews #comments ol.commentlist li .comment-text p.meta {  font-size:16px;  line-height:26px;  color:var(--dark-color4);  font-weight:500;  margin:0; } body.woocommerce .products_details #reviews #comments ol.commentlist li .comment-text p.meta time.woocommerce-review__published-date {  font-size:14px;  line-height:26px;  color:var(--gray-color);  font-weight:400;  position:relative; } body.woocommerce .products_details .description p {  margin:0;  font-size:15px;  line-height:26px;  color:var(--gray-color);  font-weight:400;  margin:0; } body.woocommerce .products_details .comment-form-rating label .required, body.woocommerce .products_details .form-group label .required {  color:var(--error-color); } body.woocommerce .products_details .comment-form-rating p.stars {  display:inline-block; } body.woocommerce .products_details .product-details-form .comment-form-cookies-consent {  display:flex;  align-items:center;  gap:10px;  font-size:16px;  color:var(--dark-color); } body.woocommerce .products_details .product-details-form .comment-form-cookies-consent input[type=checkbox] {  visibility:hidden;  opacity:0;  display:inline-block;  vertical-align:middle;  width:0;  height:0;  display:none;  border-radius:10px; } body.woocommerce .products_details .product-details-form .comment-form-cookies-consent input[type=checkbox]:checked ~ label:before {  content:"\f00c";  color:var(--white-color);  background-color:var(--theme-color);  border-color:var(--theme-color); } body.woocommerce .products_details .product-details-form .comment-form-cookies-consent input[type=checkbox] ~ label {  position:relative;  padding-left:30px;  cursor:pointer;  display:block;  margin:15px 0 0; } body.woocommerce .products_details .product-details-form .comment-form-cookies-consent input[type=checkbox] ~ label:before {  position:absolute;  content:"";  top:50%;  transform:translateY(-50%);  transition:all 0.4s ease 0s;  left:0;  font-family:var(--icon-font);  font-weight:700;  background-color:var(--white-color);  border:1px solid var(--dark-color);  height:18px;  width:18px;  line-height:18px;  text-align:center;  font-size:12px;  border-radius:4px; }  .woocommerce { } .woocommerce div.product div.images .flex-control-thumbs {  margin-left:-5px;  margin-right:-5px; } .woocommerce div.product div.images .flex-control-thumbs li {  padding:10px 5px 0; } .woocommerce div.product .stock {  display:inline-block;  color:var(--dark-color);  font-size:16px; } .woocommerce table.shop_table td {  color:#777777;  font-weight:600; } .woocommerce .form-control:focus {  color:#495057;  background-color:#fff;  border-color:var(--dark-color);  outline:0;  box-sizing:0 !important;  border:none !important;  box-shadow:0 0 0 1px rgba(202, 202, 202, 0.25); } .woocommerce .pagination-area {  margin-top:0; } .woocommerce table.shop_table td {  color:#777777;  font-weight:600; } .woocommerce .widget_shopping_cart .buttons a {  font-weight:500;  border-radius:0; } .woocommerce .form-control:focus {  border:1px solid !important; } .woocommerce table.shop_table {  border:1px solid rgba(0, 0, 0, 0.1);  margin:0 -1px 24px 0;  text-align:left;  width:100%;  border-collapse:separate;  border-radius:5px; } .woocommerce form .form-row-first {  width:50%; } .woocommerce input[type=number] {  appearance:textfield;  -moz-appearance:textfield; } .woocommerce input[type=number]::-webkit-inner-spin-button, .woocommerce input[type=number]::-webkit-outer-spin-button {  -webkit-appearance:none;  margin:0; } .woocommerce .input-counter {  display:inline-block; } .woocommerce .input-counter .quantity .qty {  height:45px;  color:#222222;  outline:0;  display:block;  border:none;  background-color:#f8f8f8;  text-align:center;  font-size:17px;  font-weight:600;  text-align:center; } .woocommerce #respond input#submit {  background-color:var(--dark-color); } .woocommerce #respond input#submit.alt {  background-color:var(--dark-color); } .woocommerce #respond input#submit.alt.disabled {  background-color:var(--dark-color); } .woocommerce #respond input#submit.alt.disabled:hover {  background-color:var(--dark-color); } .woocommerce #respond input#submit.alt:disabled {  background-color:var(--dark-color); } .woocommerce #respond input#submit.alt:disabled:hover {  background-color:var(--dark-color); } .woocommerce #respond input#submit.alt:disabled[disabled] {  background-color:var(--dark-color); } .woocommerce #respond input#submit.alt:disabled[disabled]:hover {  background-color:var(--dark-color); } .woocommerce .widget_price_filter .ui-slider {  margin-right:0;  margin-left:0; } .woocommerce .widget_price_filter .ui-slider .ui-slider-range, .woocommerce .widget_price_filter .ui-slider .ui-slider-handle {  background-color:var(--dark-color);  width:4px;  border-radius:unset;  margin-left:0; } .woocommerce .widget_price_filter .ui-slider-horizontal {  height:6px; } .woocommerce .widget_price_filter .price_slider_wrapper .ui-widget-content {  border-radius:unset;  background-color:#f3ebf1; } .woocommerce a.button, .woocommerce button.button, .woocommerce input.button {  background-color:var(--dark-color); } .woocommerce a.button.alt, .woocommerce button.button.alt, .woocommerce input.button.alt {  background-color:var(--dark-color); } .woocommerce a.button.alt.disabled, .woocommerce button.button.alt.disabled, .woocommerce input.button.alt.disabled {  background-color:var(--dark-color); } .woocommerce a.button.alt.disabled:hover, .woocommerce button.button.alt.disabled:hover, .woocommerce input.button.alt.disabled:hover {  background-color:var(--dark-color); } .woocommerce a.button.alt:disabled, .woocommerce button.button.alt:disabled, .woocommerce input.button.alt:disabled {  background-color:var(--dark-color); } .woocommerce a.button.alt:disabled:hover, .woocommerce button.button.alt:disabled:hover, .woocommerce input.button.alt:disabled:hover {  background-color:var(--dark-color); } .woocommerce a.button.alt:disabled[disabled], .woocommerce button.button.alt:disabled[disabled], .woocommerce input.button.alt:disabled[disabled] {  background-color:var(--dark-color); } .woocommerce a.button.alt:disabled[disabled]:hover, .woocommerce button.button.alt:disabled[disabled]:hover, .woocommerce input.button.alt:disabled[disabled]:hover {  background-color:var(--dark-color); } .woocommerce-info, .woocommerce-message {  box-shadow:0 2px 48px 0 rgba(0, 0, 0, 0.08);  border-left:3px solid var(--dark-color);  border-top:3px solid var(--white-color);  background:var(--white-color);  margin-bottom:50px;  padding:15px 20px; } .woocommerce-error, .woocommerce-info, .woocommerce-message {  padding:1em 2em 1em 3.5em !important; }  .cart-table table {  margin-bottom:0;  border:none !important; } .cart-table table thead tr {  padding-left:0 !important;  padding-right:0 !important; } .cart-table table thead tr th {  color:#0d1028;  border-bottom-width:0px;  vertical-align:middle;  padding:15px !important;  text-transform:uppercase;  border-top:none;  border-left:none;  border-right:none;  font-weight:700;  font-size:14px;  padding-left:0 !important;  padding-right:0 !important; } .cart-table table tbody tr {  padding-left:0 !important;  padding-right:0 !important; } .cart-table table tbody tr td {  vertical-align:middle;  padding:10px 12px !important;  border-color:#eeeeee;  border-left:none;  border:0px solid transparent;  border-right:none;  padding-left:0 !important;  padding-right:0 !important; } .cart-table table tbody tr td.product-thumbnail a {  display:block; } .cart-table table tbody tr td.product-thumbnail a img {  width:115px; } .cart-table table tbody tr td.product-name a {  font-weight:normal;  display:inline-block;  color:var(--dark-color);  text-decoration:none;  font-weight:500; } .cart-table table tbody tr td.product-name span {  font-weight:600; } .cart-table table tbody tr td.product-subtotal .remove {  color:var(--error-color);  float:right;  position:relative;  top:-1px; } .cart-table table tbody tr td.product-quantity .form-control {  background:transparent;  width:80px; } .cart-table table tbody tr td.product-subtotal {  overflow:hidden; } .cart-table table tbody tr td.product-subtotal span {  font-weight:600; } .cart-table table tbody .cart-coupon-cls {  padding-left:0 !important;  padding-right:0 !important; } .cart-table table tbody .cart-coupon-cls .actions {  padding-left:0 !important;  padding-right:0 !important;  padding-top:25px !important; } .cart-table table tbody .cart-coupon-cls .default-btn {  background-color:var(--dark-color);  transition:all ease 0.5s;  padding:14px 20px;  padding-top:10px;  color:var(--white-color);  display:inline-block;  position:relative;  border-radius:0;  -webkit-box-shadow:unset;  box-shadow:unset;  border:0;  font-size:var(--font-size);  font-weight:500; } .cart-table table tbody .cart-coupon-cls .default-btn::before {  background:transparent; } .cart-table table tbody .cart-coupon-cls .default-btn:hover {  background-color:var(--dark-color); } .cart-table table tbody .cart-coupon-cls .default-btn:hover::before {  border-color:var(--dark-color); } .cart-table table .table-bordered td {  border:1px solid #dee2e6; } .cart-table .quantity .input-text {  border:1px solid #eee;  height:40px;  font-size:15px;  padding:5px 10px;  width:100px; } .cart-table .coupon .form-control {  width:300px !important;  padding:5px 15px !important;  height:48px;  margin-right:10px !important;  background-color:transparent; } .cart-table .coupon label {  display:none; } .cart-table a.remove {  font-size:17px; } .cart-table a.remove:hover {  background-color:transparent;  color:var(--error-color) !important; } .cart-table a.remove i {  font-style:inherit;  font-size:15px; } .table-responsive tr td, .table-responsive tr th {  border-color:#eeeeee; } .cart-totals {  background:var(--white-color);  padding:30px;  max-width:500px;  width:100% !important;  border:1px solid #eeeeee;  margin:10px auto 0;  float:right !important; } .cart-totals h3 {  margin-top:-5px;  margin-bottom:25px;  font-size:22px;  font-weight:700; } .cart-totals ul {  padding:0;  margin:0 0 25px;  list-style-type:none; } .cart-totals ul li {  border:1px solid #eeeeee;  padding:10px 15px;  color:#0a0c19;  font-weight:600;  overflow:hidden; } .cart-totals ul li:first-child {  border-bottom:none; } .cart-totals ul li:last-child {  border-top:none; } .cart-totals ul li span {  float:right;  color:#666666;  font-weight:normal; } .cart-totals .wc-proceed-to-checkout {  padding-bottom:0; } .cart-totals .wc-proceed-to-checkout .btn {  color:var(--white-color);  background-color:var(--dark-color);  text-decoration:none; } .cart-totals .wc-proceed-to-checkout .btn:hover {  background-color:var(--dark-color); } .cart-totals .shop_cart_table td, .cart-totals .shop_cart_table th {  padding-left:0;  padding-right:0;  font-size:16px; } .cart-totals .shop_cart_table th {  font-weight:500; } .cart-totals .shop_cart_table td {  text-align:right; } .cart-totals .shop_cart_table .cart-subtotal th, .cart-totals .shop_cart_table .cart-subtotal td {  padding-top:0; } .cart-totals .shop_cart_table .order-total strong {  font-size:20px; }  .woocommerce .woocommerce-MyAccount-navigation {  background:#fafafa;  border:1px solid #eee;  padding:30px; } .woocommerce .woocommerce-MyAccount-navigation ul {  list-style-type:none;  padding:0;  margin:0; } .woocommerce .woocommerce-MyAccount-navigation ul li {  list-style-type:none;  margin-bottom:10px; } .woocommerce .woocommerce-MyAccount-navigation ul li:last-child {  margin-bottom:0; } .woocommerce .woocommerce-MyAccount-navigation ul li a {  background-color:#fff;  display:block;  padding:7px 20px;  color:#333;  text-decoration:none; } .woocommerce .woocommerce-MyAccount-navigation ul li a:hover {  color:#fff;  background-color:var(--dark-color); } .woocommerce .woocommerce-MyAccount-navigation ul .is-active a {  color:#fff;  background-color:var(--dark-color); } .woocommerce .woocommerce-MyAccount-content {  border:1px solid #eee;  padding:30px; } .woocommerce .woocommerce-MyAccount-content .woocommerce-error {  margin-top:0; } .woocommerce .woocommerce-MyAccount-content .woocommerce-address-fields {  margin-top:20px; } .woocommerce .woocommerce-MyAccount-content form label {  font-size:14px;  line-height:1;  margin-bottom:10px;  font-weight:600;  color:#4a6f8a; } .woocommerce .woocommerce-MyAccount-content form p:last-child {  margin-bottom:0; } .woocommerce .woocommerce-MyAccount-content .col-1 {  max-width:48%;  padding:0; } .woocommerce .woocommerce-MyAccount-content .col-2 {  max-width:48%;  padding:0; } .woocommerce .woocommerce-MyAccount-content h3 {  font-size:15px;  margin-top:0;  margin-bottom:10px; } .woocommerce .woocommerce-MyAccount-content .title {  margin-top:0;  font-size:25px;  margin-bottom:0; } .woocommerce .woocommerce-MyAccount-content .addresses .edit {  font-size:14px; } .woocommerce .woocommerce-MyAccount-content .edit-account .input-text {  border:1px solid #eee;  height:45px;  padding:5px 15px;  font-size:14px;  color:#666666; } .woocommerce .woocommerce-MyAccount-content .edit-account .woocommerce-form-row span {  font-size:14px;  display:inline-block;  margin-top:10px; } .woocommerce .woocommerce-MyAccount-content .edit-account fieldset {  margin-top:20px;  color:#000; } .woocommerce .woocommerce-MyAccount-content .edit-account fieldset legend {  font-size:20px;  color:#000; } .woocommerce .woocommerce-MyAccount-content .woocommerce-address-fields .form-row {  margin-bottom:20px;  padding:0; } .woocommerce .woocommerce-MyAccount-content .woocommerce-address-fields .form-row label {  width:100%;  line-height:1;  font-size:14px;  margin-bottom:10px;  color:#000;  font-weight:bold; } .woocommerce .woocommerce-MyAccount-content .woocommerce-address-fields .input-text {  display:block;  width:100%;  border:1px solid #eee;  height:45px;  padding:5px 15px;  font-size:14px;  color:#62618d; } .woocommerce .woocommerce-MyAccount-content .woocommerce-address-fields .woocommerce-input-wrapper {  width:100%; } .woocommerce .woocommerce-MyAccount-content .woocommerce-address-fields .select2-selection--single {  height:45px;  border:1px solid #eee;  border-radius:0;  padding:8px 15px;  font-size:13px; } .woocommerce .woocommerce-MyAccount-content .button {  color:#fff;  font-weight:600;  font-size:15px;  padding:13px 20px;  text-decoration:none; } .woocommerce .woocommerce-MyAccount-content .button:hover {  background-color:#000;  color:#fff; } .woocommerce .woocommerce-MyAccount-content address {  font-style:normal;  font-size:15px;  border:1px solid #eee;  padding:10px 20px;  margin-top:0; } .woocommerce .woocommerce-MyAccount-content fieldset .woocommerce-form-row {  margin-bottom:15px;  display:grid; } .woocommerce .woocommerce-MyAccount-content fieldset legend {  font-size:22px;  font-weight:bold;  margin-bottom:15px; } .woocommerce .woocommerce-MyAccount-content p {  margin-top:12px; } .woocommerce .woocommerce-MyAccount-content .btn-primary {  margin-top:15px; }  .woocommerce .woocommerce-form-register, .woocommerce .woocommerce-form-login {  max-width:500px;  margin:0 auto;  padding:40px;  background-color:var(--white-color);  border-radius:12px;  box-shadow:0 10px 30px rgba(0, 0, 0, 0.08);  transition:all 0.3s ease; } .woocommerce .woocommerce-form-register:hover, .woocommerce .woocommerce-form-login:hover {  box-shadow:0 15px 35px rgba(0, 0, 0, 0.12); } .woocommerce .woocommerce-form-register .woocommerce-form-row, .woocommerce .woocommerce-form-login .woocommerce-form-row {  margin-bottom:25px; } .woocommerce .woocommerce-form-register .woocommerce-form-row label, .woocommerce .woocommerce-form-login .woocommerce-form-row label {  display:block;  margin-bottom:8px;  font-family:var(--title-font);  font-weight:500;  color:var(--dark-color);  font-size:15px; } .woocommerce .woocommerce-form-register .woocommerce-form-row label .required, .woocommerce .woocommerce-form-login .woocommerce-form-row label .required {  color:var(--error-color); } .woocommerce .woocommerce-form-register .woocommerce-form-row .woocommerce-Input, .woocommerce .woocommerce-form-login .woocommerce-form-row .woocommerce-Input {  width:100%;  padding:12px 15px;  border:1px solid var(--bs-border-color6);  border-radius:8px;  background-color:var(--light-color5);  font-family:var(--body-font);  color:var(--dark-color);  transition:all 0.3s ease; } .woocommerce .woocommerce-form-register .woocommerce-form-row .woocommerce-Input:focus, .woocommerce .woocommerce-form-login .woocommerce-form-row .woocommerce-Input:focus {  border-color:var(--theme-color);  background-color:var(--white-color);  box-shadow:0 0 0 3px rgba(var(--theme-color), 0.1);  outline:none; } .woocommerce .woocommerce-form-register .password-input, .woocommerce .woocommerce-form-login .password-input {  position:relative;  display:flex;  align-items:center; } .woocommerce .woocommerce-form-register .password-input .woocommerce-Input, .woocommerce .woocommerce-form-login .password-input .woocommerce-Input {  padding-right:45px; } .woocommerce .woocommerce-form-register .password-input .show-password-input, .woocommerce .woocommerce-form-login .password-input .show-password-input {  position:absolute;  right:15px;  background:none;  border:none;  color:var(--gray-color);  cursor:pointer;  transition:all 0.3s ease; } .woocommerce .woocommerce-form-register .password-input .show-password-input:hover, .woocommerce .woocommerce-form-login .password-input .show-password-input:hover {  color:var(--theme-color); } .woocommerce .woocommerce-form-register .woocommerce-form__label-for-checkbox, .woocommerce .woocommerce-form-login .woocommerce-form__label-for-checkbox {  display:flex;  align-items:center;  margin-bottom:20px;  cursor:pointer; } .woocommerce .woocommerce-form-register .woocommerce-form__label-for-checkbox input[type=checkbox], .woocommerce .woocommerce-form-login .woocommerce-form__label-for-checkbox input[type=checkbox] {  width:18px;  height:18px;  margin-right:10px;  accent-color:var(--theme-color); } .woocommerce .woocommerce-form-register .woocommerce-form__label-for-checkbox span, .woocommerce .woocommerce-form-login .woocommerce-form__label-for-checkbox span {  font-family:var(--body-font);  color:var(--gray-color);  font-size:14px; } .woocommerce .woocommerce-form-register .woocommerce-Button, .woocommerce .woocommerce-form-register .woocommerce-form-login__submit, .woocommerce .woocommerce-form-login .woocommerce-Button, .woocommerce .woocommerce-form-login .woocommerce-form-login__submit {  width:100%;  padding:14px;  background-color:var(--theme-color);  color:var(--white-color);  border:none;  border-radius:8px;  font-family:var(--title-font);  font-weight:600;  font-size:16px;  cursor:pointer;  transition:all 0.3s ease;  text-transform:uppercase;  letter-spacing:0.5px; } .woocommerce .woocommerce-form-register .woocommerce-Button:hover, .woocommerce .woocommerce-form-register .woocommerce-form-login__submit:hover, .woocommerce .woocommerce-form-login .woocommerce-Button:hover, .woocommerce .woocommerce-form-login .woocommerce-form-login__submit:hover {  background-color:var(--dark-color3);  color:var(--white-color) !important;  transform:translateY(-2px); } .woocommerce .woocommerce-form-register .woocommerce-Button:active, .woocommerce .woocommerce-form-register .woocommerce-form-login__submit:active, .woocommerce .woocommerce-form-login .woocommerce-Button:active, .woocommerce .woocommerce-form-login .woocommerce-form-login__submit:active {  transform:translateY(0); } .woocommerce .woocommerce-form-register .woocommerce-Button, .woocommerce .woocommerce-form-login .woocommerce-Button {  background-color:var(--dark-color3) !important; } .woocommerce .woocommerce-form-register .woocommerce-Button:hover, .woocommerce .woocommerce-form-login .woocommerce-Button:hover {  background-color:var(--theme-color) !important;  color:var(--white-color) !important; } .woocommerce .woocommerce-form-register .lost_password, .woocommerce .woocommerce-form-login .lost_password {  text-align:center;  margin-top:20px; } .woocommerce .woocommerce-form-register .lost_password a, .woocommerce .woocommerce-form-login .lost_password a {  color:var(--gray-color);  text-decoration:none;  font-size:14px;  transition:all 0.3s ease; } .woocommerce .woocommerce-form-register .lost_password a:hover, .woocommerce .woocommerce-form-login .lost_password a:hover {  color:var(--theme-color);  text-decoration:underline; } @media (max-width:576px) {  .woocommerce .woocommerce-form-login {   padding:30px 20px;  }  .woocommerce .woocommerce-form-login .woocommerce-form-row {   margin-bottom:20px;  } }  .woocommerce {  } .woocommerce .woocommerce-ResetPassword {  max-width:500px;  margin:2rem auto;  padding:40px;  background-color:var(--white-color);  border-radius:12px;  box-shadow:0 10px 30px rgba(0, 0, 0, 0.08);  transition:all 0.3s ease; } .woocommerce .woocommerce-ResetPassword:hover {  box-shadow:0 15px 35px rgba(0, 0, 0, 0.12); } .woocommerce .woocommerce-ResetPassword > p:first-child {  color:var(--gray-color);  font-family:var(--body-font);  margin-bottom:25px;  line-height:1.6;  font-size:15px;  text-align:center; } .woocommerce .woocommerce-ResetPassword .woocommerce-form-row {  margin-bottom:25px; } .woocommerce .woocommerce-ResetPassword .woocommerce-form-row label {  display:block;  margin-bottom:8px;  font-family:var(--title-font);  font-weight:500;  color:var(--dark-color);  font-size:15px; } .woocommerce .woocommerce-ResetPassword .woocommerce-form-row .woocommerce-Input {  width:100%;  padding:12px 15px;  border:1px solid var(--bs-border-color6);  border-radius:8px;  background-color:var(--light-color5);  font-family:var(--body-font);  color:var(--dark-color);  transition:all 0.3s ease; } .woocommerce .woocommerce-ResetPassword .woocommerce-form-row .woocommerce-Input:focus {  border-color:var(--theme-color);  background-color:var(--white-color);  box-shadow:0 0 0 3px rgba(var(--theme-color), 0.1);  outline:none; } .woocommerce .woocommerce-ResetPassword .woocommerce-Button {  width:100%;  padding:14px;  background-color:var(--theme-color);  color:var(--white-color);  border:none;  border-radius:8px;  font-family:var(--title-font);  font-weight:600;  font-size:16px;  cursor:pointer;  transition:all 0.3s ease;  text-transform:uppercase;  letter-spacing:0.5px;  margin-top:10px; } .woocommerce .woocommerce-ResetPassword .woocommerce-Button:hover {  background-color:var(--dark-color3);  color:var(--white-color);  transform:translateY(-2px); } .woocommerce .woocommerce-ResetPassword .woocommerce-Button:active {  transform:translateY(0); } .woocommerce .woocommerce-ResetPassword .clear {  clear:both; } .woocommerce .woocommerce-ResetPassword .form-row-first {  width:100% !important; } @media (max-width:576px) {  .woocommerce .woocommerce-ResetPassword {   padding:30px 20px;   margin:1rem auto;  }  .woocommerce .woocommerce-ResetPassword > p:first-child {   font-size:14px;  }  .woocommerce .woocommerce-ResetPassword .woocommerce-form-row {   margin-bottom:20px;  } } .woocommerce .acount-register-tabs-container {  margin-bottom:2rem; } .woocommerce .acount-register-tabs {  display:flex;  list-style:none;  padding:0;  margin:0 0 30px;  border-bottom:1px solid #ddd; } .woocommerce .acount-register-tabs .nav-tab {  margin-bottom:-1px; } .woocommerce .acount-register-tabs .nav-tab-link {  padding:10px 20px;  border:1px solid transparent;  border-bottom:none;  color:#555;  text-decoration:none;  transition:all 0.3s ease;  display:block;  cursor:pointer; } .woocommerce .acount-register-tabs .nav-tab-link:hover {  border-color:#eee #eee #ddd;  color:#333; } .woocommerce .acount-register-tabs .nav-tab-link.active {  color:#333;  background-color:#fff;  border-color:#ddd #ddd #fff;  font-weight:600;  border-top:2px solid var(--theme-color); } .woocommerce .acount-register-tabs .tab-content {  padding:20px 0; } .woocommerce .acount-register-tabs .tab-pane {  display:none; } .woocommerce .acount-register-tabs .tab-pane.active {  display:block; }   .px-0 {  padding-right:0 !important;  padding-left:0 !important; } .py-0 {  padding-top:0 !important;  padding-bottom:0 !important; } .pt-0 {  padding-top:0 !important; } .pb-0 {  padding-bottom:0 !important; } .pl-0 {  padding-left:0 !important; } .pr-0 {  padding-right:0 !important; } .p-0 {  padding:0 !important; } .pb-195 {  padding-bottom:195px !important; }  @media (max-width:1199px) {  .lg-pb-165 {   padding-bottom:165px !important;  } } @media (max-width:1199px) {  .md-pb-155 {   padding-bottom:155px !important;  } } @media (max-width:991px) {  .md-px-12 {   padding-right:12px !important;   padding-left:12px !important;  } } .px-5 {  padding-right:5px !important;  padding-left:5px !important; } .py-5 {  padding-top:5px !important;  padding-bottom:5px !important; } .pt-5 {  padding-top:5px !important; } .pb-5 {  padding-bottom:5px !important; } .pl-5 {  padding-left:5px !important; } .pr-5 {  padding-right:5px !important; } .px-10 {  padding-right:10px !important;  padding-left:10px !important; } .py-10 {  padding-top:10px !important;  padding-bottom:10px !important; } .pt-10 {  padding-top:10px !important; } .pb-10 {  padding-bottom:10px !important; } .pl-10 {  padding-left:10px !important; } .pr-10 {  padding-right:10px !important; } .px-15 {  padding-right:15px !important;  padding-left:15px !important; } .py-15 {  padding-top:15px !important;  padding-bottom:15px !important; } .pt-15 {  padding-top:15px !important; } .pb-15 {  padding-bottom:15px !important; } .pl-15 {  padding-left:15px !important; } .pr-15 {  padding-right:15px !important; } .px-20 {  padding-right:20px !important;  padding-left:20px !important; } .py-20 {  padding-top:20px !important;  padding-bottom:20px !important; } .pt-20 {  padding-top:20px !important; } .pb-20 {  padding-bottom:20px !important; } .pl-20 {  padding-left:20px !important; } .pr-20 {  padding-right:20px !important; } .px-25 {  padding-right:25px !important;  padding-left:25px !important; } .py-25 {  padding-top:25px !important;  padding-bottom:25px !important; } .pt-25 {  padding-top:25px !important; } .pb-25 {  padding-bottom:25px !important; } .pl-25 {  padding-left:25px !important; } .pr-25 {  padding-right:25px !important; } .px-30 {  padding-right:30px !important;  padding-left:30px !important; } .py-30 {  padding-top:30px !important;  padding-bottom:30px !important; } .pt-30 {  padding-top:30px !important; } .pb-30 {  padding-bottom:30px !important; } .pl-30 {  padding-left:30px !important; } .pr-30 {  padding-right:30px !important; } .px-35 {  padding-right:35px !important;  padding-left:35px !important; } .py-35 {  padding-top:35px !important;  padding-bottom:35px !important; } .pt-35 {  padding-top:35px !important; } .pb-35 {  padding-bottom:35px !important; } .pl-35 {  padding-left:35px !important; } .pr-35 {  padding-right:35px !important; } .px-40 {  padding-right:40px !important;  padding-left:40px !important; } .py-40 {  padding-top:40px !important;  padding-bottom:40px !important; } .pt-40 {  padding-top:40px !important; } .pb-40 {  padding-bottom:40px !important; } .pl-40 {  padding-left:40px !important; } .pr-40 {  padding-right:40px !important; } .px-45 {  padding-right:45px !important;  padding-left:45px !important; } .py-45 {  padding-top:45px !important;  padding-bottom:45px !important; } .pt-45 {  padding-top:45px !important; } .pb-45 {  padding-bottom:45px !important; } .pl-45 {  padding-left:45px !important; } .pr-45 {  padding-right:45px !important; } .px-50 {  padding-right:50px !important;  padding-left:50px !important; } .py-50 {  padding-top:50px !important;  padding-bottom:50px !important; } .pt-50 {  padding-top:50px !important; } .pb-50 {  padding-bottom:50px !important; } .pl-50 {  padding-left:50px !important; } .pr-50 {  padding-right:50px !important; } .px-55 {  padding-right:55px !important;  padding-left:55px !important; } .py-55 {  padding-top:55px !important;  padding-bottom:55px !important; } .pt-55 {  padding-top:55px !important; } .pb-55 {  padding-bottom:55px !important; } .pl-55 {  padding-left:55px !important; } .pr-55 {  padding-right:55px !important; } .px-60 {  padding-right:60px !important;  padding-left:60px !important; } .py-60 {  padding-top:60px !important;  padding-bottom:60px !important; } .pt-60 {  padding-top:60px !important; } .pb-60 {  padding-bottom:60px !important; } .pl-60 {  padding-left:60px !important; } .pr-60 {  padding-right:60px !important; } .px-65 {  padding-right:65px !important;  padding-left:65px !important; } .py-65 {  padding-top:65px !important;  padding-bottom:65px !important; } .pt-65 {  padding-top:65px !important; } .pb-65 {  padding-bottom:65px !important; } .pl-65 {  padding-left:65px !important; } .pr-65 {  padding-right:65px !important; } .px-70 {  padding-right:70px !important;  padding-left:70px !important; } .py-70 {  padding-top:70px !important;  padding-bottom:70px !important; } .pt-70 {  padding-top:70px !important; } .pb-70 {  padding-bottom:70px !important; } .pl-70 {  padding-left:70px !important; } .pr-70 {  padding-right:70px !important; } .px-75 {  padding-right:75px !important;  padding-left:75px !important; } .py-75 {  padding-top:75px !important;  padding-bottom:75px !important; } .pt-75 {  padding-top:75px !important; } .pb-75 {  padding-bottom:75px !important; } .pl-75 {  padding-left:75px !important; } .pr-75 {  padding-right:75px !important; } .px-80 {  padding-right:80px !important;  padding-left:80px !important; } .py-80 {  padding-top:80px !important;  padding-bottom:80px !important; } .pt-80 {  padding-top:80px !important; } .pb-80 {  padding-bottom:80px !important; } .pl-80 {  padding-left:80px !important; } .pr-80 {  padding-right:80px !important; } .px-85 {  padding-right:85px !important;  padding-left:85px !important; } .py-85 {  padding-top:85px !important;  padding-bottom:85px !important; } .pt-85 {  padding-top:85px !important; } .pb-85 {  padding-bottom:85px !important; } .pl-85 {  padding-left:85px !important; } .pr-85 {  padding-right:85px !important; } .px-90 {  padding-right:90px !important;  padding-left:90px !important; } .py-90 {  padding-top:90px !important;  padding-bottom:90px !important; } .pt-90 {  padding-top:90px !important; } .pb-90 {  padding-bottom:90px !important; } .pl-90 {  padding-left:90px !important; } .pr-90 {  padding-right:90px !important; } .px-95 {  padding-right:95px !important;  padding-left:95px !important; } .py-95 {  padding-top:95px !important;  padding-bottom:95px !important; } .pt-95 {  padding-top:95px !important; } .pb-95 {  padding-bottom:95px !important; } .pl-95 {  padding-left:95px !important; } .pr-95 {  padding-right:95px !important; } .px-100 {  padding-right:100px !important;  padding-left:100px !important; } .py-100 {  padding-top:100px !important;  padding-bottom:100px !important; } .pt-100 {  padding-top:100px !important; } .pb-100 {  padding-bottom:100px !important; } .pl-100 {  padding-left:100px !important; } .pr-100 {  padding-right:100px !important; } .px-105 {  padding-right:105px !important;  padding-left:105px !important; } .py-105 {  padding-top:105px !important;  padding-bottom:105px !important; } .pt-105 {  padding-top:105px !important; } .pb-105 {  padding-bottom:105px !important; } .pl-105 {  padding-left:105px !important; } .pr-105 {  padding-right:105px !important; } .px-110 {  padding-right:110px !important;  padding-left:110px !important; } .py-110 {  padding-top:110px !important;  padding-bottom:110px !important; } .pt-110 {  padding-top:110px !important; } .pb-110 {  padding-bottom:110px !important; } .pl-110 {  padding-left:110px !important; } .pr-110 {  padding-right:110px !important; } .px-115 {  padding-right:115px !important;  padding-left:115px !important; } .py-115 {  padding-top:115px !important;  padding-bottom:115px !important; } .pt-115 {  padding-top:115px !important; } .pb-115 {  padding-bottom:115px !important; } .pl-115 {  padding-left:115px !important; } .pr-115 {  padding-right:115px !important; } .px-120 {  padding-right:120px !important;  padding-left:120px !important; } .py-120 {  padding-top:120px !important;  padding-bottom:120px !important; } .pt-120 {  padding-top:120px !important; } .pb-120 {  padding-bottom:120px !important; } .pl-120 {  padding-left:120px !important; } .pr-120 {  padding-right:120px !important; } .px-125 {  padding-right:125px !important;  padding-left:125px !important; } .py-125 {  padding-top:125px !important;  padding-bottom:125px !important; } .pt-125 {  padding-top:125px !important; } .pb-125 {  padding-bottom:125px !important; } .pl-125 {  padding-left:125px !important; } .pr-125 {  padding-right:125px !important; } .px-130 {  padding-right:130px !important;  padding-left:130px !important; } .py-130 {  padding-top:130px !important;  padding-bottom:130px !important; } .pt-130 {  padding-top:130px !important; } .pb-130 {  padding-bottom:130px !important; } .pl-130 {  padding-left:130px !important; } .pr-130 {  padding-right:130px !important; } .px-135 {  padding-right:135px !important;  padding-left:135px !important; } .py-135 {  padding-top:135px !important;  padding-bottom:135px !important; } .pt-135 {  padding-top:135px !important; } .pb-135 {  padding-bottom:135px !important; } .pl-135 {  padding-left:135px !important; } .pr-135 {  padding-right:135px !important; } .px-140 {  padding-right:140px !important;  padding-left:140px !important; } .py-140 {  padding-top:140px !important;  padding-bottom:140px !important; } .pt-140 {  padding-top:140px !important; } .pb-140 {  padding-bottom:140px !important; } .pl-140 {  padding-left:140px !important; } .pr-140 {  padding-right:140px !important; } .px-145 {  padding-right:145px !important;  padding-left:145px !important; } .py-145 {  padding-top:145px !important;  padding-bottom:145px !important; } .pt-145 {  padding-top:145px !important; } .pb-145 {  padding-bottom:145px !important; } .pl-145 {  padding-left:145px !important; } .pr-145 {  padding-right:145px !important; } .px-150 {  padding-right:150px !important;  padding-left:150px !important; } .py-150 {  padding-top:150px !important;  padding-bottom:150px !important; } .pt-150 {  padding-top:150px !important; } .pb-150 {  padding-bottom:150px !important; } .pl-150 {  padding-left:150px !important; } .pr-150 {  padding-right:150px !important; }  @media (min-width:1922px) {  .hd-px-5 {   padding-right:5px !important;   padding-left:5px !important;  }  .hd-py-5 {   padding-top:5px !important;   padding-bottom:5px !important;  }  .hd-pt-5 {   padding-top:5px !important;  }  .hd-pb-5 {   padding-bottom:5px !important;  }  .hd-pl-5 {   padding-left:5px !important;  }  .hd-pr-5 {   padding-right:5px !important;  }  .hd-px-10 {   padding-right:10px !important;   padding-left:10px !important;  }  .hd-py-10 {   padding-top:10px !important;   padding-bottom:10px !important;  }  .hd-pt-10 {   padding-top:10px !important;  }  .hd-pb-10 {   padding-bottom:10px !important;  }  .hd-pl-10 {   padding-left:10px !important;  }  .hd-pr-10 {   padding-right:10px !important;  }  .hd-px-15 {   padding-right:15px !important;   padding-left:15px !important;  }  .hd-py-15 {   padding-top:15px !important;   padding-bottom:15px !important;  }  .hd-pt-15 {   padding-top:15px !important;  }  .hd-pb-15 {   padding-bottom:15px !important;  }  .hd-pl-15 {   padding-left:15px !important;  }  .hd-pr-15 {   padding-right:15px !important;  }  .hd-px-20 {   padding-right:20px !important;   padding-left:20px !important;  }  .hd-py-20 {   padding-top:20px !important;   padding-bottom:20px !important;  }  .hd-pt-20 {   padding-top:20px !important;  }  .hd-pb-20 {   padding-bottom:20px !important;  }  .hd-pl-20 {   padding-left:20px !important;  }  .hd-pr-20 {   padding-right:20px !important;  }  .hd-px-25 {   padding-right:25px !important;   padding-left:25px !important;  }  .hd-py-25 {   padding-top:25px !important;   padding-bottom:25px !important;  }  .hd-pt-25 {   padding-top:25px !important;  }  .hd-pb-25 {   padding-bottom:25px !important;  }  .hd-pl-25 {   padding-left:25px !important;  }  .hd-pr-25 {   padding-right:25px !important;  }  .hd-px-30 {   padding-right:30px !important;   padding-left:30px !important;  }  .hd-py-30 {   padding-top:30px !important;   padding-bottom:30px !important;  }  .hd-pt-30 {   padding-top:30px !important;  }  .hd-pb-30 {   padding-bottom:30px !important;  }  .hd-pl-30 {   padding-left:30px !important;  }  .hd-pr-30 {   padding-right:30px !important;  }  .hd-px-35 {   padding-right:35px !important;   padding-left:35px !important;  }  .hd-py-35 {   padding-top:35px !important;   padding-bottom:35px !important;  }  .hd-pt-35 {   padding-top:35px !important;  }  .hd-pb-35 {   padding-bottom:35px !important;  }  .hd-pl-35 {   padding-left:35px !important;  }  .hd-pr-35 {   padding-right:35px !important;  }  .hd-px-40 {   padding-right:40px !important;   padding-left:40px !important;  }  .hd-py-40 {   padding-top:40px !important;   padding-bottom:40px !important;  }  .hd-pt-40 {   padding-top:40px !important;  }  .hd-pb-40 {   padding-bottom:40px !important;  }  .hd-pl-40 {   padding-left:40px !important;  }  .hd-pr-40 {   padding-right:40px !important;  }  .hd-px-45 {   padding-right:45px !important;   padding-left:45px !important;  }  .hd-py-45 {   padding-top:45px !important;   padding-bottom:45px !important;  }  .hd-pt-45 {   padding-top:45px !important;  }  .hd-pb-45 {   padding-bottom:45px !important;  }  .hd-pl-45 {   padding-left:45px !important;  }  .hd-pr-45 {   padding-right:45px !important;  }  .hd-px-50 {   padding-right:50px !important;   padding-left:50px !important;  }  .hd-py-50 {   padding-top:50px !important;   padding-bottom:50px !important;  }  .hd-pt-50 {   padding-top:50px !important;  }  .hd-pb-50 {   padding-bottom:50px !important;  }  .hd-pl-50 {   padding-left:50px !important;  }  .hd-pr-50 {   padding-right:50px !important;  }  .hd-px-55 {   padding-right:55px !important;   padding-left:55px !important;  }  .hd-py-55 {   padding-top:55px !important;   padding-bottom:55px !important;  }  .hd-pt-55 {   padding-top:55px !important;  }  .hd-pb-55 {   padding-bottom:55px !important;  }  .hd-pl-55 {   padding-left:55px !important;  }  .hd-pr-55 {   padding-right:55px !important;  }  .hd-px-60 {   padding-right:60px !important;   padding-left:60px !important;  }  .hd-py-60 {   padding-top:60px !important;   padding-bottom:60px !important;  }  .hd-pt-60 {   padding-top:60px !important;  }  .hd-pb-60 {   padding-bottom:60px !important;  }  .hd-pl-60 {   padding-left:60px !important;  }  .hd-pr-60 {   padding-right:60px !important;  }  .hd-px-65 {   padding-right:65px !important;   padding-left:65px !important;  }  .hd-py-65 {   padding-top:65px !important;   padding-bottom:65px !important;  }  .hd-pt-65 {   padding-top:65px !important;  }  .hd-pb-65 {   padding-bottom:65px !important;  }  .hd-pl-65 {   padding-left:65px !important;  }  .hd-pr-65 {   padding-right:65px !important;  }  .hd-px-70 {   padding-right:70px !important;   padding-left:70px !important;  }  .hd-py-70 {   padding-top:70px !important;   padding-bottom:70px !important;  }  .hd-pt-70 {   padding-top:70px !important;  }  .hd-pb-70 {   padding-bottom:70px !important;  }  .hd-pl-70 {   padding-left:70px !important;  }  .hd-pr-70 {   padding-right:70px !important;  }  .hd-px-75 {   padding-right:75px !important;   padding-left:75px !important;  }  .hd-py-75 {   padding-top:75px !important;   padding-bottom:75px !important;  }  .hd-pt-75 {   padding-top:75px !important;  }  .hd-pb-75 {   padding-bottom:75px !important;  }  .hd-pl-75 {   padding-left:75px !important;  }  .hd-pr-75 {   padding-right:75px !important;  }  .hd-px-80 {   padding-right:80px !important;   padding-left:80px !important;  }  .hd-py-80 {   padding-top:80px !important;   padding-bottom:80px !important;  }  .hd-pt-80 {   padding-top:80px !important;  }  .hd-pb-80 {   padding-bottom:80px !important;  }  .hd-pl-80 {   padding-left:80px !important;  }  .hd-pr-80 {   padding-right:80px !important;  }  .hd-px-85 {   padding-right:85px !important;   padding-left:85px !important;  }  .hd-py-85 {   padding-top:85px !important;   padding-bottom:85px !important;  }  .hd-pt-85 {   padding-top:85px !important;  }  .hd-pb-85 {   padding-bottom:85px !important;  }  .hd-pl-85 {   padding-left:85px !important;  }  .hd-pr-85 {   padding-right:85px !important;  }  .hd-px-90 {   padding-right:90px !important;   padding-left:90px !important;  }  .hd-py-90 {   padding-top:90px !important;   padding-bottom:90px !important;  }  .hd-pt-90 {   padding-top:90px !important;  }  .hd-pb-90 {   padding-bottom:90px !important;  }  .hd-pl-90 {   padding-left:90px !important;  }  .hd-pr-90 {   padding-right:90px !important;  }  .hd-px-95 {   padding-right:95px !important;   padding-left:95px !important;  }  .hd-py-95 {   padding-top:95px !important;   padding-bottom:95px !important;  }  .hd-pt-95 {   padding-top:95px !important;  }  .hd-pb-95 {   padding-bottom:95px !important;  }  .hd-pl-95 {   padding-left:95px !important;  }  .hd-pr-95 {   padding-right:95px !important;  }  .hd-px-100 {   padding-right:100px !important;   padding-left:100px !important;  }  .hd-py-100 {   padding-top:100px !important;   padding-bottom:100px !important;  }  .hd-pt-100 {   padding-top:100px !important;  }  .hd-pb-100 {   padding-bottom:100px !important;  }  .hd-pl-100 {   padding-left:100px !important;  }  .hd-pr-100 {   padding-right:100px !important;  }  .hd-px-105 {   padding-right:105px !important;   padding-left:105px !important;  }  .hd-py-105 {   padding-top:105px !important;   padding-bottom:105px !important;  }  .hd-pt-105 {   padding-top:105px !important;  }  .hd-pb-105 {   padding-bottom:105px !important;  }  .hd-pl-105 {   padding-left:105px !important;  }  .hd-pr-105 {   padding-right:105px !important;  }  .hd-px-110 {   padding-right:110px !important;   padding-left:110px !important;  }  .hd-py-110 {   padding-top:110px !important;   padding-bottom:110px !important;  }  .hd-pt-110 {   padding-top:110px !important;  }  .hd-pb-110 {   padding-bottom:110px !important;  }  .hd-pl-110 {   padding-left:110px !important;  }  .hd-pr-110 {   padding-right:110px !important;  }  .hd-px-115 {   padding-right:115px !important;   padding-left:115px !important;  }  .hd-py-115 {   padding-top:115px !important;   padding-bottom:115px !important;  }  .hd-pt-115 {   padding-top:115px !important;  }  .hd-pb-115 {   padding-bottom:115px !important;  }  .hd-pl-115 {   padding-left:115px !important;  }  .hd-pr-115 {   padding-right:115px !important;  }  .hd-px-120 {   padding-right:120px !important;   padding-left:120px !important;  }  .hd-py-120 {   padding-top:120px !important;   padding-bottom:120px !important;  }  .hd-pt-120 {   padding-top:120px !important;  }  .hd-pb-120 {   padding-bottom:120px !important;  }  .hd-pl-120 {   padding-left:120px !important;  }  .hd-pr-120 {   padding-right:120px !important;  }  .hd-px-125 {   padding-right:125px !important;   padding-left:125px !important;  }  .hd-py-125 {   padding-top:125px !important;   padding-bottom:125px !important;  }  .hd-pt-125 {   padding-top:125px !important;  }  .hd-pb-125 {   padding-bottom:125px !important;  }  .hd-pl-125 {   padding-left:125px !important;  }  .hd-pr-125 {   padding-right:125px !important;  }  .hd-px-130 {   padding-right:130px !important;   padding-left:130px !important;  }  .hd-py-130 {   padding-top:130px !important;   padding-bottom:130px !important;  }  .hd-pt-130 {   padding-top:130px !important;  }  .hd-pb-130 {   padding-bottom:130px !important;  }  .hd-pl-130 {   padding-left:130px !important;  }  .hd-pr-130 {   padding-right:130px !important;  }  .hd-px-135 {   padding-right:135px !important;   padding-left:135px !important;  }  .hd-py-135 {   padding-top:135px !important;   padding-bottom:135px !important;  }  .hd-pt-135 {   padding-top:135px !important;  }  .hd-pb-135 {   padding-bottom:135px !important;  }  .hd-pl-135 {   padding-left:135px !important;  }  .hd-pr-135 {   padding-right:135px !important;  }  .hd-px-140 {   padding-right:140px !important;   padding-left:140px !important;  }  .hd-py-140 {   padding-top:140px !important;   padding-bottom:140px !important;  }  .hd-pt-140 {   padding-top:140px !important;  }  .hd-pb-140 {   padding-bottom:140px !important;  }  .hd-pl-140 {   padding-left:140px !important;  }  .hd-pr-140 {   padding-right:140px !important;  }  .hd-px-145 {   padding-right:145px !important;   padding-left:145px !important;  }  .hd-py-145 {   padding-top:145px !important;   padding-bottom:145px !important;  }  .hd-pt-145 {   padding-top:145px !important;  }  .hd-pb-145 {   padding-bottom:145px !important;  }  .hd-pl-145 {   padding-left:145px !important;  }  .hd-pr-145 {   padding-right:145px !important;  }  .hd-px-150 {   padding-right:150px !important;   padding-left:150px !important;  }  .hd-py-150 {   padding-top:150px !important;   padding-bottom:150px !important;  }  .hd-pt-150 {   padding-top:150px !important;  }  .hd-pb-150 {   padding-bottom:150px !important;  }  .hd-pl-150 {   padding-left:150px !important;  }  .hd-pr-150 {   padding-right:150px !important;  }  .hd-px-0 {   padding-right:0 !important;   padding-left:0 !important;  }  .hd-py-0 {   padding-top:0 !important;   padding-bottom:0 !important;  }  .hd-pt-0 {   padding-top:0 !important;  }  .hd-pb-0 {   padding-bottom:0 !important;  }  .hd-pl-0 {   padding-left:0 !important;  }  .hd-pr-0 {   padding-right:0 !important;  } } @media (max-width:1500px) {  .xxl-px-5 {   padding-right:5px !important;   padding-left:5px !important;  }  .xxl-py-5 {   padding-top:5px !important;   padding-bottom:5px !important;  }  .xxl-pt-5 {   padding-top:5px !important;  }  .xxl-pb-5 {   padding-bottom:5px !important;  }  .xxl-pl-5 {   padding-left:5px !important;  }  .xxl-pr-5 {   padding-right:5px !important;  }  .xxl-px-10 {   padding-right:10px !important;   padding-left:10px !important;  }  .xxl-py-10 {   padding-top:10px !important;   padding-bottom:10px !important;  }  .xxl-pt-10 {   padding-top:10px !important;  }  .xxl-pb-10 {   padding-bottom:10px !important;  }  .xxl-pl-10 {   padding-left:10px !important;  }  .xxl-pr-10 {   padding-right:10px !important;  }  .xxl-px-15 {   padding-right:15px !important;   padding-left:15px !important;  }  .xxl-py-15 {   padding-top:15px !important;   padding-bottom:15px !important;  }  .xxl-pt-15 {   padding-top:15px !important;  }  .xxl-pb-15 {   padding-bottom:15px !important;  }  .xxl-pl-15 {   padding-left:15px !important;  }  .xxl-pr-15 {   padding-right:15px !important;  }  .xxl-px-20 {   padding-right:20px !important;   padding-left:20px !important;  }  .xxl-py-20 {   padding-top:20px !important;   padding-bottom:20px !important;  }  .xxl-pt-20 {   padding-top:20px !important;  }  .xxl-pb-20 {   padding-bottom:20px !important;  }  .xxl-pl-20 {   padding-left:20px !important;  }  .xxl-pr-20 {   padding-right:20px !important;  }  .xxl-px-25 {   padding-right:25px !important;   padding-left:25px !important;  }  .xxl-py-25 {   padding-top:25px !important;   padding-bottom:25px !important;  }  .xxl-pt-25 {   padding-top:25px !important;  }  .xxl-pb-25 {   padding-bottom:25px !important;  }  .xxl-pl-25 {   padding-left:25px !important;  }  .xxl-pr-25 {   padding-right:25px !important;  }  .xxl-px-30 {   padding-right:30px !important;   padding-left:30px !important;  }  .xxl-py-30 {   padding-top:30px !important;   padding-bottom:30px !important;  }  .xxl-pt-30 {   padding-top:30px !important;  }  .xxl-pb-30 {   padding-bottom:30px !important;  }  .xxl-pl-30 {   padding-left:30px !important;  }  .xxl-pr-30 {   padding-right:30px !important;  }  .xxl-px-35 {   padding-right:35px !important;   padding-left:35px !important;  }  .xxl-py-35 {   padding-top:35px !important;   padding-bottom:35px !important;  }  .xxl-pt-35 {   padding-top:35px !important;  }  .xxl-pb-35 {   padding-bottom:35px !important;  }  .xxl-pl-35 {   padding-left:35px !important;  }  .xxl-pr-35 {   padding-right:35px !important;  }  .xxl-px-40 {   padding-right:40px !important;   padding-left:40px !important;  }  .xxl-py-40 {   padding-top:40px !important;   padding-bottom:40px !important;  }  .xxl-pt-40 {   padding-top:40px !important;  }  .xxl-pb-40 {   padding-bottom:40px !important;  }  .xxl-pl-40 {   padding-left:40px !important;  }  .xxl-pr-40 {   padding-right:40px !important;  }  .xxl-px-45 {   padding-right:45px !important;   padding-left:45px !important;  }  .xxl-py-45 {   padding-top:45px !important;   padding-bottom:45px !important;  }  .xxl-pt-45 {   padding-top:45px !important;  }  .xxl-pb-45 {   padding-bottom:45px !important;  }  .xxl-pl-45 {   padding-left:45px !important;  }  .xxl-pr-45 {   padding-right:45px !important;  }  .xxl-px-50 {   padding-right:50px !important;   padding-left:50px !important;  }  .xxl-py-50 {   padding-top:50px !important;   padding-bottom:50px !important;  }  .xxl-pt-50 {   padding-top:50px !important;  }  .xxl-pb-50 {   padding-bottom:50px !important;  }  .xxl-pl-50 {   padding-left:50px !important;  }  .xxl-pr-50 {   padding-right:50px !important;  }  .xxl-px-55 {   padding-right:55px !important;   padding-left:55px !important;  }  .xxl-py-55 {   padding-top:55px !important;   padding-bottom:55px !important;  }  .xxl-pt-55 {   padding-top:55px !important;  }  .xxl-pb-55 {   padding-bottom:55px !important;  }  .xxl-pl-55 {   padding-left:55px !important;  }  .xxl-pr-55 {   padding-right:55px !important;  }  .xxl-px-60 {   padding-right:60px !important;   padding-left:60px !important;  }  .xxl-py-60 {   padding-top:60px !important;   padding-bottom:60px !important;  }  .xxl-pt-60 {   padding-top:60px !important;  }  .xxl-pb-60 {   padding-bottom:60px !important;  }  .xxl-pl-60 {   padding-left:60px !important;  }  .xxl-pr-60 {   padding-right:60px !important;  }  .xxl-px-65 {   padding-right:65px !important;   padding-left:65px !important;  }  .xxl-py-65 {   padding-top:65px !important;   padding-bottom:65px !important;  }  .xxl-pt-65 {   padding-top:65px !important;  }  .xxl-pb-65 {   padding-bottom:65px !important;  }  .xxl-pl-65 {   padding-left:65px !important;  }  .xxl-pr-65 {   padding-right:65px !important;  }  .xxl-px-70 {   padding-right:70px !important;   padding-left:70px !important;  }  .xxl-py-70 {   padding-top:70px !important;   padding-bottom:70px !important;  }  .xxl-pt-70 {   padding-top:70px !important;  }  .xxl-pb-70 {   padding-bottom:70px !important;  }  .xxl-pl-70 {   padding-left:70px !important;  }  .xxl-pr-70 {   padding-right:70px !important;  }  .xxl-px-75 {   padding-right:75px !important;   padding-left:75px !important;  }  .xxl-py-75 {   padding-top:75px !important;   padding-bottom:75px !important;  }  .xxl-pt-75 {   padding-top:75px !important;  }  .xxl-pb-75 {   padding-bottom:75px !important;  }  .xxl-pl-75 {   padding-left:75px !important;  }  .xxl-pr-75 {   padding-right:75px !important;  }  .xxl-px-80 {   padding-right:80px !important;   padding-left:80px !important;  }  .xxl-py-80 {   padding-top:80px !important;   padding-bottom:80px !important;  }  .xxl-pt-80 {   padding-top:80px !important;  }  .xxl-pb-80 {   padding-bottom:80px !important;  }  .xxl-pl-80 {   padding-left:80px !important;  }  .xxl-pr-80 {   padding-right:80px !important;  }  .xxl-px-85 {   padding-right:85px !important;   padding-left:85px !important;  }  .xxl-py-85 {   padding-top:85px !important;   padding-bottom:85px !important;  }  .xxl-pt-85 {   padding-top:85px !important;  }  .xxl-pb-85 {   padding-bottom:85px !important;  }  .xxl-pl-85 {   padding-left:85px !important;  }  .xxl-pr-85 {   padding-right:85px !important;  }  .xxl-px-90 {   padding-right:90px !important;   padding-left:90px !important;  }  .xxl-py-90 {   padding-top:90px !important;   padding-bottom:90px !important;  }  .xxl-pt-90 {   padding-top:90px !important;  }  .xxl-pb-90 {   padding-bottom:90px !important;  }  .xxl-pl-90 {   padding-left:90px !important;  }  .xxl-pr-90 {   padding-right:90px !important;  }  .xxl-px-95 {   padding-right:95px !important;   padding-left:95px !important;  }  .xxl-py-95 {   padding-top:95px !important;   padding-bottom:95px !important;  }  .xxl-pt-95 {   padding-top:95px !important;  }  .xxl-pb-95 {   padding-bottom:95px !important;  }  .xxl-pl-95 {   padding-left:95px !important;  }  .xxl-pr-95 {   padding-right:95px !important;  }  .xxl-px-100 {   padding-right:100px !important;   padding-left:100px !important;  }  .xxl-py-100 {   padding-top:100px !important;   padding-bottom:100px !important;  }  .xxl-pt-100 {   padding-top:100px !important;  }  .xxl-pb-100 {   padding-bottom:100px !important;  }  .xxl-pl-100 {   padding-left:100px !important;  }  .xxl-pr-100 {   padding-right:100px !important;  }  .xxl-px-105 {   padding-right:105px !important;   padding-left:105px !important;  }  .xxl-py-105 {   padding-top:105px !important;   padding-bottom:105px !important;  }  .xxl-pt-105 {   padding-top:105px !important;  }  .xxl-pb-105 {   padding-bottom:105px !important;  }  .xxl-pl-105 {   padding-left:105px !important;  }  .xxl-pr-105 {   padding-right:105px !important;  }  .xxl-px-110 {   padding-right:110px !important;   padding-left:110px !important;  }  .xxl-py-110 {   padding-top:110px !important;   padding-bottom:110px !important;  }  .xxl-pt-110 {   padding-top:110px !important;  }  .xxl-pb-110 {   padding-bottom:110px !important;  }  .xxl-pl-110 {   padding-left:110px !important;  }  .xxl-pr-110 {   padding-right:110px !important;  }  .xxl-px-115 {   padding-right:115px !important;   padding-left:115px !important;  }  .xxl-py-115 {   padding-top:115px !important;   padding-bottom:115px !important;  }  .xxl-pt-115 {   padding-top:115px !important;  }  .xxl-pb-115 {   padding-bottom:115px !important;  }  .xxl-pl-115 {   padding-left:115px !important;  }  .xxl-pr-115 {   padding-right:115px !important;  }  .xxl-px-120 {   padding-right:120px !important;   padding-left:120px !important;  }  .xxl-py-120 {   padding-top:120px !important;   padding-bottom:120px !important;  }  .xxl-pt-120 {   padding-top:120px !important;  }  .xxl-pb-120 {   padding-bottom:120px !important;  }  .xxl-pl-120 {   padding-left:120px !important;  }  .xxl-pr-120 {   padding-right:120px !important;  }  .xxl-px-125 {   padding-right:125px !important;   padding-left:125px !important;  }  .xxl-py-125 {   padding-top:125px !important;   padding-bottom:125px !important;  }  .xxl-pt-125 {   padding-top:125px !important;  }  .xxl-pb-125 {   padding-bottom:125px !important;  }  .xxl-pl-125 {   padding-left:125px !important;  }  .xxl-pr-125 {   padding-right:125px !important;  }  .xxl-px-130 {   padding-right:130px !important;   padding-left:130px !important;  }  .xxl-py-130 {   padding-top:130px !important;   padding-bottom:130px !important;  }  .xxl-pt-130 {   padding-top:130px !important;  }  .xxl-pb-130 {   padding-bottom:130px !important;  }  .xxl-pl-130 {   padding-left:130px !important;  }  .xxl-pr-130 {   padding-right:130px !important;  }  .xxl-px-135 {   padding-right:135px !important;   padding-left:135px !important;  }  .xxl-py-135 {   padding-top:135px !important;   padding-bottom:135px !important;  }  .xxl-pt-135 {   padding-top:135px !important;  }  .xxl-pb-135 {   padding-bottom:135px !important;  }  .xxl-pl-135 {   padding-left:135px !important;  }  .xxl-pr-135 {   padding-right:135px !important;  }  .xxl-px-140 {   padding-right:140px !important;   padding-left:140px !important;  }  .xxl-py-140 {   padding-top:140px !important;   padding-bottom:140px !important;  }  .xxl-pt-140 {   padding-top:140px !important;  }  .xxl-pb-140 {   padding-bottom:140px !important;  }  .xxl-pl-140 {   padding-left:140px !important;  }  .xxl-pr-140 {   padding-right:140px !important;  }  .xxl-px-145 {   padding-right:145px !important;   padding-left:145px !important;  }  .xxl-py-145 {   padding-top:145px !important;   padding-bottom:145px !important;  }  .xxl-pt-145 {   padding-top:145px !important;  }  .xxl-pb-145 {   padding-bottom:145px !important;  }  .xxl-pl-145 {   padding-left:145px !important;  }  .xxl-pr-145 {   padding-right:145px !important;  }  .xxl-px-150 {   padding-right:150px !important;   padding-left:150px !important;  }  .xxl-py-150 {   padding-top:150px !important;   padding-bottom:150px !important;  }  .xxl-pt-150 {   padding-top:150px !important;  }  .xxl-pb-150 {   padding-bottom:150px !important;  }  .xxl-pl-150 {   padding-left:150px !important;  }  .xxl-pr-150 {   padding-right:150px !important;  }  .xxl-px-0 {   padding-right:0 !important;   padding-left:0 !important;  }  .xxl-py-0 {   padding-top:0 !important;   padding-bottom:0 !important;  }  .xxl-pt-0 {   padding-top:0 !important;  }  .xxl-pb-0 {   padding-bottom:0 !important;  }  .xxl-pl-0 {   padding-left:0 !important;  }  .xxl-pr-0 {   padding-right:0 !important;  } } @media (max-width:1399px) {  .ml-px-5 {   padding-right:5px !important;   padding-left:5px !important;  }  .ml-py-5 {   padding-top:5px !important;   padding-bottom:5px !important;  }  .ml-pt-5 {   padding-top:5px !important;  }  .ml-pb-5 {   padding-bottom:5px !important;  }  .ml-pl-5 {   padding-left:5px !important;  }  .ml-pr-5 {   padding-right:5px !important;  }  .ml-px-10 {   padding-right:10px !important;   padding-left:10px !important;  }  .ml-py-10 {   padding-top:10px !important;   padding-bottom:10px !important;  }  .ml-pt-10 {   padding-top:10px !important;  }  .ml-pb-10 {   padding-bottom:10px !important;  }  .ml-pl-10 {   padding-left:10px !important;  }  .ml-pr-10 {   padding-right:10px !important;  }  .ml-px-15 {   padding-right:15px !important;   padding-left:15px !important;  }  .ml-py-15 {   padding-top:15px !important;   padding-bottom:15px !important;  }  .ml-pt-15 {   padding-top:15px !important;  }  .ml-pb-15 {   padding-bottom:15px !important;  }  .ml-pl-15 {   padding-left:15px !important;  }  .ml-pr-15 {   padding-right:15px !important;  }  .ml-px-20 {   padding-right:20px !important;   padding-left:20px !important;  }  .ml-py-20 {   padding-top:20px !important;   padding-bottom:20px !important;  }  .ml-pt-20 {   padding-top:20px !important;  }  .ml-pb-20 {   padding-bottom:20px !important;  }  .ml-pl-20 {   padding-left:20px !important;  }  .ml-pr-20 {   padding-right:20px !important;  }  .ml-px-25 {   padding-right:25px !important;   padding-left:25px !important;  }  .ml-py-25 {   padding-top:25px !important;   padding-bottom:25px !important;  }  .ml-pt-25 {   padding-top:25px !important;  }  .ml-pb-25 {   padding-bottom:25px !important;  }  .ml-pl-25 {   padding-left:25px !important;  }  .ml-pr-25 {   padding-right:25px !important;  }  .ml-px-30 {   padding-right:30px !important;   padding-left:30px !important;  }  .ml-py-30 {   padding-top:30px !important;   padding-bottom:30px !important;  }  .ml-pt-30 {   padding-top:30px !important;  }  .ml-pb-30 {   padding-bottom:30px !important;  }  .ml-pl-30 {   padding-left:30px !important;  }  .ml-pr-30 {   padding-right:30px !important;  }  .ml-px-35 {   padding-right:35px !important;   padding-left:35px !important;  }  .ml-py-35 {   padding-top:35px !important;   padding-bottom:35px !important;  }  .ml-pt-35 {   padding-top:35px !important;  }  .ml-pb-35 {   padding-bottom:35px !important;  }  .ml-pl-35 {   padding-left:35px !important;  }  .ml-pr-35 {   padding-right:35px !important;  }  .ml-px-40 {   padding-right:40px !important;   padding-left:40px !important;  }  .ml-py-40 {   padding-top:40px !important;   padding-bottom:40px !important;  }  .ml-pt-40 {   padding-top:40px !important;  }  .ml-pb-40 {   padding-bottom:40px !important;  }  .ml-pl-40 {   padding-left:40px !important;  }  .ml-pr-40 {   padding-right:40px !important;  }  .ml-px-45 {   padding-right:45px !important;   padding-left:45px !important;  }  .ml-py-45 {   padding-top:45px !important;   padding-bottom:45px !important;  }  .ml-pt-45 {   padding-top:45px !important;  }  .ml-pb-45 {   padding-bottom:45px !important;  }  .ml-pl-45 {   padding-left:45px !important;  }  .ml-pr-45 {   padding-right:45px !important;  }  .ml-px-50 {   padding-right:50px !important;   padding-left:50px !important;  }  .ml-py-50 {   padding-top:50px !important;   padding-bottom:50px !important;  }  .ml-pt-50 {   padding-top:50px !important;  }  .ml-pb-50 {   padding-bottom:50px !important;  }  .ml-pl-50 {   padding-left:50px !important;  }  .ml-pr-50 {   padding-right:50px !important;  }  .ml-px-55 {   padding-right:55px !important;   padding-left:55px !important;  }  .ml-py-55 {   padding-top:55px !important;   padding-bottom:55px !important;  }  .ml-pt-55 {   padding-top:55px !important;  }  .ml-pb-55 {   padding-bottom:55px !important;  }  .ml-pl-55 {   padding-left:55px !important;  }  .ml-pr-55 {   padding-right:55px !important;  }  .ml-px-60 {   padding-right:60px !important;   padding-left:60px !important;  }  .ml-py-60 {   padding-top:60px !important;   padding-bottom:60px !important;  }  .ml-pt-60 {   padding-top:60px !important;  }  .ml-pb-60 {   padding-bottom:60px !important;  }  .ml-pl-60 {   padding-left:60px !important;  }  .ml-pr-60 {   padding-right:60px !important;  }  .ml-px-65 {   padding-right:65px !important;   padding-left:65px !important;  }  .ml-py-65 {   padding-top:65px !important;   padding-bottom:65px !important;  }  .ml-pt-65 {   padding-top:65px !important;  }  .ml-pb-65 {   padding-bottom:65px !important;  }  .ml-pl-65 {   padding-left:65px !important;  }  .ml-pr-65 {   padding-right:65px !important;  }  .ml-px-70 {   padding-right:70px !important;   padding-left:70px !important;  }  .ml-py-70 {   padding-top:70px !important;   padding-bottom:70px !important;  }  .ml-pt-70 {   padding-top:70px !important;  }  .ml-pb-70 {   padding-bottom:70px !important;  }  .ml-pl-70 {   padding-left:70px !important;  }  .ml-pr-70 {   padding-right:70px !important;  }  .ml-px-75 {   padding-right:75px !important;   padding-left:75px !important;  }  .ml-py-75 {   padding-top:75px !important;   padding-bottom:75px !important;  }  .ml-pt-75 {   padding-top:75px !important;  }  .ml-pb-75 {   padding-bottom:75px !important;  }  .ml-pl-75 {   padding-left:75px !important;  }  .ml-pr-75 {   padding-right:75px !important;  }  .ml-px-80 {   padding-right:80px !important;   padding-left:80px !important;  }  .ml-py-80 {   padding-top:80px !important;   padding-bottom:80px !important;  }  .ml-pt-80 {   padding-top:80px !important;  }  .ml-pb-80 {   padding-bottom:80px !important;  }  .ml-pl-80 {   padding-left:80px !important;  }  .ml-pr-80 {   padding-right:80px !important;  }  .ml-px-85 {   padding-right:85px !important;   padding-left:85px !important;  }  .ml-py-85 {   padding-top:85px !important;   padding-bottom:85px !important;  }  .ml-pt-85 {   padding-top:85px !important;  }  .ml-pb-85 {   padding-bottom:85px !important;  }  .ml-pl-85 {   padding-left:85px !important;  }  .ml-pr-85 {   padding-right:85px !important;  }  .ml-px-90 {   padding-right:90px !important;   padding-left:90px !important;  }  .ml-py-90 {   padding-top:90px !important;   padding-bottom:90px !important;  }  .ml-pt-90 {   padding-top:90px !important;  }  .ml-pb-90 {   padding-bottom:90px !important;  }  .ml-pl-90 {   padding-left:90px !important;  }  .ml-pr-90 {   padding-right:90px !important;  }  .ml-px-95 {   padding-right:95px !important;   padding-left:95px !important;  }  .ml-py-95 {   padding-top:95px !important;   padding-bottom:95px !important;  }  .ml-pt-95 {   padding-top:95px !important;  }  .ml-pb-95 {   padding-bottom:95px !important;  }  .ml-pl-95 {   padding-left:95px !important;  }  .ml-pr-95 {   padding-right:95px !important;  }  .ml-px-100 {   padding-right:100px !important;   padding-left:100px !important;  }  .ml-py-100 {   padding-top:100px !important;   padding-bottom:100px !important;  }  .ml-pt-100 {   padding-top:100px !important;  }  .ml-pb-100 {   padding-bottom:100px !important;  }  .ml-pl-100 {   padding-left:100px !important;  }  .ml-pr-100 {   padding-right:100px !important;  }  .ml-px-105 {   padding-right:105px !important;   padding-left:105px !important;  }  .ml-py-105 {   padding-top:105px !important;   padding-bottom:105px !important;  }  .ml-pt-105 {   padding-top:105px !important;  }  .ml-pb-105 {   padding-bottom:105px !important;  }  .ml-pl-105 {   padding-left:105px !important;  }  .ml-pr-105 {   padding-right:105px !important;  }  .ml-px-110 {   padding-right:110px !important;   padding-left:110px !important;  }  .ml-py-110 {   padding-top:110px !important;   padding-bottom:110px !important;  }  .ml-pt-110 {   padding-top:110px !important;  }  .ml-pb-110 {   padding-bottom:110px !important;  }  .ml-pl-110 {   padding-left:110px !important;  }  .ml-pr-110 {   padding-right:110px !important;  }  .ml-px-115 {   padding-right:115px !important;   padding-left:115px !important;  }  .ml-py-115 {   padding-top:115px !important;   padding-bottom:115px !important;  }  .ml-pt-115 {   padding-top:115px !important;  }  .ml-pb-115 {   padding-bottom:115px !important;  }  .ml-pl-115 {   padding-left:115px !important;  }  .ml-pr-115 {   padding-right:115px !important;  }  .ml-px-120 {   padding-right:120px !important;   padding-left:120px !important;  }  .ml-py-120 {   padding-top:120px !important;   padding-bottom:120px !important;  }  .ml-pt-120 {   padding-top:120px !important;  }  .ml-pb-120 {   padding-bottom:120px !important;  }  .ml-pl-120 {   padding-left:120px !important;  }  .ml-pr-120 {   padding-right:120px !important;  }  .ml-px-125 {   padding-right:125px !important;   padding-left:125px !important;  }  .ml-py-125 {   padding-top:125px !important;   padding-bottom:125px !important;  }  .ml-pt-125 {   padding-top:125px !important;  }  .ml-pb-125 {   padding-bottom:125px !important;  }  .ml-pl-125 {   padding-left:125px !important;  }  .ml-pr-125 {   padding-right:125px !important;  }  .ml-px-130 {   padding-right:130px !important;   padding-left:130px !important;  }  .ml-py-130 {   padding-top:130px !important;   padding-bottom:130px !important;  }  .ml-pt-130 {   padding-top:130px !important;  }  .ml-pb-130 {   padding-bottom:130px !important;  }  .ml-pl-130 {   padding-left:130px !important;  }  .ml-pr-130 {   padding-right:130px !important;  }  .ml-px-135 {   padding-right:135px !important;   padding-left:135px !important;  }  .ml-py-135 {   padding-top:135px !important;   padding-bottom:135px !important;  }  .ml-pt-135 {   padding-top:135px !important;  }  .ml-pb-135 {   padding-bottom:135px !important;  }  .ml-pl-135 {   padding-left:135px !important;  }  .ml-pr-135 {   padding-right:135px !important;  }  .ml-px-140 {   padding-right:140px !important;   padding-left:140px !important;  }  .ml-py-140 {   padding-top:140px !important;   padding-bottom:140px !important;  }  .ml-pt-140 {   padding-top:140px !important;  }  .ml-pb-140 {   padding-bottom:140px !important;  }  .ml-pl-140 {   padding-left:140px !important;  }  .ml-pr-140 {   padding-right:140px !important;  }  .ml-px-145 {   padding-right:145px !important;   padding-left:145px !important;  }  .ml-py-145 {   padding-top:145px !important;   padding-bottom:145px !important;  }  .ml-pt-145 {   padding-top:145px !important;  }  .ml-pb-145 {   padding-bottom:145px !important;  }  .ml-pl-145 {   padding-left:145px !important;  }  .ml-pr-145 {   padding-right:145px !important;  }  .ml-px-150 {   padding-right:150px !important;   padding-left:150px !important;  }  .ml-py-150 {   padding-top:150px !important;   padding-bottom:150px !important;  }  .ml-pt-150 {   padding-top:150px !important;  }  .ml-pb-150 {   padding-bottom:150px !important;  }  .ml-pl-150 {   padding-left:150px !important;  }  .ml-pr-150 {   padding-right:150px !important;  }  .ml-px-0 {   padding-right:0 !important;   padding-left:0 !important;  }  .ml-py-0 {   padding-top:0 !important;   padding-bottom:0 !important;  }  .ml-pt-0 {   padding-top:0 !important;  }  .ml-pb-0 {   padding-bottom:0 !important;  }  .ml-pl-0 {   padding-left:0 !important;  }  .ml-pr-0 {   padding-right:0 !important;  } } @media (max-width:1299px) {  .xl-px-5 {   padding-right:5px !important;   padding-left:5px !important;  }  .xl-py-5 {   padding-top:5px !important;   padding-bottom:5px !important;  }  .xl-pt-5 {   padding-top:5px !important;  }  .xl-pb-5 {   padding-bottom:5px !important;  }  .xl-pl-5 {   padding-left:5px !important;  }  .xl-pr-5 {   padding-right:5px !important;  }  .xl-px-10 {   padding-right:10px !important;   padding-left:10px !important;  }  .xl-py-10 {   padding-top:10px !important;   padding-bottom:10px !important;  }  .xl-pt-10 {   padding-top:10px !important;  }  .xl-pb-10 {   padding-bottom:10px !important;  }  .xl-pl-10 {   padding-left:10px !important;  }  .xl-pr-10 {   padding-right:10px !important;  }  .xl-px-15 {   padding-right:15px !important;   padding-left:15px !important;  }  .xl-py-15 {   padding-top:15px !important;   padding-bottom:15px !important;  }  .xl-pt-15 {   padding-top:15px !important;  }  .xl-pb-15 {   padding-bottom:15px !important;  }  .xl-pl-15 {   padding-left:15px !important;  }  .xl-pr-15 {   padding-right:15px !important;  }  .xl-px-20 {   padding-right:20px !important;   padding-left:20px !important;  }  .xl-py-20 {   padding-top:20px !important;   padding-bottom:20px !important;  }  .xl-pt-20 {   padding-top:20px !important;  }  .xl-pb-20 {   padding-bottom:20px !important;  }  .xl-pl-20 {   padding-left:20px !important;  }  .xl-pr-20 {   padding-right:20px !important;  }  .xl-px-25 {   padding-right:25px !important;   padding-left:25px !important;  }  .xl-py-25 {   padding-top:25px !important;   padding-bottom:25px !important;  }  .xl-pt-25 {   padding-top:25px !important;  }  .xl-pb-25 {   padding-bottom:25px !important;  }  .xl-pl-25 {   padding-left:25px !important;  }  .xl-pr-25 {   padding-right:25px !important;  }  .xl-px-30 {   padding-right:30px !important;   padding-left:30px !important;  }  .xl-py-30 {   padding-top:30px !important;   padding-bottom:30px !important;  }  .xl-pt-30 {   padding-top:30px !important;  }  .xl-pb-30 {   padding-bottom:30px !important;  }  .xl-pl-30 {   padding-left:30px !important;  }  .xl-pr-30 {   padding-right:30px !important;  }  .xl-px-35 {   padding-right:35px !important;   padding-left:35px !important;  }  .xl-py-35 {   padding-top:35px !important;   padding-bottom:35px !important;  }  .xl-pt-35 {   padding-top:35px !important;  }  .xl-pb-35 {   padding-bottom:35px !important;  }  .xl-pl-35 {   padding-left:35px !important;  }  .xl-pr-35 {   padding-right:35px !important;  }  .xl-px-40 {   padding-right:40px !important;   padding-left:40px !important;  }  .xl-py-40 {   padding-top:40px !important;   padding-bottom:40px !important;  }  .xl-pt-40 {   padding-top:40px !important;  }  .xl-pb-40 {   padding-bottom:40px !important;  }  .xl-pl-40 {   padding-left:40px !important;  }  .xl-pr-40 {   padding-right:40px !important;  }  .xl-px-45 {   padding-right:45px !important;   padding-left:45px !important;  }  .xl-py-45 {   padding-top:45px !important;   padding-bottom:45px !important;  }  .xl-pt-45 {   padding-top:45px !important;  }  .xl-pb-45 {   padding-bottom:45px !important;  }  .xl-pl-45 {   padding-left:45px !important;  }  .xl-pr-45 {   padding-right:45px !important;  }  .xl-px-50 {   padding-right:50px !important;   padding-left:50px !important;  }  .xl-py-50 {   padding-top:50px !important;   padding-bottom:50px !important;  }  .xl-pt-50 {   padding-top:50px !important;  }  .xl-pb-50 {   padding-bottom:50px !important;  }  .xl-pl-50 {   padding-left:50px !important;  }  .xl-pr-50 {   padding-right:50px !important;  }  .xl-px-55 {   padding-right:55px !important;   padding-left:55px !important;  }  .xl-py-55 {   padding-top:55px !important;   padding-bottom:55px !important;  }  .xl-pt-55 {   padding-top:55px !important;  }  .xl-pb-55 {   padding-bottom:55px !important;  }  .xl-pl-55 {   padding-left:55px !important;  }  .xl-pr-55 {   padding-right:55px !important;  }  .xl-px-60 {   padding-right:60px !important;   padding-left:60px !important;  }  .xl-py-60 {   padding-top:60px !important;   padding-bottom:60px !important;  }  .xl-pt-60 {   padding-top:60px !important;  }  .xl-pb-60 {   padding-bottom:60px !important;  }  .xl-pl-60 {   padding-left:60px !important;  }  .xl-pr-60 {   padding-right:60px !important;  }  .xl-px-65 {   padding-right:65px !important;   padding-left:65px !important;  }  .xl-py-65 {   padding-top:65px !important;   padding-bottom:65px !important;  }  .xl-pt-65 {   padding-top:65px !important;  }  .xl-pb-65 {   padding-bottom:65px !important;  }  .xl-pl-65 {   padding-left:65px !important;  }  .xl-pr-65 {   padding-right:65px !important;  }  .xl-px-70 {   padding-right:70px !important;   padding-left:70px !important;  }  .xl-py-70 {   padding-top:70px !important;   padding-bottom:70px !important;  }  .xl-pt-70 {   padding-top:70px !important;  }  .xl-pb-70 {   padding-bottom:70px !important;  }  .xl-pl-70 {   padding-left:70px !important;  }  .xl-pr-70 {   padding-right:70px !important;  }  .xl-px-75 {   padding-right:75px !important;   padding-left:75px !important;  }  .xl-py-75 {   padding-top:75px !important;   padding-bottom:75px !important;  }  .xl-pt-75 {   padding-top:75px !important;  }  .xl-pb-75 {   padding-bottom:75px !important;  }  .xl-pl-75 {   padding-left:75px !important;  }  .xl-pr-75 {   padding-right:75px !important;  }  .xl-px-80 {   padding-right:80px !important;   padding-left:80px !important;  }  .xl-py-80 {   padding-top:80px !important;   padding-bottom:80px !important;  }  .xl-pt-80 {   padding-top:80px !important;  }  .xl-pb-80 {   padding-bottom:80px !important;  }  .xl-pl-80 {   padding-left:80px !important;  }  .xl-pr-80 {   padding-right:80px !important;  }  .xl-px-85 {   padding-right:85px !important;   padding-left:85px !important;  }  .xl-py-85 {   padding-top:85px !important;   padding-bottom:85px !important;  }  .xl-pt-85 {   padding-top:85px !important;  }  .xl-pb-85 {   padding-bottom:85px !important;  }  .xl-pl-85 {   padding-left:85px !important;  }  .xl-pr-85 {   padding-right:85px !important;  }  .xl-px-90 {   padding-right:90px !important;   padding-left:90px !important;  }  .xl-py-90 {   padding-top:90px !important;   padding-bottom:90px !important;  }  .xl-pt-90 {   padding-top:90px !important;  }  .xl-pb-90 {   padding-bottom:90px !important;  }  .xl-pl-90 {   padding-left:90px !important;  }  .xl-pr-90 {   padding-right:90px !important;  }  .xl-px-95 {   padding-right:95px !important;   padding-left:95px !important;  }  .xl-py-95 {   padding-top:95px !important;   padding-bottom:95px !important;  }  .xl-pt-95 {   padding-top:95px !important;  }  .xl-pb-95 {   padding-bottom:95px !important;  }  .xl-pl-95 {   padding-left:95px !important;  }  .xl-pr-95 {   padding-right:95px !important;  }  .xl-px-100 {   padding-right:100px !important;   padding-left:100px !important;  }  .xl-py-100 {   padding-top:100px !important;   padding-bottom:100px !important;  }  .xl-pt-100 {   padding-top:100px !important;  }  .xl-pb-100 {   padding-bottom:100px !important;  }  .xl-pl-100 {   padding-left:100px !important;  }  .xl-pr-100 {   padding-right:100px !important;  }  .xl-px-105 {   padding-right:105px !important;   padding-left:105px !important;  }  .xl-py-105 {   padding-top:105px !important;   padding-bottom:105px !important;  }  .xl-pt-105 {   padding-top:105px !important;  }  .xl-pb-105 {   padding-bottom:105px !important;  }  .xl-pl-105 {   padding-left:105px !important;  }  .xl-pr-105 {   padding-right:105px !important;  }  .xl-px-110 {   padding-right:110px !important;   padding-left:110px !important;  }  .xl-py-110 {   padding-top:110px !important;   padding-bottom:110px !important;  }  .xl-pt-110 {   padding-top:110px !important;  }  .xl-pb-110 {   padding-bottom:110px !important;  }  .xl-pl-110 {   padding-left:110px !important;  }  .xl-pr-110 {   padding-right:110px !important;  }  .xl-px-115 {   padding-right:115px !important;   padding-left:115px !important;  }  .xl-py-115 {   padding-top:115px !important;   padding-bottom:115px !important;  }  .xl-pt-115 {   padding-top:115px !important;  }  .xl-pb-115 {   padding-bottom:115px !important;  }  .xl-pl-115 {   padding-left:115px !important;  }  .xl-pr-115 {   padding-right:115px !important;  }  .xl-px-120 {   padding-right:120px !important;   padding-left:120px !important;  }  .xl-py-120 {   padding-top:120px !important;   padding-bottom:120px !important;  }  .xl-pt-120 {   padding-top:120px !important;  }  .xl-pb-120 {   padding-bottom:120px !important;  }  .xl-pl-120 {   padding-left:120px !important;  }  .xl-pr-120 {   padding-right:120px !important;  }  .xl-px-125 {   padding-right:125px !important;   padding-left:125px !important;  }  .xl-py-125 {   padding-top:125px !important;   padding-bottom:125px !important;  }  .xl-pt-125 {   padding-top:125px !important;  }  .xl-pb-125 {   padding-bottom:125px !important;  }  .xl-pl-125 {   padding-left:125px !important;  }  .xl-pr-125 {   padding-right:125px !important;  }  .xl-px-130 {   padding-right:130px !important;   padding-left:130px !important;  }  .xl-py-130 {   padding-top:130px !important;   padding-bottom:130px !important;  }  .xl-pt-130 {   padding-top:130px !important;  }  .xl-pb-130 {   padding-bottom:130px !important;  }  .xl-pl-130 {   padding-left:130px !important;  }  .xl-pr-130 {   padding-right:130px !important;  }  .xl-px-135 {   padding-right:135px !important;   padding-left:135px !important;  }  .xl-py-135 {   padding-top:135px !important;   padding-bottom:135px !important;  }  .xl-pt-135 {   padding-top:135px !important;  }  .xl-pb-135 {   padding-bottom:135px !important;  }  .xl-pl-135 {   padding-left:135px !important;  }  .xl-pr-135 {   padding-right:135px !important;  }  .xl-px-140 {   padding-right:140px !important;   padding-left:140px !important;  }  .xl-py-140 {   padding-top:140px !important;   padding-bottom:140px !important;  }  .xl-pt-140 {   padding-top:140px !important;  }  .xl-pb-140 {   padding-bottom:140px !important;  }  .xl-pl-140 {   padding-left:140px !important;  }  .xl-pr-140 {   padding-right:140px !important;  }  .xl-px-145 {   padding-right:145px !important;   padding-left:145px !important;  }  .xl-py-145 {   padding-top:145px !important;   padding-bottom:145px !important;  }  .xl-pt-145 {   padding-top:145px !important;  }  .xl-pb-145 {   padding-bottom:145px !important;  }  .xl-pl-145 {   padding-left:145px !important;  }  .xl-pr-145 {   padding-right:145px !important;  }  .xl-px-150 {   padding-right:150px !important;   padding-left:150px !important;  }  .xl-py-150 {   padding-top:150px !important;   padding-bottom:150px !important;  }  .xl-pt-150 {   padding-top:150px !important;  }  .xl-pb-150 {   padding-bottom:150px !important;  }  .xl-pl-150 {   padding-left:150px !important;  }  .xl-pr-150 {   padding-right:150px !important;  }  .xl-px-0 {   padding-right:0 !important;   padding-left:0 !important;  }  .xl-py-0 {   padding-top:0 !important;   padding-bottom:0 !important;  }  .xl-pt-0 {   padding-top:0 !important;  }  .xl-pb-0 {   padding-bottom:0 !important;  }  .xl-pl-0 {   padding-left:0 !important;  }  .xl-pr-0 {   padding-right:0 !important;  } } @media (max-width:1199px) {  .lg-px-5 {   padding-right:5px !important;   padding-left:5px !important;  }  .lg-py-5 {   padding-top:5px !important;   padding-bottom:5px !important;  }  .lg-pt-5 {   padding-top:5px !important;  }  .lg-pb-5 {   padding-bottom:5px !important;  }  .lg-pl-5 {   padding-left:5px !important;  }  .lg-pr-5 {   padding-right:5px !important;  }  .lg-px-10 {   padding-right:10px !important;   padding-left:10px !important;  }  .lg-py-10 {   padding-top:10px !important;   padding-bottom:10px !important;  }  .lg-pt-10 {   padding-top:10px !important;  }  .lg-pb-10 {   padding-bottom:10px !important;  }  .lg-pl-10 {   padding-left:10px !important;  }  .lg-pr-10 {   padding-right:10px !important;  }  .lg-px-15 {   padding-right:15px !important;   padding-left:15px !important;  }  .lg-py-15 {   padding-top:15px !important;   padding-bottom:15px !important;  }  .lg-pt-15 {   padding-top:15px !important;  }  .lg-pb-15 {   padding-bottom:15px !important;  }  .lg-pl-15 {   padding-left:15px !important;  }  .lg-pr-15 {   padding-right:15px !important;  }  .lg-px-20 {   padding-right:20px !important;   padding-left:20px !important;  }  .lg-py-20 {   padding-top:20px !important;   padding-bottom:20px !important;  }  .lg-pt-20 {   padding-top:20px !important;  }  .lg-pb-20 {   padding-bottom:20px !important;  }  .lg-pl-20 {   padding-left:20px !important;  }  .lg-pr-20 {   padding-right:20px !important;  }  .lg-px-25 {   padding-right:25px !important;   padding-left:25px !important;  }  .lg-py-25 {   padding-top:25px !important;   padding-bottom:25px !important;  }  .lg-pt-25 {   padding-top:25px !important;  }  .lg-pb-25 {   padding-bottom:25px !important;  }  .lg-pl-25 {   padding-left:25px !important;  }  .lg-pr-25 {   padding-right:25px !important;  }  .lg-px-30 {   padding-right:30px !important;   padding-left:30px !important;  }  .lg-py-30 {   padding-top:30px !important;   padding-bottom:30px !important;  }  .lg-pt-30 {   padding-top:30px !important;  }  .lg-pb-30 {   padding-bottom:30px !important;  }  .lg-pl-30 {   padding-left:30px !important;  }  .lg-pr-30 {   padding-right:30px !important;  }  .lg-px-35 {   padding-right:35px !important;   padding-left:35px !important;  }  .lg-py-35 {   padding-top:35px !important;   padding-bottom:35px !important;  }  .lg-pt-35 {   padding-top:35px !important;  }  .lg-pb-35 {   padding-bottom:35px !important;  }  .lg-pl-35 {   padding-left:35px !important;  }  .lg-pr-35 {   padding-right:35px !important;  }  .lg-px-40 {   padding-right:40px !important;   padding-left:40px !important;  }  .lg-py-40 {   padding-top:40px !important;   padding-bottom:40px !important;  }  .lg-pt-40 {   padding-top:40px !important;  }  .lg-pb-40 {   padding-bottom:40px !important;  }  .lg-pl-40 {   padding-left:40px !important;  }  .lg-pr-40 {   padding-right:40px !important;  }  .lg-px-45 {   padding-right:45px !important;   padding-left:45px !important;  }  .lg-py-45 {   padding-top:45px !important;   padding-bottom:45px !important;  }  .lg-pt-45 {   padding-top:45px !important;  }  .lg-pb-45 {   padding-bottom:45px !important;  }  .lg-pl-45 {   padding-left:45px !important;  }  .lg-pr-45 {   padding-right:45px !important;  }  .lg-px-50 {   padding-right:50px !important;   padding-left:50px !important;  }  .lg-py-50 {   padding-top:50px !important;   padding-bottom:50px !important;  }  .lg-pt-50 {   padding-top:50px !important;  }  .lg-pb-50 {   padding-bottom:50px !important;  }  .lg-pl-50 {   padding-left:50px !important;  }  .lg-pr-50 {   padding-right:50px !important;  }  .lg-px-55 {   padding-right:55px !important;   padding-left:55px !important;  }  .lg-py-55 {   padding-top:55px !important;   padding-bottom:55px !important;  }  .lg-pt-55 {   padding-top:55px !important;  }  .lg-pb-55 {   padding-bottom:55px !important;  }  .lg-pl-55 {   padding-left:55px !important;  }  .lg-pr-55 {   padding-right:55px !important;  }  .lg-px-60 {   padding-right:60px !important;   padding-left:60px !important;  }  .lg-py-60 {   padding-top:60px !important;   padding-bottom:60px !important;  }  .lg-pt-60 {   padding-top:60px !important;  }  .lg-pb-60 {   padding-bottom:60px !important;  }  .lg-pl-60 {   padding-left:60px !important;  }  .lg-pr-60 {   padding-right:60px !important;  }  .lg-px-65 {   padding-right:65px !important;   padding-left:65px !important;  }  .lg-py-65 {   padding-top:65px !important;   padding-bottom:65px !important;  }  .lg-pt-65 {   padding-top:65px !important;  }  .lg-pb-65 {   padding-bottom:65px !important;  }  .lg-pl-65 {   padding-left:65px !important;  }  .lg-pr-65 {   padding-right:65px !important;  }  .lg-px-70 {   padding-right:70px !important;   padding-left:70px !important;  }  .lg-py-70 {   padding-top:70px !important;   padding-bottom:70px !important;  }  .lg-pt-70 {   padding-top:70px !important;  }  .lg-pb-70 {   padding-bottom:70px !important;  }  .lg-pl-70 {   padding-left:70px !important;  }  .lg-pr-70 {   padding-right:70px !important;  }  .lg-px-75 {   padding-right:75px !important;   padding-left:75px !important;  }  .lg-py-75 {   padding-top:75px !important;   padding-bottom:75px !important;  }  .lg-pt-75 {   padding-top:75px !important;  }  .lg-pb-75 {   padding-bottom:75px !important;  }  .lg-pl-75 {   padding-left:75px !important;  }  .lg-pr-75 {   padding-right:75px !important;  }  .lg-px-80 {   padding-right:80px !important;   padding-left:80px !important;  }  .lg-py-80 {   padding-top:80px !important;   padding-bottom:80px !important;  }  .lg-pt-80 {   padding-top:80px !important;  }  .lg-pb-80 {   padding-bottom:80px !important;  }  .lg-pl-80 {   padding-left:80px !important;  }  .lg-pr-80 {   padding-right:80px !important;  }  .lg-px-85 {   padding-right:85px !important;   padding-left:85px !important;  }  .lg-py-85 {   padding-top:85px !important;   padding-bottom:85px !important;  }  .lg-pt-85 {   padding-top:85px !important;  }  .lg-pb-85 {   padding-bottom:85px !important;  }  .lg-pl-85 {   padding-left:85px !important;  }  .lg-pr-85 {   padding-right:85px !important;  }  .lg-px-90 {   padding-right:90px !important;   padding-left:90px !important;  }  .lg-py-90 {   padding-top:90px !important;   padding-bottom:90px !important;  }  .lg-pt-90 {   padding-top:90px !important;  }  .lg-pb-90 {   padding-bottom:90px !important;  }  .lg-pl-90 {   padding-left:90px !important;  }  .lg-pr-90 {   padding-right:90px !important;  }  .lg-px-95 {   padding-right:95px !important;   padding-left:95px !important;  }  .lg-py-95 {   padding-top:95px !important;   padding-bottom:95px !important;  }  .lg-pt-95 {   padding-top:95px !important;  }  .lg-pb-95 {   padding-bottom:95px !important;  }  .lg-pl-95 {   padding-left:95px !important;  }  .lg-pr-95 {   padding-right:95px !important;  }  .lg-px-100 {   padding-right:100px !important;   padding-left:100px !important;  }  .lg-py-100 {   padding-top:100px !important;   padding-bottom:100px !important;  }  .lg-pt-100 {   padding-top:100px !important;  }  .lg-pb-100 {   padding-bottom:100px !important;  }  .lg-pl-100 {   padding-left:100px !important;  }  .lg-pr-100 {   padding-right:100px !important;  }  .lg-px-105 {   padding-right:105px !important;   padding-left:105px !important;  }  .lg-py-105 {   padding-top:105px !important;   padding-bottom:105px !important;  }  .lg-pt-105 {   padding-top:105px !important;  }  .lg-pb-105 {   padding-bottom:105px !important;  }  .lg-pl-105 {   padding-left:105px !important;  }  .lg-pr-105 {   padding-right:105px !important;  }  .lg-px-110 {   padding-right:110px !important;   padding-left:110px !important;  }  .lg-py-110 {   padding-top:110px !important;   padding-bottom:110px !important;  }  .lg-pt-110 {   padding-top:110px !important;  }  .lg-pb-110 {   padding-bottom:110px !important;  }  .lg-pl-110 {   padding-left:110px !important;  }  .lg-pr-110 {   padding-right:110px !important;  }  .lg-px-115 {   padding-right:115px !important;   padding-left:115px !important;  }  .lg-py-115 {   padding-top:115px !important;   padding-bottom:115px !important;  }  .lg-pt-115 {   padding-top:115px !important;  }  .lg-pb-115 {   padding-bottom:115px !important;  }  .lg-pl-115 {   padding-left:115px !important;  }  .lg-pr-115 {   padding-right:115px !important;  }  .lg-px-120 {   padding-right:120px !important;   padding-left:120px !important;  }  .lg-py-120 {   padding-top:120px !important;   padding-bottom:120px !important;  }  .lg-pt-120 {   padding-top:120px !important;  }  .lg-pb-120 {   padding-bottom:120px !important;  }  .lg-pl-120 {   padding-left:120px !important;  }  .lg-pr-120 {   padding-right:120px !important;  }  .lg-px-125 {   padding-right:125px !important;   padding-left:125px !important;  }  .lg-py-125 {   padding-top:125px !important;   padding-bottom:125px !important;  }  .lg-pt-125 {   padding-top:125px !important;  }  .lg-pb-125 {   padding-bottom:125px !important;  }  .lg-pl-125 {   padding-left:125px !important;  }  .lg-pr-125 {   padding-right:125px !important;  }  .lg-px-130 {   padding-right:130px !important;   padding-left:130px !important;  }  .lg-py-130 {   padding-top:130px !important;   padding-bottom:130px !important;  }  .lg-pt-130 {   padding-top:130px !important;  }  .lg-pb-130 {   padding-bottom:130px !important;  }  .lg-pl-130 {   padding-left:130px !important;  }  .lg-pr-130 {   padding-right:130px !important;  }  .lg-px-135 {   padding-right:135px !important;   padding-left:135px !important;  }  .lg-py-135 {   padding-top:135px !important;   padding-bottom:135px !important;  }  .lg-pt-135 {   padding-top:135px !important;  }  .lg-pb-135 {   padding-bottom:135px !important;  }  .lg-pl-135 {   padding-left:135px !important;  }  .lg-pr-135 {   padding-right:135px !important;  }  .lg-px-140 {   padding-right:140px !important;   padding-left:140px !important;  }  .lg-py-140 {   padding-top:140px !important;   padding-bottom:140px !important;  }  .lg-pt-140 {   padding-top:140px !important;  }  .lg-pb-140 {   padding-bottom:140px !important;  }  .lg-pl-140 {   padding-left:140px !important;  }  .lg-pr-140 {   padding-right:140px !important;  }  .lg-px-145 {   padding-right:145px !important;   padding-left:145px !important;  }  .lg-py-145 {   padding-top:145px !important;   padding-bottom:145px !important;  }  .lg-pt-145 {   padding-top:145px !important;  }  .lg-pb-145 {   padding-bottom:145px !important;  }  .lg-pl-145 {   padding-left:145px !important;  }  .lg-pr-145 {   padding-right:145px !important;  }  .lg-px-150 {   padding-right:150px !important;   padding-left:150px !important;  }  .lg-py-150 {   padding-top:150px !important;   padding-bottom:150px !important;  }  .lg-pt-150 {   padding-top:150px !important;  }  .lg-pb-150 {   padding-bottom:150px !important;  }  .lg-pl-150 {   padding-left:150px !important;  }  .lg-pr-150 {   padding-right:150px !important;  }  .lg-px-0 {   padding-right:0 !important;   padding-left:0 !important;  }  .lg-py-0 {   padding-top:0 !important;   padding-bottom:0 !important;  }  .lg-pt-0 {   padding-top:0 !important;  }  .lg-pb-0 {   padding-bottom:0 !important;  }  .lg-pl-0 {   padding-left:0 !important;  }  .lg-pr-0 {   padding-right:0 !important;  } } @media (max-width:991px) {  .md-px-5 {   padding-right:5px !important;   padding-left:5px !important;  }  .md-py-5 {   padding-top:5px !important;   padding-bottom:5px !important;  }  .md-pt-5 {   padding-top:5px !important;  }  .md-pb-5 {   padding-bottom:5px !important;  }  .md-pl-5 {   padding-left:5px !important;  }  .md-pr-5 {   padding-right:5px !important;  }  .md-px-10 {   padding-right:10px !important;   padding-left:10px !important;  }  .md-py-10 {   padding-top:10px !important;   padding-bottom:10px !important;  }  .md-pt-10 {   padding-top:10px !important;  }  .md-pb-10 {   padding-bottom:10px !important;  }  .md-pl-10 {   padding-left:10px !important;  }  .md-pr-10 {   padding-right:10px !important;  }  .md-px-15 {   padding-right:15px !important;   padding-left:15px !important;  }  .md-py-15 {   padding-top:15px !important;   padding-bottom:15px !important;  }  .md-pt-15 {   padding-top:15px !important;  }  .md-pb-15 {   padding-bottom:15px !important;  }  .md-pl-15 {   padding-left:15px !important;  }  .md-pr-15 {   padding-right:15px !important;  }  .md-px-20 {   padding-right:20px !important;   padding-left:20px !important;  }  .md-py-20 {   padding-top:20px !important;   padding-bottom:20px !important;  }  .md-pt-20 {   padding-top:20px !important;  }  .md-pb-20 {   padding-bottom:20px !important;  }  .md-pl-20 {   padding-left:20px !important;  }  .md-pr-20 {   padding-right:20px !important;  }  .md-px-25 {   padding-right:25px !important;   padding-left:25px !important;  }  .md-py-25 {   padding-top:25px !important;   padding-bottom:25px !important;  }  .md-pt-25 {   padding-top:25px !important;  }  .md-pb-25 {   padding-bottom:25px !important;  }  .md-pl-25 {   padding-left:25px !important;  }  .md-pr-25 {   padding-right:25px !important;  }  .md-px-30 {   padding-right:30px !important;   padding-left:30px !important;  }  .md-py-30 {   padding-top:30px !important;   padding-bottom:30px !important;  }  .md-pt-30 {   padding-top:30px !important;  }  .md-pb-30 {   padding-bottom:30px !important;  }  .md-pl-30 {   padding-left:30px !important;  }  .md-pr-30 {   padding-right:30px !important;  }  .md-px-35 {   padding-right:35px !important;   padding-left:35px !important;  }  .md-py-35 {   padding-top:35px !important;   padding-bottom:35px !important;  }  .md-pt-35 {   padding-top:35px !important;  }  .md-pb-35 {   padding-bottom:35px !important;  }  .md-pl-35 {   padding-left:35px !important;  }  .md-pr-35 {   padding-right:35px !important;  }  .md-px-40 {   padding-right:40px !important;   padding-left:40px !important;  }  .md-py-40 {   padding-top:40px !important;   padding-bottom:40px !important;  }  .md-pt-40 {   padding-top:40px !important;  }  .md-pb-40 {   padding-bottom:40px !important;  }  .md-pl-40 {   padding-left:40px !important;  }  .md-pr-40 {   padding-right:40px !important;  }  .md-px-45 {   padding-right:45px !important;   padding-left:45px !important;  }  .md-py-45 {   padding-top:45px !important;   padding-bottom:45px !important;  }  .md-pt-45 {   padding-top:45px !important;  }  .md-pb-45 {   padding-bottom:45px !important;  }  .md-pl-45 {   padding-left:45px !important;  }  .md-pr-45 {   padding-right:45px !important;  }  .md-px-50 {   padding-right:50px !important;   padding-left:50px !important;  }  .md-py-50 {   padding-top:50px !important;   padding-bottom:50px !important;  }  .md-pt-50 {   padding-top:50px !important;  }  .md-pb-50 {   padding-bottom:50px !important;  }  .md-pl-50 {   padding-left:50px !important;  }  .md-pr-50 {   padding-right:50px !important;  }  .md-px-55 {   padding-right:55px !important;   padding-left:55px !important;  }  .md-py-55 {   padding-top:55px !important;   padding-bottom:55px !important;  }  .md-pt-55 {   padding-top:55px !important;  }  .md-pb-55 {   padding-bottom:55px !important;  }  .md-pl-55 {   padding-left:55px !important;  }  .md-pr-55 {   padding-right:55px !important;  }  .md-px-60 {   padding-right:60px !important;   padding-left:60px !important;  }  .md-py-60 {   padding-top:60px !important;   padding-bottom:60px !important;  }  .md-pt-60 {   padding-top:60px !important;  }  .md-pb-60 {   padding-bottom:60px !important;  }  .md-pl-60 {   padding-left:60px !important;  }  .md-pr-60 {   padding-right:60px !important;  }  .md-px-65 {   padding-right:65px !important;   padding-left:65px !important;  }  .md-py-65 {   padding-top:65px !important;   padding-bottom:65px !important;  }  .md-pt-65 {   padding-top:65px !important;  }  .md-pb-65 {   padding-bottom:65px !important;  }  .md-pl-65 {   padding-left:65px !important;  }  .md-pr-65 {   padding-right:65px !important;  }  .md-px-70 {   padding-right:70px !important;   padding-left:70px !important;  }  .md-py-70 {   padding-top:70px !important;   padding-bottom:70px !important;  }  .md-pt-70 {   padding-top:70px !important;  }  .md-pb-70 {   padding-bottom:70px !important;  }  .md-pl-70 {   padding-left:70px !important;  }  .md-pr-70 {   padding-right:70px !important;  }  .md-px-75 {   padding-right:75px !important;   padding-left:75px !important;  }  .md-py-75 {   padding-top:75px !important;   padding-bottom:75px !important;  }  .md-pt-75 {   padding-top:75px !important;  }  .md-pb-75 {   padding-bottom:75px !important;  }  .md-pl-75 {   padding-left:75px !important;  }  .md-pr-75 {   padding-right:75px !important;  }  .md-px-80 {   padding-right:80px !important;   padding-left:80px !important;  }  .md-py-80 {   padding-top:80px !important;   padding-bottom:80px !important;  }  .md-pt-80 {   padding-top:80px !important;  }  .md-pb-80 {   padding-bottom:80px !important;  }  .md-pl-80 {   padding-left:80px !important;  }  .md-pr-80 {   padding-right:80px !important;  }  .md-px-85 {   padding-right:85px !important;   padding-left:85px !important;  }  .md-py-85 {   padding-top:85px !important;   padding-bottom:85px !important;  }  .md-pt-85 {   padding-top:85px !important;  }  .md-pb-85 {   padding-bottom:85px !important;  }  .md-pl-85 {   padding-left:85px !important;  }  .md-pr-85 {   padding-right:85px !important;  }  .md-px-90 {   padding-right:90px !important;   padding-left:90px !important;  }  .md-py-90 {   padding-top:90px !important;   padding-bottom:90px !important;  }  .md-pt-90 {   padding-top:90px !important;  }  .md-pb-90 {   padding-bottom:90px !important;  }  .md-pl-90 {   padding-left:90px !important;  }  .md-pr-90 {   padding-right:90px !important;  }  .md-px-95 {   padding-right:95px !important;   padding-left:95px !important;  }  .md-py-95 {   padding-top:95px !important;   padding-bottom:95px !important;  }  .md-pt-95 {   padding-top:95px !important;  }  .md-pb-95 {   padding-bottom:95px !important;  }  .md-pl-95 {   padding-left:95px !important;  }  .md-pr-95 {   padding-right:95px !important;  }  .md-px-100 {   padding-right:100px !important;   padding-left:100px !important;  }  .md-py-100 {   padding-top:100px !important;   padding-bottom:100px !important;  }  .md-pt-100 {   padding-top:100px !important;  }  .md-pb-100 {   padding-bottom:100px !important;  }  .md-pl-100 {   padding-left:100px !important;  }  .md-pr-100 {   padding-right:100px !important;  }  .md-px-105 {   padding-right:105px !important;   padding-left:105px !important;  }  .md-py-105 {   padding-top:105px !important;   padding-bottom:105px !important;  }  .md-pt-105 {   padding-top:105px !important;  }  .md-pb-105 {   padding-bottom:105px !important;  }  .md-pl-105 {   padding-left:105px !important;  }  .md-pr-105 {   padding-right:105px !important;  }  .md-px-110 {   padding-right:110px !important;   padding-left:110px !important;  }  .md-py-110 {   padding-top:110px !important;   padding-bottom:110px !important;  }  .md-pt-110 {   padding-top:110px !important;  }  .md-pb-110 {   padding-bottom:110px !important;  }  .md-pl-110 {   padding-left:110px !important;  }  .md-pr-110 {   padding-right:110px !important;  }  .md-px-115 {   padding-right:115px !important;   padding-left:115px !important;  }  .md-py-115 {   padding-top:115px !important;   padding-bottom:115px !important;  }  .md-pt-115 {   padding-top:115px !important;  }  .md-pb-115 {   padding-bottom:115px !important;  }  .md-pl-115 {   padding-left:115px !important;  }  .md-pr-115 {   padding-right:115px !important;  }  .md-px-120 {   padding-right:120px !important;   padding-left:120px !important;  }  .md-py-120 {   padding-top:120px !important;   padding-bottom:120px !important;  }  .md-pt-120 {   padding-top:120px !important;  }  .md-pb-120 {   padding-bottom:120px !important;  }  .md-pl-120 {   padding-left:120px !important;  }  .md-pr-120 {   padding-right:120px !important;  }  .md-px-125 {   padding-right:125px !important;   padding-left:125px !important;  }  .md-py-125 {   padding-top:125px !important;   padding-bottom:125px !important;  }  .md-pt-125 {   padding-top:125px !important;  }  .md-pb-125 {   padding-bottom:125px !important;  }  .md-pl-125 {   padding-left:125px !important;  }  .md-pr-125 {   padding-right:125px !important;  }  .md-px-130 {   padding-right:130px !important;   padding-left:130px !important;  }  .md-py-130 {   padding-top:130px !important;   padding-bottom:130px !important;  }  .md-pt-130 {   padding-top:130px !important;  }  .md-pb-130 {   padding-bottom:130px !important;  }  .md-pl-130 {   padding-left:130px !important;  }  .md-pr-130 {   padding-right:130px !important;  }  .md-px-135 {   padding-right:135px !important;   padding-left:135px !important;  }  .md-py-135 {   padding-top:135px !important;   padding-bottom:135px !important;  }  .md-pt-135 {   padding-top:135px !important;  }  .md-pb-135 {   padding-bottom:135px !important;  }  .md-pl-135 {   padding-left:135px !important;  }  .md-pr-135 {   padding-right:135px !important;  }  .md-px-140 {   padding-right:140px !important;   padding-left:140px !important;  }  .md-py-140 {   padding-top:140px !important;   padding-bottom:140px !important;  }  .md-pt-140 {   padding-top:140px !important;  }  .md-pb-140 {   padding-bottom:140px !important;  }  .md-pl-140 {   padding-left:140px !important;  }  .md-pr-140 {   padding-right:140px !important;  }  .md-px-145 {   padding-right:145px !important;   padding-left:145px !important;  }  .md-py-145 {   padding-top:145px !important;   padding-bottom:145px !important;  }  .md-pt-145 {   padding-top:145px !important;  }  .md-pb-145 {   padding-bottom:145px !important;  }  .md-pl-145 {   padding-left:145px !important;  }  .md-pr-145 {   padding-right:145px !important;  }  .md-px-150 {   padding-right:150px !important;   padding-left:150px !important;  }  .md-py-150 {   padding-top:150px !important;   padding-bottom:150px !important;  }  .md-pt-150 {   padding-top:150px !important;  }  .md-pb-150 {   padding-bottom:150px !important;  }  .md-pl-150 {   padding-left:150px !important;  }  .md-pr-150 {   padding-right:150px !important;  }  .md-px-0 {   padding-right:0 !important;   padding-left:0 !important;  }  .md-py-0 {   padding-top:0 !important;   padding-bottom:0 !important;  }  .md-pt-0 {   padding-top:0 !important;  }  .md-pb-0 {   padding-bottom:0 !important;  }  .md-pl-0 {   padding-left:0 !important;  }  .md-pr-0 {   padding-right:0 !important;  } } @media (max-width:767px) {  .sm-px-5 {   padding-right:5px !important;   padding-left:5px !important;  }  .sm-py-5 {   padding-top:5px !important;   padding-bottom:5px !important;  }  .sm-pt-5 {   padding-top:5px !important;  }  .sm-pb-5 {   padding-bottom:5px !important;  }  .sm-pl-5 {   padding-left:5px !important;  }  .sm-pr-5 {   padding-right:5px !important;  }  .sm-px-10 {   padding-right:10px !important;   padding-left:10px !important;  }  .sm-py-10 {   padding-top:10px !important;   padding-bottom:10px !important;  }  .sm-pt-10 {   padding-top:10px !important;  }  .sm-pb-10 {   padding-bottom:10px !important;  }  .sm-pl-10 {   padding-left:10px !important;  }  .sm-pr-10 {   padding-right:10px !important;  }  .sm-px-15 {   padding-right:15px !important;   padding-left:15px !important;  }  .sm-py-15 {   padding-top:15px !important;   padding-bottom:15px !important;  }  .sm-pt-15 {   padding-top:15px !important;  }  .sm-pb-15 {   padding-bottom:15px !important;  }  .sm-pl-15 {   padding-left:15px !important;  }  .sm-pr-15 {   padding-right:15px !important;  }  .sm-px-20 {   padding-right:20px !important;   padding-left:20px !important;  }  .sm-py-20 {   padding-top:20px !important;   padding-bottom:20px !important;  }  .sm-pt-20 {   padding-top:20px !important;  }  .sm-pb-20 {   padding-bottom:20px !important;  }  .sm-pl-20 {   padding-left:20px !important;  }  .sm-pr-20 {   padding-right:20px !important;  }  .sm-px-25 {   padding-right:25px !important;   padding-left:25px !important;  }  .sm-py-25 {   padding-top:25px !important;   padding-bottom:25px !important;  }  .sm-pt-25 {   padding-top:25px !important;  }  .sm-pb-25 {   padding-bottom:25px !important;  }  .sm-pl-25 {   padding-left:25px !important;  }  .sm-pr-25 {   padding-right:25px !important;  }  .sm-px-30 {   padding-right:30px !important;   padding-left:30px !important;  }  .sm-py-30 {   padding-top:30px !important;   padding-bottom:30px !important;  }  .sm-pt-30 {   padding-top:30px !important;  }  .sm-pb-30 {   padding-bottom:30px !important;  }  .sm-pl-30 {   padding-left:30px !important;  }  .sm-pr-30 {   padding-right:30px !important;  }  .sm-px-35 {   padding-right:35px !important;   padding-left:35px !important;  }  .sm-py-35 {   padding-top:35px !important;   padding-bottom:35px !important;  }  .sm-pt-35 {   padding-top:35px !important;  }  .sm-pb-35 {   padding-bottom:35px !important;  }  .sm-pl-35 {   padding-left:35px !important;  }  .sm-pr-35 {   padding-right:35px !important;  }  .sm-px-40 {   padding-right:40px !important;   padding-left:40px !important;  }  .sm-py-40 {   padding-top:40px !important;   padding-bottom:40px !important;  }  .sm-pt-40 {   padding-top:40px !important;  }  .sm-pb-40 {   padding-bottom:40px !important;  }  .sm-pl-40 {   padding-left:40px !important;  }  .sm-pr-40 {   padding-right:40px !important;  }  .sm-px-45 {   padding-right:45px !important;   padding-left:45px !important;  }  .sm-py-45 {   padding-top:45px !important;   padding-bottom:45px !important;  }  .sm-pt-45 {   padding-top:45px !important;  }  .sm-pb-45 {   padding-bottom:45px !important;  }  .sm-pl-45 {   padding-left:45px !important;  }  .sm-pr-45 {   padding-right:45px !important;  }  .sm-px-50 {   padding-right:50px !important;   padding-left:50px !important;  }  .sm-py-50 {   padding-top:50px !important;   padding-bottom:50px !important;  }  .sm-pt-50 {   padding-top:50px !important;  }  .sm-pb-50 {   padding-bottom:50px !important;  }  .sm-pl-50 {   padding-left:50px !important;  }  .sm-pr-50 {   padding-right:50px !important;  }  .sm-px-55 {   padding-right:55px !important;   padding-left:55px !important;  }  .sm-py-55 {   padding-top:55px !important;   padding-bottom:55px !important;  }  .sm-pt-55 {   padding-top:55px !important;  }  .sm-pb-55 {   padding-bottom:55px !important;  }  .sm-pl-55 {   padding-left:55px !important;  }  .sm-pr-55 {   padding-right:55px !important;  }  .sm-px-60 {   padding-right:60px !important;   padding-left:60px !important;  }  .sm-py-60 {   padding-top:60px !important;   padding-bottom:60px !important;  }  .sm-pt-60 {   padding-top:60px !important;  }  .sm-pb-60 {   padding-bottom:60px !important;  }  .sm-pl-60 {   padding-left:60px !important;  }  .sm-pr-60 {   padding-right:60px !important;  }  .sm-px-65 {   padding-right:65px !important;   padding-left:65px !important;  }  .sm-py-65 {   padding-top:65px !important;   padding-bottom:65px !important;  }  .sm-pt-65 {   padding-top:65px !important;  }  .sm-pb-65 {   padding-bottom:65px !important;  }  .sm-pl-65 {   padding-left:65px !important;  }  .sm-pr-65 {   padding-right:65px !important;  }  .sm-px-70 {   padding-right:70px !important;   padding-left:70px !important;  }  .sm-py-70 {   padding-top:70px !important;   padding-bottom:70px !important;  }  .sm-pt-70 {   padding-top:70px !important;  }  .sm-pb-70 {   padding-bottom:70px !important;  }  .sm-pl-70 {   padding-left:70px !important;  }  .sm-pr-70 {   padding-right:70px !important;  }  .sm-px-75 {   padding-right:75px !important;   padding-left:75px !important;  }  .sm-py-75 {   padding-top:75px !important;   padding-bottom:75px !important;  }  .sm-pt-75 {   padding-top:75px !important;  }  .sm-pb-75 {   padding-bottom:75px !important;  }  .sm-pl-75 {   padding-left:75px !important;  }  .sm-pr-75 {   padding-right:75px !important;  }  .sm-px-80 {   padding-right:80px !important;   padding-left:80px !important;  }  .sm-py-80 {   padding-top:80px !important;   padding-bottom:80px !important;  }  .sm-pt-80 {   padding-top:80px !important;  }  .sm-pb-80 {   padding-bottom:80px !important;  }  .sm-pl-80 {   padding-left:80px !important;  }  .sm-pr-80 {   padding-right:80px !important;  }  .sm-px-85 {   padding-right:85px !important;   padding-left:85px !important;  }  .sm-py-85 {   padding-top:85px !important;   padding-bottom:85px !important;  }  .sm-pt-85 {   padding-top:85px !important;  }  .sm-pb-85 {   padding-bottom:85px !important;  }  .sm-pl-85 {   padding-left:85px !important;  }  .sm-pr-85 {   padding-right:85px !important;  }  .sm-px-90 {   padding-right:90px !important;   padding-left:90px !important;  }  .sm-py-90 {   padding-top:90px !important;   padding-bottom:90px !important;  }  .sm-pt-90 {   padding-top:90px !important;  }  .sm-pb-90 {   padding-bottom:90px !important;  }  .sm-pl-90 {   padding-left:90px !important;  }  .sm-pr-90 {   padding-right:90px !important;  }  .sm-px-95 {   padding-right:95px !important;   padding-left:95px !important;  }  .sm-py-95 {   padding-top:95px !important;   padding-bottom:95px !important;  }  .sm-pt-95 {   padding-top:95px !important;  }  .sm-pb-95 {   padding-bottom:95px !important;  }  .sm-pl-95 {   padding-left:95px !important;  }  .sm-pr-95 {   padding-right:95px !important;  }  .sm-px-100 {   padding-right:100px !important;   padding-left:100px !important;  }  .sm-py-100 {   padding-top:100px !important;   padding-bottom:100px !important;  }  .sm-pt-100 {   padding-top:100px !important;  }  .sm-pb-100 {   padding-bottom:100px !important;  }  .sm-pl-100 {   padding-left:100px !important;  }  .sm-pr-100 {   padding-right:100px !important;  }  .sm-px-105 {   padding-right:105px !important;   padding-left:105px !important;  }  .sm-py-105 {   padding-top:105px !important;   padding-bottom:105px !important;  }  .sm-pt-105 {   padding-top:105px !important;  }  .sm-pb-105 {   padding-bottom:105px !important;  }  .sm-pl-105 {   padding-left:105px !important;  }  .sm-pr-105 {   padding-right:105px !important;  }  .sm-px-110 {   padding-right:110px !important;   padding-left:110px !important;  }  .sm-py-110 {   padding-top:110px !important;   padding-bottom:110px !important;  }  .sm-pt-110 {   padding-top:110px !important;  }  .sm-pb-110 {   padding-bottom:110px !important;  }  .sm-pl-110 {   padding-left:110px !important;  }  .sm-pr-110 {   padding-right:110px !important;  }  .sm-px-115 {   padding-right:115px !important;   padding-left:115px !important;  }  .sm-py-115 {   padding-top:115px !important;   padding-bottom:115px !important;  }  .sm-pt-115 {   padding-top:115px !important;  }  .sm-pb-115 {   padding-bottom:115px !important;  }  .sm-pl-115 {   padding-left:115px !important;  }  .sm-pr-115 {   padding-right:115px !important;  }  .sm-px-120 {   padding-right:120px !important;   padding-left:120px !important;  }  .sm-py-120 {   padding-top:120px !important;   padding-bottom:120px !important;  }  .sm-pt-120 {   padding-top:120px !important;  }  .sm-pb-120 {   padding-bottom:120px !important;  }  .sm-pl-120 {   padding-left:120px !important;  }  .sm-pr-120 {   padding-right:120px !important;  }  .sm-px-125 {   padding-right:125px !important;   padding-left:125px !important;  }  .sm-py-125 {   padding-top:125px !important;   padding-bottom:125px !important;  }  .sm-pt-125 {   padding-top:125px !important;  }  .sm-pb-125 {   padding-bottom:125px !important;  }  .sm-pl-125 {   padding-left:125px !important;  }  .sm-pr-125 {   padding-right:125px !important;  }  .sm-px-130 {   padding-right:130px !important;   padding-left:130px !important;  }  .sm-py-130 {   padding-top:130px !important;   padding-bottom:130px !important;  }  .sm-pt-130 {   padding-top:130px !important;  }  .sm-pb-130 {   padding-bottom:130px !important;  }  .sm-pl-130 {   padding-left:130px !important;  }  .sm-pr-130 {   padding-right:130px !important;  }  .sm-px-135 {   padding-right:135px !important;   padding-left:135px !important;  }  .sm-py-135 {   padding-top:135px !important;   padding-bottom:135px !important;  }  .sm-pt-135 {   padding-top:135px !important;  }  .sm-pb-135 {   padding-bottom:135px !important;  }  .sm-pl-135 {   padding-left:135px !important;  }  .sm-pr-135 {   padding-right:135px !important;  }  .sm-px-140 {   padding-right:140px !important;   padding-left:140px !important;  }  .sm-py-140 {   padding-top:140px !important;   padding-bottom:140px !important;  }  .sm-pt-140 {   padding-top:140px !important;  }  .sm-pb-140 {   padding-bottom:140px !important;  }  .sm-pl-140 {   padding-left:140px !important;  }  .sm-pr-140 {   padding-right:140px !important;  }  .sm-px-145 {   padding-right:145px !important;   padding-left:145px !important;  }  .sm-py-145 {   padding-top:145px !important;   padding-bottom:145px !important;  }  .sm-pt-145 {   padding-top:145px !important;  }  .sm-pb-145 {   padding-bottom:145px !important;  }  .sm-pl-145 {   padding-left:145px !important;  }  .sm-pr-145 {   padding-right:145px !important;  }  .sm-px-150 {   padding-right:150px !important;   padding-left:150px !important;  }  .sm-py-150 {   padding-top:150px !important;   padding-bottom:150px !important;  }  .sm-pt-150 {   padding-top:150px !important;  }  .sm-pb-150 {   padding-bottom:150px !important;  }  .sm-pl-150 {   padding-left:150px !important;  }  .sm-pr-150 {   padding-right:150px !important;  }  .sm-px-0 {   padding-right:0 !important;   padding-left:0 !important;  }  .sm-py-0 {   padding-top:0 !important;   padding-bottom:0 !important;  }  .sm-pt-0 {   padding-top:0 !important;  }  .sm-pb-0 {   padding-bottom:0 !important;  }  .sm-pl-0 {   padding-left:0 !important;  }  .sm-pr-0 {   padding-right:0 !important;  } } @media (max-width:575px) {  .xs-px-5 {   padding-right:5px !important;   padding-left:5px !important;  }  .xs-py-5 {   padding-top:5px !important;   padding-bottom:5px !important;  }  .xs-pt-5 {   padding-top:5px !important;  }  .xs-pb-5 {   padding-bottom:5px !important;  }  .xs-pl-5 {   padding-left:5px !important;  }  .xs-pr-5 {   padding-right:5px !important;  }  .xs-px-10 {   padding-right:10px !important;   padding-left:10px !important;  }  .xs-py-10 {   padding-top:10px !important;   padding-bottom:10px !important;  }  .xs-pt-10 {   padding-top:10px !important;  }  .xs-pb-10 {   padding-bottom:10px !important;  }  .xs-pl-10 {   padding-left:10px !important;  }  .xs-pr-10 {   padding-right:10px !important;  }  .xs-px-15 {   padding-right:15px !important;   padding-left:15px !important;  }  .xs-py-15 {   padding-top:15px !important;   padding-bottom:15px !important;  }  .xs-pt-15 {   padding-top:15px !important;  }  .xs-pb-15 {   padding-bottom:15px !important;  }  .xs-pl-15 {   padding-left:15px !important;  }  .xs-pr-15 {   padding-right:15px !important;  }  .xs-px-20 {   padding-right:20px !important;   padding-left:20px !important;  }  .xs-py-20 {   padding-top:20px !important;   padding-bottom:20px !important;  }  .xs-pt-20 {   padding-top:20px !important;  }  .xs-pb-20 {   padding-bottom:20px !important;  }  .xs-pl-20 {   padding-left:20px !important;  }  .xs-pr-20 {   padding-right:20px !important;  }  .xs-px-25 {   padding-right:25px !important;   padding-left:25px !important;  }  .xs-py-25 {   padding-top:25px !important;   padding-bottom:25px !important;  }  .xs-pt-25 {   padding-top:25px !important;  }  .xs-pb-25 {   padding-bottom:25px !important;  }  .xs-pl-25 {   padding-left:25px !important;  }  .xs-pr-25 {   padding-right:25px !important;  }  .xs-px-30 {   padding-right:30px !important;   padding-left:30px !important;  }  .xs-py-30 {   padding-top:30px !important;   padding-bottom:30px !important;  }  .xs-pt-30 {   padding-top:30px !important;  }  .xs-pb-30 {   padding-bottom:30px !important;  }  .xs-pl-30 {   padding-left:30px !important;  }  .xs-pr-30 {   padding-right:30px !important;  }  .xs-px-35 {   padding-right:35px !important;   padding-left:35px !important;  }  .xs-py-35 {   padding-top:35px !important;   padding-bottom:35px !important;  }  .xs-pt-35 {   padding-top:35px !important;  }  .xs-pb-35 {   padding-bottom:35px !important;  }  .xs-pl-35 {   padding-left:35px !important;  }  .xs-pr-35 {   padding-right:35px !important;  }  .xs-px-40 {   padding-right:40px !important;   padding-left:40px !important;  }  .xs-py-40 {   padding-top:40px !important;   padding-bottom:40px !important;  }  .xs-pt-40 {   padding-top:40px !important;  }  .xs-pb-40 {   padding-bottom:40px !important;  }  .xs-pl-40 {   padding-left:40px !important;  }  .xs-pr-40 {   padding-right:40px !important;  }  .xs-px-45 {   padding-right:45px !important;   padding-left:45px !important;  }  .xs-py-45 {   padding-top:45px !important;   padding-bottom:45px !important;  }  .xs-pt-45 {   padding-top:45px !important;  }  .xs-pb-45 {   padding-bottom:45px !important;  }  .xs-pl-45 {   padding-left:45px !important;  }  .xs-pr-45 {   padding-right:45px !important;  }  .xs-px-50 {   padding-right:50px !important;   padding-left:50px !important;  }  .xs-py-50 {   padding-top:50px !important;   padding-bottom:50px !important;  }  .xs-pt-50 {   padding-top:50px !important;  }  .xs-pb-50 {   padding-bottom:50px !important;  }  .xs-pl-50 {   padding-left:50px !important;  }  .xs-pr-50 {   padding-right:50px !important;  }  .xs-px-55 {   padding-right:55px !important;   padding-left:55px !important;  }  .xs-py-55 {   padding-top:55px !important;   padding-bottom:55px !important;  }  .xs-pt-55 {   padding-top:55px !important;  }  .xs-pb-55 {   padding-bottom:55px !important;  }  .xs-pl-55 {   padding-left:55px !important;  }  .xs-pr-55 {   padding-right:55px !important;  }  .xs-px-60 {   padding-right:60px !important;   padding-left:60px !important;  }  .xs-py-60 {   padding-top:60px !important;   padding-bottom:60px !important;  }  .xs-pt-60 {   padding-top:60px !important;  }  .xs-pb-60 {   padding-bottom:60px !important;  }  .xs-pl-60 {   padding-left:60px !important;  }  .xs-pr-60 {   padding-right:60px !important;  }  .xs-px-65 {   padding-right:65px !important;   padding-left:65px !important;  }  .xs-py-65 {   padding-top:65px !important;   padding-bottom:65px !important;  }  .xs-pt-65 {   padding-top:65px !important;  }  .xs-pb-65 {   padding-bottom:65px !important;  }  .xs-pl-65 {   padding-left:65px !important;  }  .xs-pr-65 {   padding-right:65px !important;  }  .xs-px-70 {   padding-right:70px !important;   padding-left:70px !important;  }  .xs-py-70 {   padding-top:70px !important;   padding-bottom:70px !important;  }  .xs-pt-70 {   padding-top:70px !important;  }  .xs-pb-70 {   padding-bottom:70px !important;  }  .xs-pl-70 {   padding-left:70px !important;  }  .xs-pr-70 {   padding-right:70px !important;  }  .xs-px-75 {   padding-right:75px !important;   padding-left:75px !important;  }  .xs-py-75 {   padding-top:75px !important;   padding-bottom:75px !important;  }  .xs-pt-75 {   padding-top:75px !important;  }  .xs-pb-75 {   padding-bottom:75px !important;  }  .xs-pl-75 {   padding-left:75px !important;  }  .xs-pr-75 {   padding-right:75px !important;  }  .xs-px-80 {   padding-right:80px !important;   padding-left:80px !important;  }  .xs-py-80 {   padding-top:80px !important;   padding-bottom:80px !important;  }  .xs-pt-80 {   padding-top:80px !important;  }  .xs-pb-80 {   padding-bottom:80px !important;  }  .xs-pl-80 {   padding-left:80px !important;  }  .xs-pr-80 {   padding-right:80px !important;  }  .xs-px-85 {   padding-right:85px !important;   padding-left:85px !important;  }  .xs-py-85 {   padding-top:85px !important;   padding-bottom:85px !important;  }  .xs-pt-85 {   padding-top:85px !important;  }  .xs-pb-85 {   padding-bottom:85px !important;  }  .xs-pl-85 {   padding-left:85px !important;  }  .xs-pr-85 {   padding-right:85px !important;  }  .xs-px-90 {   padding-right:90px !important;   padding-left:90px !important;  }  .xs-py-90 {   padding-top:90px !important;   padding-bottom:90px !important;  }  .xs-pt-90 {   padding-top:90px !important;  }  .xs-pb-90 {   padding-bottom:90px !important;  }  .xs-pl-90 {   padding-left:90px !important;  }  .xs-pr-90 {   padding-right:90px !important;  }  .xs-px-95 {   padding-right:95px !important;   padding-left:95px !important;  }  .xs-py-95 {   padding-top:95px !important;   padding-bottom:95px !important;  }  .xs-pt-95 {   padding-top:95px !important;  }  .xs-pb-95 {   padding-bottom:95px !important;  }  .xs-pl-95 {   padding-left:95px !important;  }  .xs-pr-95 {   padding-right:95px !important;  }  .xs-px-100 {   padding-right:100px !important;   padding-left:100px !important;  }  .xs-py-100 {   padding-top:100px !important;   padding-bottom:100px !important;  }  .xs-pt-100 {   padding-top:100px !important;  }  .xs-pb-100 {   padding-bottom:100px !important;  }  .xs-pl-100 {   padding-left:100px !important;  }  .xs-pr-100 {   padding-right:100px !important;  }  .xs-px-105 {   padding-right:105px !important;   padding-left:105px !important;  }  .xs-py-105 {   padding-top:105px !important;   padding-bottom:105px !important;  }  .xs-pt-105 {   padding-top:105px !important;  }  .xs-pb-105 {   padding-bottom:105px !important;  }  .xs-pl-105 {   padding-left:105px !important;  }  .xs-pr-105 {   padding-right:105px !important;  }  .xs-px-110 {   padding-right:110px !important;   padding-left:110px !important;  }  .xs-py-110 {   padding-top:110px !important;   padding-bottom:110px !important;  }  .xs-pt-110 {   padding-top:110px !important;  }  .xs-pb-110 {   padding-bottom:110px !important;  }  .xs-pl-110 {   padding-left:110px !important;  }  .xs-pr-110 {   padding-right:110px !important;  }  .xs-px-115 {   padding-right:115px !important;   padding-left:115px !important;  }  .xs-py-115 {   padding-top:115px !important;   padding-bottom:115px !important;  }  .xs-pt-115 {   padding-top:115px !important;  }  .xs-pb-115 {   padding-bottom:115px !important;  }  .xs-pl-115 {   padding-left:115px !important;  }  .xs-pr-115 {   padding-right:115px !important;  }  .xs-px-120 {   padding-right:120px !important;   padding-left:120px !important;  }  .xs-py-120 {   padding-top:120px !important;   padding-bottom:120px !important;  }  .xs-pt-120 {   padding-top:120px !important;  }  .xs-pb-120 {   padding-bottom:120px !important;  }  .xs-pl-120 {   padding-left:120px !important;  }  .xs-pr-120 {   padding-right:120px !important;  }  .xs-px-125 {   padding-right:125px !important;   padding-left:125px !important;  }  .xs-py-125 {   padding-top:125px !important;   padding-bottom:125px !important;  }  .xs-pt-125 {   padding-top:125px !important;  }  .xs-pb-125 {   padding-bottom:125px !important;  }  .xs-pl-125 {   padding-left:125px !important;  }  .xs-pr-125 {   padding-right:125px !important;  }  .xs-px-130 {   padding-right:130px !important;   padding-left:130px !important;  }  .xs-py-130 {   padding-top:130px !important;   padding-bottom:130px !important;  }  .xs-pt-130 {   padding-top:130px !important;  }  .xs-pb-130 {   padding-bottom:130px !important;  }  .xs-pl-130 {   padding-left:130px !important;  }  .xs-pr-130 {   padding-right:130px !important;  }  .xs-px-135 {   padding-right:135px !important;   padding-left:135px !important;  }  .xs-py-135 {   padding-top:135px !important;   padding-bottom:135px !important;  }  .xs-pt-135 {   padding-top:135px !important;  }  .xs-pb-135 {   padding-bottom:135px !important;  }  .xs-pl-135 {   padding-left:135px !important;  }  .xs-pr-135 {   padding-right:135px !important;  }  .xs-px-140 {   padding-right:140px !important;   padding-left:140px !important;  }  .xs-py-140 {   padding-top:140px !important;   padding-bottom:140px !important;  }  .xs-pt-140 {   padding-top:140px !important;  }  .xs-pb-140 {   padding-bottom:140px !important;  }  .xs-pl-140 {   padding-left:140px !important;  }  .xs-pr-140 {   padding-right:140px !important;  }  .xs-px-145 {   padding-right:145px !important;   padding-left:145px !important;  }  .xs-py-145 {   padding-top:145px !important;   padding-bottom:145px !important;  }  .xs-pt-145 {   padding-top:145px !important;  }  .xs-pb-145 {   padding-bottom:145px !important;  }  .xs-pl-145 {   padding-left:145px !important;  }  .xs-pr-145 {   padding-right:145px !important;  }  .xs-px-150 {   padding-right:150px !important;   padding-left:150px !important;  }  .xs-py-150 {   padding-top:150px !important;   padding-bottom:150px !important;  }  .xs-pt-150 {   padding-top:150px !important;  }  .xs-pb-150 {   padding-bottom:150px !important;  }  .xs-pl-150 {   padding-left:150px !important;  }  .xs-pr-150 {   padding-right:150px !important;  }  .xs-px-0 {   padding-right:0 !important;   padding-left:0 !important;  }  .xs-py-0 {   padding-top:0 !important;   padding-bottom:0 !important;  }  .xs-pt-0 {   padding-top:0 !important;  }  .xs-pb-0 {   padding-bottom:0 !important;  }  .xs-pl-0 {   padding-left:0 !important;  }  .xs-pr-0 {   padding-right:0 !important;  } } @media (max-width:375px) {  .vxs-px-5 {   padding-right:5px !important;   padding-left:5px !important;  }  .vxs-py-5 {   padding-top:5px !important;   padding-bottom:5px !important;  }  .vxs-pt-5 {   padding-top:5px !important;  }  .vxs-pb-5 {   padding-bottom:5px !important;  }  .vxs-pl-5 {   padding-left:5px !important;  }  .vxs-pr-5 {   padding-right:5px !important;  }  .vxs-px-10 {   padding-right:10px !important;   padding-left:10px !important;  }  .vxs-py-10 {   padding-top:10px !important;   padding-bottom:10px !important;  }  .vxs-pt-10 {   padding-top:10px !important;  }  .vxs-pb-10 {   padding-bottom:10px !important;  }  .vxs-pl-10 {   padding-left:10px !important;  }  .vxs-pr-10 {   padding-right:10px !important;  }  .vxs-px-15 {   padding-right:15px !important;   padding-left:15px !important;  }  .vxs-py-15 {   padding-top:15px !important;   padding-bottom:15px !important;  }  .vxs-pt-15 {   padding-top:15px !important;  }  .vxs-pb-15 {   padding-bottom:15px !important;  }  .vxs-pl-15 {   padding-left:15px !important;  }  .vxs-pr-15 {   padding-right:15px !important;  }  .vxs-px-20 {   padding-right:20px !important;   padding-left:20px !important;  }  .vxs-py-20 {   padding-top:20px !important;   padding-bottom:20px !important;  }  .vxs-pt-20 {   padding-top:20px !important;  }  .vxs-pb-20 {   padding-bottom:20px !important;  }  .vxs-pl-20 {   padding-left:20px !important;  }  .vxs-pr-20 {   padding-right:20px !important;  }  .vxs-px-25 {   padding-right:25px !important;   padding-left:25px !important;  }  .vxs-py-25 {   padding-top:25px !important;   padding-bottom:25px !important;  }  .vxs-pt-25 {   padding-top:25px !important;  }  .vxs-pb-25 {   padding-bottom:25px !important;  }  .vxs-pl-25 {   padding-left:25px !important;  }  .vxs-pr-25 {   padding-right:25px !important;  }  .vxs-px-30 {   padding-right:30px !important;   padding-left:30px !important;  }  .vxs-py-30 {   padding-top:30px !important;   padding-bottom:30px !important;  }  .vxs-pt-30 {   padding-top:30px !important;  }  .vxs-pb-30 {   padding-bottom:30px !important;  }  .vxs-pl-30 {   padding-left:30px !important;  }  .vxs-pr-30 {   padding-right:30px !important;  }  .vxs-px-35 {   padding-right:35px !important;   padding-left:35px !important;  }  .vxs-py-35 {   padding-top:35px !important;   padding-bottom:35px !important;  }  .vxs-pt-35 {   padding-top:35px !important;  }  .vxs-pb-35 {   padding-bottom:35px !important;  }  .vxs-pl-35 {   padding-left:35px !important;  }  .vxs-pr-35 {   padding-right:35px !important;  }  .vxs-px-40 {   padding-right:40px !important;   padding-left:40px !important;  }  .vxs-py-40 {   padding-top:40px !important;   padding-bottom:40px !important;  }  .vxs-pt-40 {   padding-top:40px !important;  }  .vxs-pb-40 {   padding-bottom:40px !important;  }  .vxs-pl-40 {   padding-left:40px !important;  }  .vxs-pr-40 {   padding-right:40px !important;  }  .vxs-px-45 {   padding-right:45px !important;   padding-left:45px !important;  }  .vxs-py-45 {   padding-top:45px !important;   padding-bottom:45px !important;  }  .vxs-pt-45 {   padding-top:45px !important;  }  .vxs-pb-45 {   padding-bottom:45px !important;  }  .vxs-pl-45 {   padding-left:45px !important;  }  .vxs-pr-45 {   padding-right:45px !important;  }  .vxs-px-50 {   padding-right:50px !important;   padding-left:50px !important;  }  .vxs-py-50 {   padding-top:50px !important;   padding-bottom:50px !important;  }  .vxs-pt-50 {   padding-top:50px !important;  }  .vxs-pb-50 {   padding-bottom:50px !important;  }  .vxs-pl-50 {   padding-left:50px !important;  }  .vxs-pr-50 {   padding-right:50px !important;  }  .vxs-px-55 {   padding-right:55px !important;   padding-left:55px !important;  }  .vxs-py-55 {   padding-top:55px !important;   padding-bottom:55px !important;  }  .vxs-pt-55 {   padding-top:55px !important;  }  .vxs-pb-55 {   padding-bottom:55px !important;  }  .vxs-pl-55 {   padding-left:55px !important;  }  .vxs-pr-55 {   padding-right:55px !important;  }  .vxs-px-60 {   padding-right:60px !important;   padding-left:60px !important;  }  .vxs-py-60 {   padding-top:60px !important;   padding-bottom:60px !important;  }  .vxs-pt-60 {   padding-top:60px !important;  }  .vxs-pb-60 {   padding-bottom:60px !important;  }  .vxs-pl-60 {   padding-left:60px !important;  }  .vxs-pr-60 {   padding-right:60px !important;  }  .vxs-px-65 {   padding-right:65px !important;   padding-left:65px !important;  }  .vxs-py-65 {   padding-top:65px !important;   padding-bottom:65px !important;  }  .vxs-pt-65 {   padding-top:65px !important;  }  .vxs-pb-65 {   padding-bottom:65px !important;  }  .vxs-pl-65 {   padding-left:65px !important;  }  .vxs-pr-65 {   padding-right:65px !important;  }  .vxs-px-70 {   padding-right:70px !important;   padding-left:70px !important;  }  .vxs-py-70 {   padding-top:70px !important;   padding-bottom:70px !important;  }  .vxs-pt-70 {   padding-top:70px !important;  }  .vxs-pb-70 {   padding-bottom:70px !important;  }  .vxs-pl-70 {   padding-left:70px !important;  }  .vxs-pr-70 {   padding-right:70px !important;  }  .vxs-px-75 {   padding-right:75px !important;   padding-left:75px !important;  }  .vxs-py-75 {   padding-top:75px !important;   padding-bottom:75px !important;  }  .vxs-pt-75 {   padding-top:75px !important;  }  .vxs-pb-75 {   padding-bottom:75px !important;  }  .vxs-pl-75 {   padding-left:75px !important;  }  .vxs-pr-75 {   padding-right:75px !important;  }  .vxs-px-80 {   padding-right:80px !important;   padding-left:80px !important;  }  .vxs-py-80 {   padding-top:80px !important;   padding-bottom:80px !important;  }  .vxs-pt-80 {   padding-top:80px !important;  }  .vxs-pb-80 {   padding-bottom:80px !important;  }  .vxs-pl-80 {   padding-left:80px !important;  }  .vxs-pr-80 {   padding-right:80px !important;  }  .vxs-px-85 {   padding-right:85px !important;   padding-left:85px !important;  }  .vxs-py-85 {   padding-top:85px !important;   padding-bottom:85px !important;  }  .vxs-pt-85 {   padding-top:85px !important;  }  .vxs-pb-85 {   padding-bottom:85px !important;  }  .vxs-pl-85 {   padding-left:85px !important;  }  .vxs-pr-85 {   padding-right:85px !important;  }  .vxs-px-90 {   padding-right:90px !important;   padding-left:90px !important;  }  .vxs-py-90 {   padding-top:90px !important;   padding-bottom:90px !important;  }  .vxs-pt-90 {   padding-top:90px !important;  }  .vxs-pb-90 {   padding-bottom:90px !important;  }  .vxs-pl-90 {   padding-left:90px !important;  }  .vxs-pr-90 {   padding-right:90px !important;  }  .vxs-px-95 {   padding-right:95px !important;   padding-left:95px !important;  }  .vxs-py-95 {   padding-top:95px !important;   padding-bottom:95px !important;  }  .vxs-pt-95 {   padding-top:95px !important;  }  .vxs-pb-95 {   padding-bottom:95px !important;  }  .vxs-pl-95 {   padding-left:95px !important;  }  .vxs-pr-95 {   padding-right:95px !important;  }  .vxs-px-100 {   padding-right:100px !important;   padding-left:100px !important;  }  .vxs-py-100 {   padding-top:100px !important;   padding-bottom:100px !important;  }  .vxs-pt-100 {   padding-top:100px !important;  }  .vxs-pb-100 {   padding-bottom:100px !important;  }  .vxs-pl-100 {   padding-left:100px !important;  }  .vxs-pr-100 {   padding-right:100px !important;  }  .vxs-px-105 {   padding-right:105px !important;   padding-left:105px !important;  }  .vxs-py-105 {   padding-top:105px !important;   padding-bottom:105px !important;  }  .vxs-pt-105 {   padding-top:105px !important;  }  .vxs-pb-105 {   padding-bottom:105px !important;  }  .vxs-pl-105 {   padding-left:105px !important;  }  .vxs-pr-105 {   padding-right:105px !important;  }  .vxs-px-110 {   padding-right:110px !important;   padding-left:110px !important;  }  .vxs-py-110 {   padding-top:110px !important;   padding-bottom:110px !important;  }  .vxs-pt-110 {   padding-top:110px !important;  }  .vxs-pb-110 {   padding-bottom:110px !important;  }  .vxs-pl-110 {   padding-left:110px !important;  }  .vxs-pr-110 {   padding-right:110px !important;  }  .vxs-px-115 {   padding-right:115px !important;   padding-left:115px !important;  }  .vxs-py-115 {   padding-top:115px !important;   padding-bottom:115px !important;  }  .vxs-pt-115 {   padding-top:115px !important;  }  .vxs-pb-115 {   padding-bottom:115px !important;  }  .vxs-pl-115 {   padding-left:115px !important;  }  .vxs-pr-115 {   padding-right:115px !important;  }  .vxs-px-120 {   padding-right:120px !important;   padding-left:120px !important;  }  .vxs-py-120 {   padding-top:120px !important;   padding-bottom:120px !important;  }  .vxs-pt-120 {   padding-top:120px !important;  }  .vxs-pb-120 {   padding-bottom:120px !important;  }  .vxs-pl-120 {   padding-left:120px !important;  }  .vxs-pr-120 {   padding-right:120px !important;  }  .vxs-px-125 {   padding-right:125px !important;   padding-left:125px !important;  }  .vxs-py-125 {   padding-top:125px !important;   padding-bottom:125px !important;  }  .vxs-pt-125 {   padding-top:125px !important;  }  .vxs-pb-125 {   padding-bottom:125px !important;  }  .vxs-pl-125 {   padding-left:125px !important;  }  .vxs-pr-125 {   padding-right:125px !important;  }  .vxs-px-130 {   padding-right:130px !important;   padding-left:130px !important;  }  .vxs-py-130 {   padding-top:130px !important;   padding-bottom:130px !important;  }  .vxs-pt-130 {   padding-top:130px !important;  }  .vxs-pb-130 {   padding-bottom:130px !important;  }  .vxs-pl-130 {   padding-left:130px !important;  }  .vxs-pr-130 {   padding-right:130px !important;  }  .vxs-px-135 {   padding-right:135px !important;   padding-left:135px !important;  }  .vxs-py-135 {   padding-top:135px !important;   padding-bottom:135px !important;  }  .vxs-pt-135 {   padding-top:135px !important;  }  .vxs-pb-135 {   padding-bottom:135px !important;  }  .vxs-pl-135 {   padding-left:135px !important;  }  .vxs-pr-135 {   padding-right:135px !important;  }  .vxs-px-140 {   padding-right:140px !important;   padding-left:140px !important;  }  .vxs-py-140 {   padding-top:140px !important;   padding-bottom:140px !important;  }  .vxs-pt-140 {   padding-top:140px !important;  }  .vxs-pb-140 {   padding-bottom:140px !important;  }  .vxs-pl-140 {   padding-left:140px !important;  }  .vxs-pr-140 {   padding-right:140px !important;  }  .vxs-px-145 {   padding-right:145px !important;   padding-left:145px !important;  }  .vxs-py-145 {   padding-top:145px !important;   padding-bottom:145px !important;  }  .vxs-pt-145 {   padding-top:145px !important;  }  .vxs-pb-145 {   padding-bottom:145px !important;  }  .vxs-pl-145 {   padding-left:145px !important;  }  .vxs-pr-145 {   padding-right:145px !important;  }  .vxs-px-150 {   padding-right:150px !important;   padding-left:150px !important;  }  .vxs-py-150 {   padding-top:150px !important;   padding-bottom:150px !important;  }  .vxs-pt-150 {   padding-top:150px !important;  }  .vxs-pb-150 {   padding-bottom:150px !important;  }  .vxs-pl-150 {   padding-left:150px !important;  }  .vxs-pr-150 {   padding-right:150px !important;  }  .vxs-px-0 {   padding-right:0 !important;   padding-left:0 !important;  }  .vxs-py-0 {   padding-top:0 !important;   padding-bottom:0 !important;  }  .vxs-pt-0 {   padding-top:0 !important;  }  .vxs-pb-0 {   padding-bottom:0 !important;  }  .vxs-pl-0 {   padding-left:0 !important;  }  .vxs-pr-0 {   padding-right:0 !important;  } } @media (max-width:1024px) {  .ltm-px-5 {   padding-right:5px !important;   padding-left:5px !important;  }  .ltm-py-5 {   padding-top:5px !important;   padding-bottom:5px !important;  }  .ltm-pt-5 {   padding-top:5px !important;  }  .ltm-pb-5 {   padding-bottom:5px !important;  }  .ltm-pl-5 {   padding-left:5px !important;  }  .ltm-pr-5 {   padding-right:5px !important;  }  .ltm-px-10 {   padding-right:10px !important;   padding-left:10px !important;  }  .ltm-py-10 {   padding-top:10px !important;   padding-bottom:10px !important;  }  .ltm-pt-10 {   padding-top:10px !important;  }  .ltm-pb-10 {   padding-bottom:10px !important;  }  .ltm-pl-10 {   padding-left:10px !important;  }  .ltm-pr-10 {   padding-right:10px !important;  }  .ltm-px-15 {   padding-right:15px !important;   padding-left:15px !important;  }  .ltm-py-15 {   padding-top:15px !important;   padding-bottom:15px !important;  }  .ltm-pt-15 {   padding-top:15px !important;  }  .ltm-pb-15 {   padding-bottom:15px !important;  }  .ltm-pl-15 {   padding-left:15px !important;  }  .ltm-pr-15 {   padding-right:15px !important;  }  .ltm-px-20 {   padding-right:20px !important;   padding-left:20px !important;  }  .ltm-py-20 {   padding-top:20px !important;   padding-bottom:20px !important;  }  .ltm-pt-20 {   padding-top:20px !important;  }  .ltm-pb-20 {   padding-bottom:20px !important;  }  .ltm-pl-20 {   padding-left:20px !important;  }  .ltm-pr-20 {   padding-right:20px !important;  }  .ltm-px-25 {   padding-right:25px !important;   padding-left:25px !important;  }  .ltm-py-25 {   padding-top:25px !important;   padding-bottom:25px !important;  }  .ltm-pt-25 {   padding-top:25px !important;  }  .ltm-pb-25 {   padding-bottom:25px !important;  }  .ltm-pl-25 {   padding-left:25px !important;  }  .ltm-pr-25 {   padding-right:25px !important;  }  .ltm-px-30 {   padding-right:30px !important;   padding-left:30px !important;  }  .ltm-py-30 {   padding-top:30px !important;   padding-bottom:30px !important;  }  .ltm-pt-30 {   padding-top:30px !important;  }  .ltm-pb-30 {   padding-bottom:30px !important;  }  .ltm-pl-30 {   padding-left:30px !important;  }  .ltm-pr-30 {   padding-right:30px !important;  }  .ltm-px-35 {   padding-right:35px !important;   padding-left:35px !important;  }  .ltm-py-35 {   padding-top:35px !important;   padding-bottom:35px !important;  }  .ltm-pt-35 {   padding-top:35px !important;  }  .ltm-pb-35 {   padding-bottom:35px !important;  }  .ltm-pl-35 {   padding-left:35px !important;  }  .ltm-pr-35 {   padding-right:35px !important;  }  .ltm-px-40 {   padding-right:40px !important;   padding-left:40px !important;  }  .ltm-py-40 {   padding-top:40px !important;   padding-bottom:40px !important;  }  .ltm-pt-40 {   padding-top:40px !important;  }  .ltm-pb-40 {   padding-bottom:40px !important;  }  .ltm-pl-40 {   padding-left:40px !important;  }  .ltm-pr-40 {   padding-right:40px !important;  }  .ltm-px-45 {   padding-right:45px !important;   padding-left:45px !important;  }  .ltm-py-45 {   padding-top:45px !important;   padding-bottom:45px !important;  }  .ltm-pt-45 {   padding-top:45px !important;  }  .ltm-pb-45 {   padding-bottom:45px !important;  }  .ltm-pl-45 {   padding-left:45px !important;  }  .ltm-pr-45 {   padding-right:45px !important;  }  .ltm-px-50 {   padding-right:50px !important;   padding-left:50px !important;  }  .ltm-py-50 {   padding-top:50px !important;   padding-bottom:50px !important;  }  .ltm-pt-50 {   padding-top:50px !important;  }  .ltm-pb-50 {   padding-bottom:50px !important;  }  .ltm-pl-50 {   padding-left:50px !important;  }  .ltm-pr-50 {   padding-right:50px !important;  }  .ltm-px-55 {   padding-right:55px !important;   padding-left:55px !important;  }  .ltm-py-55 {   padding-top:55px !important;   padding-bottom:55px !important;  }  .ltm-pt-55 {   padding-top:55px !important;  }  .ltm-pb-55 {   padding-bottom:55px !important;  }  .ltm-pl-55 {   padding-left:55px !important;  }  .ltm-pr-55 {   padding-right:55px !important;  }  .ltm-px-60 {   padding-right:60px !important;   padding-left:60px !important;  }  .ltm-py-60 {   padding-top:60px !important;   padding-bottom:60px !important;  }  .ltm-pt-60 {   padding-top:60px !important;  }  .ltm-pb-60 {   padding-bottom:60px !important;  }  .ltm-pl-60 {   padding-left:60px !important;  }  .ltm-pr-60 {   padding-right:60px !important;  }  .ltm-px-65 {   padding-right:65px !important;   padding-left:65px !important;  }  .ltm-py-65 {   padding-top:65px !important;   padding-bottom:65px !important;  }  .ltm-pt-65 {   padding-top:65px !important;  }  .ltm-pb-65 {   padding-bottom:65px !important;  }  .ltm-pl-65 {   padding-left:65px !important;  }  .ltm-pr-65 {   padding-right:65px !important;  }  .ltm-px-70 {   padding-right:70px !important;   padding-left:70px !important;  }  .ltm-py-70 {   padding-top:70px !important;   padding-bottom:70px !important;  }  .ltm-pt-70 {   padding-top:70px !important;  }  .ltm-pb-70 {   padding-bottom:70px !important;  }  .ltm-pl-70 {   padding-left:70px !important;  }  .ltm-pr-70 {   padding-right:70px !important;  }  .ltm-px-75 {   padding-right:75px !important;   padding-left:75px !important;  }  .ltm-py-75 {   padding-top:75px !important;   padding-bottom:75px !important;  }  .ltm-pt-75 {   padding-top:75px !important;  }  .ltm-pb-75 {   padding-bottom:75px !important;  }  .ltm-pl-75 {   padding-left:75px !important;  }  .ltm-pr-75 {   padding-right:75px !important;  }  .ltm-px-80 {   padding-right:80px !important;   padding-left:80px !important;  }  .ltm-py-80 {   padding-top:80px !important;   padding-bottom:80px !important;  }  .ltm-pt-80 {   padding-top:80px !important;  }  .ltm-pb-80 {   padding-bottom:80px !important;  }  .ltm-pl-80 {   padding-left:80px !important;  }  .ltm-pr-80 {   padding-right:80px !important;  }  .ltm-px-85 {   padding-right:85px !important;   padding-left:85px !important;  }  .ltm-py-85 {   padding-top:85px !important;   padding-bottom:85px !important;  }  .ltm-pt-85 {   padding-top:85px !important;  }  .ltm-pb-85 {   padding-bottom:85px !important;  }  .ltm-pl-85 {   padding-left:85px !important;  }  .ltm-pr-85 {   padding-right:85px !important;  }  .ltm-px-90 {   padding-right:90px !important;   padding-left:90px !important;  }  .ltm-py-90 {   padding-top:90px !important;   padding-bottom:90px !important;  }  .ltm-pt-90 {   padding-top:90px !important;  }  .ltm-pb-90 {   padding-bottom:90px !important;  }  .ltm-pl-90 {   padding-left:90px !important;  }  .ltm-pr-90 {   padding-right:90px !important;  }  .ltm-px-95 {   padding-right:95px !important;   padding-left:95px !important;  }  .ltm-py-95 {   padding-top:95px !important;   padding-bottom:95px !important;  }  .ltm-pt-95 {   padding-top:95px !important;  }  .ltm-pb-95 {   padding-bottom:95px !important;  }  .ltm-pl-95 {   padding-left:95px !important;  }  .ltm-pr-95 {   padding-right:95px !important;  }  .ltm-px-100 {   padding-right:100px !important;   padding-left:100px !important;  }  .ltm-py-100 {   padding-top:100px !important;   padding-bottom:100px !important;  }  .ltm-pt-100 {   padding-top:100px !important;  }  .ltm-pb-100 {   padding-bottom:100px !important;  }  .ltm-pl-100 {   padding-left:100px !important;  }  .ltm-pr-100 {   padding-right:100px !important;  }  .ltm-px-105 {   padding-right:105px !important;   padding-left:105px !important;  }  .ltm-py-105 {   padding-top:105px !important;   padding-bottom:105px !important;  }  .ltm-pt-105 {   padding-top:105px !important;  }  .ltm-pb-105 {   padding-bottom:105px !important;  }  .ltm-pl-105 {   padding-left:105px !important;  }  .ltm-pr-105 {   padding-right:105px !important;  }  .ltm-px-110 {   padding-right:110px !important;   padding-left:110px !important;  }  .ltm-py-110 {   padding-top:110px !important;   padding-bottom:110px !important;  }  .ltm-pt-110 {   padding-top:110px !important;  }  .ltm-pb-110 {   padding-bottom:110px !important;  }  .ltm-pl-110 {   padding-left:110px !important;  }  .ltm-pr-110 {   padding-right:110px !important;  }  .ltm-px-115 {   padding-right:115px !important;   padding-left:115px !important;  }  .ltm-py-115 {   padding-top:115px !important;   padding-bottom:115px !important;  }  .ltm-pt-115 {   padding-top:115px !important;  }  .ltm-pb-115 {   padding-bottom:115px !important;  }  .ltm-pl-115 {   padding-left:115px !important;  }  .ltm-pr-115 {   padding-right:115px !important;  }  .ltm-px-120 {   padding-right:120px !important;   padding-left:120px !important;  }  .ltm-py-120 {   padding-top:120px !important;   padding-bottom:120px !important;  }  .ltm-pt-120 {   padding-top:120px !important;  }  .ltm-pb-120 {   padding-bottom:120px !important;  }  .ltm-pl-120 {   padding-left:120px !important;  }  .ltm-pr-120 {   padding-right:120px !important;  }  .ltm-px-125 {   padding-right:125px !important;   padding-left:125px !important;  }  .ltm-py-125 {   padding-top:125px !important;   padding-bottom:125px !important;  }  .ltm-pt-125 {   padding-top:125px !important;  }  .ltm-pb-125 {   padding-bottom:125px !important;  }  .ltm-pl-125 {   padding-left:125px !important;  }  .ltm-pr-125 {   padding-right:125px !important;  }  .ltm-px-130 {   padding-right:130px !important;   padding-left:130px !important;  }  .ltm-py-130 {   padding-top:130px !important;   padding-bottom:130px !important;  }  .ltm-pt-130 {   padding-top:130px !important;  }  .ltm-pb-130 {   padding-bottom:130px !important;  }  .ltm-pl-130 {   padding-left:130px !important;  }  .ltm-pr-130 {   padding-right:130px !important;  }  .ltm-px-135 {   padding-right:135px !important;   padding-left:135px !important;  }  .ltm-py-135 {   padding-top:135px !important;   padding-bottom:135px !important;  }  .ltm-pt-135 {   padding-top:135px !important;  }  .ltm-pb-135 {   padding-bottom:135px !important;  }  .ltm-pl-135 {   padding-left:135px !important;  }  .ltm-pr-135 {   padding-right:135px !important;  }  .ltm-px-140 {   padding-right:140px !important;   padding-left:140px !important;  }  .ltm-py-140 {   padding-top:140px !important;   padding-bottom:140px !important;  }  .ltm-pt-140 {   padding-top:140px !important;  }  .ltm-pb-140 {   padding-bottom:140px !important;  }  .ltm-pl-140 {   padding-left:140px !important;  }  .ltm-pr-140 {   padding-right:140px !important;  }  .ltm-px-145 {   padding-right:145px !important;   padding-left:145px !important;  }  .ltm-py-145 {   padding-top:145px !important;   padding-bottom:145px !important;  }  .ltm-pt-145 {   padding-top:145px !important;  }  .ltm-pb-145 {   padding-bottom:145px !important;  }  .ltm-pl-145 {   padding-left:145px !important;  }  .ltm-pr-145 {   padding-right:145px !important;  }  .ltm-px-150 {   padding-right:150px !important;   padding-left:150px !important;  }  .ltm-py-150 {   padding-top:150px !important;   padding-bottom:150px !important;  }  .ltm-pt-150 {   padding-top:150px !important;  }  .ltm-pb-150 {   padding-bottom:150px !important;  }  .ltm-pl-150 {   padding-left:150px !important;  }  .ltm-pr-150 {   padding-right:150px !important;  }  .ltm-px-0 {   padding-right:0 !important;   padding-left:0 !important;  }  .ltm-py-0 {   padding-top:0 !important;   padding-bottom:0 !important;  }  .ltm-pt-0 {   padding-top:0 !important;  }  .ltm-pb-0 {   padding-bottom:0 !important;  }  .ltm-pl-0 {   padding-left:0 !important;  }  .ltm-pr-0 {   padding-right:0 !important;  } } @media (min-width:992px) and (max-width:1024px) {  .nhb-px-5 {   padding-right:5px !important;   padding-left:5px !important;  }  .nhb-py-5 {   padding-top:5px !important;   padding-bottom:5px !important;  }  .nhb-pt-5 {   padding-top:5px !important;  }  .nhb-pb-5 {   padding-bottom:5px !important;  }  .nhb-pl-5 {   padding-left:5px !important;  }  .nhb-pr-5 {   padding-right:5px !important;  }  .nhb-px-10 {   padding-right:10px !important;   padding-left:10px !important;  }  .nhb-py-10 {   padding-top:10px !important;   padding-bottom:10px !important;  }  .nhb-pt-10 {   padding-top:10px !important;  }  .nhb-pb-10 {   padding-bottom:10px !important;  }  .nhb-pl-10 {   padding-left:10px !important;  }  .nhb-pr-10 {   padding-right:10px !important;  }  .nhb-px-15 {   padding-right:15px !important;   padding-left:15px !important;  }  .nhb-py-15 {   padding-top:15px !important;   padding-bottom:15px !important;  }  .nhb-pt-15 {   padding-top:15px !important;  }  .nhb-pb-15 {   padding-bottom:15px !important;  }  .nhb-pl-15 {   padding-left:15px !important;  }  .nhb-pr-15 {   padding-right:15px !important;  }  .nhb-px-20 {   padding-right:20px !important;   padding-left:20px !important;  }  .nhb-py-20 {   padding-top:20px !important;   padding-bottom:20px !important;  }  .nhb-pt-20 {   padding-top:20px !important;  }  .nhb-pb-20 {   padding-bottom:20px !important;  }  .nhb-pl-20 {   padding-left:20px !important;  }  .nhb-pr-20 {   padding-right:20px !important;  }  .nhb-px-25 {   padding-right:25px !important;   padding-left:25px !important;  }  .nhb-py-25 {   padding-top:25px !important;   padding-bottom:25px !important;  }  .nhb-pt-25 {   padding-top:25px !important;  }  .nhb-pb-25 {   padding-bottom:25px !important;  }  .nhb-pl-25 {   padding-left:25px !important;  }  .nhb-pr-25 {   padding-right:25px !important;  }  .nhb-px-30 {   padding-right:30px !important;   padding-left:30px !important;  }  .nhb-py-30 {   padding-top:30px !important;   padding-bottom:30px !important;  }  .nhb-pt-30 {   padding-top:30px !important;  }  .nhb-pb-30 {   padding-bottom:30px !important;  }  .nhb-pl-30 {   padding-left:30px !important;  }  .nhb-pr-30 {   padding-right:30px !important;  }  .nhb-px-35 {   padding-right:35px !important;   padding-left:35px !important;  }  .nhb-py-35 {   padding-top:35px !important;   padding-bottom:35px !important;  }  .nhb-pt-35 {   padding-top:35px !important;  }  .nhb-pb-35 {   padding-bottom:35px !important;  }  .nhb-pl-35 {   padding-left:35px !important;  }  .nhb-pr-35 {   padding-right:35px !important;  }  .nhb-px-40 {   padding-right:40px !important;   padding-left:40px !important;  }  .nhb-py-40 {   padding-top:40px !important;   padding-bottom:40px !important;  }  .nhb-pt-40 {   padding-top:40px !important;  }  .nhb-pb-40 {   padding-bottom:40px !important;  }  .nhb-pl-40 {   padding-left:40px !important;  }  .nhb-pr-40 {   padding-right:40px !important;  }  .nhb-px-45 {   padding-right:45px !important;   padding-left:45px !important;  }  .nhb-py-45 {   padding-top:45px !important;   padding-bottom:45px !important;  }  .nhb-pt-45 {   padding-top:45px !important;  }  .nhb-pb-45 {   padding-bottom:45px !important;  }  .nhb-pl-45 {   padding-left:45px !important;  }  .nhb-pr-45 {   padding-right:45px !important;  }  .nhb-px-50 {   padding-right:50px !important;   padding-left:50px !important;  }  .nhb-py-50 {   padding-top:50px !important;   padding-bottom:50px !important;  }  .nhb-pt-50 {   padding-top:50px !important;  }  .nhb-pb-50 {   padding-bottom:50px !important;  }  .nhb-pl-50 {   padding-left:50px !important;  }  .nhb-pr-50 {   padding-right:50px !important;  }  .nhb-px-55 {   padding-right:55px !important;   padding-left:55px !important;  }  .nhb-py-55 {   padding-top:55px !important;   padding-bottom:55px !important;  }  .nhb-pt-55 {   padding-top:55px !important;  }  .nhb-pb-55 {   padding-bottom:55px !important;  }  .nhb-pl-55 {   padding-left:55px !important;  }  .nhb-pr-55 {   padding-right:55px !important;  }  .nhb-px-60 {   padding-right:60px !important;   padding-left:60px !important;  }  .nhb-py-60 {   padding-top:60px !important;   padding-bottom:60px !important;  }  .nhb-pt-60 {   padding-top:60px !important;  }  .nhb-pb-60 {   padding-bottom:60px !important;  }  .nhb-pl-60 {   padding-left:60px !important;  }  .nhb-pr-60 {   padding-right:60px !important;  }  .nhb-px-65 {   padding-right:65px !important;   padding-left:65px !important;  }  .nhb-py-65 {   padding-top:65px !important;   padding-bottom:65px !important;  }  .nhb-pt-65 {   padding-top:65px !important;  }  .nhb-pb-65 {   padding-bottom:65px !important;  }  .nhb-pl-65 {   padding-left:65px !important;  }  .nhb-pr-65 {   padding-right:65px !important;  }  .nhb-px-70 {   padding-right:70px !important;   padding-left:70px !important;  }  .nhb-py-70 {   padding-top:70px !important;   padding-bottom:70px !important;  }  .nhb-pt-70 {   padding-top:70px !important;  }  .nhb-pb-70 {   padding-bottom:70px !important;  }  .nhb-pl-70 {   padding-left:70px !important;  }  .nhb-pr-70 {   padding-right:70px !important;  }  .nhb-px-75 {   padding-right:75px !important;   padding-left:75px !important;  }  .nhb-py-75 {   padding-top:75px !important;   padding-bottom:75px !important;  }  .nhb-pt-75 {   padding-top:75px !important;  }  .nhb-pb-75 {   padding-bottom:75px !important;  }  .nhb-pl-75 {   padding-left:75px !important;  }  .nhb-pr-75 {   padding-right:75px !important;  }  .nhb-px-80 {   padding-right:80px !important;   padding-left:80px !important;  }  .nhb-py-80 {   padding-top:80px !important;   padding-bottom:80px !important;  }  .nhb-pt-80 {   padding-top:80px !important;  }  .nhb-pb-80 {   padding-bottom:80px !important;  }  .nhb-pl-80 {   padding-left:80px !important;  }  .nhb-pr-80 {   padding-right:80px !important;  }  .nhb-px-85 {   padding-right:85px !important;   padding-left:85px !important;  }  .nhb-py-85 {   padding-top:85px !important;   padding-bottom:85px !important;  }  .nhb-pt-85 {   padding-top:85px !important;  }  .nhb-pb-85 {   padding-bottom:85px !important;  }  .nhb-pl-85 {   padding-left:85px !important;  }  .nhb-pr-85 {   padding-right:85px !important;  }  .nhb-px-90 {   padding-right:90px !important;   padding-left:90px !important;  }  .nhb-py-90 {   padding-top:90px !important;   padding-bottom:90px !important;  }  .nhb-pt-90 {   padding-top:90px !important;  }  .nhb-pb-90 {   padding-bottom:90px !important;  }  .nhb-pl-90 {   padding-left:90px !important;  }  .nhb-pr-90 {   padding-right:90px !important;  }  .nhb-px-95 {   padding-right:95px !important;   padding-left:95px !important;  }  .nhb-py-95 {   padding-top:95px !important;   padding-bottom:95px !important;  }  .nhb-pt-95 {   padding-top:95px !important;  }  .nhb-pb-95 {   padding-bottom:95px !important;  }  .nhb-pl-95 {   padding-left:95px !important;  }  .nhb-pr-95 {   padding-right:95px !important;  }  .nhb-px-100 {   padding-right:100px !important;   padding-left:100px !important;  }  .nhb-py-100 {   padding-top:100px !important;   padding-bottom:100px !important;  }  .nhb-pt-100 {   padding-top:100px !important;  }  .nhb-pb-100 {   padding-bottom:100px !important;  }  .nhb-pl-100 {   padding-left:100px !important;  }  .nhb-pr-100 {   padding-right:100px !important;  }  .nhb-px-105 {   padding-right:105px !important;   padding-left:105px !important;  }  .nhb-py-105 {   padding-top:105px !important;   padding-bottom:105px !important;  }  .nhb-pt-105 {   padding-top:105px !important;  }  .nhb-pb-105 {   padding-bottom:105px !important;  }  .nhb-pl-105 {   padding-left:105px !important;  }  .nhb-pr-105 {   padding-right:105px !important;  }  .nhb-px-110 {   padding-right:110px !important;   padding-left:110px !important;  }  .nhb-py-110 {   padding-top:110px !important;   padding-bottom:110px !important;  }  .nhb-pt-110 {   padding-top:110px !important;  }  .nhb-pb-110 {   padding-bottom:110px !important;  }  .nhb-pl-110 {   padding-left:110px !important;  }  .nhb-pr-110 {   padding-right:110px !important;  }  .nhb-px-115 {   padding-right:115px !important;   padding-left:115px !important;  }  .nhb-py-115 {   padding-top:115px !important;   padding-bottom:115px !important;  }  .nhb-pt-115 {   padding-top:115px !important;  }  .nhb-pb-115 {   padding-bottom:115px !important;  }  .nhb-pl-115 {   padding-left:115px !important;  }  .nhb-pr-115 {   padding-right:115px !important;  }  .nhb-px-120 {   padding-right:120px !important;   padding-left:120px !important;  }  .nhb-py-120 {   padding-top:120px !important;   padding-bottom:120px !important;  }  .nhb-pt-120 {   padding-top:120px !important;  }  .nhb-pb-120 {   padding-bottom:120px !important;  }  .nhb-pl-120 {   padding-left:120px !important;  }  .nhb-pr-120 {   padding-right:120px !important;  }  .nhb-px-125 {   padding-right:125px !important;   padding-left:125px !important;  }  .nhb-py-125 {   padding-top:125px !important;   padding-bottom:125px !important;  }  .nhb-pt-125 {   padding-top:125px !important;  }  .nhb-pb-125 {   padding-bottom:125px !important;  }  .nhb-pl-125 {   padding-left:125px !important;  }  .nhb-pr-125 {   padding-right:125px !important;  }  .nhb-px-130 {   padding-right:130px !important;   padding-left:130px !important;  }  .nhb-py-130 {   padding-top:130px !important;   padding-bottom:130px !important;  }  .nhb-pt-130 {   padding-top:130px !important;  }  .nhb-pb-130 {   padding-bottom:130px !important;  }  .nhb-pl-130 {   padding-left:130px !important;  }  .nhb-pr-130 {   padding-right:130px !important;  }  .nhb-px-135 {   padding-right:135px !important;   padding-left:135px !important;  }  .nhb-py-135 {   padding-top:135px !important;   padding-bottom:135px !important;  }  .nhb-pt-135 {   padding-top:135px !important;  }  .nhb-pb-135 {   padding-bottom:135px !important;  }  .nhb-pl-135 {   padding-left:135px !important;  }  .nhb-pr-135 {   padding-right:135px !important;  }  .nhb-px-140 {   padding-right:140px !important;   padding-left:140px !important;  }  .nhb-py-140 {   padding-top:140px !important;   padding-bottom:140px !important;  }  .nhb-pt-140 {   padding-top:140px !important;  }  .nhb-pb-140 {   padding-bottom:140px !important;  }  .nhb-pl-140 {   padding-left:140px !important;  }  .nhb-pr-140 {   padding-right:140px !important;  }  .nhb-px-145 {   padding-right:145px !important;   padding-left:145px !important;  }  .nhb-py-145 {   padding-top:145px !important;   padding-bottom:145px !important;  }  .nhb-pt-145 {   padding-top:145px !important;  }  .nhb-pb-145 {   padding-bottom:145px !important;  }  .nhb-pl-145 {   padding-left:145px !important;  }  .nhb-pr-145 {   padding-right:145px !important;  }  .nhb-px-150 {   padding-right:150px !important;   padding-left:150px !important;  }  .nhb-py-150 {   padding-top:150px !important;   padding-bottom:150px !important;  }  .nhb-pt-150 {   padding-top:150px !important;  }  .nhb-pb-150 {   padding-bottom:150px !important;  }  .nhb-pl-150 {   padding-left:150px !important;  }  .nhb-pr-150 {   padding-right:150px !important;  }  .nhb-px-0 {   padding-right:0 !important;   padding-left:0 !important;  }  .nhb-py-0 {   padding-top:0 !important;   padding-bottom:0 !important;  }  .nhb-pt-0 {   padding-top:0 !important;  }  .nhb-pb-0 {   padding-bottom:0 !important;  }  .nhb-pl-0 {   padding-left:0 !important;  }  .nhb-pr-0 {   padding-right:0 !important;  } } .mx-0 {  margin-right:0 !important;  margin-left:0 !important; } .my-0 {  margin-top:0 !important;  margin-bottom:0 !important; } .mt-0 {  margin-top:0 !important; } .mb-0 {  margin-bottom:0 !important; } .ml-0 {  margin-left:0 !important; } .mr-0 {  margin-right:0 !important; } .m-0 {  margin:0 !important; } .mx-5 {  margin-right:5px !important;  margin-left:5px !important; } .mx--5 {  margin-right:-5px !important;  margin-left:-5px !important; } .my-5 {  margin-top:5px !important;  margin-bottom:5px !important; } .my--5 {  margin-top:-5px !important;  margin-bottom:-5px !important; } .mt-5 {  margin-top:5px !important; } .mt--5 {  margin-top:-5px !important; } .mb-5 {  margin-bottom:5px !important; } .mb--5 {  margin-bottom:-5px !important; } .ml-5 {  margin-left:5px !important; } .ml--5 {  margin-left:-5px !important; } .mr-5 {  margin-right:5px !important; } .mr--5 {  margin-right:-5px !important; } .mx-10 {  margin-right:10px !important;  margin-left:10px !important; } .mx--10 {  margin-right:-10px !important;  margin-left:-10px !important; } .my-10 {  margin-top:10px !important;  margin-bottom:10px !important; } .my--10 {  margin-top:-10px !important;  margin-bottom:-10px !important; } .mt-10 {  margin-top:10px !important; } .mt--10 {  margin-top:-10px !important; } .mb-10 {  margin-bottom:10px !important; } .mb--10 {  margin-bottom:-10px !important; } .ml-10 {  margin-left:10px !important; } .ml--10 {  margin-left:-10px !important; } .mr-10 {  margin-right:10px !important; } .mr--10 {  margin-right:-10px !important; } .mx-15 {  margin-right:15px !important;  margin-left:15px !important; } .mx--15 {  margin-right:-15px !important;  margin-left:-15px !important; } .my-15 {  margin-top:15px !important;  margin-bottom:15px !important; } .my--15 {  margin-top:-15px !important;  margin-bottom:-15px !important; } .mt-15 {  margin-top:15px !important; } .mt--15 {  margin-top:-15px !important; } .mb-15 {  margin-bottom:15px !important; } .mb--15 {  margin-bottom:-15px !important; } .ml-15 {  margin-left:15px !important; } .ml--15 {  margin-left:-15px !important; } .mr-15 {  margin-right:15px !important; } .mr--15 {  margin-right:-15px !important; } .mx-20 {  margin-right:20px !important;  margin-left:20px !important; } .mx--20 {  margin-right:-20px !important;  margin-left:-20px !important; } .my-20 {  margin-top:20px !important;  margin-bottom:20px !important; } .my--20 {  margin-top:-20px !important;  margin-bottom:-20px !important; } .mt-20 {  margin-top:20px !important; } .mt--20 {  margin-top:-20px !important; } .mb-20 {  margin-bottom:20px !important; } .mb--20 {  margin-bottom:-20px !important; } .ml-20 {  margin-left:20px !important; } .ml--20 {  margin-left:-20px !important; } .mr-20 {  margin-right:20px !important; } .mr--20 {  margin-right:-20px !important; } .mx-25 {  margin-right:25px !important;  margin-left:25px !important; } .mx--25 {  margin-right:-25px !important;  margin-left:-25px !important; } .my-25 {  margin-top:25px !important;  margin-bottom:25px !important; } .my--25 {  margin-top:-25px !important;  margin-bottom:-25px !important; } .mt-25 {  margin-top:25px !important; } .mt--25 {  margin-top:-25px !important; } .mb-25 {  margin-bottom:25px !important; } .mb--25 {  margin-bottom:-25px !important; } .ml-25 {  margin-left:25px !important; } .ml--25 {  margin-left:-25px !important; } .mr-25 {  margin-right:25px !important; } .mr--25 {  margin-right:-25px !important; } .mx-30 {  margin-right:30px !important;  margin-left:30px !important; } .mx--30 {  margin-right:-30px !important;  margin-left:-30px !important; } .my-30 {  margin-top:30px !important;  margin-bottom:30px !important; } .my--30 {  margin-top:-30px !important;  margin-bottom:-30px !important; } .mt-30 {  margin-top:30px !important; } .mt--30 {  margin-top:-30px !important; } .mb-30 {  margin-bottom:30px !important; } .mb--30 {  margin-bottom:-30px !important; } .ml-30 {  margin-left:30px !important; } .ml--30 {  margin-left:-30px !important; } .mr-30 {  margin-right:30px !important; } .mr--30 {  margin-right:-30px !important; } .mx-35 {  margin-right:35px !important;  margin-left:35px !important; } .mx--35 {  margin-right:-35px !important;  margin-left:-35px !important; } .my-35 {  margin-top:35px !important;  margin-bottom:35px !important; } .my--35 {  margin-top:-35px !important;  margin-bottom:-35px !important; } .mt-35 {  margin-top:35px !important; } .mt--35 {  margin-top:-35px !important; } .mb-35 {  margin-bottom:35px !important; } .mb--35 {  margin-bottom:-35px !important; } .ml-35 {  margin-left:35px !important; } .ml--35 {  margin-left:-35px !important; } .mr-35 {  margin-right:35px !important; } .mr--35 {  margin-right:-35px !important; } .mx-40 {  margin-right:40px !important;  margin-left:40px !important; } .mx--40 {  margin-right:-40px !important;  margin-left:-40px !important; } .my-40 {  margin-top:40px !important;  margin-bottom:40px !important; } .my--40 {  margin-top:-40px !important;  margin-bottom:-40px !important; } .mt-40 {  margin-top:40px !important; } .mt--40 {  margin-top:-40px !important; } .mb-40 {  margin-bottom:40px !important; } .mb--40 {  margin-bottom:-40px !important; } .ml-40 {  margin-left:40px !important; } .ml--40 {  margin-left:-40px !important; } .mr-40 {  margin-right:40px !important; } .mr--40 {  margin-right:-40px !important; } .mx-45 {  margin-right:45px !important;  margin-left:45px !important; } .mx--45 {  margin-right:-45px !important;  margin-left:-45px !important; } .my-45 {  margin-top:45px !important;  margin-bottom:45px !important; } .my--45 {  margin-top:-45px !important;  margin-bottom:-45px !important; } .mt-45 {  margin-top:45px !important; } .mt--45 {  margin-top:-45px !important; } .mb-45 {  margin-bottom:45px !important; } .mb--45 {  margin-bottom:-45px !important; } .ml-45 {  margin-left:45px !important; } .ml--45 {  margin-left:-45px !important; } .mr-45 {  margin-right:45px !important; } .mr--45 {  margin-right:-45px !important; } .mx-50 {  margin-right:50px !important;  margin-left:50px !important; } .mx--50 {  margin-right:-50px !important;  margin-left:-50px !important; } .my-50 {  margin-top:50px !important;  margin-bottom:50px !important; } .my--50 {  margin-top:-50px !important;  margin-bottom:-50px !important; } .mt-50 {  margin-top:50px !important; } .mt--50 {  margin-top:-50px !important; } .mb-50 {  margin-bottom:50px !important; } .mb--50 {  margin-bottom:-50px !important; } .ml-50 {  margin-left:50px !important; } .ml--50 {  margin-left:-50px !important; } .mr-50 {  margin-right:50px !important; } .mr--50 {  margin-right:-50px !important; } .mx-55 {  margin-right:55px !important;  margin-left:55px !important; } .mx--55 {  margin-right:-55px !important;  margin-left:-55px !important; } .my-55 {  margin-top:55px !important;  margin-bottom:55px !important; } .my--55 {  margin-top:-55px !important;  margin-bottom:-55px !important; } .mt-55 {  margin-top:55px !important; } .mt--55 {  margin-top:-55px !important; } .mb-55 {  margin-bottom:55px !important; } .mb--55 {  margin-bottom:-55px !important; } .ml-55 {  margin-left:55px !important; } .ml--55 {  margin-left:-55px !important; } .mr-55 {  margin-right:55px !important; } .mr--55 {  margin-right:-55px !important; } .mx-60 {  margin-right:60px !important;  margin-left:60px !important; } .mx--60 {  margin-right:-60px !important;  margin-left:-60px !important; } .my-60 {  margin-top:60px !important;  margin-bottom:60px !important; } .my--60 {  margin-top:-60px !important;  margin-bottom:-60px !important; } .mt-60 {  margin-top:60px !important; } .mt--60 {  margin-top:-60px !important; } .mb-60 {  margin-bottom:60px !important; } .mb--60 {  margin-bottom:-60px !important; } .ml-60 {  margin-left:60px !important; } .ml--60 {  margin-left:-60px !important; } .mr-60 {  margin-right:60px !important; } .mr--60 {  margin-right:-60px !important; } .mx-65 {  margin-right:65px !important;  margin-left:65px !important; } .mx--65 {  margin-right:-65px !important;  margin-left:-65px !important; } .my-65 {  margin-top:65px !important;  margin-bottom:65px !important; } .my--65 {  margin-top:-65px !important;  margin-bottom:-65px !important; } .mt-65 {  margin-top:65px !important; } .mt--65 {  margin-top:-65px !important; } .mb-65 {  margin-bottom:65px !important; } .mb--65 {  margin-bottom:-65px !important; } .ml-65 {  margin-left:65px !important; } .ml--65 {  margin-left:-65px !important; } .mr-65 {  margin-right:65px !important; } .mr--65 {  margin-right:-65px !important; } .mx-70 {  margin-right:70px !important;  margin-left:70px !important; } .mx--70 {  margin-right:-70px !important;  margin-left:-70px !important; } .my-70 {  margin-top:70px !important;  margin-bottom:70px !important; } .my--70 {  margin-top:-70px !important;  margin-bottom:-70px !important; } .mt-70 {  margin-top:70px !important; } .mt--70 {  margin-top:-70px !important; } .mb-70 {  margin-bottom:70px !important; } .mb--70 {  margin-bottom:-70px !important; } .ml-70 {  margin-left:70px !important; } .ml--70 {  margin-left:-70px !important; } .mr-70 {  margin-right:70px !important; } .mr--70 {  margin-right:-70px !important; } .mx-75 {  margin-right:75px !important;  margin-left:75px !important; } .mx--75 {  margin-right:-75px !important;  margin-left:-75px !important; } .my-75 {  margin-top:75px !important;  margin-bottom:75px !important; } .my--75 {  margin-top:-75px !important;  margin-bottom:-75px !important; } .mt-75 {  margin-top:75px !important; } .mt--75 {  margin-top:-75px !important; } .mb-75 {  margin-bottom:75px !important; } .mb--75 {  margin-bottom:-75px !important; } .ml-75 {  margin-left:75px !important; } .ml--75 {  margin-left:-75px !important; } .mr-75 {  margin-right:75px !important; } .mr--75 {  margin-right:-75px !important; } .mx-80 {  margin-right:80px !important;  margin-left:80px !important; } .mx--80 {  margin-right:-80px !important;  margin-left:-80px !important; } .my-80 {  margin-top:80px !important;  margin-bottom:80px !important; } .my--80 {  margin-top:-80px !important;  margin-bottom:-80px !important; } .mt-80 {  margin-top:80px !important; } .mt--80 {  margin-top:-80px !important; } .mb-80 {  margin-bottom:80px !important; } .mb--80 {  margin-bottom:-80px !important; } .ml-80 {  margin-left:80px !important; } .ml--80 {  margin-left:-80px !important; } .mr-80 {  margin-right:80px !important; } .mr--80 {  margin-right:-80px !important; } .mx-85 {  margin-right:85px !important;  margin-left:85px !important; } .mx--85 {  margin-right:-85px !important;  margin-left:-85px !important; } .my-85 {  margin-top:85px !important;  margin-bottom:85px !important; } .my--85 {  margin-top:-85px !important;  margin-bottom:-85px !important; } .mt-85 {  margin-top:85px !important; } .mt--85 {  margin-top:-85px !important; } .mb-85 {  margin-bottom:85px !important; } .mb--85 {  margin-bottom:-85px !important; } .ml-85 {  margin-left:85px !important; } .ml--85 {  margin-left:-85px !important; } .mr-85 {  margin-right:85px !important; } .mr--85 {  margin-right:-85px !important; } .mx-90 {  margin-right:90px !important;  margin-left:90px !important; } .mx--90 {  margin-right:-90px !important;  margin-left:-90px !important; } .my-90 {  margin-top:90px !important;  margin-bottom:90px !important; } .my--90 {  margin-top:-90px !important;  margin-bottom:-90px !important; } .mt-90 {  margin-top:90px !important; } .mt--90 {  margin-top:-90px !important; } .mb-90 {  margin-bottom:90px !important; } .mb--90 {  margin-bottom:-90px !important; } .ml-90 {  margin-left:90px !important; } .ml--90 {  margin-left:-90px !important; } .mr-90 {  margin-right:90px !important; } .mr--90 {  margin-right:-90px !important; } .mx-95 {  margin-right:95px !important;  margin-left:95px !important; } .mx--95 {  margin-right:-95px !important;  margin-left:-95px !important; } .my-95 {  margin-top:95px !important;  margin-bottom:95px !important; } .my--95 {  margin-top:-95px !important;  margin-bottom:-95px !important; } .mt-95 {  margin-top:95px !important; } .mt--95 {  margin-top:-95px !important; } .mb-95 {  margin-bottom:95px !important; } .mb--95 {  margin-bottom:-95px !important; } .ml-95 {  margin-left:95px !important; } .ml--95 {  margin-left:-95px !important; } .mr-95 {  margin-right:95px !important; } .mr--95 {  margin-right:-95px !important; } .mx-100 {  margin-right:100px !important;  margin-left:100px !important; } .mx--100 {  margin-right:-100px !important;  margin-left:-100px !important; } .my-100 {  margin-top:100px !important;  margin-bottom:100px !important; } .my--100 {  margin-top:-100px !important;  margin-bottom:-100px !important; } .mt-100 {  margin-top:100px !important; } .mt--100 {  margin-top:-100px !important; } .mb-100 {  margin-bottom:100px !important; } .mb--100 {  margin-bottom:-100px !important; } .ml-100 {  margin-left:100px !important; } .ml--100 {  margin-left:-100px !important; } .mr-100 {  margin-right:100px !important; } .mr--100 {  margin-right:-100px !important; } .mx-105 {  margin-right:105px !important;  margin-left:105px !important; } .mx--105 {  margin-right:-105px !important;  margin-left:-105px !important; } .my-105 {  margin-top:105px !important;  margin-bottom:105px !important; } .my--105 {  margin-top:-105px !important;  margin-bottom:-105px !important; } .mt-105 {  margin-top:105px !important; } .mt--105 {  margin-top:-105px !important; } .mb-105 {  margin-bottom:105px !important; } .mb--105 {  margin-bottom:-105px !important; } .ml-105 {  margin-left:105px !important; } .ml--105 {  margin-left:-105px !important; } .mr-105 {  margin-right:105px !important; } .mr--105 {  margin-right:-105px !important; } .mx-110 {  margin-right:110px !important;  margin-left:110px !important; } .mx--110 {  margin-right:-110px !important;  margin-left:-110px !important; } .my-110 {  margin-top:110px !important;  margin-bottom:110px !important; } .my--110 {  margin-top:-110px !important;  margin-bottom:-110px !important; } .mt-110 {  margin-top:110px !important; } .mt--110 {  margin-top:-110px !important; } .mb-110 {  margin-bottom:110px !important; } .mb--110 {  margin-bottom:-110px !important; } .ml-110 {  margin-left:110px !important; } .ml--110 {  margin-left:-110px !important; } .mr-110 {  margin-right:110px !important; } .mr--110 {  margin-right:-110px !important; } .mx-115 {  margin-right:115px !important;  margin-left:115px !important; } .mx--115 {  margin-right:-115px !important;  margin-left:-115px !important; } .my-115 {  margin-top:115px !important;  margin-bottom:115px !important; } .my--115 {  margin-top:-115px !important;  margin-bottom:-115px !important; } .mt-115 {  margin-top:115px !important; } .mt--115 {  margin-top:-115px !important; } .mb-115 {  margin-bottom:115px !important; } .mb--115 {  margin-bottom:-115px !important; } .ml-115 {  margin-left:115px !important; } .ml--115 {  margin-left:-115px !important; } .mr-115 {  margin-right:115px !important; } .mr--115 {  margin-right:-115px !important; } .mx-120 {  margin-right:120px !important;  margin-left:120px !important; } .mx--120 {  margin-right:-120px !important;  margin-left:-120px !important; } .my-120 {  margin-top:120px !important;  margin-bottom:120px !important; } .my--120 {  margin-top:-120px !important;  margin-bottom:-120px !important; } .mt-120 {  margin-top:120px !important; } .mt--120 {  margin-top:-120px !important; } .mb-120 {  margin-bottom:120px !important; } .mb--120 {  margin-bottom:-120px !important; } .ml-120 {  margin-left:120px !important; } .ml--120 {  margin-left:-120px !important; } .mr-120 {  margin-right:120px !important; } .mr--120 {  margin-right:-120px !important; } .mx-125 {  margin-right:125px !important;  margin-left:125px !important; } .mx--125 {  margin-right:-125px !important;  margin-left:-125px !important; } .my-125 {  margin-top:125px !important;  margin-bottom:125px !important; } .my--125 {  margin-top:-125px !important;  margin-bottom:-125px !important; } .mt-125 {  margin-top:125px !important; } .mt--125 {  margin-top:-125px !important; } .mb-125 {  margin-bottom:125px !important; } .mb--125 {  margin-bottom:-125px !important; } .ml-125 {  margin-left:125px !important; } .ml--125 {  margin-left:-125px !important; } .mr-125 {  margin-right:125px !important; } .mr--125 {  margin-right:-125px !important; } .mx-130 {  margin-right:130px !important;  margin-left:130px !important; } .mx--130 {  margin-right:-130px !important;  margin-left:-130px !important; } .my-130 {  margin-top:130px !important;  margin-bottom:130px !important; } .my--130 {  margin-top:-130px !important;  margin-bottom:-130px !important; } .mt-130 {  margin-top:130px !important; } .mt--130 {  margin-top:-130px !important; } .mb-130 {  margin-bottom:130px !important; } .mb--130 {  margin-bottom:-130px !important; } .ml-130 {  margin-left:130px !important; } .ml--130 {  margin-left:-130px !important; } .mr-130 {  margin-right:130px !important; } .mr--130 {  margin-right:-130px !important; } .mx-135 {  margin-right:135px !important;  margin-left:135px !important; } .mx--135 {  margin-right:-135px !important;  margin-left:-135px !important; } .my-135 {  margin-top:135px !important;  margin-bottom:135px !important; } .my--135 {  margin-top:-135px !important;  margin-bottom:-135px !important; } .mt-135 {  margin-top:135px !important; } .mt--135 {  margin-top:-135px !important; } .mb-135 {  margin-bottom:135px !important; } .mb--135 {  margin-bottom:-135px !important; } .ml-135 {  margin-left:135px !important; } .ml--135 {  margin-left:-135px !important; } .mr-135 {  margin-right:135px !important; } .mr--135 {  margin-right:-135px !important; } .mx-140 {  margin-right:140px !important;  margin-left:140px !important; } .mx--140 {  margin-right:-140px !important;  margin-left:-140px !important; } .my-140 {  margin-top:140px !important;  margin-bottom:140px !important; } .my--140 {  margin-top:-140px !important;  margin-bottom:-140px !important; } .mt-140 {  margin-top:140px !important; } .mt--140 {  margin-top:-140px !important; } .mb-140 {  margin-bottom:140px !important; } .mb--140 {  margin-bottom:-140px !important; } .ml-140 {  margin-left:140px !important; } .ml--140 {  margin-left:-140px !important; } .mr-140 {  margin-right:140px !important; } .mr--140 {  margin-right:-140px !important; } .mx-145 {  margin-right:145px !important;  margin-left:145px !important; } .mx--145 {  margin-right:-145px !important;  margin-left:-145px !important; } .my-145 {  margin-top:145px !important;  margin-bottom:145px !important; } .my--145 {  margin-top:-145px !important;  margin-bottom:-145px !important; } .mt-145 {  margin-top:145px !important; } .mt--145 {  margin-top:-145px !important; } .mb-145 {  margin-bottom:145px !important; } .mb--145 {  margin-bottom:-145px !important; } .ml-145 {  margin-left:145px !important; } .ml--145 {  margin-left:-145px !important; } .mr-145 {  margin-right:145px !important; } .mr--145 {  margin-right:-145px !important; } .mx-150 {  margin-right:150px !important;  margin-left:150px !important; } .mx--150 {  margin-right:-150px !important;  margin-left:-150px !important; } .my-150 {  margin-top:150px !important;  margin-bottom:150px !important; } .my--150 {  margin-top:-150px !important;  margin-bottom:-150px !important; } .mt-150 {  margin-top:150px !important; } .mt--150 {  margin-top:-150px !important; } .mb-150 {  margin-bottom:150px !important; } .mb--150 {  margin-bottom:-150px !important; } .ml-150 {  margin-left:150px !important; } .ml--150 {  margin-left:-150px !important; } .mr-150 {  margin-right:150px !important; } .mr--150 {  margin-right:-150px !important; } .-mx-5 {  margin-right:5px !important;  margin-left:5px !important; } .-my-5 {  margin-top:5px !important;  margin-bottom:5px !important; } .-mt-5 {  margin-top:5px !important; } .-mb-5 {  margin-bottom:5px !important; } .-ml-5 {  margin-left:5px !important; } .-mr-5 {  margin-right:5px !important; } .-mx-10 {  margin-right:10px !important;  margin-left:10px !important; } .-my-10 {  margin-top:10px !important;  margin-bottom:10px !important; } .-mt-10 {  margin-top:10px !important; } .-mb-10 {  margin-bottom:10px !important; } .-ml-10 {  margin-left:10px !important; } .-mr-10 {  margin-right:10px !important; } .-mx-15 {  margin-right:15px !important;  margin-left:15px !important; } .-my-15 {  margin-top:15px !important;  margin-bottom:15px !important; } .-mt-15 {  margin-top:15px !important; } .-mb-15 {  margin-bottom:15px !important; } .-ml-15 {  margin-left:15px !important; } .-mr-15 {  margin-right:15px !important; } .-mx-20 {  margin-right:20px !important;  margin-left:20px !important; } .-my-20 {  margin-top:20px !important;  margin-bottom:20px !important; } .-mt-20 {  margin-top:20px !important; } .-mb-20 {  margin-bottom:20px !important; } .-ml-20 {  margin-left:20px !important; } .-mr-20 {  margin-right:20px !important; } .-mx-25 {  margin-right:25px !important;  margin-left:25px !important; } .-my-25 {  margin-top:25px !important;  margin-bottom:25px !important; } .-mt-25 {  margin-top:25px !important; } .-mb-25 {  margin-bottom:25px !important; } .-ml-25 {  margin-left:25px !important; } .-mr-25 {  margin-right:25px !important; } .-mx-30 {  margin-right:30px !important;  margin-left:30px !important; } .-my-30 {  margin-top:30px !important;  margin-bottom:30px !important; } .-mt-30 {  margin-top:30px !important; } .-mb-30 {  margin-bottom:30px !important; } .-ml-30 {  margin-left:30px !important; } .-mr-30 {  margin-right:30px !important; } .-mx-35 {  margin-right:35px !important;  margin-left:35px !important; } .-my-35 {  margin-top:35px !important;  margin-bottom:35px !important; } .-mt-35 {  margin-top:35px !important; } .-mb-35 {  margin-bottom:35px !important; } .-ml-35 {  margin-left:35px !important; } .-mr-35 {  margin-right:35px !important; } .-mx-40 {  margin-right:40px !important;  margin-left:40px !important; } .-my-40 {  margin-top:40px !important;  margin-bottom:40px !important; } .-mt-40 {  margin-top:40px !important; } .-mb-40 {  margin-bottom:40px !important; } .-ml-40 {  margin-left:40px !important; } .-mr-40 {  margin-right:40px !important; } .-mx-45 {  margin-right:45px !important;  margin-left:45px !important; } .-my-45 {  margin-top:45px !important;  margin-bottom:45px !important; } .-mt-45 {  margin-top:45px !important; } .-mb-45 {  margin-bottom:45px !important; } .-ml-45 {  margin-left:45px !important; } .-mr-45 {  margin-right:45px !important; } .-mx-50 {  margin-right:50px !important;  margin-left:50px !important; } .-my-50 {  margin-top:50px !important;  margin-bottom:50px !important; } .-mt-50 {  margin-top:50px !important; } .-mb-50 {  margin-bottom:50px !important; } .-ml-50 {  margin-left:50px !important; } .-mr-50 {  margin-right:50px !important; } .-mx-55 {  margin-right:55px !important;  margin-left:55px !important; } .-my-55 {  margin-top:55px !important;  margin-bottom:55px !important; } .-mt-55 {  margin-top:55px !important; } .-mb-55 {  margin-bottom:55px !important; } .-ml-55 {  margin-left:55px !important; } .-mr-55 {  margin-right:55px !important; } .-mx-60 {  margin-right:60px !important;  margin-left:60px !important; } .-my-60 {  margin-top:60px !important;  margin-bottom:60px !important; } .-mt-60 {  margin-top:60px !important; } .-mb-60 {  margin-bottom:60px !important; } .-ml-60 {  margin-left:60px !important; } .-mr-60 {  margin-right:60px !important; } .-mx-65 {  margin-right:65px !important;  margin-left:65px !important; } .-my-65 {  margin-top:65px !important;  margin-bottom:65px !important; } .-mt-65 {  margin-top:65px !important; } .-mb-65 {  margin-bottom:65px !important; } .-ml-65 {  margin-left:65px !important; } .-mr-65 {  margin-right:65px !important; } .-mx-70 {  margin-right:70px !important;  margin-left:70px !important; } .-my-70 {  margin-top:70px !important;  margin-bottom:70px !important; } .-mt-70 {  margin-top:70px !important; } .-mb-70 {  margin-bottom:70px !important; } .-ml-70 {  margin-left:70px !important; } .-mr-70 {  margin-right:70px !important; } .-mx-75 {  margin-right:75px !important;  margin-left:75px !important; } .-my-75 {  margin-top:75px !important;  margin-bottom:75px !important; } .-mt-75 {  margin-top:75px !important; } .-mb-75 {  margin-bottom:75px !important; } .-ml-75 {  margin-left:75px !important; } .-mr-75 {  margin-right:75px !important; } .-mx-80 {  margin-right:80px !important;  margin-left:80px !important; } .-my-80 {  margin-top:80px !important;  margin-bottom:80px !important; } .-mt-80 {  margin-top:80px !important; } .-mb-80 {  margin-bottom:80px !important; } .-ml-80 {  margin-left:80px !important; } .-mr-80 {  margin-right:80px !important; } .-mx-85 {  margin-right:85px !important;  margin-left:85px !important; } .-my-85 {  margin-top:85px !important;  margin-bottom:85px !important; } .-mt-85 {  margin-top:85px !important; } .-mb-85 {  margin-bottom:85px !important; } .-ml-85 {  margin-left:85px !important; } .-mr-85 {  margin-right:85px !important; } .-mx-90 {  margin-right:90px !important;  margin-left:90px !important; } .-my-90 {  margin-top:90px !important;  margin-bottom:90px !important; } .-mt-90 {  margin-top:90px !important; } .-mb-90 {  margin-bottom:90px !important; } .-ml-90 {  margin-left:90px !important; } .-mr-90 {  margin-right:90px !important; } .-mx-95 {  margin-right:95px !important;  margin-left:95px !important; } .-my-95 {  margin-top:95px !important;  margin-bottom:95px !important; } .-mt-95 {  margin-top:95px !important; } .-mb-95 {  margin-bottom:95px !important; } .-ml-95 {  margin-left:95px !important; } .-mr-95 {  margin-right:95px !important; } .-mx-100 {  margin-right:100px !important;  margin-left:100px !important; } .-my-100 {  margin-top:100px !important;  margin-bottom:100px !important; } .-mt-100 {  margin-top:100px !important; } .-mb-100 {  margin-bottom:100px !important; } .-ml-100 {  margin-left:100px !important; } .-mr-100 {  margin-right:100px !important; } .-mx-105 {  margin-right:105px !important;  margin-left:105px !important; } .-my-105 {  margin-top:105px !important;  margin-bottom:105px !important; } .-mt-105 {  margin-top:105px !important; } .-mb-105 {  margin-bottom:105px !important; } .-ml-105 {  margin-left:105px !important; } .-mr-105 {  margin-right:105px !important; } .-mx-110 {  margin-right:110px !important;  margin-left:110px !important; } .-my-110 {  margin-top:110px !important;  margin-bottom:110px !important; } .-mt-110 {  margin-top:110px !important; } .-mb-110 {  margin-bottom:110px !important; } .-ml-110 {  margin-left:110px !important; } .-mr-110 {  margin-right:110px !important; } .-mx-115 {  margin-right:115px !important;  margin-left:115px !important; } .-my-115 {  margin-top:115px !important;  margin-bottom:115px !important; } .-mt-115 {  margin-top:115px !important; } .-mb-115 {  margin-bottom:115px !important; } .-ml-115 {  margin-left:115px !important; } .-mr-115 {  margin-right:115px !important; } .-mx-120 {  margin-right:120px !important;  margin-left:120px !important; } .-my-120 {  margin-top:120px !important;  margin-bottom:120px !important; } .-mt-120 {  margin-top:120px !important; } .-mb-120 {  margin-bottom:120px !important; } .-ml-120 {  margin-left:120px !important; } .-mr-120 {  margin-right:120px !important; } .-mx-125 {  margin-right:125px !important;  margin-left:125px !important; } .-my-125 {  margin-top:125px !important;  margin-bottom:125px !important; } .-mt-125 {  margin-top:125px !important; } .-mb-125 {  margin-bottom:125px !important; } .-ml-125 {  margin-left:125px !important; } .-mr-125 {  margin-right:125px !important; } .-mx-130 {  margin-right:130px !important;  margin-left:130px !important; } .-my-130 {  margin-top:130px !important;  margin-bottom:130px !important; } .-mt-130 {  margin-top:130px !important; } .-mb-130 {  margin-bottom:130px !important; } .-ml-130 {  margin-left:130px !important; } .-mr-130 {  margin-right:130px !important; } .-mx-135 {  margin-right:135px !important;  margin-left:135px !important; } .-my-135 {  margin-top:135px !important;  margin-bottom:135px !important; } .-mt-135 {  margin-top:135px !important; } .-mb-135 {  margin-bottom:135px !important; } .-ml-135 {  margin-left:135px !important; } .-mr-135 {  margin-right:135px !important; } .-mx-140 {  margin-right:140px !important;  margin-left:140px !important; } .-my-140 {  margin-top:140px !important;  margin-bottom:140px !important; } .-mt-140 {  margin-top:140px !important; } .-mb-140 {  margin-bottom:140px !important; } .-ml-140 {  margin-left:140px !important; } .-mr-140 {  margin-right:140px !important; } .-mx-145 {  margin-right:145px !important;  margin-left:145px !important; } .-my-145 {  margin-top:145px !important;  margin-bottom:145px !important; } .-mt-145 {  margin-top:145px !important; } .-mb-145 {  margin-bottom:145px !important; } .-ml-145 {  margin-left:145px !important; } .-mr-145 {  margin-right:145px !important; } .-mx-150 {  margin-right:150px !important;  margin-left:150px !important; } .-my-150 {  margin-top:150px !important;  margin-bottom:150px !important; } .-mt-150 {  margin-top:150px !important; } .-mb-150 {  margin-bottom:150px !important; } .-ml-150 {  margin-left:150px !important; } .-mr-150 {  margin-right:150px !important; } .-mx--5 {  margin-right:-5px !important;  margin-left:-5px !important; } .-my--5 {  margin-top:-5px !important;  margin-bottom:-5px !important; } .-mt--5 {  margin-top:-5px !important; } .-mb--5 {  margin-bottom:-5px !important; } .-ml--5 {  margin-left:-5px !important; } .-mr--5 {  margin-right:-5px !important; } .-mx--10 {  margin-right:-10px !important;  margin-left:-10px !important; } .-my--10 {  margin-top:-10px !important;  margin-bottom:-10px !important; } .-mt--10 {  margin-top:-10px !important; } .-mb--10 {  margin-bottom:-10px !important; } .-ml--10 {  margin-left:-10px !important; } .-mr--10 {  margin-right:-10px !important; } .-mx--15 {  margin-right:-15px !important;  margin-left:-15px !important; } .-my--15 {  margin-top:-15px !important;  margin-bottom:-15px !important; } .-mt--15 {  margin-top:-15px !important; } .-mb--15 {  margin-bottom:-15px !important; } .-ml--15 {  margin-left:-15px !important; } .-mr--15 {  margin-right:-15px !important; } .-mx--20 {  margin-right:-20px !important;  margin-left:-20px !important; } .-my--20 {  margin-top:-20px !important;  margin-bottom:-20px !important; } .-mt--20 {  margin-top:-20px !important; } .-mb--20 {  margin-bottom:-20px !important; } .-ml--20 {  margin-left:-20px !important; } .-mr--20 {  margin-right:-20px !important; } .-mx--25 {  margin-right:-25px !important;  margin-left:-25px !important; } .-my--25 {  margin-top:-25px !important;  margin-bottom:-25px !important; } .-mt--25 {  margin-top:-25px !important; } .-mb--25 {  margin-bottom:-25px !important; } .-ml--25 {  margin-left:-25px !important; } .-mr--25 {  margin-right:-25px !important; } .-mx--30 {  margin-right:-30px !important;  margin-left:-30px !important; } .-my--30 {  margin-top:-30px !important;  margin-bottom:-30px !important; } .-mt--30 {  margin-top:-30px !important; } .-mb--30 {  margin-bottom:-30px !important; } .-ml--30 {  margin-left:-30px !important; } .-mr--30 {  margin-right:-30px !important; } .-mx--35 {  margin-right:-35px !important;  margin-left:-35px !important; } .-my--35 {  margin-top:-35px !important;  margin-bottom:-35px !important; } .-mt--35 {  margin-top:-35px !important; } .-mb--35 {  margin-bottom:-35px !important; } .-ml--35 {  margin-left:-35px !important; } .-mr--35 {  margin-right:-35px !important; } .-mx--40 {  margin-right:-40px !important;  margin-left:-40px !important; } .-my--40 {  margin-top:-40px !important;  margin-bottom:-40px !important; } .-mt--40 {  margin-top:-40px !important; } .-mb--40 {  margin-bottom:-40px !important; } .-ml--40 {  margin-left:-40px !important; } .-mr--40 {  margin-right:-40px !important; } .-mx--45 {  margin-right:-45px !important;  margin-left:-45px !important; } .-my--45 {  margin-top:-45px !important;  margin-bottom:-45px !important; } .-mt--45 {  margin-top:-45px !important; } .-mb--45 {  margin-bottom:-45px !important; } .-ml--45 {  margin-left:-45px !important; } .-mr--45 {  margin-right:-45px !important; } .-mx--50 {  margin-right:-50px !important;  margin-left:-50px !important; } .-my--50 {  margin-top:-50px !important;  margin-bottom:-50px !important; } .-mt--50 {  margin-top:-50px !important; } .-mb--50 {  margin-bottom:-50px !important; } .-ml--50 {  margin-left:-50px !important; } .-mr--50 {  margin-right:-50px !important; } .-mx--55 {  margin-right:-55px !important;  margin-left:-55px !important; } .-my--55 {  margin-top:-55px !important;  margin-bottom:-55px !important; } .-mt--55 {  margin-top:-55px !important; } .-mb--55 {  margin-bottom:-55px !important; } .-ml--55 {  margin-left:-55px !important; } .-mr--55 {  margin-right:-55px !important; } .-mx--60 {  margin-right:-60px !important;  margin-left:-60px !important; } .-my--60 {  margin-top:-60px !important;  margin-bottom:-60px !important; } .-mt--60 {  margin-top:-60px !important; } .-mb--60 {  margin-bottom:-60px !important; } .-ml--60 {  margin-left:-60px !important; } .-mr--60 {  margin-right:-60px !important; } .-mx--65 {  margin-right:-65px !important;  margin-left:-65px !important; } .-my--65 {  margin-top:-65px !important;  margin-bottom:-65px !important; } .-mt--65 {  margin-top:-65px !important; } .-mb--65 {  margin-bottom:-65px !important; } .-ml--65 {  margin-left:-65px !important; } .-mr--65 {  margin-right:-65px !important; } .-mx--70 {  margin-right:-70px !important;  margin-left:-70px !important; } .-my--70 {  margin-top:-70px !important;  margin-bottom:-70px !important; } .-mt--70 {  margin-top:-70px !important; } .-mb--70 {  margin-bottom:-70px !important; } .-ml--70 {  margin-left:-70px !important; } .-mr--70 {  margin-right:-70px !important; } .-mx--75 {  margin-right:-75px !important;  margin-left:-75px !important; } .-my--75 {  margin-top:-75px !important;  margin-bottom:-75px !important; } .-mt--75 {  margin-top:-75px !important; } .-mb--75 {  margin-bottom:-75px !important; } .-ml--75 {  margin-left:-75px !important; } .-mr--75 {  margin-right:-75px !important; } .-mx--80 {  margin-right:-80px !important;  margin-left:-80px !important; } .-my--80 {  margin-top:-80px !important;  margin-bottom:-80px !important; } .-mt--80 {  margin-top:-80px !important; } .-mb--80 {  margin-bottom:-80px !important; } .-ml--80 {  margin-left:-80px !important; } .-mr--80 {  margin-right:-80px !important; } .-mx--85 {  margin-right:-85px !important;  margin-left:-85px !important; } .-my--85 {  margin-top:-85px !important;  margin-bottom:-85px !important; } .-mt--85 {  margin-top:-85px !important; } .-mb--85 {  margin-bottom:-85px !important; } .-ml--85 {  margin-left:-85px !important; } .-mr--85 {  margin-right:-85px !important; } .-mx--90 {  margin-right:-90px !important;  margin-left:-90px !important; } .-my--90 {  margin-top:-90px !important;  margin-bottom:-90px !important; } .-mt--90 {  margin-top:-90px !important; } .-mb--90 {  margin-bottom:-90px !important; } .-ml--90 {  margin-left:-90px !important; } .-mr--90 {  margin-right:-90px !important; } .-mx--95 {  margin-right:-95px !important;  margin-left:-95px !important; } .-my--95 {  margin-top:-95px !important;  margin-bottom:-95px !important; } .-mt--95 {  margin-top:-95px !important; } .-mb--95 {  margin-bottom:-95px !important; } .-ml--95 {  margin-left:-95px !important; } .-mr--95 {  margin-right:-95px !important; } .-mx--100 {  margin-right:-100px !important;  margin-left:-100px !important; } .-my--100 {  margin-top:-100px !important;  margin-bottom:-100px !important; } .-mt--100 {  margin-top:-100px !important; } .-mb--100 {  margin-bottom:-100px !important; } .-ml--100 {  margin-left:-100px !important; } .-mr--100 {  margin-right:-100px !important; } .-mx--105 {  margin-right:-105px !important;  margin-left:-105px !important; } .-my--105 {  margin-top:-105px !important;  margin-bottom:-105px !important; } .-mt--105 {  margin-top:-105px !important; } .-mb--105 {  margin-bottom:-105px !important; } .-ml--105 {  margin-left:-105px !important; } .-mr--105 {  margin-right:-105px !important; } .-mx--110 {  margin-right:-110px !important;  margin-left:-110px !important; } .-my--110 {  margin-top:-110px !important;  margin-bottom:-110px !important; } .-mt--110 {  margin-top:-110px !important; } .-mb--110 {  margin-bottom:-110px !important; } .-ml--110 {  margin-left:-110px !important; } .-mr--110 {  margin-right:-110px !important; } .-mx--115 {  margin-right:-115px !important;  margin-left:-115px !important; } .-my--115 {  margin-top:-115px !important;  margin-bottom:-115px !important; } .-mt--115 {  margin-top:-115px !important; } .-mb--115 {  margin-bottom:-115px !important; } .-ml--115 {  margin-left:-115px !important; } .-mr--115 {  margin-right:-115px !important; } .-mx--120 {  margin-right:-120px !important;  margin-left:-120px !important; } .-my--120 {  margin-top:-120px !important;  margin-bottom:-120px !important; } .-mt--120 {  margin-top:-120px !important; } .-mb--120 {  margin-bottom:-120px !important; } .-ml--120 {  margin-left:-120px !important; } .-mr--120 {  margin-right:-120px !important; } .-mx--125 {  margin-right:-125px !important;  margin-left:-125px !important; } .-my--125 {  margin-top:-125px !important;  margin-bottom:-125px !important; } .-mt--125 {  margin-top:-125px !important; } .-mb--125 {  margin-bottom:-125px !important; } .-ml--125 {  margin-left:-125px !important; } .-mr--125 {  margin-right:-125px !important; } .-mx--130 {  margin-right:-130px !important;  margin-left:-130px !important; } .-my--130 {  margin-top:-130px !important;  margin-bottom:-130px !important; } .-mt--130 {  margin-top:-130px !important; } .-mb--130 {  margin-bottom:-130px !important; } .-ml--130 {  margin-left:-130px !important; } .-mr--130 {  margin-right:-130px !important; } .-mx--135 {  margin-right:-135px !important;  margin-left:-135px !important; } .-my--135 {  margin-top:-135px !important;  margin-bottom:-135px !important; } .-mt--135 {  margin-top:-135px !important; } .-mb--135 {  margin-bottom:-135px !important; } .-ml--135 {  margin-left:-135px !important; } .-mr--135 {  margin-right:-135px !important; } .-mx--140 {  margin-right:-140px !important;  margin-left:-140px !important; } .-my--140 {  margin-top:-140px !important;  margin-bottom:-140px !important; } .-mt--140 {  margin-top:-140px !important; } .-mb--140 {  margin-bottom:-140px !important; } .-ml--140 {  margin-left:-140px !important; } .-mr--140 {  margin-right:-140px !important; } .-mx--145 {  margin-right:-145px !important;  margin-left:-145px !important; } .-my--145 {  margin-top:-145px !important;  margin-bottom:-145px !important; } .-mt--145 {  margin-top:-145px !important; } .-mb--145 {  margin-bottom:-145px !important; } .-ml--145 {  margin-left:-145px !important; } .-mr--145 {  margin-right:-145px !important; } .-mx--150 {  margin-right:-150px !important;  margin-left:-150px !important; } .-my--150 {  margin-top:-150px !important;  margin-bottom:-150px !important; } .-mt--150 {  margin-top:-150px !important; } .-mb--150 {  margin-bottom:-150px !important; } .-ml--150 {  margin-left:-150px !important; } .-mr--150 {  margin-right:-150px !important; }  @media (min-width:1922px) {  .hd-mx-5 {   margin-right:5px !important;   margin-left:5px !important;  }  .hd-my-5 {   margin-top:5px !important;   margin-bottom:5px !important;  }  .hd-mt-5 {   margin-top:5px !important;  }  .hd-mb-5 {   margin-bottom:5px !important;  }  .hd-ml-5 {   margin-left:5px !important;  }  .hd-mr-5 {   margin-right:5px !important;  }  .hd-mx-10 {   margin-right:10px !important;   margin-left:10px !important;  }  .hd-my-10 {   margin-top:10px !important;   margin-bottom:10px !important;  }  .hd-mt-10 {   margin-top:10px !important;  }  .hd-mb-10 {   margin-bottom:10px !important;  }  .hd-ml-10 {   margin-left:10px !important;  }  .hd-mr-10 {   margin-right:10px !important;  }  .hd-mx-15 {   margin-right:15px !important;   margin-left:15px !important;  }  .hd-my-15 {   margin-top:15px !important;   margin-bottom:15px !important;  }  .hd-mt-15 {   margin-top:15px !important;  }  .hd-mb-15 {   margin-bottom:15px !important;  }  .hd-ml-15 {   margin-left:15px !important;  }  .hd-mr-15 {   margin-right:15px !important;  }  .hd-mx-20 {   margin-right:20px !important;   margin-left:20px !important;  }  .hd-my-20 {   margin-top:20px !important;   margin-bottom:20px !important;  }  .hd-mt-20 {   margin-top:20px !important;  }  .hd-mb-20 {   margin-bottom:20px !important;  }  .hd-ml-20 {   margin-left:20px !important;  }  .hd-mr-20 {   margin-right:20px !important;  }  .hd-mx-25 {   margin-right:25px !important;   margin-left:25px !important;  }  .hd-my-25 {   margin-top:25px !important;   margin-bottom:25px !important;  }  .hd-mt-25 {   margin-top:25px !important;  }  .hd-mb-25 {   margin-bottom:25px !important;  }  .hd-ml-25 {   margin-left:25px !important;  }  .hd-mr-25 {   margin-right:25px !important;  }  .hd-mx-30 {   margin-right:30px !important;   margin-left:30px !important;  }  .hd-my-30 {   margin-top:30px !important;   margin-bottom:30px !important;  }  .hd-mt-30 {   margin-top:30px !important;  }  .hd-mb-30 {   margin-bottom:30px !important;  }  .hd-ml-30 {   margin-left:30px !important;  }  .hd-mr-30 {   margin-right:30px !important;  }  .hd-mx-35 {   margin-right:35px !important;   margin-left:35px !important;  }  .hd-my-35 {   margin-top:35px !important;   margin-bottom:35px !important;  }  .hd-mt-35 {   margin-top:35px !important;  }  .hd-mb-35 {   margin-bottom:35px !important;  }  .hd-ml-35 {   margin-left:35px !important;  }  .hd-mr-35 {   margin-right:35px !important;  }  .hd-mx-40 {   margin-right:40px !important;   margin-left:40px !important;  }  .hd-my-40 {   margin-top:40px !important;   margin-bottom:40px !important;  }  .hd-mt-40 {   margin-top:40px !important;  }  .hd-mb-40 {   margin-bottom:40px !important;  }  .hd-ml-40 {   margin-left:40px !important;  }  .hd-mr-40 {   margin-right:40px !important;  }  .hd-mx-45 {   margin-right:45px !important;   margin-left:45px !important;  }  .hd-my-45 {   margin-top:45px !important;   margin-bottom:45px !important;  }  .hd-mt-45 {   margin-top:45px !important;  }  .hd-mb-45 {   margin-bottom:45px !important;  }  .hd-ml-45 {   margin-left:45px !important;  }  .hd-mr-45 {   margin-right:45px !important;  }  .hd-mx-50 {   margin-right:50px !important;   margin-left:50px !important;  }  .hd-my-50 {   margin-top:50px !important;   margin-bottom:50px !important;  }  .hd-mt-50 {   margin-top:50px !important;  }  .hd-mb-50 {   margin-bottom:50px !important;  }  .hd-ml-50 {   margin-left:50px !important;  }  .hd-mr-50 {   margin-right:50px !important;  }  .hd-mx-55 {   margin-right:55px !important;   margin-left:55px !important;  }  .hd-my-55 {   margin-top:55px !important;   margin-bottom:55px !important;  }  .hd-mt-55 {   margin-top:55px !important;  }  .hd-mb-55 {   margin-bottom:55px !important;  }  .hd-ml-55 {   margin-left:55px !important;  }  .hd-mr-55 {   margin-right:55px !important;  }  .hd-mx-60 {   margin-right:60px !important;   margin-left:60px !important;  }  .hd-my-60 {   margin-top:60px !important;   margin-bottom:60px !important;  }  .hd-mt-60 {   margin-top:60px !important;  }  .hd-mb-60 {   margin-bottom:60px !important;  }  .hd-ml-60 {   margin-left:60px !important;  }  .hd-mr-60 {   margin-right:60px !important;  }  .hd-mx-65 {   margin-right:65px !important;   margin-left:65px !important;  }  .hd-my-65 {   margin-top:65px !important;   margin-bottom:65px !important;  }  .hd-mt-65 {   margin-top:65px !important;  }  .hd-mb-65 {   margin-bottom:65px !important;  }  .hd-ml-65 {   margin-left:65px !important;  }  .hd-mr-65 {   margin-right:65px !important;  }  .hd-mx-70 {   margin-right:70px !important;   margin-left:70px !important;  }  .hd-my-70 {   margin-top:70px !important;   margin-bottom:70px !important;  }  .hd-mt-70 {   margin-top:70px !important;  }  .hd-mb-70 {   margin-bottom:70px !important;  }  .hd-ml-70 {   margin-left:70px !important;  }  .hd-mr-70 {   margin-right:70px !important;  }  .hd-mx-75 {   margin-right:75px !important;   margin-left:75px !important;  }  .hd-my-75 {   margin-top:75px !important;   margin-bottom:75px !important;  }  .hd-mt-75 {   margin-top:75px !important;  }  .hd-mb-75 {   margin-bottom:75px !important;  }  .hd-ml-75 {   margin-left:75px !important;  }  .hd-mr-75 {   margin-right:75px !important;  }  .hd-mx-80 {   margin-right:80px !important;   margin-left:80px !important;  }  .hd-my-80 {   margin-top:80px !important;   margin-bottom:80px !important;  }  .hd-mt-80 {   margin-top:80px !important;  }  .hd-mb-80 {   margin-bottom:80px !important;  }  .hd-ml-80 {   margin-left:80px !important;  }  .hd-mr-80 {   margin-right:80px !important;  }  .hd-mx-85 {   margin-right:85px !important;   margin-left:85px !important;  }  .hd-my-85 {   margin-top:85px !important;   margin-bottom:85px !important;  }  .hd-mt-85 {   margin-top:85px !important;  }  .hd-mb-85 {   margin-bottom:85px !important;  }  .hd-ml-85 {   margin-left:85px !important;  }  .hd-mr-85 {   margin-right:85px !important;  }  .hd-mx-90 {   margin-right:90px !important;   margin-left:90px !important;  }  .hd-my-90 {   margin-top:90px !important;   margin-bottom:90px !important;  }  .hd-mt-90 {   margin-top:90px !important;  }  .hd-mb-90 {   margin-bottom:90px !important;  }  .hd-ml-90 {   margin-left:90px !important;  }  .hd-mr-90 {   margin-right:90px !important;  }  .hd-mx-95 {   margin-right:95px !important;   margin-left:95px !important;  }  .hd-my-95 {   margin-top:95px !important;   margin-bottom:95px !important;  }  .hd-mt-95 {   margin-top:95px !important;  }  .hd-mb-95 {   margin-bottom:95px !important;  }  .hd-ml-95 {   margin-left:95px !important;  }  .hd-mr-95 {   margin-right:95px !important;  }  .hd-mx-100 {   margin-right:100px !important;   margin-left:100px !important;  }  .hd-my-100 {   margin-top:100px !important;   margin-bottom:100px !important;  }  .hd-mt-100 {   margin-top:100px !important;  }  .hd-mb-100 {   margin-bottom:100px !important;  }  .hd-ml-100 {   margin-left:100px !important;  }  .hd-mr-100 {   margin-right:100px !important;  }  .hd-mx-105 {   margin-right:105px !important;   margin-left:105px !important;  }  .hd-my-105 {   margin-top:105px !important;   margin-bottom:105px !important;  }  .hd-mt-105 {   margin-top:105px !important;  }  .hd-mb-105 {   margin-bottom:105px !important;  }  .hd-ml-105 {   margin-left:105px !important;  }  .hd-mr-105 {   margin-right:105px !important;  }  .hd-mx-110 {   margin-right:110px !important;   margin-left:110px !important;  }  .hd-my-110 {   margin-top:110px !important;   margin-bottom:110px !important;  }  .hd-mt-110 {   margin-top:110px !important;  }  .hd-mb-110 {   margin-bottom:110px !important;  }  .hd-ml-110 {   margin-left:110px !important;  }  .hd-mr-110 {   margin-right:110px !important;  }  .hd-mx-115 {   margin-right:115px !important;   margin-left:115px !important;  }  .hd-my-115 {   margin-top:115px !important;   margin-bottom:115px !important;  }  .hd-mt-115 {   margin-top:115px !important;  }  .hd-mb-115 {   margin-bottom:115px !important;  }  .hd-ml-115 {   margin-left:115px !important;  }  .hd-mr-115 {   margin-right:115px !important;  }  .hd-mx-120 {   margin-right:120px !important;   margin-left:120px !important;  }  .hd-my-120 {   margin-top:120px !important;   margin-bottom:120px !important;  }  .hd-mt-120 {   margin-top:120px !important;  }  .hd-mb-120 {   margin-bottom:120px !important;  }  .hd-ml-120 {   margin-left:120px !important;  }  .hd-mr-120 {   margin-right:120px !important;  }  .hd-mx-125 {   margin-right:125px !important;   margin-left:125px !important;  }  .hd-my-125 {   margin-top:125px !important;   margin-bottom:125px !important;  }  .hd-mt-125 {   margin-top:125px !important;  }  .hd-mb-125 {   margin-bottom:125px !important;  }  .hd-ml-125 {   margin-left:125px !important;  }  .hd-mr-125 {   margin-right:125px !important;  }  .hd-mx-130 {   margin-right:130px !important;   margin-left:130px !important;  }  .hd-my-130 {   margin-top:130px !important;   margin-bottom:130px !important;  }  .hd-mt-130 {   margin-top:130px !important;  }  .hd-mb-130 {   margin-bottom:130px !important;  }  .hd-ml-130 {   margin-left:130px !important;  }  .hd-mr-130 {   margin-right:130px !important;  }  .hd-mx-135 {   margin-right:135px !important;   margin-left:135px !important;  }  .hd-my-135 {   margin-top:135px !important;   margin-bottom:135px !important;  }  .hd-mt-135 {   margin-top:135px !important;  }  .hd-mb-135 {   margin-bottom:135px !important;  }  .hd-ml-135 {   margin-left:135px !important;  }  .hd-mr-135 {   margin-right:135px !important;  }  .hd-mx-140 {   margin-right:140px !important;   margin-left:140px !important;  }  .hd-my-140 {   margin-top:140px !important;   margin-bottom:140px !important;  }  .hd-mt-140 {   margin-top:140px !important;  }  .hd-mb-140 {   margin-bottom:140px !important;  }  .hd-ml-140 {   margin-left:140px !important;  }  .hd-mr-140 {   margin-right:140px !important;  }  .hd-mx-145 {   margin-right:145px !important;   margin-left:145px !important;  }  .hd-my-145 {   margin-top:145px !important;   margin-bottom:145px !important;  }  .hd-mt-145 {   margin-top:145px !important;  }  .hd-mb-145 {   margin-bottom:145px !important;  }  .hd-ml-145 {   margin-left:145px !important;  }  .hd-mr-145 {   margin-right:145px !important;  }  .hd-mx-150 {   margin-right:150px !important;   margin-left:150px !important;  }  .hd-my-150 {   margin-top:150px !important;   margin-bottom:150px !important;  }  .hd-mt-150 {   margin-top:150px !important;  }  .hd-mb-150 {   margin-bottom:150px !important;  }  .hd-ml-150 {   margin-left:150px !important;  }  .hd-mr-150 {   margin-right:150px !important;  }  .hd-mx-0 {   margin-right:0 !important;   margin-left:0 !important;  }  .hd-my-0 {   margin-top:0 !important;   margin-bottom:0 !important;  }  .hd-mt-0 {   margin-top:0 !important;  }  .hd-mb-0 {   margin-bottom:0 !important;  }  .hd-ml-0 {   margin-left:0 !important;  }  .hd-mr-0 {   margin-right:0 !important;  }  .hd-m-0 {   margin:0 !important;  }  .hd-mx--5 {   margin-right:-5px !important;   margin-left:-5px !important;  }  .hd-my--5 {   margin-top:-5px !important;   margin-bottom:-5px !important;  }  .hd-mt--5 {   margin-top:-5px !important;  }  .hd-mb--5 {   margin-bottom:-5px !important;  }  .hd-ml--5 {   margin-left:-5px !important;  }  .hd-mr--5 {   margin-right:-5px !important;  }  .hd-mx--10 {   margin-right:-10px !important;   margin-left:-10px !important;  }  .hd-my--10 {   margin-top:-10px !important;   margin-bottom:-10px !important;  }  .hd-mt--10 {   margin-top:-10px !important;  }  .hd-mb--10 {   margin-bottom:-10px !important;  }  .hd-ml--10 {   margin-left:-10px !important;  }  .hd-mr--10 {   margin-right:-10px !important;  }  .hd-mx--15 {   margin-right:-15px !important;   margin-left:-15px !important;  }  .hd-my--15 {   margin-top:-15px !important;   margin-bottom:-15px !important;  }  .hd-mt--15 {   margin-top:-15px !important;  }  .hd-mb--15 {   margin-bottom:-15px !important;  }  .hd-ml--15 {   margin-left:-15px !important;  }  .hd-mr--15 {   margin-right:-15px !important;  }  .hd-mx--20 {   margin-right:-20px !important;   margin-left:-20px !important;  }  .hd-my--20 {   margin-top:-20px !important;   margin-bottom:-20px !important;  }  .hd-mt--20 {   margin-top:-20px !important;  }  .hd-mb--20 {   margin-bottom:-20px !important;  }  .hd-ml--20 {   margin-left:-20px !important;  }  .hd-mr--20 {   margin-right:-20px !important;  }  .hd-mx--25 {   margin-right:-25px !important;   margin-left:-25px !important;  }  .hd-my--25 {   margin-top:-25px !important;   margin-bottom:-25px !important;  }  .hd-mt--25 {   margin-top:-25px !important;  }  .hd-mb--25 {   margin-bottom:-25px !important;  }  .hd-ml--25 {   margin-left:-25px !important;  }  .hd-mr--25 {   margin-right:-25px !important;  }  .hd-mx--30 {   margin-right:-30px !important;   margin-left:-30px !important;  }  .hd-my--30 {   margin-top:-30px !important;   margin-bottom:-30px !important;  }  .hd-mt--30 {   margin-top:-30px !important;  }  .hd-mb--30 {   margin-bottom:-30px !important;  }  .hd-ml--30 {   margin-left:-30px !important;  }  .hd-mr--30 {   margin-right:-30px !important;  }  .hd-mx--35 {   margin-right:-35px !important;   margin-left:-35px !important;  }  .hd-my--35 {   margin-top:-35px !important;   margin-bottom:-35px !important;  }  .hd-mt--35 {   margin-top:-35px !important;  }  .hd-mb--35 {   margin-bottom:-35px !important;  }  .hd-ml--35 {   margin-left:-35px !important;  }  .hd-mr--35 {   margin-right:-35px !important;  }  .hd-mx--40 {   margin-right:-40px !important;   margin-left:-40px !important;  }  .hd-my--40 {   margin-top:-40px !important;   margin-bottom:-40px !important;  }  .hd-mt--40 {   margin-top:-40px !important;  }  .hd-mb--40 {   margin-bottom:-40px !important;  }  .hd-ml--40 {   margin-left:-40px !important;  }  .hd-mr--40 {   margin-right:-40px !important;  }  .hd-mx--45 {   margin-right:-45px !important;   margin-left:-45px !important;  }  .hd-my--45 {   margin-top:-45px !important;   margin-bottom:-45px !important;  }  .hd-mt--45 {   margin-top:-45px !important;  }  .hd-mb--45 {   margin-bottom:-45px !important;  }  .hd-ml--45 {   margin-left:-45px !important;  }  .hd-mr--45 {   margin-right:-45px !important;  }  .hd-mx--50 {   margin-right:-50px !important;   margin-left:-50px !important;  }  .hd-my--50 {   margin-top:-50px !important;   margin-bottom:-50px !important;  }  .hd-mt--50 {   margin-top:-50px !important;  }  .hd-mb--50 {   margin-bottom:-50px !important;  }  .hd-ml--50 {   margin-left:-50px !important;  }  .hd-mr--50 {   margin-right:-50px !important;  }  .hd-mx--55 {   margin-right:-55px !important;   margin-left:-55px !important;  }  .hd-my--55 {   margin-top:-55px !important;   margin-bottom:-55px !important;  }  .hd-mt--55 {   margin-top:-55px !important;  }  .hd-mb--55 {   margin-bottom:-55px !important;  }  .hd-ml--55 {   margin-left:-55px !important;  }  .hd-mr--55 {   margin-right:-55px !important;  }  .hd-mx--60 {   margin-right:-60px !important;   margin-left:-60px !important;  }  .hd-my--60 {   margin-top:-60px !important;   margin-bottom:-60px !important;  }  .hd-mt--60 {   margin-top:-60px !important;  }  .hd-mb--60 {   margin-bottom:-60px !important;  }  .hd-ml--60 {   margin-left:-60px !important;  }  .hd-mr--60 {   margin-right:-60px !important;  }  .hd-mx--65 {   margin-right:-65px !important;   margin-left:-65px !important;  }  .hd-my--65 {   margin-top:-65px !important;   margin-bottom:-65px !important;  }  .hd-mt--65 {   margin-top:-65px !important;  }  .hd-mb--65 {   margin-bottom:-65px !important;  }  .hd-ml--65 {   margin-left:-65px !important;  }  .hd-mr--65 {   margin-right:-65px !important;  }  .hd-mx--70 {   margin-right:-70px !important;   margin-left:-70px !important;  }  .hd-my--70 {   margin-top:-70px !important;   margin-bottom:-70px !important;  }  .hd-mt--70 {   margin-top:-70px !important;  }  .hd-mb--70 {   margin-bottom:-70px !important;  }  .hd-ml--70 {   margin-left:-70px !important;  }  .hd-mr--70 {   margin-right:-70px !important;  }  .hd-mx--75 {   margin-right:-75px !important;   margin-left:-75px !important;  }  .hd-my--75 {   margin-top:-75px !important;   margin-bottom:-75px !important;  }  .hd-mt--75 {   margin-top:-75px !important;  }  .hd-mb--75 {   margin-bottom:-75px !important;  }  .hd-ml--75 {   margin-left:-75px !important;  }  .hd-mr--75 {   margin-right:-75px !important;  }  .hd-mx--80 {   margin-right:-80px !important;   margin-left:-80px !important;  }  .hd-my--80 {   margin-top:-80px !important;   margin-bottom:-80px !important;  }  .hd-mt--80 {   margin-top:-80px !important;  }  .hd-mb--80 {   margin-bottom:-80px !important;  }  .hd-ml--80 {   margin-left:-80px !important;  }  .hd-mr--80 {   margin-right:-80px !important;  }  .hd-mx--85 {   margin-right:-85px !important;   margin-left:-85px !important;  }  .hd-my--85 {   margin-top:-85px !important;   margin-bottom:-85px !important;  }  .hd-mt--85 {   margin-top:-85px !important;  }  .hd-mb--85 {   margin-bottom:-85px !important;  }  .hd-ml--85 {   margin-left:-85px !important;  }  .hd-mr--85 {   margin-right:-85px !important;  }  .hd-mx--90 {   margin-right:-90px !important;   margin-left:-90px !important;  }  .hd-my--90 {   margin-top:-90px !important;   margin-bottom:-90px !important;  }  .hd-mt--90 {   margin-top:-90px !important;  }  .hd-mb--90 {   margin-bottom:-90px !important;  }  .hd-ml--90 {   margin-left:-90px !important;  }  .hd-mr--90 {   margin-right:-90px !important;  }  .hd-mx--95 {   margin-right:-95px !important;   margin-left:-95px !important;  }  .hd-my--95 {   margin-top:-95px !important;   margin-bottom:-95px !important;  }  .hd-mt--95 {   margin-top:-95px !important;  }  .hd-mb--95 {   margin-bottom:-95px !important;  }  .hd-ml--95 {   margin-left:-95px !important;  }  .hd-mr--95 {   margin-right:-95px !important;  }  .hd-mx--100 {   margin-right:-100px !important;   margin-left:-100px !important;  }  .hd-my--100 {   margin-top:-100px !important;   margin-bottom:-100px !important;  }  .hd-mt--100 {   margin-top:-100px !important;  }  .hd-mb--100 {   margin-bottom:-100px !important;  }  .hd-ml--100 {   margin-left:-100px !important;  }  .hd-mr--100 {   margin-right:-100px !important;  }  .hd-mx--105 {   margin-right:-105px !important;   margin-left:-105px !important;  }  .hd-my--105 {   margin-top:-105px !important;   margin-bottom:-105px !important;  }  .hd-mt--105 {   margin-top:-105px !important;  }  .hd-mb--105 {   margin-bottom:-105px !important;  }  .hd-ml--105 {   margin-left:-105px !important;  }  .hd-mr--105 {   margin-right:-105px !important;  }  .hd-mx--110 {   margin-right:-110px !important;   margin-left:-110px !important;  }  .hd-my--110 {   margin-top:-110px !important;   margin-bottom:-110px !important;  }  .hd-mt--110 {   margin-top:-110px !important;  }  .hd-mb--110 {   margin-bottom:-110px !important;  }  .hd-ml--110 {   margin-left:-110px !important;  }  .hd-mr--110 {   margin-right:-110px !important;  }  .hd-mx--115 {   margin-right:-115px !important;   margin-left:-115px !important;  }  .hd-my--115 {   margin-top:-115px !important;   margin-bottom:-115px !important;  }  .hd-mt--115 {   margin-top:-115px !important;  }  .hd-mb--115 {   margin-bottom:-115px !important;  }  .hd-ml--115 {   margin-left:-115px !important;  }  .hd-mr--115 {   margin-right:-115px !important;  }  .hd-mx--120 {   margin-right:-120px !important;   margin-left:-120px !important;  }  .hd-my--120 {   margin-top:-120px !important;   margin-bottom:-120px !important;  }  .hd-mt--120 {   margin-top:-120px !important;  }  .hd-mb--120 {   margin-bottom:-120px !important;  }  .hd-ml--120 {   margin-left:-120px !important;  }  .hd-mr--120 {   margin-right:-120px !important;  }  .hd-mx--125 {   margin-right:-125px !important;   margin-left:-125px !important;  }  .hd-my--125 {   margin-top:-125px !important;   margin-bottom:-125px !important;  }  .hd-mt--125 {   margin-top:-125px !important;  }  .hd-mb--125 {   margin-bottom:-125px !important;  }  .hd-ml--125 {   margin-left:-125px !important;  }  .hd-mr--125 {   margin-right:-125px !important;  }  .hd-mx--130 {   margin-right:-130px !important;   margin-left:-130px !important;  }  .hd-my--130 {   margin-top:-130px !important;   margin-bottom:-130px !important;  }  .hd-mt--130 {   margin-top:-130px !important;  }  .hd-mb--130 {   margin-bottom:-130px !important;  }  .hd-ml--130 {   margin-left:-130px !important;  }  .hd-mr--130 {   margin-right:-130px !important;  }  .hd-mx--135 {   margin-right:-135px !important;   margin-left:-135px !important;  }  .hd-my--135 {   margin-top:-135px !important;   margin-bottom:-135px !important;  }  .hd-mt--135 {   margin-top:-135px !important;  }  .hd-mb--135 {   margin-bottom:-135px !important;  }  .hd-ml--135 {   margin-left:-135px !important;  }  .hd-mr--135 {   margin-right:-135px !important;  }  .hd-mx--140 {   margin-right:-140px !important;   margin-left:-140px !important;  }  .hd-my--140 {   margin-top:-140px !important;   margin-bottom:-140px !important;  }  .hd-mt--140 {   margin-top:-140px !important;  }  .hd-mb--140 {   margin-bottom:-140px !important;  }  .hd-ml--140 {   margin-left:-140px !important;  }  .hd-mr--140 {   margin-right:-140px !important;  }  .hd-mx--145 {   margin-right:-145px !important;   margin-left:-145px !important;  }  .hd-my--145 {   margin-top:-145px !important;   margin-bottom:-145px !important;  }  .hd-mt--145 {   margin-top:-145px !important;  }  .hd-mb--145 {   margin-bottom:-145px !important;  }  .hd-ml--145 {   margin-left:-145px !important;  }  .hd-mr--145 {   margin-right:-145px !important;  }  .hd-mx--150 {   margin-right:-150px !important;   margin-left:-150px !important;  }  .hd-my--150 {   margin-top:-150px !important;   margin-bottom:-150px !important;  }  .hd-mt--150 {   margin-top:-150px !important;  }  .hd-mb--150 {   margin-bottom:-150px !important;  }  .hd-ml--150 {   margin-left:-150px !important;  }  .hd-mr--150 {   margin-right:-150px !important;  } } @media (max-width:1500px) {  .xxl-mx-5 {   margin-right:5px !important;   margin-left:5px !important;  }  .xxl-my-5 {   margin-top:5px !important;   margin-bottom:5px !important;  }  .xxl-mt-5 {   margin-top:5px !important;  }  .xxl-mb-5 {   margin-bottom:5px !important;  }  .xxl-ml-5 {   margin-left:5px !important;  }  .xxl-mr-5 {   margin-right:5px !important;  }  .xxl-mx-10 {   margin-right:10px !important;   margin-left:10px !important;  }  .xxl-my-10 {   margin-top:10px !important;   margin-bottom:10px !important;  }  .xxl-mt-10 {   margin-top:10px !important;  }  .xxl-mb-10 {   margin-bottom:10px !important;  }  .xxl-ml-10 {   margin-left:10px !important;  }  .xxl-mr-10 {   margin-right:10px !important;  }  .xxl-mx-15 {   margin-right:15px !important;   margin-left:15px !important;  }  .xxl-my-15 {   margin-top:15px !important;   margin-bottom:15px !important;  }  .xxl-mt-15 {   margin-top:15px !important;  }  .xxl-mb-15 {   margin-bottom:15px !important;  }  .xxl-ml-15 {   margin-left:15px !important;  }  .xxl-mr-15 {   margin-right:15px !important;  }  .xxl-mx-20 {   margin-right:20px !important;   margin-left:20px !important;  }  .xxl-my-20 {   margin-top:20px !important;   margin-bottom:20px !important;  }  .xxl-mt-20 {   margin-top:20px !important;  }  .xxl-mb-20 {   margin-bottom:20px !important;  }  .xxl-ml-20 {   margin-left:20px !important;  }  .xxl-mr-20 {   margin-right:20px !important;  }  .xxl-mx-25 {   margin-right:25px !important;   margin-left:25px !important;  }  .xxl-my-25 {   margin-top:25px !important;   margin-bottom:25px !important;  }  .xxl-mt-25 {   margin-top:25px !important;  }  .xxl-mb-25 {   margin-bottom:25px !important;  }  .xxl-ml-25 {   margin-left:25px !important;  }  .xxl-mr-25 {   margin-right:25px !important;  }  .xxl-mx-30 {   margin-right:30px !important;   margin-left:30px !important;  }  .xxl-my-30 {   margin-top:30px !important;   margin-bottom:30px !important;  }  .xxl-mt-30 {   margin-top:30px !important;  }  .xxl-mb-30 {   margin-bottom:30px !important;  }  .xxl-ml-30 {   margin-left:30px !important;  }  .xxl-mr-30 {   margin-right:30px !important;  }  .xxl-mx-35 {   margin-right:35px !important;   margin-left:35px !important;  }  .xxl-my-35 {   margin-top:35px !important;   margin-bottom:35px !important;  }  .xxl-mt-35 {   margin-top:35px !important;  }  .xxl-mb-35 {   margin-bottom:35px !important;  }  .xxl-ml-35 {   margin-left:35px !important;  }  .xxl-mr-35 {   margin-right:35px !important;  }  .xxl-mx-40 {   margin-right:40px !important;   margin-left:40px !important;  }  .xxl-my-40 {   margin-top:40px !important;   margin-bottom:40px !important;  }  .xxl-mt-40 {   margin-top:40px !important;  }  .xxl-mb-40 {   margin-bottom:40px !important;  }  .xxl-ml-40 {   margin-left:40px !important;  }  .xxl-mr-40 {   margin-right:40px !important;  }  .xxl-mx-45 {   margin-right:45px !important;   margin-left:45px !important;  }  .xxl-my-45 {   margin-top:45px !important;   margin-bottom:45px !important;  }  .xxl-mt-45 {   margin-top:45px !important;  }  .xxl-mb-45 {   margin-bottom:45px !important;  }  .xxl-ml-45 {   margin-left:45px !important;  }  .xxl-mr-45 {   margin-right:45px !important;  }  .xxl-mx-50 {   margin-right:50px !important;   margin-left:50px !important;  }  .xxl-my-50 {   margin-top:50px !important;   margin-bottom:50px !important;  }  .xxl-mt-50 {   margin-top:50px !important;  }  .xxl-mb-50 {   margin-bottom:50px !important;  }  .xxl-ml-50 {   margin-left:50px !important;  }  .xxl-mr-50 {   margin-right:50px !important;  }  .xxl-mx-55 {   margin-right:55px !important;   margin-left:55px !important;  }  .xxl-my-55 {   margin-top:55px !important;   margin-bottom:55px !important;  }  .xxl-mt-55 {   margin-top:55px !important;  }  .xxl-mb-55 {   margin-bottom:55px !important;  }  .xxl-ml-55 {   margin-left:55px !important;  }  .xxl-mr-55 {   margin-right:55px !important;  }  .xxl-mx-60 {   margin-right:60px !important;   margin-left:60px !important;  }  .xxl-my-60 {   margin-top:60px !important;   margin-bottom:60px !important;  }  .xxl-mt-60 {   margin-top:60px !important;  }  .xxl-mb-60 {   margin-bottom:60px !important;  }  .xxl-ml-60 {   margin-left:60px !important;  }  .xxl-mr-60 {   margin-right:60px !important;  }  .xxl-mx-65 {   margin-right:65px !important;   margin-left:65px !important;  }  .xxl-my-65 {   margin-top:65px !important;   margin-bottom:65px !important;  }  .xxl-mt-65 {   margin-top:65px !important;  }  .xxl-mb-65 {   margin-bottom:65px !important;  }  .xxl-ml-65 {   margin-left:65px !important;  }  .xxl-mr-65 {   margin-right:65px !important;  }  .xxl-mx-70 {   margin-right:70px !important;   margin-left:70px !important;  }  .xxl-my-70 {   margin-top:70px !important;   margin-bottom:70px !important;  }  .xxl-mt-70 {   margin-top:70px !important;  }  .xxl-mb-70 {   margin-bottom:70px !important;  }  .xxl-ml-70 {   margin-left:70px !important;  }  .xxl-mr-70 {   margin-right:70px !important;  }  .xxl-mx-75 {   margin-right:75px !important;   margin-left:75px !important;  }  .xxl-my-75 {   margin-top:75px !important;   margin-bottom:75px !important;  }  .xxl-mt-75 {   margin-top:75px !important;  }  .xxl-mb-75 {   margin-bottom:75px !important;  }  .xxl-ml-75 {   margin-left:75px !important;  }  .xxl-mr-75 {   margin-right:75px !important;  }  .xxl-mx-80 {   margin-right:80px !important;   margin-left:80px !important;  }  .xxl-my-80 {   margin-top:80px !important;   margin-bottom:80px !important;  }  .xxl-mt-80 {   margin-top:80px !important;  }  .xxl-mb-80 {   margin-bottom:80px !important;  }  .xxl-ml-80 {   margin-left:80px !important;  }  .xxl-mr-80 {   margin-right:80px !important;  }  .xxl-mx-85 {   margin-right:85px !important;   margin-left:85px !important;  }  .xxl-my-85 {   margin-top:85px !important;   margin-bottom:85px !important;  }  .xxl-mt-85 {   margin-top:85px !important;  }  .xxl-mb-85 {   margin-bottom:85px !important;  }  .xxl-ml-85 {   margin-left:85px !important;  }  .xxl-mr-85 {   margin-right:85px !important;  }  .xxl-mx-90 {   margin-right:90px !important;   margin-left:90px !important;  }  .xxl-my-90 {   margin-top:90px !important;   margin-bottom:90px !important;  }  .xxl-mt-90 {   margin-top:90px !important;  }  .xxl-mb-90 {   margin-bottom:90px !important;  }  .xxl-ml-90 {   margin-left:90px !important;  }  .xxl-mr-90 {   margin-right:90px !important;  }  .xxl-mx-95 {   margin-right:95px !important;   margin-left:95px !important;  }  .xxl-my-95 {   margin-top:95px !important;   margin-bottom:95px !important;  }  .xxl-mt-95 {   margin-top:95px !important;  }  .xxl-mb-95 {   margin-bottom:95px !important;  }  .xxl-ml-95 {   margin-left:95px !important;  }  .xxl-mr-95 {   margin-right:95px !important;  }  .xxl-mx-100 {   margin-right:100px !important;   margin-left:100px !important;  }  .xxl-my-100 {   margin-top:100px !important;   margin-bottom:100px !important;  }  .xxl-mt-100 {   margin-top:100px !important;  }  .xxl-mb-100 {   margin-bottom:100px !important;  }  .xxl-ml-100 {   margin-left:100px !important;  }  .xxl-mr-100 {   margin-right:100px !important;  }  .xxl-mx-105 {   margin-right:105px !important;   margin-left:105px !important;  }  .xxl-my-105 {   margin-top:105px !important;   margin-bottom:105px !important;  }  .xxl-mt-105 {   margin-top:105px !important;  }  .xxl-mb-105 {   margin-bottom:105px !important;  }  .xxl-ml-105 {   margin-left:105px !important;  }  .xxl-mr-105 {   margin-right:105px !important;  }  .xxl-mx-110 {   margin-right:110px !important;   margin-left:110px !important;  }  .xxl-my-110 {   margin-top:110px !important;   margin-bottom:110px !important;  }  .xxl-mt-110 {   margin-top:110px !important;  }  .xxl-mb-110 {   margin-bottom:110px !important;  }  .xxl-ml-110 {   margin-left:110px !important;  }  .xxl-mr-110 {   margin-right:110px !important;  }  .xxl-mx-115 {   margin-right:115px !important;   margin-left:115px !important;  }  .xxl-my-115 {   margin-top:115px !important;   margin-bottom:115px !important;  }  .xxl-mt-115 {   margin-top:115px !important;  }  .xxl-mb-115 {   margin-bottom:115px !important;  }  .xxl-ml-115 {   margin-left:115px !important;  }  .xxl-mr-115 {   margin-right:115px !important;  }  .xxl-mx-120 {   margin-right:120px !important;   margin-left:120px !important;  }  .xxl-my-120 {   margin-top:120px !important;   margin-bottom:120px !important;  }  .xxl-mt-120 {   margin-top:120px !important;  }  .xxl-mb-120 {   margin-bottom:120px !important;  }  .xxl-ml-120 {   margin-left:120px !important;  }  .xxl-mr-120 {   margin-right:120px !important;  }  .xxl-mx-125 {   margin-right:125px !important;   margin-left:125px !important;  }  .xxl-my-125 {   margin-top:125px !important;   margin-bottom:125px !important;  }  .xxl-mt-125 {   margin-top:125px !important;  }  .xxl-mb-125 {   margin-bottom:125px !important;  }  .xxl-ml-125 {   margin-left:125px !important;  }  .xxl-mr-125 {   margin-right:125px !important;  }  .xxl-mx-130 {   margin-right:130px !important;   margin-left:130px !important;  }  .xxl-my-130 {   margin-top:130px !important;   margin-bottom:130px !important;  }  .xxl-mt-130 {   margin-top:130px !important;  }  .xxl-mb-130 {   margin-bottom:130px !important;  }  .xxl-ml-130 {   margin-left:130px !important;  }  .xxl-mr-130 {   margin-right:130px !important;  }  .xxl-mx-135 {   margin-right:135px !important;   margin-left:135px !important;  }  .xxl-my-135 {   margin-top:135px !important;   margin-bottom:135px !important;  }  .xxl-mt-135 {   margin-top:135px !important;  }  .xxl-mb-135 {   margin-bottom:135px !important;  }  .xxl-ml-135 {   margin-left:135px !important;  }  .xxl-mr-135 {   margin-right:135px !important;  }  .xxl-mx-140 {   margin-right:140px !important;   margin-left:140px !important;  }  .xxl-my-140 {   margin-top:140px !important;   margin-bottom:140px !important;  }  .xxl-mt-140 {   margin-top:140px !important;  }  .xxl-mb-140 {   margin-bottom:140px !important;  }  .xxl-ml-140 {   margin-left:140px !important;  }  .xxl-mr-140 {   margin-right:140px !important;  }  .xxl-mx-145 {   margin-right:145px !important;   margin-left:145px !important;  }  .xxl-my-145 {   margin-top:145px !important;   margin-bottom:145px !important;  }  .xxl-mt-145 {   margin-top:145px !important;  }  .xxl-mb-145 {   margin-bottom:145px !important;  }  .xxl-ml-145 {   margin-left:145px !important;  }  .xxl-mr-145 {   margin-right:145px !important;  }  .xxl-mx-150 {   margin-right:150px !important;   margin-left:150px !important;  }  .xxl-my-150 {   margin-top:150px !important;   margin-bottom:150px !important;  }  .xxl-mt-150 {   margin-top:150px !important;  }  .xxl-mb-150 {   margin-bottom:150px !important;  }  .xxl-ml-150 {   margin-left:150px !important;  }  .xxl-mr-150 {   margin-right:150px !important;  }  .xxl-mx-0 {   margin-right:0 !important;   margin-left:0 !important;  }  .xxl-my-0 {   margin-top:0 !important;   margin-bottom:0 !important;  }  .xxl-mt-0 {   margin-top:0 !important;  }  .xxl-mb-0 {   margin-bottom:0 !important;  }  .xxl-ml-0 {   margin-left:0 !important;  }  .xxl-mr-0 {   margin-right:0 !important;  }  .xxl-m-0 {   margin:0 !important;  }  .xxl-mx--5 {   margin-right:-5px !important;   margin-left:-5px !important;  }  .xxl-my--5 {   margin-top:-5px !important;   margin-bottom:-5px !important;  }  .xxl-mt--5 {   margin-top:-5px !important;  }  .xxl-mb--5 {   margin-bottom:-5px !important;  }  .xxl-ml--5 {   margin-left:-5px !important;  }  .xxl-mr--5 {   margin-right:-5px !important;  }  .xxl-mx--10 {   margin-right:-10px !important;   margin-left:-10px !important;  }  .xxl-my--10 {   margin-top:-10px !important;   margin-bottom:-10px !important;  }  .xxl-mt--10 {   margin-top:-10px !important;  }  .xxl-mb--10 {   margin-bottom:-10px !important;  }  .xxl-ml--10 {   margin-left:-10px !important;  }  .xxl-mr--10 {   margin-right:-10px !important;  }  .xxl-mx--15 {   margin-right:-15px !important;   margin-left:-15px !important;  }  .xxl-my--15 {   margin-top:-15px !important;   margin-bottom:-15px !important;  }  .xxl-mt--15 {   margin-top:-15px !important;  }  .xxl-mb--15 {   margin-bottom:-15px !important;  }  .xxl-ml--15 {   margin-left:-15px !important;  }  .xxl-mr--15 {   margin-right:-15px !important;  }  .xxl-mx--20 {   margin-right:-20px !important;   margin-left:-20px !important;  }  .xxl-my--20 {   margin-top:-20px !important;   margin-bottom:-20px !important;  }  .xxl-mt--20 {   margin-top:-20px !important;  }  .xxl-mb--20 {   margin-bottom:-20px !important;  }  .xxl-ml--20 {   margin-left:-20px !important;  }  .xxl-mr--20 {   margin-right:-20px !important;  }  .xxl-mx--25 {   margin-right:-25px !important;   margin-left:-25px !important;  }  .xxl-my--25 {   margin-top:-25px !important;   margin-bottom:-25px !important;  }  .xxl-mt--25 {   margin-top:-25px !important;  }  .xxl-mb--25 {   margin-bottom:-25px !important;  }  .xxl-ml--25 {   margin-left:-25px !important;  }  .xxl-mr--25 {   margin-right:-25px !important;  }  .xxl-mx--30 {   margin-right:-30px !important;   margin-left:-30px !important;  }  .xxl-my--30 {   margin-top:-30px !important;   margin-bottom:-30px !important;  }  .xxl-mt--30 {   margin-top:-30px !important;  }  .xxl-mb--30 {   margin-bottom:-30px !important;  }  .xxl-ml--30 {   margin-left:-30px !important;  }  .xxl-mr--30 {   margin-right:-30px !important;  }  .xxl-mx--35 {   margin-right:-35px !important;   margin-left:-35px !important;  }  .xxl-my--35 {   margin-top:-35px !important;   margin-bottom:-35px !important;  }  .xxl-mt--35 {   margin-top:-35px !important;  }  .xxl-mb--35 {   margin-bottom:-35px !important;  }  .xxl-ml--35 {   margin-left:-35px !important;  }  .xxl-mr--35 {   margin-right:-35px !important;  }  .xxl-mx--40 {   margin-right:-40px !important;   margin-left:-40px !important;  }  .xxl-my--40 {   margin-top:-40px !important;   margin-bottom:-40px !important;  }  .xxl-mt--40 {   margin-top:-40px !important;  }  .xxl-mb--40 {   margin-bottom:-40px !important;  }  .xxl-ml--40 {   margin-left:-40px !important;  }  .xxl-mr--40 {   margin-right:-40px !important;  }  .xxl-mx--45 {   margin-right:-45px !important;   margin-left:-45px !important;  }  .xxl-my--45 {   margin-top:-45px !important;   margin-bottom:-45px !important;  }  .xxl-mt--45 {   margin-top:-45px !important;  }  .xxl-mb--45 {   margin-bottom:-45px !important;  }  .xxl-ml--45 {   margin-left:-45px !important;  }  .xxl-mr--45 {   margin-right:-45px !important;  }  .xxl-mx--50 {   margin-right:-50px !important;   margin-left:-50px !important;  }  .xxl-my--50 {   margin-top:-50px !important;   margin-bottom:-50px !important;  }  .xxl-mt--50 {   margin-top:-50px !important;  }  .xxl-mb--50 {   margin-bottom:-50px !important;  }  .xxl-ml--50 {   margin-left:-50px !important;  }  .xxl-mr--50 {   margin-right:-50px !important;  }  .xxl-mx--55 {   margin-right:-55px !important;   margin-left:-55px !important;  }  .xxl-my--55 {   margin-top:-55px !important;   margin-bottom:-55px !important;  }  .xxl-mt--55 {   margin-top:-55px !important;  }  .xxl-mb--55 {   margin-bottom:-55px !important;  }  .xxl-ml--55 {   margin-left:-55px !important;  }  .xxl-mr--55 {   margin-right:-55px !important;  }  .xxl-mx--60 {   margin-right:-60px !important;   margin-left:-60px !important;  }  .xxl-my--60 {   margin-top:-60px !important;   margin-bottom:-60px !important;  }  .xxl-mt--60 {   margin-top:-60px !important;  }  .xxl-mb--60 {   margin-bottom:-60px !important;  }  .xxl-ml--60 {   margin-left:-60px !important;  }  .xxl-mr--60 {   margin-right:-60px !important;  }  .xxl-mx--65 {   margin-right:-65px !important;   margin-left:-65px !important;  }  .xxl-my--65 {   margin-top:-65px !important;   margin-bottom:-65px !important;  }  .xxl-mt--65 {   margin-top:-65px !important;  }  .xxl-mb--65 {   margin-bottom:-65px !important;  }  .xxl-ml--65 {   margin-left:-65px !important;  }  .xxl-mr--65 {   margin-right:-65px !important;  }  .xxl-mx--70 {   margin-right:-70px !important;   margin-left:-70px !important;  }  .xxl-my--70 {   margin-top:-70px !important;   margin-bottom:-70px !important;  }  .xxl-mt--70 {   margin-top:-70px !important;  }  .xxl-mb--70 {   margin-bottom:-70px !important;  }  .xxl-ml--70 {   margin-left:-70px !important;  }  .xxl-mr--70 {   margin-right:-70px !important;  }  .xxl-mx--75 {   margin-right:-75px !important;   margin-left:-75px !important;  }  .xxl-my--75 {   margin-top:-75px !important;   margin-bottom:-75px !important;  }  .xxl-mt--75 {   margin-top:-75px !important;  }  .xxl-mb--75 {   margin-bottom:-75px !important;  }  .xxl-ml--75 {   margin-left:-75px !important;  }  .xxl-mr--75 {   margin-right:-75px !important;  }  .xxl-mx--80 {   margin-right:-80px !important;   margin-left:-80px !important;  }  .xxl-my--80 {   margin-top:-80px !important;   margin-bottom:-80px !important;  }  .xxl-mt--80 {   margin-top:-80px !important;  }  .xxl-mb--80 {   margin-bottom:-80px !important;  }  .xxl-ml--80 {   margin-left:-80px !important;  }  .xxl-mr--80 {   margin-right:-80px !important;  }  .xxl-mx--85 {   margin-right:-85px !important;   margin-left:-85px !important;  }  .xxl-my--85 {   margin-top:-85px !important;   margin-bottom:-85px !important;  }  .xxl-mt--85 {   margin-top:-85px !important;  }  .xxl-mb--85 {   margin-bottom:-85px !important;  }  .xxl-ml--85 {   margin-left:-85px !important;  }  .xxl-mr--85 {   margin-right:-85px !important;  }  .xxl-mx--90 {   margin-right:-90px !important;   margin-left:-90px !important;  }  .xxl-my--90 {   margin-top:-90px !important;   margin-bottom:-90px !important;  }  .xxl-mt--90 {   margin-top:-90px !important;  }  .xxl-mb--90 {   margin-bottom:-90px !important;  }  .xxl-ml--90 {   margin-left:-90px !important;  }  .xxl-mr--90 {   margin-right:-90px !important;  }  .xxl-mx--95 {   margin-right:-95px !important;   margin-left:-95px !important;  }  .xxl-my--95 {   margin-top:-95px !important;   margin-bottom:-95px !important;  }  .xxl-mt--95 {   margin-top:-95px !important;  }  .xxl-mb--95 {   margin-bottom:-95px !important;  }  .xxl-ml--95 {   margin-left:-95px !important;  }  .xxl-mr--95 {   margin-right:-95px !important;  }  .xxl-mx--100 {   margin-right:-100px !important;   margin-left:-100px !important;  }  .xxl-my--100 {   margin-top:-100px !important;   margin-bottom:-100px !important;  }  .xxl-mt--100 {   margin-top:-100px !important;  }  .xxl-mb--100 {   margin-bottom:-100px !important;  }  .xxl-ml--100 {   margin-left:-100px !important;  }  .xxl-mr--100 {   margin-right:-100px !important;  }  .xxl-mx--105 {   margin-right:-105px !important;   margin-left:-105px !important;  }  .xxl-my--105 {   margin-top:-105px !important;   margin-bottom:-105px !important;  }  .xxl-mt--105 {   margin-top:-105px !important;  }  .xxl-mb--105 {   margin-bottom:-105px !important;  }  .xxl-ml--105 {   margin-left:-105px !important;  }  .xxl-mr--105 {   margin-right:-105px !important;  }  .xxl-mx--110 {   margin-right:-110px !important;   margin-left:-110px !important;  }  .xxl-my--110 {   margin-top:-110px !important;   margin-bottom:-110px !important;  }  .xxl-mt--110 {   margin-top:-110px !important;  }  .xxl-mb--110 {   margin-bottom:-110px !important;  }  .xxl-ml--110 {   margin-left:-110px !important;  }  .xxl-mr--110 {   margin-right:-110px !important;  }  .xxl-mx--115 {   margin-right:-115px !important;   margin-left:-115px !important;  }  .xxl-my--115 {   margin-top:-115px !important;   margin-bottom:-115px !important;  }  .xxl-mt--115 {   margin-top:-115px !important;  }  .xxl-mb--115 {   margin-bottom:-115px !important;  }  .xxl-ml--115 {   margin-left:-115px !important;  }  .xxl-mr--115 {   margin-right:-115px !important;  }  .xxl-mx--120 {   margin-right:-120px !important;   margin-left:-120px !important;  }  .xxl-my--120 {   margin-top:-120px !important;   margin-bottom:-120px !important;  }  .xxl-mt--120 {   margin-top:-120px !important;  }  .xxl-mb--120 {   margin-bottom:-120px !important;  }  .xxl-ml--120 {   margin-left:-120px !important;  }  .xxl-mr--120 {   margin-right:-120px !important;  }  .xxl-mx--125 {   margin-right:-125px !important;   margin-left:-125px !important;  }  .xxl-my--125 {   margin-top:-125px !important;   margin-bottom:-125px !important;  }  .xxl-mt--125 {   margin-top:-125px !important;  }  .xxl-mb--125 {   margin-bottom:-125px !important;  }  .xxl-ml--125 {   margin-left:-125px !important;  }  .xxl-mr--125 {   margin-right:-125px !important;  }  .xxl-mx--130 {   margin-right:-130px !important;   margin-left:-130px !important;  }  .xxl-my--130 {   margin-top:-130px !important;   margin-bottom:-130px !important;  }  .xxl-mt--130 {   margin-top:-130px !important;  }  .xxl-mb--130 {   margin-bottom:-130px !important;  }  .xxl-ml--130 {   margin-left:-130px !important;  }  .xxl-mr--130 {   margin-right:-130px !important;  }  .xxl-mx--135 {   margin-right:-135px !important;   margin-left:-135px !important;  }  .xxl-my--135 {   margin-top:-135px !important;   margin-bottom:-135px !important;  }  .xxl-mt--135 {   margin-top:-135px !important;  }  .xxl-mb--135 {   margin-bottom:-135px !important;  }  .xxl-ml--135 {   margin-left:-135px !important;  }  .xxl-mr--135 {   margin-right:-135px !important;  }  .xxl-mx--140 {   margin-right:-140px !important;   margin-left:-140px !important;  }  .xxl-my--140 {   margin-top:-140px !important;   margin-bottom:-140px !important;  }  .xxl-mt--140 {   margin-top:-140px !important;  }  .xxl-mb--140 {   margin-bottom:-140px !important;  }  .xxl-ml--140 {   margin-left:-140px !important;  }  .xxl-mr--140 {   margin-right:-140px !important;  }  .xxl-mx--145 {   margin-right:-145px !important;   margin-left:-145px !important;  }  .xxl-my--145 {   margin-top:-145px !important;   margin-bottom:-145px !important;  }  .xxl-mt--145 {   margin-top:-145px !important;  }  .xxl-mb--145 {   margin-bottom:-145px !important;  }  .xxl-ml--145 {   margin-left:-145px !important;  }  .xxl-mr--145 {   margin-right:-145px !important;  }  .xxl-mx--150 {   margin-right:-150px !important;   margin-left:-150px !important;  }  .xxl-my--150 {   margin-top:-150px !important;   margin-bottom:-150px !important;  }  .xxl-mt--150 {   margin-top:-150px !important;  }  .xxl-mb--150 {   margin-bottom:-150px !important;  }  .xxl-ml--150 {   margin-left:-150px !important;  }  .xxl-mr--150 {   margin-right:-150px !important;  } } @media (max-width:1399px) {  .ml-mx-5 {   margin-right:5px !important;   margin-left:5px !important;  }  .ml-my-5 {   margin-top:5px !important;   margin-bottom:5px !important;  }  .ml-mt-5 {   margin-top:5px !important;  }  .ml-mb-5 {   margin-bottom:5px !important;  }  .ml-ml-5 {   margin-left:5px !important;  }  .ml-mr-5 {   margin-right:5px !important;  }  .ml-mx-10 {   margin-right:10px !important;   margin-left:10px !important;  }  .ml-my-10 {   margin-top:10px !important;   margin-bottom:10px !important;  }  .ml-mt-10 {   margin-top:10px !important;  }  .ml-mb-10 {   margin-bottom:10px !important;  }  .ml-ml-10 {   margin-left:10px !important;  }  .ml-mr-10 {   margin-right:10px !important;  }  .ml-mx-15 {   margin-right:15px !important;   margin-left:15px !important;  }  .ml-my-15 {   margin-top:15px !important;   margin-bottom:15px !important;  }  .ml-mt-15 {   margin-top:15px !important;  }  .ml-mb-15 {   margin-bottom:15px !important;  }  .ml-ml-15 {   margin-left:15px !important;  }  .ml-mr-15 {   margin-right:15px !important;  }  .ml-mx-20 {   margin-right:20px !important;   margin-left:20px !important;  }  .ml-my-20 {   margin-top:20px !important;   margin-bottom:20px !important;  }  .ml-mt-20 {   margin-top:20px !important;  }  .ml-mb-20 {   margin-bottom:20px !important;  }  .ml-ml-20 {   margin-left:20px !important;  }  .ml-mr-20 {   margin-right:20px !important;  }  .ml-mx-25 {   margin-right:25px !important;   margin-left:25px !important;  }  .ml-my-25 {   margin-top:25px !important;   margin-bottom:25px !important;  }  .ml-mt-25 {   margin-top:25px !important;  }  .ml-mb-25 {   margin-bottom:25px !important;  }  .ml-ml-25 {   margin-left:25px !important;  }  .ml-mr-25 {   margin-right:25px !important;  }  .ml-mx-30 {   margin-right:30px !important;   margin-left:30px !important;  }  .ml-my-30 {   margin-top:30px !important;   margin-bottom:30px !important;  }  .ml-mt-30 {   margin-top:30px !important;  }  .ml-mb-30 {   margin-bottom:30px !important;  }  .ml-ml-30 {   margin-left:30px !important;  }  .ml-mr-30 {   margin-right:30px !important;  }  .ml-mx-35 {   margin-right:35px !important;   margin-left:35px !important;  }  .ml-my-35 {   margin-top:35px !important;   margin-bottom:35px !important;  }  .ml-mt-35 {   margin-top:35px !important;  }  .ml-mb-35 {   margin-bottom:35px !important;  }  .ml-ml-35 {   margin-left:35px !important;  }  .ml-mr-35 {   margin-right:35px !important;  }  .ml-mx-40 {   margin-right:40px !important;   margin-left:40px !important;  }  .ml-my-40 {   margin-top:40px !important;   margin-bottom:40px !important;  }  .ml-mt-40 {   margin-top:40px !important;  }  .ml-mb-40 {   margin-bottom:40px !important;  }  .ml-ml-40 {   margin-left:40px !important;  }  .ml-mr-40 {   margin-right:40px !important;  }  .ml-mx-45 {   margin-right:45px !important;   margin-left:45px !important;  }  .ml-my-45 {   margin-top:45px !important;   margin-bottom:45px !important;  }  .ml-mt-45 {   margin-top:45px !important;  }  .ml-mb-45 {   margin-bottom:45px !important;  }  .ml-ml-45 {   margin-left:45px !important;  }  .ml-mr-45 {   margin-right:45px !important;  }  .ml-mx-50 {   margin-right:50px !important;   margin-left:50px !important;  }  .ml-my-50 {   margin-top:50px !important;   margin-bottom:50px !important;  }  .ml-mt-50 {   margin-top:50px !important;  }  .ml-mb-50 {   margin-bottom:50px !important;  }  .ml-ml-50 {   margin-left:50px !important;  }  .ml-mr-50 {   margin-right:50px !important;  }  .ml-mx-55 {   margin-right:55px !important;   margin-left:55px !important;  }  .ml-my-55 {   margin-top:55px !important;   margin-bottom:55px !important;  }  .ml-mt-55 {   margin-top:55px !important;  }  .ml-mb-55 {   margin-bottom:55px !important;  }  .ml-ml-55 {   margin-left:55px !important;  }  .ml-mr-55 {   margin-right:55px !important;  }  .ml-mx-60 {   margin-right:60px !important;   margin-left:60px !important;  }  .ml-my-60 {   margin-top:60px !important;   margin-bottom:60px !important;  }  .ml-mt-60 {   margin-top:60px !important;  }  .ml-mb-60 {   margin-bottom:60px !important;  }  .ml-ml-60 {   margin-left:60px !important;  }  .ml-mr-60 {   margin-right:60px !important;  }  .ml-mx-65 {   margin-right:65px !important;   margin-left:65px !important;  }  .ml-my-65 {   margin-top:65px !important;   margin-bottom:65px !important;  }  .ml-mt-65 {   margin-top:65px !important;  }  .ml-mb-65 {   margin-bottom:65px !important;  }  .ml-ml-65 {   margin-left:65px !important;  }  .ml-mr-65 {   margin-right:65px !important;  }  .ml-mx-70 {   margin-right:70px !important;   margin-left:70px !important;  }  .ml-my-70 {   margin-top:70px !important;   margin-bottom:70px !important;  }  .ml-mt-70 {   margin-top:70px !important;  }  .ml-mb-70 {   margin-bottom:70px !important;  }  .ml-ml-70 {   margin-left:70px !important;  }  .ml-mr-70 {   margin-right:70px !important;  }  .ml-mx-75 {   margin-right:75px !important;   margin-left:75px !important;  }  .ml-my-75 {   margin-top:75px !important;   margin-bottom:75px !important;  }  .ml-mt-75 {   margin-top:75px !important;  }  .ml-mb-75 {   margin-bottom:75px !important;  }  .ml-ml-75 {   margin-left:75px !important;  }  .ml-mr-75 {   margin-right:75px !important;  }  .ml-mx-80 {   margin-right:80px !important;   margin-left:80px !important;  }  .ml-my-80 {   margin-top:80px !important;   margin-bottom:80px !important;  }  .ml-mt-80 {   margin-top:80px !important;  }  .ml-mb-80 {   margin-bottom:80px !important;  }  .ml-ml-80 {   margin-left:80px !important;  }  .ml-mr-80 {   margin-right:80px !important;  }  .ml-mx-85 {   margin-right:85px !important;   margin-left:85px !important;  }  .ml-my-85 {   margin-top:85px !important;   margin-bottom:85px !important;  }  .ml-mt-85 {   margin-top:85px !important;  }  .ml-mb-85 {   margin-bottom:85px !important;  }  .ml-ml-85 {   margin-left:85px !important;  }  .ml-mr-85 {   margin-right:85px !important;  }  .ml-mx-90 {   margin-right:90px !important;   margin-left:90px !important;  }  .ml-my-90 {   margin-top:90px !important;   margin-bottom:90px !important;  }  .ml-mt-90 {   margin-top:90px !important;  }  .ml-mb-90 {   margin-bottom:90px !important;  }  .ml-ml-90 {   margin-left:90px !important;  }  .ml-mr-90 {   margin-right:90px !important;  }  .ml-mx-95 {   margin-right:95px !important;   margin-left:95px !important;  }  .ml-my-95 {   margin-top:95px !important;   margin-bottom:95px !important;  }  .ml-mt-95 {   margin-top:95px !important;  }  .ml-mb-95 {   margin-bottom:95px !important;  }  .ml-ml-95 {   margin-left:95px !important;  }  .ml-mr-95 {   margin-right:95px !important;  }  .ml-mx-100 {   margin-right:100px !important;   margin-left:100px !important;  }  .ml-my-100 {   margin-top:100px !important;   margin-bottom:100px !important;  }  .ml-mt-100 {   margin-top:100px !important;  }  .ml-mb-100 {   margin-bottom:100px !important;  }  .ml-ml-100 {   margin-left:100px !important;  }  .ml-mr-100 {   margin-right:100px !important;  }  .ml-mx-105 {   margin-right:105px !important;   margin-left:105px !important;  }  .ml-my-105 {   margin-top:105px !important;   margin-bottom:105px !important;  }  .ml-mt-105 {   margin-top:105px !important;  }  .ml-mb-105 {   margin-bottom:105px !important;  }  .ml-ml-105 {   margin-left:105px !important;  }  .ml-mr-105 {   margin-right:105px !important;  }  .ml-mx-110 {   margin-right:110px !important;   margin-left:110px !important;  }  .ml-my-110 {   margin-top:110px !important;   margin-bottom:110px !important;  }  .ml-mt-110 {   margin-top:110px !important;  }  .ml-mb-110 {   margin-bottom:110px !important;  }  .ml-ml-110 {   margin-left:110px !important;  }  .ml-mr-110 {   margin-right:110px !important;  }  .ml-mx-115 {   margin-right:115px !important;   margin-left:115px !important;  }  .ml-my-115 {   margin-top:115px !important;   margin-bottom:115px !important;  }  .ml-mt-115 {   margin-top:115px !important;  }  .ml-mb-115 {   margin-bottom:115px !important;  }  .ml-ml-115 {   margin-left:115px !important;  }  .ml-mr-115 {   margin-right:115px !important;  }  .ml-mx-120 {   margin-right:120px !important;   margin-left:120px !important;  }  .ml-my-120 {   margin-top:120px !important;   margin-bottom:120px !important;  }  .ml-mt-120 {   margin-top:120px !important;  }  .ml-mb-120 {   margin-bottom:120px !important;  }  .ml-ml-120 {   margin-left:120px !important;  }  .ml-mr-120 {   margin-right:120px !important;  }  .ml-mx-125 {   margin-right:125px !important;   margin-left:125px !important;  }  .ml-my-125 {   margin-top:125px !important;   margin-bottom:125px !important;  }  .ml-mt-125 {   margin-top:125px !important;  }  .ml-mb-125 {   margin-bottom:125px !important;  }  .ml-ml-125 {   margin-left:125px !important;  }  .ml-mr-125 {   margin-right:125px !important;  }  .ml-mx-130 {   margin-right:130px !important;   margin-left:130px !important;  }  .ml-my-130 {   margin-top:130px !important;   margin-bottom:130px !important;  }  .ml-mt-130 {   margin-top:130px !important;  }  .ml-mb-130 {   margin-bottom:130px !important;  }  .ml-ml-130 {   margin-left:130px !important;  }  .ml-mr-130 {   margin-right:130px !important;  }  .ml-mx-135 {   margin-right:135px !important;   margin-left:135px !important;  }  .ml-my-135 {   margin-top:135px !important;   margin-bottom:135px !important;  }  .ml-mt-135 {   margin-top:135px !important;  }  .ml-mb-135 {   margin-bottom:135px !important;  }  .ml-ml-135 {   margin-left:135px !important;  }  .ml-mr-135 {   margin-right:135px !important;  }  .ml-mx-140 {   margin-right:140px !important;   margin-left:140px !important;  }  .ml-my-140 {   margin-top:140px !important;   margin-bottom:140px !important;  }  .ml-mt-140 {   margin-top:140px !important;  }  .ml-mb-140 {   margin-bottom:140px !important;  }  .ml-ml-140 {   margin-left:140px !important;  }  .ml-mr-140 {   margin-right:140px !important;  }  .ml-mx-145 {   margin-right:145px !important;   margin-left:145px !important;  }  .ml-my-145 {   margin-top:145px !important;   margin-bottom:145px !important;  }  .ml-mt-145 {   margin-top:145px !important;  }  .ml-mb-145 {   margin-bottom:145px !important;  }  .ml-ml-145 {   margin-left:145px !important;  }  .ml-mr-145 {   margin-right:145px !important;  }  .ml-mx-150 {   margin-right:150px !important;   margin-left:150px !important;  }  .ml-my-150 {   margin-top:150px !important;   margin-bottom:150px !important;  }  .ml-mt-150 {   margin-top:150px !important;  }  .ml-mb-150 {   margin-bottom:150px !important;  }  .ml-ml-150 {   margin-left:150px !important;  }  .ml-mr-150 {   margin-right:150px !important;  }  .ml-mx-0 {   margin-right:0 !important;   margin-left:0 !important;  }  .ml-my-0 {   margin-top:0 !important;   margin-bottom:0 !important;  }  .ml-mt-0 {   margin-top:0 !important;  }  .ml-mb-0 {   margin-bottom:0 !important;  }  .ml-ml-0 {   margin-left:0 !important;  }  .ml-mr-0 {   margin-right:0 !important;  }  .ml-m-0 {   margin:0 !important;  }  .ml-mx--5 {   margin-right:-5px !important;   margin-left:-5px !important;  }  .ml-my--5 {   margin-top:-5px !important;   margin-bottom:-5px !important;  }  .ml-mt--5 {   margin-top:-5px !important;  }  .ml-mb--5 {   margin-bottom:-5px !important;  }  .ml-ml--5 {   margin-left:-5px !important;  }  .ml-mr--5 {   margin-right:-5px !important;  }  .ml-mx--10 {   margin-right:-10px !important;   margin-left:-10px !important;  }  .ml-my--10 {   margin-top:-10px !important;   margin-bottom:-10px !important;  }  .ml-mt--10 {   margin-top:-10px !important;  }  .ml-mb--10 {   margin-bottom:-10px !important;  }  .ml-ml--10 {   margin-left:-10px !important;  }  .ml-mr--10 {   margin-right:-10px !important;  }  .ml-mx--15 {   margin-right:-15px !important;   margin-left:-15px !important;  }  .ml-my--15 {   margin-top:-15px !important;   margin-bottom:-15px !important;  }  .ml-mt--15 {   margin-top:-15px !important;  }  .ml-mb--15 {   margin-bottom:-15px !important;  }  .ml-ml--15 {   margin-left:-15px !important;  }  .ml-mr--15 {   margin-right:-15px !important;  }  .ml-mx--20 {   margin-right:-20px !important;   margin-left:-20px !important;  }  .ml-my--20 {   margin-top:-20px !important;   margin-bottom:-20px !important;  }  .ml-mt--20 {   margin-top:-20px !important;  }  .ml-mb--20 {   margin-bottom:-20px !important;  }  .ml-ml--20 {   margin-left:-20px !important;  }  .ml-mr--20 {   margin-right:-20px !important;  }  .ml-mx--25 {   margin-right:-25px !important;   margin-left:-25px !important;  }  .ml-my--25 {   margin-top:-25px !important;   margin-bottom:-25px !important;  }  .ml-mt--25 {   margin-top:-25px !important;  }  .ml-mb--25 {   margin-bottom:-25px !important;  }  .ml-ml--25 {   margin-left:-25px !important;  }  .ml-mr--25 {   margin-right:-25px !important;  }  .ml-mx--30 {   margin-right:-30px !important;   margin-left:-30px !important;  }  .ml-my--30 {   margin-top:-30px !important;   margin-bottom:-30px !important;  }  .ml-mt--30 {   margin-top:-30px !important;  }  .ml-mb--30 {   margin-bottom:-30px !important;  }  .ml-ml--30 {   margin-left:-30px !important;  }  .ml-mr--30 {   margin-right:-30px !important;  }  .ml-mx--35 {   margin-right:-35px !important;   margin-left:-35px !important;  }  .ml-my--35 {   margin-top:-35px !important;   margin-bottom:-35px !important;  }  .ml-mt--35 {   margin-top:-35px !important;  }  .ml-mb--35 {   margin-bottom:-35px !important;  }  .ml-ml--35 {   margin-left:-35px !important;  }  .ml-mr--35 {   margin-right:-35px !important;  }  .ml-mx--40 {   margin-right:-40px !important;   margin-left:-40px !important;  }  .ml-my--40 {   margin-top:-40px !important;   margin-bottom:-40px !important;  }  .ml-mt--40 {   margin-top:-40px !important;  }  .ml-mb--40 {   margin-bottom:-40px !important;  }  .ml-ml--40 {   margin-left:-40px !important;  }  .ml-mr--40 {   margin-right:-40px !important;  }  .ml-mx--45 {   margin-right:-45px !important;   margin-left:-45px !important;  }  .ml-my--45 {   margin-top:-45px !important;   margin-bottom:-45px !important;  }  .ml-mt--45 {   margin-top:-45px !important;  }  .ml-mb--45 {   margin-bottom:-45px !important;  }  .ml-ml--45 {   margin-left:-45px !important;  }  .ml-mr--45 {   margin-right:-45px !important;  }  .ml-mx--50 {   margin-right:-50px !important;   margin-left:-50px !important;  }  .ml-my--50 {   margin-top:-50px !important;   margin-bottom:-50px !important;  }  .ml-mt--50 {   margin-top:-50px !important;  }  .ml-mb--50 {   margin-bottom:-50px !important;  }  .ml-ml--50 {   margin-left:-50px !important;  }  .ml-mr--50 {   margin-right:-50px !important;  }  .ml-mx--55 {   margin-right:-55px !important;   margin-left:-55px !important;  }  .ml-my--55 {   margin-top:-55px !important;   margin-bottom:-55px !important;  }  .ml-mt--55 {   margin-top:-55px !important;  }  .ml-mb--55 {   margin-bottom:-55px !important;  }  .ml-ml--55 {   margin-left:-55px !important;  }  .ml-mr--55 {   margin-right:-55px !important;  }  .ml-mx--60 {   margin-right:-60px !important;   margin-left:-60px !important;  }  .ml-my--60 {   margin-top:-60px !important;   margin-bottom:-60px !important;  }  .ml-mt--60 {   margin-top:-60px !important;  }  .ml-mb--60 {   margin-bottom:-60px !important;  }  .ml-ml--60 {   margin-left:-60px !important;  }  .ml-mr--60 {   margin-right:-60px !important;  }  .ml-mx--65 {   margin-right:-65px !important;   margin-left:-65px !important;  }  .ml-my--65 {   margin-top:-65px !important;   margin-bottom:-65px !important;  }  .ml-mt--65 {   margin-top:-65px !important;  }  .ml-mb--65 {   margin-bottom:-65px !important;  }  .ml-ml--65 {   margin-left:-65px !important;  }  .ml-mr--65 {   margin-right:-65px !important;  }  .ml-mx--70 {   margin-right:-70px !important;   margin-left:-70px !important;  }  .ml-my--70 {   margin-top:-70px !important;   margin-bottom:-70px !important;  }  .ml-mt--70 {   margin-top:-70px !important;  }  .ml-mb--70 {   margin-bottom:-70px !important;  }  .ml-ml--70 {   margin-left:-70px !important;  }  .ml-mr--70 {   margin-right:-70px !important;  }  .ml-mx--75 {   margin-right:-75px !important;   margin-left:-75px !important;  }  .ml-my--75 {   margin-top:-75px !important;   margin-bottom:-75px !important;  }  .ml-mt--75 {   margin-top:-75px !important;  }  .ml-mb--75 {   margin-bottom:-75px !important;  }  .ml-ml--75 {   margin-left:-75px !important;  }  .ml-mr--75 {   margin-right:-75px !important;  }  .ml-mx--80 {   margin-right:-80px !important;   margin-left:-80px !important;  }  .ml-my--80 {   margin-top:-80px !important;   margin-bottom:-80px !important;  }  .ml-mt--80 {   margin-top:-80px !important;  }  .ml-mb--80 {   margin-bottom:-80px !important;  }  .ml-ml--80 {   margin-left:-80px !important;  }  .ml-mr--80 {   margin-right:-80px !important;  }  .ml-mx--85 {   margin-right:-85px !important;   margin-left:-85px !important;  }  .ml-my--85 {   margin-top:-85px !important;   margin-bottom:-85px !important;  }  .ml-mt--85 {   margin-top:-85px !important;  }  .ml-mb--85 {   margin-bottom:-85px !important;  }  .ml-ml--85 {   margin-left:-85px !important;  }  .ml-mr--85 {   margin-right:-85px !important;  }  .ml-mx--90 {   margin-right:-90px !important;   margin-left:-90px !important;  }  .ml-my--90 {   margin-top:-90px !important;   margin-bottom:-90px !important;  }  .ml-mt--90 {   margin-top:-90px !important;  }  .ml-mb--90 {   margin-bottom:-90px !important;  }  .ml-ml--90 {   margin-left:-90px !important;  }  .ml-mr--90 {   margin-right:-90px !important;  }  .ml-mx--95 {   margin-right:-95px !important;   margin-left:-95px !important;  }  .ml-my--95 {   margin-top:-95px !important;   margin-bottom:-95px !important;  }  .ml-mt--95 {   margin-top:-95px !important;  }  .ml-mb--95 {   margin-bottom:-95px !important;  }  .ml-ml--95 {   margin-left:-95px !important;  }  .ml-mr--95 {   margin-right:-95px !important;  }  .ml-mx--100 {   margin-right:-100px !important;   margin-left:-100px !important;  }  .ml-my--100 {   margin-top:-100px !important;   margin-bottom:-100px !important;  }  .ml-mt--100 {   margin-top:-100px !important;  }  .ml-mb--100 {   margin-bottom:-100px !important;  }  .ml-ml--100 {   margin-left:-100px !important;  }  .ml-mr--100 {   margin-right:-100px !important;  }  .ml-mx--105 {   margin-right:-105px !important;   margin-left:-105px !important;  }  .ml-my--105 {   margin-top:-105px !important;   margin-bottom:-105px !important;  }  .ml-mt--105 {   margin-top:-105px !important;  }  .ml-mb--105 {   margin-bottom:-105px !important;  }  .ml-ml--105 {   margin-left:-105px !important;  }  .ml-mr--105 {   margin-right:-105px !important;  }  .ml-mx--110 {   margin-right:-110px !important;   margin-left:-110px !important;  }  .ml-my--110 {   margin-top:-110px !important;   margin-bottom:-110px !important;  }  .ml-mt--110 {   margin-top:-110px !important;  }  .ml-mb--110 {   margin-bottom:-110px !important;  }  .ml-ml--110 {   margin-left:-110px !important;  }  .ml-mr--110 {   margin-right:-110px !important;  }  .ml-mx--115 {   margin-right:-115px !important;   margin-left:-115px !important;  }  .ml-my--115 {   margin-top:-115px !important;   margin-bottom:-115px !important;  }  .ml-mt--115 {   margin-top:-115px !important;  }  .ml-mb--115 {   margin-bottom:-115px !important;  }  .ml-ml--115 {   margin-left:-115px !important;  }  .ml-mr--115 {   margin-right:-115px !important;  }  .ml-mx--120 {   margin-right:-120px !important;   margin-left:-120px !important;  }  .ml-my--120 {   margin-top:-120px !important;   margin-bottom:-120px !important;  }  .ml-mt--120 {   margin-top:-120px !important;  }  .ml-mb--120 {   margin-bottom:-120px !important;  }  .ml-ml--120 {   margin-left:-120px !important;  }  .ml-mr--120 {   margin-right:-120px !important;  }  .ml-mx--125 {   margin-right:-125px !important;   margin-left:-125px !important;  }  .ml-my--125 {   margin-top:-125px !important;   margin-bottom:-125px !important;  }  .ml-mt--125 {   margin-top:-125px !important;  }  .ml-mb--125 {   margin-bottom:-125px !important;  }  .ml-ml--125 {   margin-left:-125px !important;  }  .ml-mr--125 {   margin-right:-125px !important;  }  .ml-mx--130 {   margin-right:-130px !important;   margin-left:-130px !important;  }  .ml-my--130 {   margin-top:-130px !important;   margin-bottom:-130px !important;  }  .ml-mt--130 {   margin-top:-130px !important;  }  .ml-mb--130 {   margin-bottom:-130px !important;  }  .ml-ml--130 {   margin-left:-130px !important;  }  .ml-mr--130 {   margin-right:-130px !important;  }  .ml-mx--135 {   margin-right:-135px !important;   margin-left:-135px !important;  }  .ml-my--135 {   margin-top:-135px !important;   margin-bottom:-135px !important;  }  .ml-mt--135 {   margin-top:-135px !important;  }  .ml-mb--135 {   margin-bottom:-135px !important;  }  .ml-ml--135 {   margin-left:-135px !important;  }  .ml-mr--135 {   margin-right:-135px !important;  }  .ml-mx--140 {   margin-right:-140px !important;   margin-left:-140px !important;  }  .ml-my--140 {   margin-top:-140px !important;   margin-bottom:-140px !important;  }  .ml-mt--140 {   margin-top:-140px !important;  }  .ml-mb--140 {   margin-bottom:-140px !important;  }  .ml-ml--140 {   margin-left:-140px !important;  }  .ml-mr--140 {   margin-right:-140px !important;  }  .ml-mx--145 {   margin-right:-145px !important;   margin-left:-145px !important;  }  .ml-my--145 {   margin-top:-145px !important;   margin-bottom:-145px !important;  }  .ml-mt--145 {   margin-top:-145px !important;  }  .ml-mb--145 {   margin-bottom:-145px !important;  }  .ml-ml--145 {   margin-left:-145px !important;  }  .ml-mr--145 {   margin-right:-145px !important;  }  .ml-mx--150 {   margin-right:-150px !important;   margin-left:-150px !important;  }  .ml-my--150 {   margin-top:-150px !important;   margin-bottom:-150px !important;  }  .ml-mt--150 {   margin-top:-150px !important;  }  .ml-mb--150 {   margin-bottom:-150px !important;  }  .ml-ml--150 {   margin-left:-150px !important;  }  .ml-mr--150 {   margin-right:-150px !important;  } } @media (max-width:1299px) {  .xl-mx-5 {   margin-right:5px !important;   margin-left:5px !important;  }  .xl-my-5 {   margin-top:5px !important;   margin-bottom:5px !important;  }  .xl-mt-5 {   margin-top:5px !important;  }  .xl-mb-5 {   margin-bottom:5px !important;  }  .xl-ml-5 {   margin-left:5px !important;  }  .xl-mr-5 {   margin-right:5px !important;  }  .xl-mx-10 {   margin-right:10px !important;   margin-left:10px !important;  }  .xl-my-10 {   margin-top:10px !important;   margin-bottom:10px !important;  }  .xl-mt-10 {   margin-top:10px !important;  }  .xl-mb-10 {   margin-bottom:10px !important;  }  .xl-ml-10 {   margin-left:10px !important;  }  .xl-mr-10 {   margin-right:10px !important;  }  .xl-mx-15 {   margin-right:15px !important;   margin-left:15px !important;  }  .xl-my-15 {   margin-top:15px !important;   margin-bottom:15px !important;  }  .xl-mt-15 {   margin-top:15px !important;  }  .xl-mb-15 {   margin-bottom:15px !important;  }  .xl-ml-15 {   margin-left:15px !important;  }  .xl-mr-15 {   margin-right:15px !important;  }  .xl-mx-20 {   margin-right:20px !important;   margin-left:20px !important;  }  .xl-my-20 {   margin-top:20px !important;   margin-bottom:20px !important;  }  .xl-mt-20 {   margin-top:20px !important;  }  .xl-mb-20 {   margin-bottom:20px !important;  }  .xl-ml-20 {   margin-left:20px !important;  }  .xl-mr-20 {   margin-right:20px !important;  }  .xl-mx-25 {   margin-right:25px !important;   margin-left:25px !important;  }  .xl-my-25 {   margin-top:25px !important;   margin-bottom:25px !important;  }  .xl-mt-25 {   margin-top:25px !important;  }  .xl-mb-25 {   margin-bottom:25px !important;  }  .xl-ml-25 {   margin-left:25px !important;  }  .xl-mr-25 {   margin-right:25px !important;  }  .xl-mx-30 {   margin-right:30px !important;   margin-left:30px !important;  }  .xl-my-30 {   margin-top:30px !important;   margin-bottom:30px !important;  }  .xl-mt-30 {   margin-top:30px !important;  }  .xl-mb-30 {   margin-bottom:30px !important;  }  .xl-ml-30 {   margin-left:30px !important;  }  .xl-mr-30 {   margin-right:30px !important;  }  .xl-mx-35 {   margin-right:35px !important;   margin-left:35px !important;  }  .xl-my-35 {   margin-top:35px !important;   margin-bottom:35px !important;  }  .xl-mt-35 {   margin-top:35px !important;  }  .xl-mb-35 {   margin-bottom:35px !important;  }  .xl-ml-35 {   margin-left:35px !important;  }  .xl-mr-35 {   margin-right:35px !important;  }  .xl-mx-40 {   margin-right:40px !important;   margin-left:40px !important;  }  .xl-my-40 {   margin-top:40px !important;   margin-bottom:40px !important;  }  .xl-mt-40 {   margin-top:40px !important;  }  .xl-mb-40 {   margin-bottom:40px !important;  }  .xl-ml-40 {   margin-left:40px !important;  }  .xl-mr-40 {   margin-right:40px !important;  }  .xl-mx-45 {   margin-right:45px !important;   margin-left:45px !important;  }  .xl-my-45 {   margin-top:45px !important;   margin-bottom:45px !important;  }  .xl-mt-45 {   margin-top:45px !important;  }  .xl-mb-45 {   margin-bottom:45px !important;  }  .xl-ml-45 {   margin-left:45px !important;  }  .xl-mr-45 {   margin-right:45px !important;  }  .xl-mx-50 {   margin-right:50px !important;   margin-left:50px !important;  }  .xl-my-50 {   margin-top:50px !important;   margin-bottom:50px !important;  }  .xl-mt-50 {   margin-top:50px !important;  }  .xl-mb-50 {   margin-bottom:50px !important;  }  .xl-ml-50 {   margin-left:50px !important;  }  .xl-mr-50 {   margin-right:50px !important;  }  .xl-mx-55 {   margin-right:55px !important;   margin-left:55px !important;  }  .xl-my-55 {   margin-top:55px !important;   margin-bottom:55px !important;  }  .xl-mt-55 {   margin-top:55px !important;  }  .xl-mb-55 {   margin-bottom:55px !important;  }  .xl-ml-55 {   margin-left:55px !important;  }  .xl-mr-55 {   margin-right:55px !important;  }  .xl-mx-60 {   margin-right:60px !important;   margin-left:60px !important;  }  .xl-my-60 {   margin-top:60px !important;   margin-bottom:60px !important;  }  .xl-mt-60 {   margin-top:60px !important;  }  .xl-mb-60 {   margin-bottom:60px !important;  }  .xl-ml-60 {   margin-left:60px !important;  }  .xl-mr-60 {   margin-right:60px !important;  }  .xl-mx-65 {   margin-right:65px !important;   margin-left:65px !important;  }  .xl-my-65 {   margin-top:65px !important;   margin-bottom:65px !important;  }  .xl-mt-65 {   margin-top:65px !important;  }  .xl-mb-65 {   margin-bottom:65px !important;  }  .xl-ml-65 {   margin-left:65px !important;  }  .xl-mr-65 {   margin-right:65px !important;  }  .xl-mx-70 {   margin-right:70px !important;   margin-left:70px !important;  }  .xl-my-70 {   margin-top:70px !important;   margin-bottom:70px !important;  }  .xl-mt-70 {   margin-top:70px !important;  }  .xl-mb-70 {   margin-bottom:70px !important;  }  .xl-ml-70 {   margin-left:70px !important;  }  .xl-mr-70 {   margin-right:70px !important;  }  .xl-mx-75 {   margin-right:75px !important;   margin-left:75px !important;  }  .xl-my-75 {   margin-top:75px !important;   margin-bottom:75px !important;  }  .xl-mt-75 {   margin-top:75px !important;  }  .xl-mb-75 {   margin-bottom:75px !important;  }  .xl-ml-75 {   margin-left:75px !important;  }  .xl-mr-75 {   margin-right:75px !important;  }  .xl-mx-80 {   margin-right:80px !important;   margin-left:80px !important;  }  .xl-my-80 {   margin-top:80px !important;   margin-bottom:80px !important;  }  .xl-mt-80 {   margin-top:80px !important;  }  .xl-mb-80 {   margin-bottom:80px !important;  }  .xl-ml-80 {   margin-left:80px !important;  }  .xl-mr-80 {   margin-right:80px !important;  }  .xl-mx-85 {   margin-right:85px !important;   margin-left:85px !important;  }  .xl-my-85 {   margin-top:85px !important;   margin-bottom:85px !important;  }  .xl-mt-85 {   margin-top:85px !important;  }  .xl-mb-85 {   margin-bottom:85px !important;  }  .xl-ml-85 {   margin-left:85px !important;  }  .xl-mr-85 {   margin-right:85px !important;  }  .xl-mx-90 {   margin-right:90px !important;   margin-left:90px !important;  }  .xl-my-90 {   margin-top:90px !important;   margin-bottom:90px !important;  }  .xl-mt-90 {   margin-top:90px !important;  }  .xl-mb-90 {   margin-bottom:90px !important;  }  .xl-ml-90 {   margin-left:90px !important;  }  .xl-mr-90 {   margin-right:90px !important;  }  .xl-mx-95 {   margin-right:95px !important;   margin-left:95px !important;  }  .xl-my-95 {   margin-top:95px !important;   margin-bottom:95px !important;  }  .xl-mt-95 {   margin-top:95px !important;  }  .xl-mb-95 {   margin-bottom:95px !important;  }  .xl-ml-95 {   margin-left:95px !important;  }  .xl-mr-95 {   margin-right:95px !important;  }  .xl-mx-100 {   margin-right:100px !important;   margin-left:100px !important;  }  .xl-my-100 {   margin-top:100px !important;   margin-bottom:100px !important;  }  .xl-mt-100 {   margin-top:100px !important;  }  .xl-mb-100 {   margin-bottom:100px !important;  }  .xl-ml-100 {   margin-left:100px !important;  }  .xl-mr-100 {   margin-right:100px !important;  }  .xl-mx-105 {   margin-right:105px !important;   margin-left:105px !important;  }  .xl-my-105 {   margin-top:105px !important;   margin-bottom:105px !important;  }  .xl-mt-105 {   margin-top:105px !important;  }  .xl-mb-105 {   margin-bottom:105px !important;  }  .xl-ml-105 {   margin-left:105px !important;  }  .xl-mr-105 {   margin-right:105px !important;  }  .xl-mx-110 {   margin-right:110px !important;   margin-left:110px !important;  }  .xl-my-110 {   margin-top:110px !important;   margin-bottom:110px !important;  }  .xl-mt-110 {   margin-top:110px !important;  }  .xl-mb-110 {   margin-bottom:110px !important;  }  .xl-ml-110 {   margin-left:110px !important;  }  .xl-mr-110 {   margin-right:110px !important;  }  .xl-mx-115 {   margin-right:115px !important;   margin-left:115px !important;  }  .xl-my-115 {   margin-top:115px !important;   margin-bottom:115px !important;  }  .xl-mt-115 {   margin-top:115px !important;  }  .xl-mb-115 {   margin-bottom:115px !important;  }  .xl-ml-115 {   margin-left:115px !important;  }  .xl-mr-115 {   margin-right:115px !important;  }  .xl-mx-120 {   margin-right:120px !important;   margin-left:120px !important;  }  .xl-my-120 {   margin-top:120px !important;   margin-bottom:120px !important;  }  .xl-mt-120 {   margin-top:120px !important;  }  .xl-mb-120 {   margin-bottom:120px !important;  }  .xl-ml-120 {   margin-left:120px !important;  }  .xl-mr-120 {   margin-right:120px !important;  }  .xl-mx-125 {   margin-right:125px !important;   margin-left:125px !important;  }  .xl-my-125 {   margin-top:125px !important;   margin-bottom:125px !important;  }  .xl-mt-125 {   margin-top:125px !important;  }  .xl-mb-125 {   margin-bottom:125px !important;  }  .xl-ml-125 {   margin-left:125px !important;  }  .xl-mr-125 {   margin-right:125px !important;  }  .xl-mx-130 {   margin-right:130px !important;   margin-left:130px !important;  }  .xl-my-130 {   margin-top:130px !important;   margin-bottom:130px !important;  }  .xl-mt-130 {   margin-top:130px !important;  }  .xl-mb-130 {   margin-bottom:130px !important;  }  .xl-ml-130 {   margin-left:130px !important;  }  .xl-mr-130 {   margin-right:130px !important;  }  .xl-mx-135 {   margin-right:135px !important;   margin-left:135px !important;  }  .xl-my-135 {   margin-top:135px !important;   margin-bottom:135px !important;  }  .xl-mt-135 {   margin-top:135px !important;  }  .xl-mb-135 {   margin-bottom:135px !important;  }  .xl-ml-135 {   margin-left:135px !important;  }  .xl-mr-135 {   margin-right:135px !important;  }  .xl-mx-140 {   margin-right:140px !important;   margin-left:140px !important;  }  .xl-my-140 {   margin-top:140px !important;   margin-bottom:140px !important;  }  .xl-mt-140 {   margin-top:140px !important;  }  .xl-mb-140 {   margin-bottom:140px !important;  }  .xl-ml-140 {   margin-left:140px !important;  }  .xl-mr-140 {   margin-right:140px !important;  }  .xl-mx-145 {   margin-right:145px !important;   margin-left:145px !important;  }  .xl-my-145 {   margin-top:145px !important;   margin-bottom:145px !important;  }  .xl-mt-145 {   margin-top:145px !important;  }  .xl-mb-145 {   margin-bottom:145px !important;  }  .xl-ml-145 {   margin-left:145px !important;  }  .xl-mr-145 {   margin-right:145px !important;  }  .xl-mx-150 {   margin-right:150px !important;   margin-left:150px !important;  }  .xl-my-150 {   margin-top:150px !important;   margin-bottom:150px !important;  }  .xl-mt-150 {   margin-top:150px !important;  }  .xl-mb-150 {   margin-bottom:150px !important;  }  .xl-ml-150 {   margin-left:150px !important;  }  .xl-mr-150 {   margin-right:150px !important;  }  .xl-mx-0 {   margin-right:0 !important;   margin-left:0 !important;  }  .xl-my-0 {   margin-top:0 !important;   margin-bottom:0 !important;  }  .xl-mt-0 {   margin-top:0 !important;  }  .xl-mb-0 {   margin-bottom:0 !important;  }  .xl-ml-0 {   margin-left:0 !important;  }  .xl-mr-0 {   margin-right:0 !important;  }  .xl-m-0 {   margin:0 !important;  }  .xl-mx--5 {   margin-right:-5px !important;   margin-left:-5px !important;  }  .xl-my--5 {   margin-top:-5px !important;   margin-bottom:-5px !important;  }  .xl-mt--5 {   margin-top:-5px !important;  }  .xl-mb--5 {   margin-bottom:-5px !important;  }  .xl-ml--5 {   margin-left:-5px !important;  }  .xl-mr--5 {   margin-right:-5px !important;  }  .xl-mx--10 {   margin-right:-10px !important;   margin-left:-10px !important;  }  .xl-my--10 {   margin-top:-10px !important;   margin-bottom:-10px !important;  }  .xl-mt--10 {   margin-top:-10px !important;  }  .xl-mb--10 {   margin-bottom:-10px !important;  }  .xl-ml--10 {   margin-left:-10px !important;  }  .xl-mr--10 {   margin-right:-10px !important;  }  .xl-mx--15 {   margin-right:-15px !important;   margin-left:-15px !important;  }  .xl-my--15 {   margin-top:-15px !important;   margin-bottom:-15px !important;  }  .xl-mt--15 {   margin-top:-15px !important;  }  .xl-mb--15 {   margin-bottom:-15px !important;  }  .xl-ml--15 {   margin-left:-15px !important;  }  .xl-mr--15 {   margin-right:-15px !important;  }  .xl-mx--20 {   margin-right:-20px !important;   margin-left:-20px !important;  }  .xl-my--20 {   margin-top:-20px !important;   margin-bottom:-20px !important;  }  .xl-mt--20 {   margin-top:-20px !important;  }  .xl-mb--20 {   margin-bottom:-20px !important;  }  .xl-ml--20 {   margin-left:-20px !important;  }  .xl-mr--20 {   margin-right:-20px !important;  }  .xl-mx--25 {   margin-right:-25px !important;   margin-left:-25px !important;  }  .xl-my--25 {   margin-top:-25px !important;   margin-bottom:-25px !important;  }  .xl-mt--25 {   margin-top:-25px !important;  }  .xl-mb--25 {   margin-bottom:-25px !important;  }  .xl-ml--25 {   margin-left:-25px !important;  }  .xl-mr--25 {   margin-right:-25px !important;  }  .xl-mx--30 {   margin-right:-30px !important;   margin-left:-30px !important;  }  .xl-my--30 {   margin-top:-30px !important;   margin-bottom:-30px !important;  }  .xl-mt--30 {   margin-top:-30px !important;  }  .xl-mb--30 {   margin-bottom:-30px !important;  }  .xl-ml--30 {   margin-left:-30px !important;  }  .xl-mr--30 {   margin-right:-30px !important;  }  .xl-mx--35 {   margin-right:-35px !important;   margin-left:-35px !important;  }  .xl-my--35 {   margin-top:-35px !important;   margin-bottom:-35px !important;  }  .xl-mt--35 {   margin-top:-35px !important;  }  .xl-mb--35 {   margin-bottom:-35px !important;  }  .xl-ml--35 {   margin-left:-35px !important;  }  .xl-mr--35 {   margin-right:-35px !important;  }  .xl-mx--40 {   margin-right:-40px !important;   margin-left:-40px !important;  }  .xl-my--40 {   margin-top:-40px !important;   margin-bottom:-40px !important;  }  .xl-mt--40 {   margin-top:-40px !important;  }  .xl-mb--40 {   margin-bottom:-40px !important;  }  .xl-ml--40 {   margin-left:-40px !important;  }  .xl-mr--40 {   margin-right:-40px !important;  }  .xl-mx--45 {   margin-right:-45px !important;   margin-left:-45px !important;  }  .xl-my--45 {   margin-top:-45px !important;   margin-bottom:-45px !important;  }  .xl-mt--45 {   margin-top:-45px !important;  }  .xl-mb--45 {   margin-bottom:-45px !important;  }  .xl-ml--45 {   margin-left:-45px !important;  }  .xl-mr--45 {   margin-right:-45px !important;  }  .xl-mx--50 {   margin-right:-50px !important;   margin-left:-50px !important;  }  .xl-my--50 {   margin-top:-50px !important;   margin-bottom:-50px !important;  }  .xl-mt--50 {   margin-top:-50px !important;  }  .xl-mb--50 {   margin-bottom:-50px !important;  }  .xl-ml--50 {   margin-left:-50px !important;  }  .xl-mr--50 {   margin-right:-50px !important;  }  .xl-mx--55 {   margin-right:-55px !important;   margin-left:-55px !important;  }  .xl-my--55 {   margin-top:-55px !important;   margin-bottom:-55px !important;  }  .xl-mt--55 {   margin-top:-55px !important;  }  .xl-mb--55 {   margin-bottom:-55px !important;  }  .xl-ml--55 {   margin-left:-55px !important;  }  .xl-mr--55 {   margin-right:-55px !important;  }  .xl-mx--60 {   margin-right:-60px !important;   margin-left:-60px !important;  }  .xl-my--60 {   margin-top:-60px !important;   margin-bottom:-60px !important;  }  .xl-mt--60 {   margin-top:-60px !important;  }  .xl-mb--60 {   margin-bottom:-60px !important;  }  .xl-ml--60 {   margin-left:-60px !important;  }  .xl-mr--60 {   margin-right:-60px !important;  }  .xl-mx--65 {   margin-right:-65px !important;   margin-left:-65px !important;  }  .xl-my--65 {   margin-top:-65px !important;   margin-bottom:-65px !important;  }  .xl-mt--65 {   margin-top:-65px !important;  }  .xl-mb--65 {   margin-bottom:-65px !important;  }  .xl-ml--65 {   margin-left:-65px !important;  }  .xl-mr--65 {   margin-right:-65px !important;  }  .xl-mx--70 {   margin-right:-70px !important;   margin-left:-70px !important;  }  .xl-my--70 {   margin-top:-70px !important;   margin-bottom:-70px !important;  }  .xl-mt--70 {   margin-top:-70px !important;  }  .xl-mb--70 {   margin-bottom:-70px !important;  }  .xl-ml--70 {   margin-left:-70px !important;  }  .xl-mr--70 {   margin-right:-70px !important;  }  .xl-mx--75 {   margin-right:-75px !important;   margin-left:-75px !important;  }  .xl-my--75 {   margin-top:-75px !important;   margin-bottom:-75px !important;  }  .xl-mt--75 {   margin-top:-75px !important;  }  .xl-mb--75 {   margin-bottom:-75px !important;  }  .xl-ml--75 {   margin-left:-75px !important;  }  .xl-mr--75 {   margin-right:-75px !important;  }  .xl-mx--80 {   margin-right:-80px !important;   margin-left:-80px !important;  }  .xl-my--80 {   margin-top:-80px !important;   margin-bottom:-80px !important;  }  .xl-mt--80 {   margin-top:-80px !important;  }  .xl-mb--80 {   margin-bottom:-80px !important;  }  .xl-ml--80 {   margin-left:-80px !important;  }  .xl-mr--80 {   margin-right:-80px !important;  }  .xl-mx--85 {   margin-right:-85px !important;   margin-left:-85px !important;  }  .xl-my--85 {   margin-top:-85px !important;   margin-bottom:-85px !important;  }  .xl-mt--85 {   margin-top:-85px !important;  }  .xl-mb--85 {   margin-bottom:-85px !important;  }  .xl-ml--85 {   margin-left:-85px !important;  }  .xl-mr--85 {   margin-right:-85px !important;  }  .xl-mx--90 {   margin-right:-90px !important;   margin-left:-90px !important;  }  .xl-my--90 {   margin-top:-90px !important;   margin-bottom:-90px !important;  }  .xl-mt--90 {   margin-top:-90px !important;  }  .xl-mb--90 {   margin-bottom:-90px !important;  }  .xl-ml--90 {   margin-left:-90px !important;  }  .xl-mr--90 {   margin-right:-90px !important;  }  .xl-mx--95 {   margin-right:-95px !important;   margin-left:-95px !important;  }  .xl-my--95 {   margin-top:-95px !important;   margin-bottom:-95px !important;  }  .xl-mt--95 {   margin-top:-95px !important;  }  .xl-mb--95 {   margin-bottom:-95px !important;  }  .xl-ml--95 {   margin-left:-95px !important;  }  .xl-mr--95 {   margin-right:-95px !important;  }  .xl-mx--100 {   margin-right:-100px !important;   margin-left:-100px !important;  }  .xl-my--100 {   margin-top:-100px !important;   margin-bottom:-100px !important;  }  .xl-mt--100 {   margin-top:-100px !important;  }  .xl-mb--100 {   margin-bottom:-100px !important;  }  .xl-ml--100 {   margin-left:-100px !important;  }  .xl-mr--100 {   margin-right:-100px !important;  }  .xl-mx--105 {   margin-right:-105px !important;   margin-left:-105px !important;  }  .xl-my--105 {   margin-top:-105px !important;   margin-bottom:-105px !important;  }  .xl-mt--105 {   margin-top:-105px !important;  }  .xl-mb--105 {   margin-bottom:-105px !important;  }  .xl-ml--105 {   margin-left:-105px !important;  }  .xl-mr--105 {   margin-right:-105px !important;  }  .xl-mx--110 {   margin-right:-110px !important;   margin-left:-110px !important;  }  .xl-my--110 {   margin-top:-110px !important;   margin-bottom:-110px !important;  }  .xl-mt--110 {   margin-top:-110px !important;  }  .xl-mb--110 {   margin-bottom:-110px !important;  }  .xl-ml--110 {   margin-left:-110px !important;  }  .xl-mr--110 {   margin-right:-110px !important;  }  .xl-mx--115 {   margin-right:-115px !important;   margin-left:-115px !important;  }  .xl-my--115 {   margin-top:-115px !important;   margin-bottom:-115px !important;  }  .xl-mt--115 {   margin-top:-115px !important;  }  .xl-mb--115 {   margin-bottom:-115px !important;  }  .xl-ml--115 {   margin-left:-115px !important;  }  .xl-mr--115 {   margin-right:-115px !important;  }  .xl-mx--120 {   margin-right:-120px !important;   margin-left:-120px !important;  }  .xl-my--120 {   margin-top:-120px !important;   margin-bottom:-120px !important;  }  .xl-mt--120 {   margin-top:-120px !important;  }  .xl-mb--120 {   margin-bottom:-120px !important;  }  .xl-ml--120 {   margin-left:-120px !important;  }  .xl-mr--120 {   margin-right:-120px !important;  }  .xl-mx--125 {   margin-right:-125px !important;   margin-left:-125px !important;  }  .xl-my--125 {   margin-top:-125px !important;   margin-bottom:-125px !important;  }  .xl-mt--125 {   margin-top:-125px !important;  }  .xl-mb--125 {   margin-bottom:-125px !important;  }  .xl-ml--125 {   margin-left:-125px !important;  }  .xl-mr--125 {   margin-right:-125px !important;  }  .xl-mx--130 {   margin-right:-130px !important;   margin-left:-130px !important;  }  .xl-my--130 {   margin-top:-130px !important;   margin-bottom:-130px !important;  }  .xl-mt--130 {   margin-top:-130px !important;  }  .xl-mb--130 {   margin-bottom:-130px !important;  }  .xl-ml--130 {   margin-left:-130px !important;  }  .xl-mr--130 {   margin-right:-130px !important;  }  .xl-mx--135 {   margin-right:-135px !important;   margin-left:-135px !important;  }  .xl-my--135 {   margin-top:-135px !important;   margin-bottom:-135px !important;  }  .xl-mt--135 {   margin-top:-135px !important;  }  .xl-mb--135 {   margin-bottom:-135px !important;  }  .xl-ml--135 {   margin-left:-135px !important;  }  .xl-mr--135 {   margin-right:-135px !important;  }  .xl-mx--140 {   margin-right:-140px !important;   margin-left:-140px !important;  }  .xl-my--140 {   margin-top:-140px !important;   margin-bottom:-140px !important;  }  .xl-mt--140 {   margin-top:-140px !important;  }  .xl-mb--140 {   margin-bottom:-140px !important;  }  .xl-ml--140 {   margin-left:-140px !important;  }  .xl-mr--140 {   margin-right:-140px !important;  }  .xl-mx--145 {   margin-right:-145px !important;   margin-left:-145px !important;  }  .xl-my--145 {   margin-top:-145px !important;   margin-bottom:-145px !important;  }  .xl-mt--145 {   margin-top:-145px !important;  }  .xl-mb--145 {   margin-bottom:-145px !important;  }  .xl-ml--145 {   margin-left:-145px !important;  }  .xl-mr--145 {   margin-right:-145px !important;  }  .xl-mx--150 {   margin-right:-150px !important;   margin-left:-150px !important;  }  .xl-my--150 {   margin-top:-150px !important;   margin-bottom:-150px !important;  }  .xl-mt--150 {   margin-top:-150px !important;  }  .xl-mb--150 {   margin-bottom:-150px !important;  }  .xl-ml--150 {   margin-left:-150px !important;  }  .xl-mr--150 {   margin-right:-150px !important;  } } @media (max-width:1199px) {  .lg-mx-5 {   margin-right:5px !important;   margin-left:5px !important;  }  .lg-my-5 {   margin-top:5px !important;   margin-bottom:5px !important;  }  .lg-mt-5 {   margin-top:5px !important;  }  .lg-mb-5 {   margin-bottom:5px !important;  }  .lg-ml-5 {   margin-left:5px !important;  }  .lg-mr-5 {   margin-right:5px !important;  }  .lg-mx-10 {   margin-right:10px !important;   margin-left:10px !important;  }  .lg-my-10 {   margin-top:10px !important;   margin-bottom:10px !important;  }  .lg-mt-10 {   margin-top:10px !important;  }  .lg-mb-10 {   margin-bottom:10px !important;  }  .lg-ml-10 {   margin-left:10px !important;  }  .lg-mr-10 {   margin-right:10px !important;  }  .lg-mx-15 {   margin-right:15px !important;   margin-left:15px !important;  }  .lg-my-15 {   margin-top:15px !important;   margin-bottom:15px !important;  }  .lg-mt-15 {   margin-top:15px !important;  }  .lg-mb-15 {   margin-bottom:15px !important;  }  .lg-ml-15 {   margin-left:15px !important;  }  .lg-mr-15 {   margin-right:15px !important;  }  .lg-mx-20 {   margin-right:20px !important;   margin-left:20px !important;  }  .lg-my-20 {   margin-top:20px !important;   margin-bottom:20px !important;  }  .lg-mt-20 {   margin-top:20px !important;  }  .lg-mb-20 {   margin-bottom:20px !important;  }  .lg-ml-20 {   margin-left:20px !important;  }  .lg-mr-20 {   margin-right:20px !important;  }  .lg-mx-25 {   margin-right:25px !important;   margin-left:25px !important;  }  .lg-my-25 {   margin-top:25px !important;   margin-bottom:25px !important;  }  .lg-mt-25 {   margin-top:25px !important;  }  .lg-mb-25 {   margin-bottom:25px !important;  }  .lg-ml-25 {   margin-left:25px !important;  }  .lg-mr-25 {   margin-right:25px !important;  }  .lg-mx-30 {   margin-right:30px !important;   margin-left:30px !important;  }  .lg-my-30 {   margin-top:30px !important;   margin-bottom:30px !important;  }  .lg-mt-30 {   margin-top:30px !important;  }  .lg-mb-30 {   margin-bottom:30px !important;  }  .lg-ml-30 {   margin-left:30px !important;  }  .lg-mr-30 {   margin-right:30px !important;  }  .lg-mx-35 {   margin-right:35px !important;   margin-left:35px !important;  }  .lg-my-35 {   margin-top:35px !important;   margin-bottom:35px !important;  }  .lg-mt-35 {   margin-top:35px !important;  }  .lg-mb-35 {   margin-bottom:35px !important;  }  .lg-ml-35 {   margin-left:35px !important;  }  .lg-mr-35 {   margin-right:35px !important;  }  .lg-mx-40 {   margin-right:40px !important;   margin-left:40px !important;  }  .lg-my-40 {   margin-top:40px !important;   margin-bottom:40px !important;  }  .lg-mt-40 {   margin-top:40px !important;  }  .lg-mb-40 {   margin-bottom:40px !important;  }  .lg-ml-40 {   margin-left:40px !important;  }  .lg-mr-40 {   margin-right:40px !important;  }  .lg-mx-45 {   margin-right:45px !important;   margin-left:45px !important;  }  .lg-my-45 {   margin-top:45px !important;   margin-bottom:45px !important;  }  .lg-mt-45 {   margin-top:45px !important;  }  .lg-mb-45 {   margin-bottom:45px !important;  }  .lg-ml-45 {   margin-left:45px !important;  }  .lg-mr-45 {   margin-right:45px !important;  }  .lg-mx-50 {   margin-right:50px !important;   margin-left:50px !important;  }  .lg-my-50 {   margin-top:50px !important;   margin-bottom:50px !important;  }  .lg-mt-50 {   margin-top:50px !important;  }  .lg-mb-50 {   margin-bottom:50px !important;  }  .lg-ml-50 {   margin-left:50px !important;  }  .lg-mr-50 {   margin-right:50px !important;  }  .lg-mx-55 {   margin-right:55px !important;   margin-left:55px !important;  }  .lg-my-55 {   margin-top:55px !important;   margin-bottom:55px !important;  }  .lg-mt-55 {   margin-top:55px !important;  }  .lg-mb-55 {   margin-bottom:55px !important;  }  .lg-ml-55 {   margin-left:55px !important;  }  .lg-mr-55 {   margin-right:55px !important;  }  .lg-mx-60 {   margin-right:60px !important;   margin-left:60px !important;  }  .lg-my-60 {   margin-top:60px !important;   margin-bottom:60px !important;  }  .lg-mt-60 {   margin-top:60px !important;  }  .lg-mb-60 {   margin-bottom:60px !important;  }  .lg-ml-60 {   margin-left:60px !important;  }  .lg-mr-60 {   margin-right:60px !important;  }  .lg-mx-65 {   margin-right:65px !important;   margin-left:65px !important;  }  .lg-my-65 {   margin-top:65px !important;   margin-bottom:65px !important;  }  .lg-mt-65 {   margin-top:65px !important;  }  .lg-mb-65 {   margin-bottom:65px !important;  }  .lg-ml-65 {   margin-left:65px !important;  }  .lg-mr-65 {   margin-right:65px !important;  }  .lg-mx-70 {   margin-right:70px !important;   margin-left:70px !important;  }  .lg-my-70 {   margin-top:70px !important;   margin-bottom:70px !important;  }  .lg-mt-70 {   margin-top:70px !important;  }  .lg-mb-70 {   margin-bottom:70px !important;  }  .lg-ml-70 {   margin-left:70px !important;  }  .lg-mr-70 {   margin-right:70px !important;  }  .lg-mx-75 {   margin-right:75px !important;   margin-left:75px !important;  }  .lg-my-75 {   margin-top:75px !important;   margin-bottom:75px !important;  }  .lg-mt-75 {   margin-top:75px !important;  }  .lg-mb-75 {   margin-bottom:75px !important;  }  .lg-ml-75 {   margin-left:75px !important;  }  .lg-mr-75 {   margin-right:75px !important;  }  .lg-mx-80 {   margin-right:80px !important;   margin-left:80px !important;  }  .lg-my-80 {   margin-top:80px !important;   margin-bottom:80px !important;  }  .lg-mt-80 {   margin-top:80px !important;  }  .lg-mb-80 {   margin-bottom:80px !important;  }  .lg-ml-80 {   margin-left:80px !important;  }  .lg-mr-80 {   margin-right:80px !important;  }  .lg-mx-85 {   margin-right:85px !important;   margin-left:85px !important;  }  .lg-my-85 {   margin-top:85px !important;   margin-bottom:85px !important;  }  .lg-mt-85 {   margin-top:85px !important;  }  .lg-mb-85 {   margin-bottom:85px !important;  }  .lg-ml-85 {   margin-left:85px !important;  }  .lg-mr-85 {   margin-right:85px !important;  }  .lg-mx-90 {   margin-right:90px !important;   margin-left:90px !important;  }  .lg-my-90 {   margin-top:90px !important;   margin-bottom:90px !important;  }  .lg-mt-90 {   margin-top:90px !important;  }  .lg-mb-90 {   margin-bottom:90px !important;  }  .lg-ml-90 {   margin-left:90px !important;  }  .lg-mr-90 {   margin-right:90px !important;  }  .lg-mx-95 {   margin-right:95px !important;   margin-left:95px !important;  }  .lg-my-95 {   margin-top:95px !important;   margin-bottom:95px !important;  }  .lg-mt-95 {   margin-top:95px !important;  }  .lg-mb-95 {   margin-bottom:95px !important;  }  .lg-ml-95 {   margin-left:95px !important;  }  .lg-mr-95 {   margin-right:95px !important;  }  .lg-mx-100 {   margin-right:100px !important;   margin-left:100px !important;  }  .lg-my-100 {   margin-top:100px !important;   margin-bottom:100px !important;  }  .lg-mt-100 {   margin-top:100px !important;  }  .lg-mb-100 {   margin-bottom:100px !important;  }  .lg-ml-100 {   margin-left:100px !important;  }  .lg-mr-100 {   margin-right:100px !important;  }  .lg-mx-105 {   margin-right:105px !important;   margin-left:105px !important;  }  .lg-my-105 {   margin-top:105px !important;   margin-bottom:105px !important;  }  .lg-mt-105 {   margin-top:105px !important;  }  .lg-mb-105 {   margin-bottom:105px !important;  }  .lg-ml-105 {   margin-left:105px !important;  }  .lg-mr-105 {   margin-right:105px !important;  }  .lg-mx-110 {   margin-right:110px !important;   margin-left:110px !important;  }  .lg-my-110 {   margin-top:110px !important;   margin-bottom:110px !important;  }  .lg-mt-110 {   margin-top:110px !important;  }  .lg-mb-110 {   margin-bottom:110px !important;  }  .lg-ml-110 {   margin-left:110px !important;  }  .lg-mr-110 {   margin-right:110px !important;  }  .lg-mx-115 {   margin-right:115px !important;   margin-left:115px !important;  }  .lg-my-115 {   margin-top:115px !important;   margin-bottom:115px !important;  }  .lg-mt-115 {   margin-top:115px !important;  }  .lg-mb-115 {   margin-bottom:115px !important;  }  .lg-ml-115 {   margin-left:115px !important;  }  .lg-mr-115 {   margin-right:115px !important;  }  .lg-mx-120 {   margin-right:120px !important;   margin-left:120px !important;  }  .lg-my-120 {   margin-top:120px !important;   margin-bottom:120px !important;  }  .lg-mt-120 {   margin-top:120px !important;  }  .lg-mb-120 {   margin-bottom:120px !important;  }  .lg-ml-120 {   margin-left:120px !important;  }  .lg-mr-120 {   margin-right:120px !important;  }  .lg-mx-125 {   margin-right:125px !important;   margin-left:125px !important;  }  .lg-my-125 {   margin-top:125px !important;   margin-bottom:125px !important;  }  .lg-mt-125 {   margin-top:125px !important;  }  .lg-mb-125 {   margin-bottom:125px !important;  }  .lg-ml-125 {   margin-left:125px !important;  }  .lg-mr-125 {   margin-right:125px !important;  }  .lg-mx-130 {   margin-right:130px !important;   margin-left:130px !important;  }  .lg-my-130 {   margin-top:130px !important;   margin-bottom:130px !important;  }  .lg-mt-130 {   margin-top:130px !important;  }  .lg-mb-130 {   margin-bottom:130px !important;  }  .lg-ml-130 {   margin-left:130px !important;  }  .lg-mr-130 {   margin-right:130px !important;  }  .lg-mx-135 {   margin-right:135px !important;   margin-left:135px !important;  }  .lg-my-135 {   margin-top:135px !important;   margin-bottom:135px !important;  }  .lg-mt-135 {   margin-top:135px !important;  }  .lg-mb-135 {   margin-bottom:135px !important;  }  .lg-ml-135 {   margin-left:135px !important;  }  .lg-mr-135 {   margin-right:135px !important;  }  .lg-mx-140 {   margin-right:140px !important;   margin-left:140px !important;  }  .lg-my-140 {   margin-top:140px !important;   margin-bottom:140px !important;  }  .lg-mt-140 {   margin-top:140px !important;  }  .lg-mb-140 {   margin-bottom:140px !important;  }  .lg-ml-140 {   margin-left:140px !important;  }  .lg-mr-140 {   margin-right:140px !important;  }  .lg-mx-145 {   margin-right:145px !important;   margin-left:145px !important;  }  .lg-my-145 {   margin-top:145px !important;   margin-bottom:145px !important;  }  .lg-mt-145 {   margin-top:145px !important;  }  .lg-mb-145 {   margin-bottom:145px !important;  }  .lg-ml-145 {   margin-left:145px !important;  }  .lg-mr-145 {   margin-right:145px !important;  }  .lg-mx-150 {   margin-right:150px !important;   margin-left:150px !important;  }  .lg-my-150 {   margin-top:150px !important;   margin-bottom:150px !important;  }  .lg-mt-150 {   margin-top:150px !important;  }  .lg-mb-150 {   margin-bottom:150px !important;  }  .lg-ml-150 {   margin-left:150px !important;  }  .lg-mr-150 {   margin-right:150px !important;  }  .lg-mx-0 {   margin-right:0 !important;   margin-left:0 !important;  }  .lg-my-0 {   margin-top:0 !important;   margin-bottom:0 !important;  }  .lg-mt-0 {   margin-top:0 !important;  }  .lg-mb-0 {   margin-bottom:0 !important;  }  .lg-ml-0 {   margin-left:0 !important;  }  .lg-mr-0 {   margin-right:0 !important;  }  .lg-m-0 {   margin:0 !important;  }  .lg-mx--5 {   margin-right:-5px !important;   margin-left:-5px !important;  }  .lg-my--5 {   margin-top:-5px !important;   margin-bottom:-5px !important;  }  .lg-mt--5 {   margin-top:-5px !important;  }  .lg-mb--5 {   margin-bottom:-5px !important;  }  .lg-ml--5 {   margin-left:-5px !important;  }  .lg-mr--5 {   margin-right:-5px !important;  }  .lg-mx--10 {   margin-right:-10px !important;   margin-left:-10px !important;  }  .lg-my--10 {   margin-top:-10px !important;   margin-bottom:-10px !important;  }  .lg-mt--10 {   margin-top:-10px !important;  }  .lg-mb--10 {   margin-bottom:-10px !important;  }  .lg-ml--10 {   margin-left:-10px !important;  }  .lg-mr--10 {   margin-right:-10px !important;  }  .lg-mx--15 {   margin-right:-15px !important;   margin-left:-15px !important;  }  .lg-my--15 {   margin-top:-15px !important;   margin-bottom:-15px !important;  }  .lg-mt--15 {   margin-top:-15px !important;  }  .lg-mb--15 {   margin-bottom:-15px !important;  }  .lg-ml--15 {   margin-left:-15px !important;  }  .lg-mr--15 {   margin-right:-15px !important;  }  .lg-mx--20 {   margin-right:-20px !important;   margin-left:-20px !important;  }  .lg-my--20 {   margin-top:-20px !important;   margin-bottom:-20px !important;  }  .lg-mt--20 {   margin-top:-20px !important;  }  .lg-mb--20 {   margin-bottom:-20px !important;  }  .lg-ml--20 {   margin-left:-20px !important;  }  .lg-mr--20 {   margin-right:-20px !important;  }  .lg-mx--25 {   margin-right:-25px !important;   margin-left:-25px !important;  }  .lg-my--25 {   margin-top:-25px !important;   margin-bottom:-25px !important;  }  .lg-mt--25 {   margin-top:-25px !important;  }  .lg-mb--25 {   margin-bottom:-25px !important;  }  .lg-ml--25 {   margin-left:-25px !important;  }  .lg-mr--25 {   margin-right:-25px !important;  }  .lg-mx--30 {   margin-right:-30px !important;   margin-left:-30px !important;  }  .lg-my--30 {   margin-top:-30px !important;   margin-bottom:-30px !important;  }  .lg-mt--30 {   margin-top:-30px !important;  }  .lg-mb--30 {   margin-bottom:-30px !important;  }  .lg-ml--30 {   margin-left:-30px !important;  }  .lg-mr--30 {   margin-right:-30px !important;  }  .lg-mx--35 {   margin-right:-35px !important;   margin-left:-35px !important;  }  .lg-my--35 {   margin-top:-35px !important;   margin-bottom:-35px !important;  }  .lg-mt--35 {   margin-top:-35px !important;  }  .lg-mb--35 {   margin-bottom:-35px !important;  }  .lg-ml--35 {   margin-left:-35px !important;  }  .lg-mr--35 {   margin-right:-35px !important;  }  .lg-mx--40 {   margin-right:-40px !important;   margin-left:-40px !important;  }  .lg-my--40 {   margin-top:-40px !important;   margin-bottom:-40px !important;  }  .lg-mt--40 {   margin-top:-40px !important;  }  .lg-mb--40 {   margin-bottom:-40px !important;  }  .lg-ml--40 {   margin-left:-40px !important;  }  .lg-mr--40 {   margin-right:-40px !important;  }  .lg-mx--45 {   margin-right:-45px !important;   margin-left:-45px !important;  }  .lg-my--45 {   margin-top:-45px !important;   margin-bottom:-45px !important;  }  .lg-mt--45 {   margin-top:-45px !important;  }  .lg-mb--45 {   margin-bottom:-45px !important;  }  .lg-ml--45 {   margin-left:-45px !important;  }  .lg-mr--45 {   margin-right:-45px !important;  }  .lg-mx--50 {   margin-right:-50px !important;   margin-left:-50px !important;  }  .lg-my--50 {   margin-top:-50px !important;   margin-bottom:-50px !important;  }  .lg-mt--50 {   margin-top:-50px !important;  }  .lg-mb--50 {   margin-bottom:-50px !important;  }  .lg-ml--50 {   margin-left:-50px !important;  }  .lg-mr--50 {   margin-right:-50px !important;  }  .lg-mx--55 {   margin-right:-55px !important;   margin-left:-55px !important;  }  .lg-my--55 {   margin-top:-55px !important;   margin-bottom:-55px !important;  }  .lg-mt--55 {   margin-top:-55px !important;  }  .lg-mb--55 {   margin-bottom:-55px !important;  }  .lg-ml--55 {   margin-left:-55px !important;  }  .lg-mr--55 {   margin-right:-55px !important;  }  .lg-mx--60 {   margin-right:-60px !important;   margin-left:-60px !important;  }  .lg-my--60 {   margin-top:-60px !important;   margin-bottom:-60px !important;  }  .lg-mt--60 {   margin-top:-60px !important;  }  .lg-mb--60 {   margin-bottom:-60px !important;  }  .lg-ml--60 {   margin-left:-60px !important;  }  .lg-mr--60 {   margin-right:-60px !important;  }  .lg-mx--65 {   margin-right:-65px !important;   margin-left:-65px !important;  }  .lg-my--65 {   margin-top:-65px !important;   margin-bottom:-65px !important;  }  .lg-mt--65 {   margin-top:-65px !important;  }  .lg-mb--65 {   margin-bottom:-65px !important;  }  .lg-ml--65 {   margin-left:-65px !important;  }  .lg-mr--65 {   margin-right:-65px !important;  }  .lg-mx--70 {   margin-right:-70px !important;   margin-left:-70px !important;  }  .lg-my--70 {   margin-top:-70px !important;   margin-bottom:-70px !important;  }  .lg-mt--70 {   margin-top:-70px !important;  }  .lg-mb--70 {   margin-bottom:-70px !important;  }  .lg-ml--70 {   margin-left:-70px !important;  }  .lg-mr--70 {   margin-right:-70px !important;  }  .lg-mx--75 {   margin-right:-75px !important;   margin-left:-75px !important;  }  .lg-my--75 {   margin-top:-75px !important;   margin-bottom:-75px !important;  }  .lg-mt--75 {   margin-top:-75px !important;  }  .lg-mb--75 {   margin-bottom:-75px !important;  }  .lg-ml--75 {   margin-left:-75px !important;  }  .lg-mr--75 {   margin-right:-75px !important;  }  .lg-mx--80 {   margin-right:-80px !important;   margin-left:-80px !important;  }  .lg-my--80 {   margin-top:-80px !important;   margin-bottom:-80px !important;  }  .lg-mt--80 {   margin-top:-80px !important;  }  .lg-mb--80 {   margin-bottom:-80px !important;  }  .lg-ml--80 {   margin-left:-80px !important;  }  .lg-mr--80 {   margin-right:-80px !important;  }  .lg-mx--85 {   margin-right:-85px !important;   margin-left:-85px !important;  }  .lg-my--85 {   margin-top:-85px !important;   margin-bottom:-85px !important;  }  .lg-mt--85 {   margin-top:-85px !important;  }  .lg-mb--85 {   margin-bottom:-85px !important;  }  .lg-ml--85 {   margin-left:-85px !important;  }  .lg-mr--85 {   margin-right:-85px !important;  }  .lg-mx--90 {   margin-right:-90px !important;   margin-left:-90px !important;  }  .lg-my--90 {   margin-top:-90px !important;   margin-bottom:-90px !important;  }  .lg-mt--90 {   margin-top:-90px !important;  }  .lg-mb--90 {   margin-bottom:-90px !important;  }  .lg-ml--90 {   margin-left:-90px !important;  }  .lg-mr--90 {   margin-right:-90px !important;  }  .lg-mx--95 {   margin-right:-95px !important;   margin-left:-95px !important;  }  .lg-my--95 {   margin-top:-95px !important;   margin-bottom:-95px !important;  }  .lg-mt--95 {   margin-top:-95px !important;  }  .lg-mb--95 {   margin-bottom:-95px !important;  }  .lg-ml--95 {   margin-left:-95px !important;  }  .lg-mr--95 {   margin-right:-95px !important;  }  .lg-mx--100 {   margin-right:-100px !important;   margin-left:-100px !important;  }  .lg-my--100 {   margin-top:-100px !important;   margin-bottom:-100px !important;  }  .lg-mt--100 {   margin-top:-100px !important;  }  .lg-mb--100 {   margin-bottom:-100px !important;  }  .lg-ml--100 {   margin-left:-100px !important;  }  .lg-mr--100 {   margin-right:-100px !important;  }  .lg-mx--105 {   margin-right:-105px !important;   margin-left:-105px !important;  }  .lg-my--105 {   margin-top:-105px !important;   margin-bottom:-105px !important;  }  .lg-mt--105 {   margin-top:-105px !important;  }  .lg-mb--105 {   margin-bottom:-105px !important;  }  .lg-ml--105 {   margin-left:-105px !important;  }  .lg-mr--105 {   margin-right:-105px !important;  }  .lg-mx--110 {   margin-right:-110px !important;   margin-left:-110px !important;  }  .lg-my--110 {   margin-top:-110px !important;   margin-bottom:-110px !important;  }  .lg-mt--110 {   margin-top:-110px !important;  }  .lg-mb--110 {   margin-bottom:-110px !important;  }  .lg-ml--110 {   margin-left:-110px !important;  }  .lg-mr--110 {   margin-right:-110px !important;  }  .lg-mx--115 {   margin-right:-115px !important;   margin-left:-115px !important;  }  .lg-my--115 {   margin-top:-115px !important;   margin-bottom:-115px !important;  }  .lg-mt--115 {   margin-top:-115px !important;  }  .lg-mb--115 {   margin-bottom:-115px !important;  }  .lg-ml--115 {   margin-left:-115px !important;  }  .lg-mr--115 {   margin-right:-115px !important;  }  .lg-mx--120 {   margin-right:-120px !important;   margin-left:-120px !important;  }  .lg-my--120 {   margin-top:-120px !important;   margin-bottom:-120px !important;  }  .lg-mt--120 {   margin-top:-120px !important;  }  .lg-mb--120 {   margin-bottom:-120px !important;  }  .lg-ml--120 {   margin-left:-120px !important;  }  .lg-mr--120 {   margin-right:-120px !important;  }  .lg-mx--125 {   margin-right:-125px !important;   margin-left:-125px !important;  }  .lg-my--125 {   margin-top:-125px !important;   margin-bottom:-125px !important;  }  .lg-mt--125 {   margin-top:-125px !important;  }  .lg-mb--125 {   margin-bottom:-125px !important;  }  .lg-ml--125 {   margin-left:-125px !important;  }  .lg-mr--125 {   margin-right:-125px !important;  }  .lg-mx--130 {   margin-right:-130px !important;   margin-left:-130px !important;  }  .lg-my--130 {   margin-top:-130px !important;   margin-bottom:-130px !important;  }  .lg-mt--130 {   margin-top:-130px !important;  }  .lg-mb--130 {   margin-bottom:-130px !important;  }  .lg-ml--130 {   margin-left:-130px !important;  }  .lg-mr--130 {   margin-right:-130px !important;  }  .lg-mx--135 {   margin-right:-135px !important;   margin-left:-135px !important;  }  .lg-my--135 {   margin-top:-135px !important;   margin-bottom:-135px !important;  }  .lg-mt--135 {   margin-top:-135px !important;  }  .lg-mb--135 {   margin-bottom:-135px !important;  }  .lg-ml--135 {   margin-left:-135px !important;  }  .lg-mr--135 {   margin-right:-135px !important;  }  .lg-mx--140 {   margin-right:-140px !important;   margin-left:-140px !important;  }  .lg-my--140 {   margin-top:-140px !important;   margin-bottom:-140px !important;  }  .lg-mt--140 {   margin-top:-140px !important;  }  .lg-mb--140 {   margin-bottom:-140px !important;  }  .lg-ml--140 {   margin-left:-140px !important;  }  .lg-mr--140 {   margin-right:-140px !important;  }  .lg-mx--145 {   margin-right:-145px !important;   margin-left:-145px !important;  }  .lg-my--145 {   margin-top:-145px !important;   margin-bottom:-145px !important;  }  .lg-mt--145 {   margin-top:-145px !important;  }  .lg-mb--145 {   margin-bottom:-145px !important;  }  .lg-ml--145 {   margin-left:-145px !important;  }  .lg-mr--145 {   margin-right:-145px !important;  }  .lg-mx--150 {   margin-right:-150px !important;   margin-left:-150px !important;  }  .lg-my--150 {   margin-top:-150px !important;   margin-bottom:-150px !important;  }  .lg-mt--150 {   margin-top:-150px !important;  }  .lg-mb--150 {   margin-bottom:-150px !important;  }  .lg-ml--150 {   margin-left:-150px !important;  }  .lg-mr--150 {   margin-right:-150px !important;  } } @media (max-width:991px) {  .md-mx-5 {   margin-right:5px !important;   margin-left:5px !important;  }  .md-my-5 {   margin-top:5px !important;   margin-bottom:5px !important;  }  .md-mt-5 {   margin-top:5px !important;  }  .md-mb-5 {   margin-bottom:5px !important;  }  .md-ml-5 {   margin-left:5px !important;  }  .md-mr-5 {   margin-right:5px !important;  }  .md-mx-10 {   margin-right:10px !important;   margin-left:10px !important;  }  .md-my-10 {   margin-top:10px !important;   margin-bottom:10px !important;  }  .md-mt-10 {   margin-top:10px !important;  }  .md-mb-10 {   margin-bottom:10px !important;  }  .md-ml-10 {   margin-left:10px !important;  }  .md-mr-10 {   margin-right:10px !important;  }  .md-mx-15 {   margin-right:15px !important;   margin-left:15px !important;  }  .md-my-15 {   margin-top:15px !important;   margin-bottom:15px !important;  }  .md-mt-15 {   margin-top:15px !important;  }  .md-mb-15 {   margin-bottom:15px !important;  }  .md-ml-15 {   margin-left:15px !important;  }  .md-mr-15 {   margin-right:15px !important;  }  .md-mx-20 {   margin-right:20px !important;   margin-left:20px !important;  }  .md-my-20 {   margin-top:20px !important;   margin-bottom:20px !important;  }  .md-mt-20 {   margin-top:20px !important;  }  .md-mb-20 {   margin-bottom:20px !important;  }  .md-ml-20 {   margin-left:20px !important;  }  .md-mr-20 {   margin-right:20px !important;  }  .md-mx-25 {   margin-right:25px !important;   margin-left:25px !important;  }  .md-my-25 {   margin-top:25px !important;   margin-bottom:25px !important;  }  .md-mt-25 {   margin-top:25px !important;  }  .md-mb-25 {   margin-bottom:25px !important;  }  .md-ml-25 {   margin-left:25px !important;  }  .md-mr-25 {   margin-right:25px !important;  }  .md-mx-30 {   margin-right:30px !important;   margin-left:30px !important;  }  .md-my-30 {   margin-top:30px !important;   margin-bottom:30px !important;  }  .md-mt-30 {   margin-top:30px !important;  }  .md-mb-30 {   margin-bottom:30px !important;  }  .md-ml-30 {   margin-left:30px !important;  }  .md-mr-30 {   margin-right:30px !important;  }  .md-mx-35 {   margin-right:35px !important;   margin-left:35px !important;  }  .md-my-35 {   margin-top:35px !important;   margin-bottom:35px !important;  }  .md-mt-35 {   margin-top:35px !important;  }  .md-mb-35 {   margin-bottom:35px !important;  }  .md-ml-35 {   margin-left:35px !important;  }  .md-mr-35 {   margin-right:35px !important;  }  .md-mx-40 {   margin-right:40px !important;   margin-left:40px !important;  }  .md-my-40 {   margin-top:40px !important;   margin-bottom:40px !important;  }  .md-mt-40 {   margin-top:40px !important;  }  .md-mb-40 {   margin-bottom:40px !important;  }  .md-ml-40 {   margin-left:40px !important;  }  .md-mr-40 {   margin-right:40px !important;  }  .md-mx-45 {   margin-right:45px !important;   margin-left:45px !important;  }  .md-my-45 {   margin-top:45px !important;   margin-bottom:45px !important;  }  .md-mt-45 {   margin-top:45px !important;  }  .md-mb-45 {   margin-bottom:45px !important;  }  .md-ml-45 {   margin-left:45px !important;  }  .md-mr-45 {   margin-right:45px !important;  }  .md-mx-50 {   margin-right:50px !important;   margin-left:50px !important;  }  .md-my-50 {   margin-top:50px !important;   margin-bottom:50px !important;  }  .md-mt-50 {   margin-top:50px !important;  }  .md-mb-50 {   margin-bottom:50px !important;  }  .md-ml-50 {   margin-left:50px !important;  }  .md-mr-50 {   margin-right:50px !important;  }  .md-mx-55 {   margin-right:55px !important;   margin-left:55px !important;  }  .md-my-55 {   margin-top:55px !important;   margin-bottom:55px !important;  }  .md-mt-55 {   margin-top:55px !important;  }  .md-mb-55 {   margin-bottom:55px !important;  }  .md-ml-55 {   margin-left:55px !important;  }  .md-mr-55 {   margin-right:55px !important;  }  .md-mx-60 {   margin-right:60px !important;   margin-left:60px !important;  }  .md-my-60 {   margin-top:60px !important;   margin-bottom:60px !important;  }  .md-mt-60 {   margin-top:60px !important;  }  .md-mb-60 {   margin-bottom:60px !important;  }  .md-ml-60 {   margin-left:60px !important;  }  .md-mr-60 {   margin-right:60px !important;  }  .md-mx-65 {   margin-right:65px !important;   margin-left:65px !important;  }  .md-my-65 {   margin-top:65px !important;   margin-bottom:65px !important;  }  .md-mt-65 {   margin-top:65px !important;  }  .md-mb-65 {   margin-bottom:65px !important;  }  .md-ml-65 {   margin-left:65px !important;  }  .md-mr-65 {   margin-right:65px !important;  }  .md-mx-70 {   margin-right:70px !important;   margin-left:70px !important;  }  .md-my-70 {   margin-top:70px !important;   margin-bottom:70px !important;  }  .md-mt-70 {   margin-top:70px !important;  }  .md-mb-70 {   margin-bottom:70px !important;  }  .md-ml-70 {   margin-left:70px !important;  }  .md-mr-70 {   margin-right:70px !important;  }  .md-mx-75 {   margin-right:75px !important;   margin-left:75px !important;  }  .md-my-75 {   margin-top:75px !important;   margin-bottom:75px !important;  }  .md-mt-75 {   margin-top:75px !important;  }  .md-mb-75 {   margin-bottom:75px !important;  }  .md-ml-75 {   margin-left:75px !important;  }  .md-mr-75 {   margin-right:75px !important;  }  .md-mx-80 {   margin-right:80px !important;   margin-left:80px !important;  }  .md-my-80 {   margin-top:80px !important;   margin-bottom:80px !important;  }  .md-mt-80 {   margin-top:80px !important;  }  .md-mb-80 {   margin-bottom:80px !important;  }  .md-ml-80 {   margin-left:80px !important;  }  .md-mr-80 {   margin-right:80px !important;  }  .md-mx-85 {   margin-right:85px !important;   margin-left:85px !important;  }  .md-my-85 {   margin-top:85px !important;   margin-bottom:85px !important;  }  .md-mt-85 {   margin-top:85px !important;  }  .md-mb-85 {   margin-bottom:85px !important;  }  .md-ml-85 {   margin-left:85px !important;  }  .md-mr-85 {   margin-right:85px !important;  }  .md-mx-90 {   margin-right:90px !important;   margin-left:90px !important;  }  .md-my-90 {   margin-top:90px !important;   margin-bottom:90px !important;  }  .md-mt-90 {   margin-top:90px !important;  }  .md-mb-90 {   margin-bottom:90px !important;  }  .md-ml-90 {   margin-left:90px !important;  }  .md-mr-90 {   margin-right:90px !important;  }  .md-mx-95 {   margin-right:95px !important;   margin-left:95px !important;  }  .md-my-95 {   margin-top:95px !important;   margin-bottom:95px !important;  }  .md-mt-95 {   margin-top:95px !important;  }  .md-mb-95 {   margin-bottom:95px !important;  }  .md-ml-95 {   margin-left:95px !important;  }  .md-mr-95 {   margin-right:95px !important;  }  .md-mx-100 {   margin-right:100px !important;   margin-left:100px !important;  }  .md-my-100 {   margin-top:100px !important;   margin-bottom:100px !important;  }  .md-mt-100 {   margin-top:100px !important;  }  .md-mb-100 {   margin-bottom:100px !important;  }  .md-ml-100 {   margin-left:100px !important;  }  .md-mr-100 {   margin-right:100px !important;  }  .md-mx-105 {   margin-right:105px !important;   margin-left:105px !important;  }  .md-my-105 {   margin-top:105px !important;   margin-bottom:105px !important;  }  .md-mt-105 {   margin-top:105px !important;  }  .md-mb-105 {   margin-bottom:105px !important;  }  .md-ml-105 {   margin-left:105px !important;  }  .md-mr-105 {   margin-right:105px !important;  }  .md-mx-110 {   margin-right:110px !important;   margin-left:110px !important;  }  .md-my-110 {   margin-top:110px !important;   margin-bottom:110px !important;  }  .md-mt-110 {   margin-top:110px !important;  }  .md-mb-110 {   margin-bottom:110px !important;  }  .md-ml-110 {   margin-left:110px !important;  }  .md-mr-110 {   margin-right:110px !important;  }  .md-mx-115 {   margin-right:115px !important;   margin-left:115px !important;  }  .md-my-115 {   margin-top:115px !important;   margin-bottom:115px !important;  }  .md-mt-115 {   margin-top:115px !important;  }  .md-mb-115 {   margin-bottom:115px !important;  }  .md-ml-115 {   margin-left:115px !important;  }  .md-mr-115 {   margin-right:115px !important;  }  .md-mx-120 {   margin-right:120px !important;   margin-left:120px !important;  }  .md-my-120 {   margin-top:120px !important;   margin-bottom:120px !important;  }  .md-mt-120 {   margin-top:120px !important;  }  .md-mb-120 {   margin-bottom:120px !important;  }  .md-ml-120 {   margin-left:120px !important;  }  .md-mr-120 {   margin-right:120px !important;  }  .md-mx-125 {   margin-right:125px !important;   margin-left:125px !important;  }  .md-my-125 {   margin-top:125px !important;   margin-bottom:125px !important;  }  .md-mt-125 {   margin-top:125px !important;  }  .md-mb-125 {   margin-bottom:125px !important;  }  .md-ml-125 {   margin-left:125px !important;  }  .md-mr-125 {   margin-right:125px !important;  }  .md-mx-130 {   margin-right:130px !important;   margin-left:130px !important;  }  .md-my-130 {   margin-top:130px !important;   margin-bottom:130px !important;  }  .md-mt-130 {   margin-top:130px !important;  }  .md-mb-130 {   margin-bottom:130px !important;  }  .md-ml-130 {   margin-left:130px !important;  }  .md-mr-130 {   margin-right:130px !important;  }  .md-mx-135 {   margin-right:135px !important;   margin-left:135px !important;  }  .md-my-135 {   margin-top:135px !important;   margin-bottom:135px !important;  }  .md-mt-135 {   margin-top:135px !important;  }  .md-mb-135 {   margin-bottom:135px !important;  }  .md-ml-135 {   margin-left:135px !important;  }  .md-mr-135 {   margin-right:135px !important;  }  .md-mx-140 {   margin-right:140px !important;   margin-left:140px !important;  }  .md-my-140 {   margin-top:140px !important;   margin-bottom:140px !important;  }  .md-mt-140 {   margin-top:140px !important;  }  .md-mb-140 {   margin-bottom:140px !important;  }  .md-ml-140 {   margin-left:140px !important;  }  .md-mr-140 {   margin-right:140px !important;  }  .md-mx-145 {   margin-right:145px !important;   margin-left:145px !important;  }  .md-my-145 {   margin-top:145px !important;   margin-bottom:145px !important;  }  .md-mt-145 {   margin-top:145px !important;  }  .md-mb-145 {   margin-bottom:145px !important;  }  .md-ml-145 {   margin-left:145px !important;  }  .md-mr-145 {   margin-right:145px !important;  }  .md-mx-150 {   margin-right:150px !important;   margin-left:150px !important;  }  .md-my-150 {   margin-top:150px !important;   margin-bottom:150px !important;  }  .md-mt-150 {   margin-top:150px !important;  }  .md-mb-150 {   margin-bottom:150px !important;  }  .md-ml-150 {   margin-left:150px !important;  }  .md-mr-150 {   margin-right:150px !important;  }  .md-mx-0 {   margin-right:0 !important;   margin-left:0 !important;  }  .md-my-0 {   margin-top:0 !important;   margin-bottom:0 !important;  }  .md-mt-0 {   margin-top:0 !important;  }  .md-mb-0 {   margin-bottom:0 !important;  }  .md-ml-0 {   margin-left:0 !important;  }  .md-mr-0 {   margin-right:0 !important;  }  .md-m-0 {   margin:0 !important;  }  .md-mx--5 {   margin-right:-5px !important;   margin-left:-5px !important;  }  .md-my--5 {   margin-top:-5px !important;   margin-bottom:-5px !important;  }  .md-mt--5 {   margin-top:-5px !important;  }  .md-mb--5 {   margin-bottom:-5px !important;  }  .md-ml--5 {   margin-left:-5px !important;  }  .md-mr--5 {   margin-right:-5px !important;  }  .md-mx--10 {   margin-right:-10px !important;   margin-left:-10px !important;  }  .md-my--10 {   margin-top:-10px !important;   margin-bottom:-10px !important;  }  .md-mt--10 {   margin-top:-10px !important;  }  .md-mb--10 {   margin-bottom:-10px !important;  }  .md-ml--10 {   margin-left:-10px !important;  }  .md-mr--10 {   margin-right:-10px !important;  }  .md-mx--15 {   margin-right:-15px !important;   margin-left:-15px !important;  }  .md-my--15 {   margin-top:-15px !important;   margin-bottom:-15px !important;  }  .md-mt--15 {   margin-top:-15px !important;  }  .md-mb--15 {   margin-bottom:-15px !important;  }  .md-ml--15 {   margin-left:-15px !important;  }  .md-mr--15 {   margin-right:-15px !important;  }  .md-mx--20 {   margin-right:-20px !important;   margin-left:-20px !important;  }  .md-my--20 {   margin-top:-20px !important;   margin-bottom:-20px !important;  }  .md-mt--20 {   margin-top:-20px !important;  }  .md-mb--20 {   margin-bottom:-20px !important;  }  .md-ml--20 {   margin-left:-20px !important;  }  .md-mr--20 {   margin-right:-20px !important;  }  .md-mx--25 {   margin-right:-25px !important;   margin-left:-25px !important;  }  .md-my--25 {   margin-top:-25px !important;   margin-bottom:-25px !important;  }  .md-mt--25 {   margin-top:-25px !important;  }  .md-mb--25 {   margin-bottom:-25px !important;  }  .md-ml--25 {   margin-left:-25px !important;  }  .md-mr--25 {   margin-right:-25px !important;  }  .md-mx--30 {   margin-right:-30px !important;   margin-left:-30px !important;  }  .md-my--30 {   margin-top:-30px !important;   margin-bottom:-30px !important;  }  .md-mt--30 {   margin-top:-30px !important;  }  .md-mb--30 {   margin-bottom:-30px !important;  }  .md-ml--30 {   margin-left:-30px !important;  }  .md-mr--30 {   margin-right:-30px !important;  }  .md-mx--35 {   margin-right:-35px !important;   margin-left:-35px !important;  }  .md-my--35 {   margin-top:-35px !important;   margin-bottom:-35px !important;  }  .md-mt--35 {   margin-top:-35px !important;  }  .md-mb--35 {   margin-bottom:-35px !important;  }  .md-ml--35 {   margin-left:-35px !important;  }  .md-mr--35 {   margin-right:-35px !important;  }  .md-mx--40 {   margin-right:-40px !important;   margin-left:-40px !important;  }  .md-my--40 {   margin-top:-40px !important;   margin-bottom:-40px !important;  }  .md-mt--40 {   margin-top:-40px !important;  }  .md-mb--40 {   margin-bottom:-40px !important;  }  .md-ml--40 {   margin-left:-40px !important;  }  .md-mr--40 {   margin-right:-40px !important;  }  .md-mx--45 {   margin-right:-45px !important;   margin-left:-45px !important;  }  .md-my--45 {   margin-top:-45px !important;   margin-bottom:-45px !important;  }  .md-mt--45 {   margin-top:-45px !important;  }  .md-mb--45 {   margin-bottom:-45px !important;  }  .md-ml--45 {   margin-left:-45px !important;  }  .md-mr--45 {   margin-right:-45px !important;  }  .md-mx--50 {   margin-right:-50px !important;   margin-left:-50px !important;  }  .md-my--50 {   margin-top:-50px !important;   margin-bottom:-50px !important;  }  .md-mt--50 {   margin-top:-50px !important;  }  .md-mb--50 {   margin-bottom:-50px !important;  }  .md-ml--50 {   margin-left:-50px !important;  }  .md-mr--50 {   margin-right:-50px !important;  }  .md-mx--55 {   margin-right:-55px !important;   margin-left:-55px !important;  }  .md-my--55 {   margin-top:-55px !important;   margin-bottom:-55px !important;  }  .md-mt--55 {   margin-top:-55px !important;  }  .md-mb--55 {   margin-bottom:-55px !important;  }  .md-ml--55 {   margin-left:-55px !important;  }  .md-mr--55 {   margin-right:-55px !important;  }  .md-mx--60 {   margin-right:-60px !important;   margin-left:-60px !important;  }  .md-my--60 {   margin-top:-60px !important;   margin-bottom:-60px !important;  }  .md-mt--60 {   margin-top:-60px !important;  }  .md-mb--60 {   margin-bottom:-60px !important;  }  .md-ml--60 {   margin-left:-60px !important;  }  .md-mr--60 {   margin-right:-60px !important;  }  .md-mx--65 {   margin-right:-65px !important;   margin-left:-65px !important;  }  .md-my--65 {   margin-top:-65px !important;   margin-bottom:-65px !important;  }  .md-mt--65 {   margin-top:-65px !important;  }  .md-mb--65 {   margin-bottom:-65px !important;  }  .md-ml--65 {   margin-left:-65px !important;  }  .md-mr--65 {   margin-right:-65px !important;  }  .md-mx--70 {   margin-right:-70px !important;   margin-left:-70px !important;  }  .md-my--70 {   margin-top:-70px !important;   margin-bottom:-70px !important;  }  .md-mt--70 {   margin-top:-70px !important;  }  .md-mb--70 {   margin-bottom:-70px !important;  }  .md-ml--70 {   margin-left:-70px !important;  }  .md-mr--70 {   margin-right:-70px !important;  }  .md-mx--75 {   margin-right:-75px !important;   margin-left:-75px !important;  }  .md-my--75 {   margin-top:-75px !important;   margin-bottom:-75px !important;  }  .md-mt--75 {   margin-top:-75px !important;  }  .md-mb--75 {   margin-bottom:-75px !important;  }  .md-ml--75 {   margin-left:-75px !important;  }  .md-mr--75 {   margin-right:-75px !important;  }  .md-mx--80 {   margin-right:-80px !important;   margin-left:-80px !important;  }  .md-my--80 {   margin-top:-80px !important;   margin-bottom:-80px !important;  }  .md-mt--80 {   margin-top:-80px !important;  }  .md-mb--80 {   margin-bottom:-80px !important;  }  .md-ml--80 {   margin-left:-80px !important;  }  .md-mr--80 {   margin-right:-80px !important;  }  .md-mx--85 {   margin-right:-85px !important;   margin-left:-85px !important;  }  .md-my--85 {   margin-top:-85px !important;   margin-bottom:-85px !important;  }  .md-mt--85 {   margin-top:-85px !important;  }  .md-mb--85 {   margin-bottom:-85px !important;  }  .md-ml--85 {   margin-left:-85px !important;  }  .md-mr--85 {   margin-right:-85px !important;  }  .md-mx--90 {   margin-right:-90px !important;   margin-left:-90px !important;  }  .md-my--90 {   margin-top:-90px !important;   margin-bottom:-90px !important;  }  .md-mt--90 {   margin-top:-90px !important;  }  .md-mb--90 {   margin-bottom:-90px !important;  }  .md-ml--90 {   margin-left:-90px !important;  }  .md-mr--90 {   margin-right:-90px !important;  }  .md-mx--95 {   margin-right:-95px !important;   margin-left:-95px !important;  }  .md-my--95 {   margin-top:-95px !important;   margin-bottom:-95px !important;  }  .md-mt--95 {   margin-top:-95px !important;  }  .md-mb--95 {   margin-bottom:-95px !important;  }  .md-ml--95 {   margin-left:-95px !important;  }  .md-mr--95 {   margin-right:-95px !important;  }  .md-mx--100 {   margin-right:-100px !important;   margin-left:-100px !important;  }  .md-my--100 {   margin-top:-100px !important;   margin-bottom:-100px !important;  }  .md-mt--100 {   margin-top:-100px !important;  }  .md-mb--100 {   margin-bottom:-100px !important;  }  .md-ml--100 {   margin-left:-100px !important;  }  .md-mr--100 {   margin-right:-100px !important;  }  .md-mx--105 {   margin-right:-105px !important;   margin-left:-105px !important;  }  .md-my--105 {   margin-top:-105px !important;   margin-bottom:-105px !important;  }  .md-mt--105 {   margin-top:-105px !important;  }  .md-mb--105 {   margin-bottom:-105px !important;  }  .md-ml--105 {   margin-left:-105px !important;  }  .md-mr--105 {   margin-right:-105px !important;  }  .md-mx--110 {   margin-right:-110px !important;   margin-left:-110px !important;  }  .md-my--110 {   margin-top:-110px !important;   margin-bottom:-110px !important;  }  .md-mt--110 {   margin-top:-110px !important;  }  .md-mb--110 {   margin-bottom:-110px !important;  }  .md-ml--110 {   margin-left:-110px !important;  }  .md-mr--110 {   margin-right:-110px !important;  }  .md-mx--115 {   margin-right:-115px !important;   margin-left:-115px !important;  }  .md-my--115 {   margin-top:-115px !important;   margin-bottom:-115px !important;  }  .md-mt--115 {   margin-top:-115px !important;  }  .md-mb--115 {   margin-bottom:-115px !important;  }  .md-ml--115 {   margin-left:-115px !important;  }  .md-mr--115 {   margin-right:-115px !important;  }  .md-mx--120 {   margin-right:-120px !important;   margin-left:-120px !important;  }  .md-my--120 {   margin-top:-120px !important;   margin-bottom:-120px !important;  }  .md-mt--120 {   margin-top:-120px !important;  }  .md-mb--120 {   margin-bottom:-120px !important;  }  .md-ml--120 {   margin-left:-120px !important;  }  .md-mr--120 {   margin-right:-120px !important;  }  .md-mx--125 {   margin-right:-125px !important;   margin-left:-125px !important;  }  .md-my--125 {   margin-top:-125px !important;   margin-bottom:-125px !important;  }  .md-mt--125 {   margin-top:-125px !important;  }  .md-mb--125 {   margin-bottom:-125px !important;  }  .md-ml--125 {   margin-left:-125px !important;  }  .md-mr--125 {   margin-right:-125px !important;  }  .md-mx--130 {   margin-right:-130px !important;   margin-left:-130px !important;  }  .md-my--130 {   margin-top:-130px !important;   margin-bottom:-130px !important;  }  .md-mt--130 {   margin-top:-130px !important;  }  .md-mb--130 {   margin-bottom:-130px !important;  }  .md-ml--130 {   margin-left:-130px !important;  }  .md-mr--130 {   margin-right:-130px !important;  }  .md-mx--135 {   margin-right:-135px !important;   margin-left:-135px !important;  }  .md-my--135 {   margin-top:-135px !important;   margin-bottom:-135px !important;  }  .md-mt--135 {   margin-top:-135px !important;  }  .md-mb--135 {   margin-bottom:-135px !important;  }  .md-ml--135 {   margin-left:-135px !important;  }  .md-mr--135 {   margin-right:-135px !important;  }  .md-mx--140 {   margin-right:-140px !important;   margin-left:-140px !important;  }  .md-my--140 {   margin-top:-140px !important;   margin-bottom:-140px !important;  }  .md-mt--140 {   margin-top:-140px !important;  }  .md-mb--140 {   margin-bottom:-140px !important;  }  .md-ml--140 {   margin-left:-140px !important;  }  .md-mr--140 {   margin-right:-140px !important;  }  .md-mx--145 {   margin-right:-145px !important;   margin-left:-145px !important;  }  .md-my--145 {   margin-top:-145px !important;   margin-bottom:-145px !important;  }  .md-mt--145 {   margin-top:-145px !important;  }  .md-mb--145 {   margin-bottom:-145px !important;  }  .md-ml--145 {   margin-left:-145px !important;  }  .md-mr--145 {   margin-right:-145px !important;  }  .md-mx--150 {   margin-right:-150px !important;   margin-left:-150px !important;  }  .md-my--150 {   margin-top:-150px !important;   margin-bottom:-150px !important;  }  .md-mt--150 {   margin-top:-150px !important;  }  .md-mb--150 {   margin-bottom:-150px !important;  }  .md-ml--150 {   margin-left:-150px !important;  }  .md-mr--150 {   margin-right:-150px !important;  } } @media (max-width:767px) {  .sm-mx-5 {   margin-right:5px !important;   margin-left:5px !important;  }  .sm-my-5 {   margin-top:5px !important;   margin-bottom:5px !important;  }  .sm-mt-5 {   margin-top:5px !important;  }  .sm-mb-5 {   margin-bottom:5px !important;  }  .sm-ml-5 {   margin-left:5px !important;  }  .sm-mr-5 {   margin-right:5px !important;  }  .sm-mx-10 {   margin-right:10px !important;   margin-left:10px !important;  }  .sm-my-10 {   margin-top:10px !important;   margin-bottom:10px !important;  }  .sm-mt-10 {   margin-top:10px !important;  }  .sm-mb-10 {   margin-bottom:10px !important;  }  .sm-ml-10 {   margin-left:10px !important;  }  .sm-mr-10 {   margin-right:10px !important;  }  .sm-mx-15 {   margin-right:15px !important;   margin-left:15px !important;  }  .sm-my-15 {   margin-top:15px !important;   margin-bottom:15px !important;  }  .sm-mt-15 {   margin-top:15px !important;  }  .sm-mb-15 {   margin-bottom:15px !important;  }  .sm-ml-15 {   margin-left:15px !important;  }  .sm-mr-15 {   margin-right:15px !important;  }  .sm-mx-20 {   margin-right:20px !important;   margin-left:20px !important;  }  .sm-my-20 {   margin-top:20px !important;   margin-bottom:20px !important;  }  .sm-mt-20 {   margin-top:20px !important;  }  .sm-mb-20 {   margin-bottom:20px !important;  }  .sm-ml-20 {   margin-left:20px !important;  }  .sm-mr-20 {   margin-right:20px !important;  }  .sm-mx-25 {   margin-right:25px !important;   margin-left:25px !important;  }  .sm-my-25 {   margin-top:25px !important;   margin-bottom:25px !important;  }  .sm-mt-25 {   margin-top:25px !important;  }  .sm-mb-25 {   margin-bottom:25px !important;  }  .sm-ml-25 {   margin-left:25px !important;  }  .sm-mr-25 {   margin-right:25px !important;  }  .sm-mx-30 {   margin-right:30px !important;   margin-left:30px !important;  }  .sm-my-30 {   margin-top:30px !important;   margin-bottom:30px !important;  }  .sm-mt-30 {   margin-top:30px !important;  }  .sm-mb-30 {   margin-bottom:30px !important;  }  .sm-ml-30 {   margin-left:30px !important;  }  .sm-mr-30 {   margin-right:30px !important;  }  .sm-mx-35 {   margin-right:35px !important;   margin-left:35px !important;  }  .sm-my-35 {   margin-top:35px !important;   margin-bottom:35px !important;  }  .sm-mt-35 {   margin-top:35px !important;  }  .sm-mb-35 {   margin-bottom:35px !important;  }  .sm-ml-35 {   margin-left:35px !important;  }  .sm-mr-35 {   margin-right:35px !important;  }  .sm-mx-40 {   margin-right:40px !important;   margin-left:40px !important;  }  .sm-my-40 {   margin-top:40px !important;   margin-bottom:40px !important;  }  .sm-mt-40 {   margin-top:40px !important;  }  .sm-mb-40 {   margin-bottom:40px !important;  }  .sm-ml-40 {   margin-left:40px !important;  }  .sm-mr-40 {   margin-right:40px !important;  }  .sm-mx-45 {   margin-right:45px !important;   margin-left:45px !important;  }  .sm-my-45 {   margin-top:45px !important;   margin-bottom:45px !important;  }  .sm-mt-45 {   margin-top:45px !important;  }  .sm-mb-45 {   margin-bottom:45px !important;  }  .sm-ml-45 {   margin-left:45px !important;  }  .sm-mr-45 {   margin-right:45px !important;  }  .sm-mx-50 {   margin-right:50px !important;   margin-left:50px !important;  }  .sm-my-50 {   margin-top:50px !important;   margin-bottom:50px !important;  }  .sm-mt-50 {   margin-top:50px !important;  }  .sm-mb-50 {   margin-bottom:50px !important;  }  .sm-ml-50 {   margin-left:50px !important;  }  .sm-mr-50 {   margin-right:50px !important;  }  .sm-mx-55 {   margin-right:55px !important;   margin-left:55px !important;  }  .sm-my-55 {   margin-top:55px !important;   margin-bottom:55px !important;  }  .sm-mt-55 {   margin-top:55px !important;  }  .sm-mb-55 {   margin-bottom:55px !important;  }  .sm-ml-55 {   margin-left:55px !important;  }  .sm-mr-55 {   margin-right:55px !important;  }  .sm-mx-60 {   margin-right:60px !important;   margin-left:60px !important;  }  .sm-my-60 {   margin-top:60px !important;   margin-bottom:60px !important;  }  .sm-mt-60 {   margin-top:60px !important;  }  .sm-mb-60 {   margin-bottom:60px !important;  }  .sm-ml-60 {   margin-left:60px !important;  }  .sm-mr-60 {   margin-right:60px !important;  }  .sm-mx-65 {   margin-right:65px !important;   margin-left:65px !important;  }  .sm-my-65 {   margin-top:65px !important;   margin-bottom:65px !important;  }  .sm-mt-65 {   margin-top:65px !important;  }  .sm-mb-65 {   margin-bottom:65px !important;  }  .sm-ml-65 {   margin-left:65px !important;  }  .sm-mr-65 {   margin-right:65px !important;  }  .sm-mx-70 {   margin-right:70px !important;   margin-left:70px !important;  }  .sm-my-70 {   margin-top:70px !important;   margin-bottom:70px !important;  }  .sm-mt-70 {   margin-top:70px !important;  }  .sm-mb-70 {   margin-bottom:70px !important;  }  .sm-ml-70 {   margin-left:70px !important;  }  .sm-mr-70 {   margin-right:70px !important;  }  .sm-mx-75 {   margin-right:75px !important;   margin-left:75px !important;  }  .sm-my-75 {   margin-top:75px !important;   margin-bottom:75px !important;  }  .sm-mt-75 {   margin-top:75px !important;  }  .sm-mb-75 {   margin-bottom:75px !important;  }  .sm-ml-75 {   margin-left:75px !important;  }  .sm-mr-75 {   margin-right:75px !important;  }  .sm-mx-80 {   margin-right:80px !important;   margin-left:80px !important;  }  .sm-my-80 {   margin-top:80px !important;   margin-bottom:80px !important;  }  .sm-mt-80 {   margin-top:80px !important;  }  .sm-mb-80 {   margin-bottom:80px !important;  }  .sm-ml-80 {   margin-left:80px !important;  }  .sm-mr-80 {   margin-right:80px !important;  }  .sm-mx-85 {   margin-right:85px !important;   margin-left:85px !important;  }  .sm-my-85 {   margin-top:85px !important;   margin-bottom:85px !important;  }  .sm-mt-85 {   margin-top:85px !important;  }  .sm-mb-85 {   margin-bottom:85px !important;  }  .sm-ml-85 {   margin-left:85px !important;  }  .sm-mr-85 {   margin-right:85px !important;  }  .sm-mx-90 {   margin-right:90px !important;   margin-left:90px !important;  }  .sm-my-90 {   margin-top:90px !important;   margin-bottom:90px !important;  }  .sm-mt-90 {   margin-top:90px !important;  }  .sm-mb-90 {   margin-bottom:90px !important;  }  .sm-ml-90 {   margin-left:90px !important;  }  .sm-mr-90 {   margin-right:90px !important;  }  .sm-mx-95 {   margin-right:95px !important;   margin-left:95px !important;  }  .sm-my-95 {   margin-top:95px !important;   margin-bottom:95px !important;  }  .sm-mt-95 {   margin-top:95px !important;  }  .sm-mb-95 {   margin-bottom:95px !important;  }  .sm-ml-95 {   margin-left:95px !important;  }  .sm-mr-95 {   margin-right:95px !important;  }  .sm-mx-100 {   margin-right:100px !important;   margin-left:100px !important;  }  .sm-my-100 {   margin-top:100px !important;   margin-bottom:100px !important;  }  .sm-mt-100 {   margin-top:100px !important;  }  .sm-mb-100 {   margin-bottom:100px !important;  }  .sm-ml-100 {   margin-left:100px !important;  }  .sm-mr-100 {   margin-right:100px !important;  }  .sm-mx-105 {   margin-right:105px !important;   margin-left:105px !important;  }  .sm-my-105 {   margin-top:105px !important;   margin-bottom:105px !important;  }  .sm-mt-105 {   margin-top:105px !important;  }  .sm-mb-105 {   margin-bottom:105px !important;  }  .sm-ml-105 {   margin-left:105px !important;  }  .sm-mr-105 {   margin-right:105px !important;  }  .sm-mx-110 {   margin-right:110px !important;   margin-left:110px !important;  }  .sm-my-110 {   margin-top:110px !important;   margin-bottom:110px !important;  }  .sm-mt-110 {   margin-top:110px !important;  }  .sm-mb-110 {   margin-bottom:110px !important;  }  .sm-ml-110 {   margin-left:110px !important;  }  .sm-mr-110 {   margin-right:110px !important;  }  .sm-mx-115 {   margin-right:115px !important;   margin-left:115px !important;  }  .sm-my-115 {   margin-top:115px !important;   margin-bottom:115px !important;  }  .sm-mt-115 {   margin-top:115px !important;  }  .sm-mb-115 {   margin-bottom:115px !important;  }  .sm-ml-115 {   margin-left:115px !important;  }  .sm-mr-115 {   margin-right:115px !important;  }  .sm-mx-120 {   margin-right:120px !important;   margin-left:120px !important;  }  .sm-my-120 {   margin-top:120px !important;   margin-bottom:120px !important;  }  .sm-mt-120 {   margin-top:120px !important;  }  .sm-mb-120 {   margin-bottom:120px !important;  }  .sm-ml-120 {   margin-left:120px !important;  }  .sm-mr-120 {   margin-right:120px !important;  }  .sm-mx-125 {   margin-right:125px !important;   margin-left:125px !important;  }  .sm-my-125 {   margin-top:125px !important;   margin-bottom:125px !important;  }  .sm-mt-125 {   margin-top:125px !important;  }  .sm-mb-125 {   margin-bottom:125px !important;  }  .sm-ml-125 {   margin-left:125px !important;  }  .sm-mr-125 {   margin-right:125px !important;  }  .sm-mx-130 {   margin-right:130px !important;   margin-left:130px !important;  }  .sm-my-130 {   margin-top:130px !important;   margin-bottom:130px !important;  }  .sm-mt-130 {   margin-top:130px !important;  }  .sm-mb-130 {   margin-bottom:130px !important;  }  .sm-ml-130 {   margin-left:130px !important;  }  .sm-mr-130 {   margin-right:130px !important;  }  .sm-mx-135 {   margin-right:135px !important;   margin-left:135px !important;  }  .sm-my-135 {   margin-top:135px !important;   margin-bottom:135px !important;  }  .sm-mt-135 {   margin-top:135px !important;  }  .sm-mb-135 {   margin-bottom:135px !important;  }  .sm-ml-135 {   margin-left:135px !important;  }  .sm-mr-135 {   margin-right:135px !important;  }  .sm-mx-140 {   margin-right:140px !important;   margin-left:140px !important;  }  .sm-my-140 {   margin-top:140px !important;   margin-bottom:140px !important;  }  .sm-mt-140 {   margin-top:140px !important;  }  .sm-mb-140 {   margin-bottom:140px !important;  }  .sm-ml-140 {   margin-left:140px !important;  }  .sm-mr-140 {   margin-right:140px !important;  }  .sm-mx-145 {   margin-right:145px !important;   margin-left:145px !important;  }  .sm-my-145 {   margin-top:145px !important;   margin-bottom:145px !important;  }  .sm-mt-145 {   margin-top:145px !important;  }  .sm-mb-145 {   margin-bottom:145px !important;  }  .sm-ml-145 {   margin-left:145px !important;  }  .sm-mr-145 {   margin-right:145px !important;  }  .sm-mx-150 {   margin-right:150px !important;   margin-left:150px !important;  }  .sm-my-150 {   margin-top:150px !important;   margin-bottom:150px !important;  }  .sm-mt-150 {   margin-top:150px !important;  }  .sm-mb-150 {   margin-bottom:150px !important;  }  .sm-ml-150 {   margin-left:150px !important;  }  .sm-mr-150 {   margin-right:150px !important;  }  .sm-mx-0 {   margin-right:0 !important;   margin-left:0 !important;  }  .sm-my-0 {   margin-top:0 !important;   margin-bottom:0 !important;  }  .sm-mt-0 {   margin-top:0 !important;  }  .sm-mb-0 {   margin-bottom:0 !important;  }  .sm-ml-0 {   margin-left:0 !important;  }  .sm-mr-0 {   margin-right:0 !important;  }  .sm-m-0 {   margin:0 !important;  }  .sm-mx--5 {   margin-right:-5px !important;   margin-left:-5px !important;  }  .sm-my--5 {   margin-top:-5px !important;   margin-bottom:-5px !important;  }  .sm-mt--5 {   margin-top:-5px !important;  }  .sm-mb--5 {   margin-bottom:-5px !important;  }  .sm-ml--5 {   margin-left:-5px !important;  }  .sm-mr--5 {   margin-right:-5px !important;  }  .sm-mx--10 {   margin-right:-10px !important;   margin-left:-10px !important;  }  .sm-my--10 {   margin-top:-10px !important;   margin-bottom:-10px !important;  }  .sm-mt--10 {   margin-top:-10px !important;  }  .sm-mb--10 {   margin-bottom:-10px !important;  }  .sm-ml--10 {   margin-left:-10px !important;  }  .sm-mr--10 {   margin-right:-10px !important;  }  .sm-mx--15 {   margin-right:-15px !important;   margin-left:-15px !important;  }  .sm-my--15 {   margin-top:-15px !important;   margin-bottom:-15px !important;  }  .sm-mt--15 {   margin-top:-15px !important;  }  .sm-mb--15 {   margin-bottom:-15px !important;  }  .sm-ml--15 {   margin-left:-15px !important;  }  .sm-mr--15 {   margin-right:-15px !important;  }  .sm-mx--20 {   margin-right:-20px !important;   margin-left:-20px !important;  }  .sm-my--20 {   margin-top:-20px !important;   margin-bottom:-20px !important;  }  .sm-mt--20 {   margin-top:-20px !important;  }  .sm-mb--20 {   margin-bottom:-20px !important;  }  .sm-ml--20 {   margin-left:-20px !important;  }  .sm-mr--20 {   margin-right:-20px !important;  }  .sm-mx--25 {   margin-right:-25px !important;   margin-left:-25px !important;  }  .sm-my--25 {   margin-top:-25px !important;   margin-bottom:-25px !important;  }  .sm-mt--25 {   margin-top:-25px !important;  }  .sm-mb--25 {   margin-bottom:-25px !important;  }  .sm-ml--25 {   margin-left:-25px !important;  }  .sm-mr--25 {   margin-right:-25px !important;  }  .sm-mx--30 {   margin-right:-30px !important;   margin-left:-30px !important;  }  .sm-my--30 {   margin-top:-30px !important;   margin-bottom:-30px !important;  }  .sm-mt--30 {   margin-top:-30px !important;  }  .sm-mb--30 {   margin-bottom:-30px !important;  }  .sm-ml--30 {   margin-left:-30px !important;  }  .sm-mr--30 {   margin-right:-30px !important;  }  .sm-mx--35 {   margin-right:-35px !important;   margin-left:-35px !important;  }  .sm-my--35 {   margin-top:-35px !important;   margin-bottom:-35px !important;  }  .sm-mt--35 {   margin-top:-35px !important;  }  .sm-mb--35 {   margin-bottom:-35px !important;  }  .sm-ml--35 {   margin-left:-35px !important;  }  .sm-mr--35 {   margin-right:-35px !important;  }  .sm-mx--40 {   margin-right:-40px !important;   margin-left:-40px !important;  }  .sm-my--40 {   margin-top:-40px !important;   margin-bottom:-40px !important;  }  .sm-mt--40 {   margin-top:-40px !important;  }  .sm-mb--40 {   margin-bottom:-40px !important;  }  .sm-ml--40 {   margin-left:-40px !important;  }  .sm-mr--40 {   margin-right:-40px !important;  }  .sm-mx--45 {   margin-right:-45px !important;   margin-left:-45px !important;  }  .sm-my--45 {   margin-top:-45px !important;   margin-bottom:-45px !important;  }  .sm-mt--45 {   margin-top:-45px !important;  }  .sm-mb--45 {   margin-bottom:-45px !important;  }  .sm-ml--45 {   margin-left:-45px !important;  }  .sm-mr--45 {   margin-right:-45px !important;  }  .sm-mx--50 {   margin-right:-50px !important;   margin-left:-50px !important;  }  .sm-my--50 {   margin-top:-50px !important;   margin-bottom:-50px !important;  }  .sm-mt--50 {   margin-top:-50px !important;  }  .sm-mb--50 {   margin-bottom:-50px !important;  }  .sm-ml--50 {   margin-left:-50px !important;  }  .sm-mr--50 {   margin-right:-50px !important;  }  .sm-mx--55 {   margin-right:-55px !important;   margin-left:-55px !important;  }  .sm-my--55 {   margin-top:-55px !important;   margin-bottom:-55px !important;  }  .sm-mt--55 {   margin-top:-55px !important;  }  .sm-mb--55 {   margin-bottom:-55px !important;  }  .sm-ml--55 {   margin-left:-55px !important;  }  .sm-mr--55 {   margin-right:-55px !important;  }  .sm-mx--60 {   margin-right:-60px !important;   margin-left:-60px !important;  }  .sm-my--60 {   margin-top:-60px !important;   margin-bottom:-60px !important;  }  .sm-mt--60 {   margin-top:-60px !important;  }  .sm-mb--60 {   margin-bottom:-60px !important;  }  .sm-ml--60 {   margin-left:-60px !important;  }  .sm-mr--60 {   margin-right:-60px !important;  }  .sm-mx--65 {   margin-right:-65px !important;   margin-left:-65px !important;  }  .sm-my--65 {   margin-top:-65px !important;   margin-bottom:-65px !important;  }  .sm-mt--65 {   margin-top:-65px !important;  }  .sm-mb--65 {   margin-bottom:-65px !important;  }  .sm-ml--65 {   margin-left:-65px !important;  }  .sm-mr--65 {   margin-right:-65px !important;  }  .sm-mx--70 {   margin-right:-70px !important;   margin-left:-70px !important;  }  .sm-my--70 {   margin-top:-70px !important;   margin-bottom:-70px !important;  }  .sm-mt--70 {   margin-top:-70px !important;  }  .sm-mb--70 {   margin-bottom:-70px !important;  }  .sm-ml--70 {   margin-left:-70px !important;  }  .sm-mr--70 {   margin-right:-70px !important;  }  .sm-mx--75 {   margin-right:-75px !important;   margin-left:-75px !important;  }  .sm-my--75 {   margin-top:-75px !important;   margin-bottom:-75px !important;  }  .sm-mt--75 {   margin-top:-75px !important;  }  .sm-mb--75 {   margin-bottom:-75px !important;  }  .sm-ml--75 {   margin-left:-75px !important;  }  .sm-mr--75 {   margin-right:-75px !important;  }  .sm-mx--80 {   margin-right:-80px !important;   margin-left:-80px !important;  }  .sm-my--80 {   margin-top:-80px !important;   margin-bottom:-80px !important;  }  .sm-mt--80 {   margin-top:-80px !important;  }  .sm-mb--80 {   margin-bottom:-80px !important;  }  .sm-ml--80 {   margin-left:-80px !important;  }  .sm-mr--80 {   margin-right:-80px !important;  }  .sm-mx--85 {   margin-right:-85px !important;   margin-left:-85px !important;  }  .sm-my--85 {   margin-top:-85px !important;   margin-bottom:-85px !important;  }  .sm-mt--85 {   margin-top:-85px !important;  }  .sm-mb--85 {   margin-bottom:-85px !important;  }  .sm-ml--85 {   margin-left:-85px !important;  }  .sm-mr--85 {   margin-right:-85px !important;  }  .sm-mx--90 {   margin-right:-90px !important;   margin-left:-90px !important;  }  .sm-my--90 {   margin-top:-90px !important;   margin-bottom:-90px !important;  }  .sm-mt--90 {   margin-top:-90px !important;  }  .sm-mb--90 {   margin-bottom:-90px !important;  }  .sm-ml--90 {   margin-left:-90px !important;  }  .sm-mr--90 {   margin-right:-90px !important;  }  .sm-mx--95 {   margin-right:-95px !important;   margin-left:-95px !important;  }  .sm-my--95 {   margin-top:-95px !important;   margin-bottom:-95px !important;  }  .sm-mt--95 {   margin-top:-95px !important;  }  .sm-mb--95 {   margin-bottom:-95px !important;  }  .sm-ml--95 {   margin-left:-95px !important;  }  .sm-mr--95 {   margin-right:-95px !important;  }  .sm-mx--100 {   margin-right:-100px !important;   margin-left:-100px !important;  }  .sm-my--100 {   margin-top:-100px !important;   margin-bottom:-100px !important;  }  .sm-mt--100 {   margin-top:-100px !important;  }  .sm-mb--100 {   margin-bottom:-100px !important;  }  .sm-ml--100 {   margin-left:-100px !important;  }  .sm-mr--100 {   margin-right:-100px !important;  }  .sm-mx--105 {   margin-right:-105px !important;   margin-left:-105px !important;  }  .sm-my--105 {   margin-top:-105px !important;   margin-bottom:-105px !important;  }  .sm-mt--105 {   margin-top:-105px !important;  }  .sm-mb--105 {   margin-bottom:-105px !important;  }  .sm-ml--105 {   margin-left:-105px !important;  }  .sm-mr--105 {   margin-right:-105px !important;  }  .sm-mx--110 {   margin-right:-110px !important;   margin-left:-110px !important;  }  .sm-my--110 {   margin-top:-110px !important;   margin-bottom:-110px !important;  }  .sm-mt--110 {   margin-top:-110px !important;  }  .sm-mb--110 {   margin-bottom:-110px !important;  }  .sm-ml--110 {   margin-left:-110px !important;  }  .sm-mr--110 {   margin-right:-110px !important;  }  .sm-mx--115 {   margin-right:-115px !important;   margin-left:-115px !important;  }  .sm-my--115 {   margin-top:-115px !important;   margin-bottom:-115px !important;  }  .sm-mt--115 {   margin-top:-115px !important;  }  .sm-mb--115 {   margin-bottom:-115px !important;  }  .sm-ml--115 {   margin-left:-115px !important;  }  .sm-mr--115 {   margin-right:-115px !important;  }  .sm-mx--120 {   margin-right:-120px !important;   margin-left:-120px !important;  }  .sm-my--120 {   margin-top:-120px !important;   margin-bottom:-120px !important;  }  .sm-mt--120 {   margin-top:-120px !important;  }  .sm-mb--120 {   margin-bottom:-120px !important;  }  .sm-ml--120 {   margin-left:-120px !important;  }  .sm-mr--120 {   margin-right:-120px !important;  }  .sm-mx--125 {   margin-right:-125px !important;   margin-left:-125px !important;  }  .sm-my--125 {   margin-top:-125px !important;   margin-bottom:-125px !important;  }  .sm-mt--125 {   margin-top:-125px !important;  }  .sm-mb--125 {   margin-bottom:-125px !important;  }  .sm-ml--125 {   margin-left:-125px !important;  }  .sm-mr--125 {   margin-right:-125px !important;  }  .sm-mx--130 {   margin-right:-130px !important;   margin-left:-130px !important;  }  .sm-my--130 {   margin-top:-130px !important;   margin-bottom:-130px !important;  }  .sm-mt--130 {   margin-top:-130px !important;  }  .sm-mb--130 {   margin-bottom:-130px !important;  }  .sm-ml--130 {   margin-left:-130px !important;  }  .sm-mr--130 {   margin-right:-130px !important;  }  .sm-mx--135 {   margin-right:-135px !important;   margin-left:-135px !important;  }  .sm-my--135 {   margin-top:-135px !important;   margin-bottom:-135px !important;  }  .sm-mt--135 {   margin-top:-135px !important;  }  .sm-mb--135 {   margin-bottom:-135px !important;  }  .sm-ml--135 {   margin-left:-135px !important;  }  .sm-mr--135 {   margin-right:-135px !important;  }  .sm-mx--140 {   margin-right:-140px !important;   margin-left:-140px !important;  }  .sm-my--140 {   margin-top:-140px !important;   margin-bottom:-140px !important;  }  .sm-mt--140 {   margin-top:-140px !important;  }  .sm-mb--140 {   margin-bottom:-140px !important;  }  .sm-ml--140 {   margin-left:-140px !important;  }  .sm-mr--140 {   margin-right:-140px !important;  }  .sm-mx--145 {   margin-right:-145px !important;   margin-left:-145px !important;  }  .sm-my--145 {   margin-top:-145px !important;   margin-bottom:-145px !important;  }  .sm-mt--145 {   margin-top:-145px !important;  }  .sm-mb--145 {   margin-bottom:-145px !important;  }  .sm-ml--145 {   margin-left:-145px !important;  }  .sm-mr--145 {   margin-right:-145px !important;  }  .sm-mx--150 {   margin-right:-150px !important;   margin-left:-150px !important;  }  .sm-my--150 {   margin-top:-150px !important;   margin-bottom:-150px !important;  }  .sm-mt--150 {   margin-top:-150px !important;  }  .sm-mb--150 {   margin-bottom:-150px !important;  }  .sm-ml--150 {   margin-left:-150px !important;  }  .sm-mr--150 {   margin-right:-150px !important;  } } @media (max-width:575px) {  .xs-mx-5 {   margin-right:5px !important;   margin-left:5px !important;  }  .xs-my-5 {   margin-top:5px !important;   margin-bottom:5px !important;  }  .xs-mt-5 {   margin-top:5px !important;  }  .xs-mb-5 {   margin-bottom:5px !important;  }  .xs-ml-5 {   margin-left:5px !important;  }  .xs-mr-5 {   margin-right:5px !important;  }  .xs-mx-10 {   margin-right:10px !important;   margin-left:10px !important;  }  .xs-my-10 {   margin-top:10px !important;   margin-bottom:10px !important;  }  .xs-mt-10 {   margin-top:10px !important;  }  .xs-mb-10 {   margin-bottom:10px !important;  }  .xs-ml-10 {   margin-left:10px !important;  }  .xs-mr-10 {   margin-right:10px !important;  }  .xs-mx-15 {   margin-right:15px !important;   margin-left:15px !important;  }  .xs-my-15 {   margin-top:15px !important;   margin-bottom:15px !important;  }  .xs-mt-15 {   margin-top:15px !important;  }  .xs-mb-15 {   margin-bottom:15px !important;  }  .xs-ml-15 {   margin-left:15px !important;  }  .xs-mr-15 {   margin-right:15px !important;  }  .xs-mx-20 {   margin-right:20px !important;   margin-left:20px !important;  }  .xs-my-20 {   margin-top:20px !important;   margin-bottom:20px !important;  }  .xs-mt-20 {   margin-top:20px !important;  }  .xs-mb-20 {   margin-bottom:20px !important;  }  .xs-ml-20 {   margin-left:20px !important;  }  .xs-mr-20 {   margin-right:20px !important;  }  .xs-mx-25 {   margin-right:25px !important;   margin-left:25px !important;  }  .xs-my-25 {   margin-top:25px !important;   margin-bottom:25px !important;  }  .xs-mt-25 {   margin-top:25px !important;  }  .xs-mb-25 {   margin-bottom:25px !important;  }  .xs-ml-25 {   margin-left:25px !important;  }  .xs-mr-25 {   margin-right:25px !important;  }  .xs-mx-30 {   margin-right:30px !important;   margin-left:30px !important;  }  .xs-my-30 {   margin-top:30px !important;   margin-bottom:30px !important;  }  .xs-mt-30 {   margin-top:30px !important;  }  .xs-mb-30 {   margin-bottom:30px !important;  }  .xs-ml-30 {   margin-left:30px !important;  }  .xs-mr-30 {   margin-right:30px !important;  }  .xs-mx-35 {   margin-right:35px !important;   margin-left:35px !important;  }  .xs-my-35 {   margin-top:35px !important;   margin-bottom:35px !important;  }  .xs-mt-35 {   margin-top:35px !important;  }  .xs-mb-35 {   margin-bottom:35px !important;  }  .xs-ml-35 {   margin-left:35px !important;  }  .xs-mr-35 {   margin-right:35px !important;  }  .xs-mx-40 {   margin-right:40px !important;   margin-left:40px !important;  }  .xs-my-40 {   margin-top:40px !important;   margin-bottom:40px !important;  }  .xs-mt-40 {   margin-top:40px !important;  }  .xs-mb-40 {   margin-bottom:40px !important;  }  .xs-ml-40 {   margin-left:40px !important;  }  .xs-mr-40 {   margin-right:40px !important;  }  .xs-mx-45 {   margin-right:45px !important;   margin-left:45px !important;  }  .xs-my-45 {   margin-top:45px !important;   margin-bottom:45px !important;  }  .xs-mt-45 {   margin-top:45px !important;  }  .xs-mb-45 {   margin-bottom:45px !important;  }  .xs-ml-45 {   margin-left:45px !important;  }  .xs-mr-45 {   margin-right:45px !important;  }  .xs-mx-50 {   margin-right:50px !important;   margin-left:50px !important;  }  .xs-my-50 {   margin-top:50px !important;   margin-bottom:50px !important;  }  .xs-mt-50 {   margin-top:50px !important;  }  .xs-mb-50 {   margin-bottom:50px !important;  }  .xs-ml-50 {   margin-left:50px !important;  }  .xs-mr-50 {   margin-right:50px !important;  }  .xs-mx-55 {   margin-right:55px !important;   margin-left:55px !important;  }  .xs-my-55 {   margin-top:55px !important;   margin-bottom:55px !important;  }  .xs-mt-55 {   margin-top:55px !important;  }  .xs-mb-55 {   margin-bottom:55px !important;  }  .xs-ml-55 {   margin-left:55px !important;  }  .xs-mr-55 {   margin-right:55px !important;  }  .xs-mx-60 {   margin-right:60px !important;   margin-left:60px !important;  }  .xs-my-60 {   margin-top:60px !important;   margin-bottom:60px !important;  }  .xs-mt-60 {   margin-top:60px !important;  }  .xs-mb-60 {   margin-bottom:60px !important;  }  .xs-ml-60 {   margin-left:60px !important;  }  .xs-mr-60 {   margin-right:60px !important;  }  .xs-mx-65 {   margin-right:65px !important;   margin-left:65px !important;  }  .xs-my-65 {   margin-top:65px !important;   margin-bottom:65px !important;  }  .xs-mt-65 {   margin-top:65px !important;  }  .xs-mb-65 {   margin-bottom:65px !important;  }  .xs-ml-65 {   margin-left:65px !important;  }  .xs-mr-65 {   margin-right:65px !important;  }  .xs-mx-70 {   margin-right:70px !important;   margin-left:70px !important;  }  .xs-my-70 {   margin-top:70px !important;   margin-bottom:70px !important;  }  .xs-mt-70 {   margin-top:70px !important;  }  .xs-mb-70 {   margin-bottom:70px !important;  }  .xs-ml-70 {   margin-left:70px !important;  }  .xs-mr-70 {   margin-right:70px !important;  }  .xs-mx-75 {   margin-right:75px !important;   margin-left:75px !important;  }  .xs-my-75 {   margin-top:75px !important;   margin-bottom:75px !important;  }  .xs-mt-75 {   margin-top:75px !important;  }  .xs-mb-75 {   margin-bottom:75px !important;  }  .xs-ml-75 {   margin-left:75px !important;  }  .xs-mr-75 {   margin-right:75px !important;  }  .xs-mx-80 {   margin-right:80px !important;   margin-left:80px !important;  }  .xs-my-80 {   margin-top:80px !important;   margin-bottom:80px !important;  }  .xs-mt-80 {   margin-top:80px !important;  }  .xs-mb-80 {   margin-bottom:80px !important;  }  .xs-ml-80 {   margin-left:80px !important;  }  .xs-mr-80 {   margin-right:80px !important;  }  .xs-mx-85 {   margin-right:85px !important;   margin-left:85px !important;  }  .xs-my-85 {   margin-top:85px !important;   margin-bottom:85px !important;  }  .xs-mt-85 {   margin-top:85px !important;  }  .xs-mb-85 {   margin-bottom:85px !important;  }  .xs-ml-85 {   margin-left:85px !important;  }  .xs-mr-85 {   margin-right:85px !important;  }  .xs-mx-90 {   margin-right:90px !important;   margin-left:90px !important;  }  .xs-my-90 {   margin-top:90px !important;   margin-bottom:90px !important;  }  .xs-mt-90 {   margin-top:90px !important;  }  .xs-mb-90 {   margin-bottom:90px !important;  }  .xs-ml-90 {   margin-left:90px !important;  }  .xs-mr-90 {   margin-right:90px !important;  }  .xs-mx-95 {   margin-right:95px !important;   margin-left:95px !important;  }  .xs-my-95 {   margin-top:95px !important;   margin-bottom:95px !important;  }  .xs-mt-95 {   margin-top:95px !important;  }  .xs-mb-95 {   margin-bottom:95px !important;  }  .xs-ml-95 {   margin-left:95px !important;  }  .xs-mr-95 {   margin-right:95px !important;  }  .xs-mx-100 {   margin-right:100px !important;   margin-left:100px !important;  }  .xs-my-100 {   margin-top:100px !important;   margin-bottom:100px !important;  }  .xs-mt-100 {   margin-top:100px !important;  }  .xs-mb-100 {   margin-bottom:100px !important;  }  .xs-ml-100 {   margin-left:100px !important;  }  .xs-mr-100 {   margin-right:100px !important;  }  .xs-mx-105 {   margin-right:105px !important;   margin-left:105px !important;  }  .xs-my-105 {   margin-top:105px !important;   margin-bottom:105px !important;  }  .xs-mt-105 {   margin-top:105px !important;  }  .xs-mb-105 {   margin-bottom:105px !important;  }  .xs-ml-105 {   margin-left:105px !important;  }  .xs-mr-105 {   margin-right:105px !important;  }  .xs-mx-110 {   margin-right:110px !important;   margin-left:110px !important;  }  .xs-my-110 {   margin-top:110px !important;   margin-bottom:110px !important;  }  .xs-mt-110 {   margin-top:110px !important;  }  .xs-mb-110 {   margin-bottom:110px !important;  }  .xs-ml-110 {   margin-left:110px !important;  }  .xs-mr-110 {   margin-right:110px !important;  }  .xs-mx-115 {   margin-right:115px !important;   margin-left:115px !important;  }  .xs-my-115 {   margin-top:115px !important;   margin-bottom:115px !important;  }  .xs-mt-115 {   margin-top:115px !important;  }  .xs-mb-115 {   margin-bottom:115px !important;  }  .xs-ml-115 {   margin-left:115px !important;  }  .xs-mr-115 {   margin-right:115px !important;  }  .xs-mx-120 {   margin-right:120px !important;   margin-left:120px !important;  }  .xs-my-120 {   margin-top:120px !important;   margin-bottom:120px !important;  }  .xs-mt-120 {   margin-top:120px !important;  }  .xs-mb-120 {   margin-bottom:120px !important;  }  .xs-ml-120 {   margin-left:120px !important;  }  .xs-mr-120 {   margin-right:120px !important;  }  .xs-mx-125 {   margin-right:125px !important;   margin-left:125px !important;  }  .xs-my-125 {   margin-top:125px !important;   margin-bottom:125px !important;  }  .xs-mt-125 {   margin-top:125px !important;  }  .xs-mb-125 {   margin-bottom:125px !important;  }  .xs-ml-125 {   margin-left:125px !important;  }  .xs-mr-125 {   margin-right:125px !important;  }  .xs-mx-130 {   margin-right:130px !important;   margin-left:130px !important;  }  .xs-my-130 {   margin-top:130px !important;   margin-bottom:130px !important;  }  .xs-mt-130 {   margin-top:130px !important;  }  .xs-mb-130 {   margin-bottom:130px !important;  }  .xs-ml-130 {   margin-left:130px !important;  }  .xs-mr-130 {   margin-right:130px !important;  }  .xs-mx-135 {   margin-right:135px !important;   margin-left:135px !important;  }  .xs-my-135 {   margin-top:135px !important;   margin-bottom:135px !important;  }  .xs-mt-135 {   margin-top:135px !important;  }  .xs-mb-135 {   margin-bottom:135px !important;  }  .xs-ml-135 {   margin-left:135px !important;  }  .xs-mr-135 {   margin-right:135px !important;  }  .xs-mx-140 {   margin-right:140px !important;   margin-left:140px !important;  }  .xs-my-140 {   margin-top:140px !important;   margin-bottom:140px !important;  }  .xs-mt-140 {   margin-top:140px !important;  }  .xs-mb-140 {   margin-bottom:140px !important;  }  .xs-ml-140 {   margin-left:140px !important;  }  .xs-mr-140 {   margin-right:140px !important;  }  .xs-mx-145 {   margin-right:145px !important;   margin-left:145px !important;  }  .xs-my-145 {   margin-top:145px !important;   margin-bottom:145px !important;  }  .xs-mt-145 {   margin-top:145px !important;  }  .xs-mb-145 {   margin-bottom:145px !important;  }  .xs-ml-145 {   margin-left:145px !important;  }  .xs-mr-145 {   margin-right:145px !important;  }  .xs-mx-150 {   margin-right:150px !important;   margin-left:150px !important;  }  .xs-my-150 {   margin-top:150px !important;   margin-bottom:150px !important;  }  .xs-mt-150 {   margin-top:150px !important;  }  .xs-mb-150 {   margin-bottom:150px !important;  }  .xs-ml-150 {   margin-left:150px !important;  }  .xs-mr-150 {   margin-right:150px !important;  }  .xs-mx-0 {   margin-right:0 !important;   margin-left:0 !important;  }  .xs-my-0 {   margin-top:0 !important;   margin-bottom:0 !important;  }  .xs-mt-0 {   margin-top:0 !important;  }  .xs-mb-0 {   margin-bottom:0 !important;  }  .xs-ml-0 {   margin-left:0 !important;  }  .xs-mr-0 {   margin-right:0 !important;  }  .xs-m-0 {   margin:0 !important;  }  .xs-mx--5 {   margin-right:-5px !important;   margin-left:-5px !important;  }  .xs-my--5 {   margin-top:-5px !important;   margin-bottom:-5px !important;  }  .xs-mt--5 {   margin-top:-5px !important;  }  .xs-mb--5 {   margin-bottom:-5px !important;  }  .xs-ml--5 {   margin-left:-5px !important;  }  .xs-mr--5 {   margin-right:-5px !important;  }  .xs-mx--10 {   margin-right:-10px !important;   margin-left:-10px !important;  }  .xs-my--10 {   margin-top:-10px !important;   margin-bottom:-10px !important;  }  .xs-mt--10 {   margin-top:-10px !important;  }  .xs-mb--10 {   margin-bottom:-10px !important;  }  .xs-ml--10 {   margin-left:-10px !important;  }  .xs-mr--10 {   margin-right:-10px !important;  }  .xs-mx--15 {   margin-right:-15px !important;   margin-left:-15px !important;  }  .xs-my--15 {   margin-top:-15px !important;   margin-bottom:-15px !important;  }  .xs-mt--15 {   margin-top:-15px !important;  }  .xs-mb--15 {   margin-bottom:-15px !important;  }  .xs-ml--15 {   margin-left:-15px !important;  }  .xs-mr--15 {   margin-right:-15px !important;  }  .xs-mx--20 {   margin-right:-20px !important;   margin-left:-20px !important;  }  .xs-my--20 {   margin-top:-20px !important;   margin-bottom:-20px !important;  }  .xs-mt--20 {   margin-top:-20px !important;  }  .xs-mb--20 {   margin-bottom:-20px !important;  }  .xs-ml--20 {   margin-left:-20px !important;  }  .xs-mr--20 {   margin-right:-20px !important;  }  .xs-mx--25 {   margin-right:-25px !important;   margin-left:-25px !important;  }  .xs-my--25 {   margin-top:-25px !important;   margin-bottom:-25px !important;  }  .xs-mt--25 {   margin-top:-25px !important;  }  .xs-mb--25 {   margin-bottom:-25px !important;  }  .xs-ml--25 {   margin-left:-25px !important;  }  .xs-mr--25 {   margin-right:-25px !important;  }  .xs-mx--30 {   margin-right:-30px !important;   margin-left:-30px !important;  }  .xs-my--30 {   margin-top:-30px !important;   margin-bottom:-30px !important;  }  .xs-mt--30 {   margin-top:-30px !important;  }  .xs-mb--30 {   margin-bottom:-30px !important;  }  .xs-ml--30 {   margin-left:-30px !important;  }  .xs-mr--30 {   margin-right:-30px !important;  }  .xs-mx--35 {   margin-right:-35px !important;   margin-left:-35px !important;  }  .xs-my--35 {   margin-top:-35px !important;   margin-bottom:-35px !important;  }  .xs-mt--35 {   margin-top:-35px !important;  }  .xs-mb--35 {   margin-bottom:-35px !important;  }  .xs-ml--35 {   margin-left:-35px !important;  }  .xs-mr--35 {   margin-right:-35px !important;  }  .xs-mx--40 {   margin-right:-40px !important;   margin-left:-40px !important;  }  .xs-my--40 {   margin-top:-40px !important;   margin-bottom:-40px !important;  }  .xs-mt--40 {   margin-top:-40px !important;  }  .xs-mb--40 {   margin-bottom:-40px !important;  }  .xs-ml--40 {   margin-left:-40px !important;  }  .xs-mr--40 {   margin-right:-40px !important;  }  .xs-mx--45 {   margin-right:-45px !important;   margin-left:-45px !important;  }  .xs-my--45 {   margin-top:-45px !important;   margin-bottom:-45px !important;  }  .xs-mt--45 {   margin-top:-45px !important;  }  .xs-mb--45 {   margin-bottom:-45px !important;  }  .xs-ml--45 {   margin-left:-45px !important;  }  .xs-mr--45 {   margin-right:-45px !important;  }  .xs-mx--50 {   margin-right:-50px !important;   margin-left:-50px !important;  }  .xs-my--50 {   margin-top:-50px !important;   margin-bottom:-50px !important;  }  .xs-mt--50 {   margin-top:-50px !important;  }  .xs-mb--50 {   margin-bottom:-50px !important;  }  .xs-ml--50 {   margin-left:-50px !important;  }  .xs-mr--50 {   margin-right:-50px !important;  }  .xs-mx--55 {   margin-right:-55px !important;   margin-left:-55px !important;  }  .xs-my--55 {   margin-top:-55px !important;   margin-bottom:-55px !important;  }  .xs-mt--55 {   margin-top:-55px !important;  }  .xs-mb--55 {   margin-bottom:-55px !important;  }  .xs-ml--55 {   margin-left:-55px !important;  }  .xs-mr--55 {   margin-right:-55px !important;  }  .xs-mx--60 {   margin-right:-60px !important;   margin-left:-60px !important;  }  .xs-my--60 {   margin-top:-60px !important;   margin-bottom:-60px !important;  }  .xs-mt--60 {   margin-top:-60px !important;  }  .xs-mb--60 {   margin-bottom:-60px !important;  }  .xs-ml--60 {   margin-left:-60px !important;  }  .xs-mr--60 {   margin-right:-60px !important;  }  .xs-mx--65 {   margin-right:-65px !important;   margin-left:-65px !important;  }  .xs-my--65 {   margin-top:-65px !important;   margin-bottom:-65px !important;  }  .xs-mt--65 {   margin-top:-65px !important;  }  .xs-mb--65 {   margin-bottom:-65px !important;  }  .xs-ml--65 {   margin-left:-65px !important;  }  .xs-mr--65 {   margin-right:-65px !important;  }  .xs-mx--70 {   margin-right:-70px !important;   margin-left:-70px !important;  }  .xs-my--70 {   margin-top:-70px !important;   margin-bottom:-70px !important;  }  .xs-mt--70 {   margin-top:-70px !important;  }  .xs-mb--70 {   margin-bottom:-70px !important;  }  .xs-ml--70 {   margin-left:-70px !important;  }  .xs-mr--70 {   margin-right:-70px !important;  }  .xs-mx--75 {   margin-right:-75px !important;   margin-left:-75px !important;  }  .xs-my--75 {   margin-top:-75px !important;   margin-bottom:-75px !important;  }  .xs-mt--75 {   margin-top:-75px !important;  }  .xs-mb--75 {   margin-bottom:-75px !important;  }  .xs-ml--75 {   margin-left:-75px !important;  }  .xs-mr--75 {   margin-right:-75px !important;  }  .xs-mx--80 {   margin-right:-80px !important;   margin-left:-80px !important;  }  .xs-my--80 {   margin-top:-80px !important;   margin-bottom:-80px !important;  }  .xs-mt--80 {   margin-top:-80px !important;  }  .xs-mb--80 {   margin-bottom:-80px !important;  }  .xs-ml--80 {   margin-left:-80px !important;  }  .xs-mr--80 {   margin-right:-80px !important;  }  .xs-mx--85 {   margin-right:-85px !important;   margin-left:-85px !important;  }  .xs-my--85 {   margin-top:-85px !important;   margin-bottom:-85px !important;  }  .xs-mt--85 {   margin-top:-85px !important;  }  .xs-mb--85 {   margin-bottom:-85px !important;  }  .xs-ml--85 {   margin-left:-85px !important;  }  .xs-mr--85 {   margin-right:-85px !important;  }  .xs-mx--90 {   margin-right:-90px !important;   margin-left:-90px !important;  }  .xs-my--90 {   margin-top:-90px !important;   margin-bottom:-90px !important;  }  .xs-mt--90 {   margin-top:-90px !important;  }  .xs-mb--90 {   margin-bottom:-90px !important;  }  .xs-ml--90 {   margin-left:-90px !important;  }  .xs-mr--90 {   margin-right:-90px !important;  }  .xs-mx--95 {   margin-right:-95px !important;   margin-left:-95px !important;  }  .xs-my--95 {   margin-top:-95px !important;   margin-bottom:-95px !important;  }  .xs-mt--95 {   margin-top:-95px !important;  }  .xs-mb--95 {   margin-bottom:-95px !important;  }  .xs-ml--95 {   margin-left:-95px !important;  }  .xs-mr--95 {   margin-right:-95px !important;  }  .xs-mx--100 {   margin-right:-100px !important;   margin-left:-100px !important;  }  .xs-my--100 {   margin-top:-100px !important;   margin-bottom:-100px !important;  }  .xs-mt--100 {   margin-top:-100px !important;  }  .xs-mb--100 {   margin-bottom:-100px !important;  }  .xs-ml--100 {   margin-left:-100px !important;  }  .xs-mr--100 {   margin-right:-100px !important;  }  .xs-mx--105 {   margin-right:-105px !important;   margin-left:-105px !important;  }  .xs-my--105 {   margin-top:-105px !important;   margin-bottom:-105px !important;  }  .xs-mt--105 {   margin-top:-105px !important;  }  .xs-mb--105 {   margin-bottom:-105px !important;  }  .xs-ml--105 {   margin-left:-105px !important;  }  .xs-mr--105 {   margin-right:-105px !important;  }  .xs-mx--110 {   margin-right:-110px !important;   margin-left:-110px !important;  }  .xs-my--110 {   margin-top:-110px !important;   margin-bottom:-110px !important;  }  .xs-mt--110 {   margin-top:-110px !important;  }  .xs-mb--110 {   margin-bottom:-110px !important;  }  .xs-ml--110 {   margin-left:-110px !important;  }  .xs-mr--110 {   margin-right:-110px !important;  }  .xs-mx--115 {   margin-right:-115px !important;   margin-left:-115px !important;  }  .xs-my--115 {   margin-top:-115px !important;   margin-bottom:-115px !important;  }  .xs-mt--115 {   margin-top:-115px !important;  }  .xs-mb--115 {   margin-bottom:-115px !important;  }  .xs-ml--115 {   margin-left:-115px !important;  }  .xs-mr--115 {   margin-right:-115px !important;  }  .xs-mx--120 {   margin-right:-120px !important;   margin-left:-120px !important;  }  .xs-my--120 {   margin-top:-120px !important;   margin-bottom:-120px !important;  }  .xs-mt--120 {   margin-top:-120px !important;  }  .xs-mb--120 {   margin-bottom:-120px !important;  }  .xs-ml--120 {   margin-left:-120px !important;  }  .xs-mr--120 {   margin-right:-120px !important;  }  .xs-mx--125 {   margin-right:-125px !important;   margin-left:-125px !important;  }  .xs-my--125 {   margin-top:-125px !important;   margin-bottom:-125px !important;  }  .xs-mt--125 {   margin-top:-125px !important;  }  .xs-mb--125 {   margin-bottom:-125px !important;  }  .xs-ml--125 {   margin-left:-125px !important;  }  .xs-mr--125 {   margin-right:-125px !important;  }  .xs-mx--130 {   margin-right:-130px !important;   margin-left:-130px !important;  }  .xs-my--130 {   margin-top:-130px !important;   margin-bottom:-130px !important;  }  .xs-mt--130 {   margin-top:-130px !important;  }  .xs-mb--130 {   margin-bottom:-130px !important;  }  .xs-ml--130 {   margin-left:-130px !important;  }  .xs-mr--130 {   margin-right:-130px !important;  }  .xs-mx--135 {   margin-right:-135px !important;   margin-left:-135px !important;  }  .xs-my--135 {   margin-top:-135px !important;   margin-bottom:-135px !important;  }  .xs-mt--135 {   margin-top:-135px !important;  }  .xs-mb--135 {   margin-bottom:-135px !important;  }  .xs-ml--135 {   margin-left:-135px !important;  }  .xs-mr--135 {   margin-right:-135px !important;  }  .xs-mx--140 {   margin-right:-140px !important;   margin-left:-140px !important;  }  .xs-my--140 {   margin-top:-140px !important;   margin-bottom:-140px !important;  }  .xs-mt--140 {   margin-top:-140px !important;  }  .xs-mb--140 {   margin-bottom:-140px !important;  }  .xs-ml--140 {   margin-left:-140px !important;  }  .xs-mr--140 {   margin-right:-140px !important;  }  .xs-mx--145 {   margin-right:-145px !important;   margin-left:-145px !important;  }  .xs-my--145 {   margin-top:-145px !important;   margin-bottom:-145px !important;  }  .xs-mt--145 {   margin-top:-145px !important;  }  .xs-mb--145 {   margin-bottom:-145px !important;  }  .xs-ml--145 {   margin-left:-145px !important;  }  .xs-mr--145 {   margin-right:-145px !important;  }  .xs-mx--150 {   margin-right:-150px !important;   margin-left:-150px !important;  }  .xs-my--150 {   margin-top:-150px !important;   margin-bottom:-150px !important;  }  .xs-mt--150 {   margin-top:-150px !important;  }  .xs-mb--150 {   margin-bottom:-150px !important;  }  .xs-ml--150 {   margin-left:-150px !important;  }  .xs-mr--150 {   margin-right:-150px !important;  } } @media (max-width:375px) {  .vxs-mx-5 {   margin-right:5px !important;   margin-left:5px !important;  }  .vxs-my-5 {   margin-top:5px !important;   margin-bottom:5px !important;  }  .vxs-mt-5 {   margin-top:5px !important;  }  .vxs-mb-5 {   margin-bottom:5px !important;  }  .vxs-ml-5 {   margin-left:5px !important;  }  .vxs-mr-5 {   margin-right:5px !important;  }  .vxs-mx-10 {   margin-right:10px !important;   margin-left:10px !important;  }  .vxs-my-10 {   margin-top:10px !important;   margin-bottom:10px !important;  }  .vxs-mt-10 {   margin-top:10px !important;  }  .vxs-mb-10 {   margin-bottom:10px !important;  }  .vxs-ml-10 {   margin-left:10px !important;  }  .vxs-mr-10 {   margin-right:10px !important;  }  .vxs-mx-15 {   margin-right:15px !important;   margin-left:15px !important;  }  .vxs-my-15 {   margin-top:15px !important;   margin-bottom:15px !important;  }  .vxs-mt-15 {   margin-top:15px !important;  }  .vxs-mb-15 {   margin-bottom:15px !important;  }  .vxs-ml-15 {   margin-left:15px !important;  }  .vxs-mr-15 {   margin-right:15px !important;  }  .vxs-mx-20 {   margin-right:20px !important;   margin-left:20px !important;  }  .vxs-my-20 {   margin-top:20px !important;   margin-bottom:20px !important;  }  .vxs-mt-20 {   margin-top:20px !important;  }  .vxs-mb-20 {   margin-bottom:20px !important;  }  .vxs-ml-20 {   margin-left:20px !important;  }  .vxs-mr-20 {   margin-right:20px !important;  }  .vxs-mx-25 {   margin-right:25px !important;   margin-left:25px !important;  }  .vxs-my-25 {   margin-top:25px !important;   margin-bottom:25px !important;  }  .vxs-mt-25 {   margin-top:25px !important;  }  .vxs-mb-25 {   margin-bottom:25px !important;  }  .vxs-ml-25 {   margin-left:25px !important;  }  .vxs-mr-25 {   margin-right:25px !important;  }  .vxs-mx-30 {   margin-right:30px !important;   margin-left:30px !important;  }  .vxs-my-30 {   margin-top:30px !important;   margin-bottom:30px !important;  }  .vxs-mt-30 {   margin-top:30px !important;  }  .vxs-mb-30 {   margin-bottom:30px !important;  }  .vxs-ml-30 {   margin-left:30px !important;  }  .vxs-mr-30 {   margin-right:30px !important;  }  .vxs-mx-35 {   margin-right:35px !important;   margin-left:35px !important;  }  .vxs-my-35 {   margin-top:35px !important;   margin-bottom:35px !important;  }  .vxs-mt-35 {   margin-top:35px !important;  }  .vxs-mb-35 {   margin-bottom:35px !important;  }  .vxs-ml-35 {   margin-left:35px !important;  }  .vxs-mr-35 {   margin-right:35px !important;  }  .vxs-mx-40 {   margin-right:40px !important;   margin-left:40px !important;  }  .vxs-my-40 {   margin-top:40px !important;   margin-bottom:40px !important;  }  .vxs-mt-40 {   margin-top:40px !important;  }  .vxs-mb-40 {   margin-bottom:40px !important;  }  .vxs-ml-40 {   margin-left:40px !important;  }  .vxs-mr-40 {   margin-right:40px !important;  }  .vxs-mx-45 {   margin-right:45px !important;   margin-left:45px !important;  }  .vxs-my-45 {   margin-top:45px !important;   margin-bottom:45px !important;  }  .vxs-mt-45 {   margin-top:45px !important;  }  .vxs-mb-45 {   margin-bottom:45px !important;  }  .vxs-ml-45 {   margin-left:45px !important;  }  .vxs-mr-45 {   margin-right:45px !important;  }  .vxs-mx-50 {   margin-right:50px !important;   margin-left:50px !important;  }  .vxs-my-50 {   margin-top:50px !important;   margin-bottom:50px !important;  }  .vxs-mt-50 {   margin-top:50px !important;  }  .vxs-mb-50 {   margin-bottom:50px !important;  }  .vxs-ml-50 {   margin-left:50px !important;  }  .vxs-mr-50 {   margin-right:50px !important;  }  .vxs-mx-55 {   margin-right:55px !important;   margin-left:55px !important;  }  .vxs-my-55 {   margin-top:55px !important;   margin-bottom:55px !important;  }  .vxs-mt-55 {   margin-top:55px !important;  }  .vxs-mb-55 {   margin-bottom:55px !important;  }  .vxs-ml-55 {   margin-left:55px !important;  }  .vxs-mr-55 {   margin-right:55px !important;  }  .vxs-mx-60 {   margin-right:60px !important;   margin-left:60px !important;  }  .vxs-my-60 {   margin-top:60px !important;   margin-bottom:60px !important;  }  .vxs-mt-60 {   margin-top:60px !important;  }  .vxs-mb-60 {   margin-bottom:60px !important;  }  .vxs-ml-60 {   margin-left:60px !important;  }  .vxs-mr-60 {   margin-right:60px !important;  }  .vxs-mx-65 {   margin-right:65px !important;   margin-left:65px !important;  }  .vxs-my-65 {   margin-top:65px !important;   margin-bottom:65px !important;  }  .vxs-mt-65 {   margin-top:65px !important;  }  .vxs-mb-65 {   margin-bottom:65px !important;  }  .vxs-ml-65 {   margin-left:65px !important;  }  .vxs-mr-65 {   margin-right:65px !important;  }  .vxs-mx-70 {   margin-right:70px !important;   margin-left:70px !important;  }  .vxs-my-70 {   margin-top:70px !important;   margin-bottom:70px !important;  }  .vxs-mt-70 {   margin-top:70px !important;  }  .vxs-mb-70 {   margin-bottom:70px !important;  }  .vxs-ml-70 {   margin-left:70px !important;  }  .vxs-mr-70 {   margin-right:70px !important;  }  .vxs-mx-75 {   margin-right:75px !important;   margin-left:75px !important;  }  .vxs-my-75 {   margin-top:75px !important;   margin-bottom:75px !important;  }  .vxs-mt-75 {   margin-top:75px !important;  }  .vxs-mb-75 {   margin-bottom:75px !important;  }  .vxs-ml-75 {   margin-left:75px !important;  }  .vxs-mr-75 {   margin-right:75px !important;  }  .vxs-mx-80 {   margin-right:80px !important;   margin-left:80px !important;  }  .vxs-my-80 {   margin-top:80px !important;   margin-bottom:80px !important;  }  .vxs-mt-80 {   margin-top:80px !important;  }  .vxs-mb-80 {   margin-bottom:80px !important;  }  .vxs-ml-80 {   margin-left:80px !important;  }  .vxs-mr-80 {   margin-right:80px !important;  }  .vxs-mx-85 {   margin-right:85px !important;   margin-left:85px !important;  }  .vxs-my-85 {   margin-top:85px !important;   margin-bottom:85px !important;  }  .vxs-mt-85 {   margin-top:85px !important;  }  .vxs-mb-85 {   margin-bottom:85px !important;  }  .vxs-ml-85 {   margin-left:85px !important;  }  .vxs-mr-85 {   margin-right:85px !important;  }  .vxs-mx-90 {   margin-right:90px !important;   margin-left:90px !important;  }  .vxs-my-90 {   margin-top:90px !important;   margin-bottom:90px !important;  }  .vxs-mt-90 {   margin-top:90px !important;  }  .vxs-mb-90 {   margin-bottom:90px !important;  }  .vxs-ml-90 {   margin-left:90px !important;  }  .vxs-mr-90 {   margin-right:90px !important;  }  .vxs-mx-95 {   margin-right:95px !important;   margin-left:95px !important;  }  .vxs-my-95 {   margin-top:95px !important;   margin-bottom:95px !important;  }  .vxs-mt-95 {   margin-top:95px !important;  }  .vxs-mb-95 {   margin-bottom:95px !important;  }  .vxs-ml-95 {   margin-left:95px !important;  }  .vxs-mr-95 {   margin-right:95px !important;  }  .vxs-mx-100 {   margin-right:100px !important;   margin-left:100px !important;  }  .vxs-my-100 {   margin-top:100px !important;   margin-bottom:100px !important;  }  .vxs-mt-100 {   margin-top:100px !important;  }  .vxs-mb-100 {   margin-bottom:100px !important;  }  .vxs-ml-100 {   margin-left:100px !important;  }  .vxs-mr-100 {   margin-right:100px !important;  }  .vxs-mx-105 {   margin-right:105px !important;   margin-left:105px !important;  }  .vxs-my-105 {   margin-top:105px !important;   margin-bottom:105px !important;  }  .vxs-mt-105 {   margin-top:105px !important;  }  .vxs-mb-105 {   margin-bottom:105px !important;  }  .vxs-ml-105 {   margin-left:105px !important;  }  .vxs-mr-105 {   margin-right:105px !important;  }  .vxs-mx-110 {   margin-right:110px !important;   margin-left:110px !important;  }  .vxs-my-110 {   margin-top:110px !important;   margin-bottom:110px !important;  }  .vxs-mt-110 {   margin-top:110px !important;  }  .vxs-mb-110 {   margin-bottom:110px !important;  }  .vxs-ml-110 {   margin-left:110px !important;  }  .vxs-mr-110 {   margin-right:110px !important;  }  .vxs-mx-115 {   margin-right:115px !important;   margin-left:115px !important;  }  .vxs-my-115 {   margin-top:115px !important;   margin-bottom:115px !important;  }  .vxs-mt-115 {   margin-top:115px !important;  }  .vxs-mb-115 {   margin-bottom:115px !important;  }  .vxs-ml-115 {   margin-left:115px !important;  }  .vxs-mr-115 {   margin-right:115px !important;  }  .vxs-mx-120 {   margin-right:120px !important;   margin-left:120px !important;  }  .vxs-my-120 {   margin-top:120px !important;   margin-bottom:120px !important;  }  .vxs-mt-120 {   margin-top:120px !important;  }  .vxs-mb-120 {   margin-bottom:120px !important;  }  .vxs-ml-120 {   margin-left:120px !important;  }  .vxs-mr-120 {   margin-right:120px !important;  }  .vxs-mx-125 {   margin-right:125px !important;   margin-left:125px !important;  }  .vxs-my-125 {   margin-top:125px !important;   margin-bottom:125px !important;  }  .vxs-mt-125 {   margin-top:125px !important;  }  .vxs-mb-125 {   margin-bottom:125px !important;  }  .vxs-ml-125 {   margin-left:125px !important;  }  .vxs-mr-125 {   margin-right:125px !important;  }  .vxs-mx-130 {   margin-right:130px !important;   margin-left:130px !important;  }  .vxs-my-130 {   margin-top:130px !important;   margin-bottom:130px !important;  }  .vxs-mt-130 {   margin-top:130px !important;  }  .vxs-mb-130 {   margin-bottom:130px !important;  }  .vxs-ml-130 {   margin-left:130px !important;  }  .vxs-mr-130 {   margin-right:130px !important;  }  .vxs-mx-135 {   margin-right:135px !important;   margin-left:135px !important;  }  .vxs-my-135 {   margin-top:135px !important;   margin-bottom:135px !important;  }  .vxs-mt-135 {   margin-top:135px !important;  }  .vxs-mb-135 {   margin-bottom:135px !important;  }  .vxs-ml-135 {   margin-left:135px !important;  }  .vxs-mr-135 {   margin-right:135px !important;  }  .vxs-mx-140 {   margin-right:140px !important;   margin-left:140px !important;  }  .vxs-my-140 {   margin-top:140px !important;   margin-bottom:140px !important;  }  .vxs-mt-140 {   margin-top:140px !important;  }  .vxs-mb-140 {   margin-bottom:140px !important;  }  .vxs-ml-140 {   margin-left:140px !important;  }  .vxs-mr-140 {   margin-right:140px !important;  }  .vxs-mx-145 {   margin-right:145px !important;   margin-left:145px !important;  }  .vxs-my-145 {   margin-top:145px !important;   margin-bottom:145px !important;  }  .vxs-mt-145 {   margin-top:145px !important;  }  .vxs-mb-145 {   margin-bottom:145px !important;  }  .vxs-ml-145 {   margin-left:145px !important;  }  .vxs-mr-145 {   margin-right:145px !important;  }  .vxs-mx-150 {   margin-right:150px !important;   margin-left:150px !important;  }  .vxs-my-150 {   margin-top:150px !important;   margin-bottom:150px !important;  }  .vxs-mt-150 {   margin-top:150px !important;  }  .vxs-mb-150 {   margin-bottom:150px !important;  }  .vxs-ml-150 {   margin-left:150px !important;  }  .vxs-mr-150 {   margin-right:150px !important;  }  .vxs-mx-0 {   margin-right:0 !important;   margin-left:0 !important;  }  .vxs-my-0 {   margin-top:0 !important;   margin-bottom:0 !important;  }  .vxs-mt-0 {   margin-top:0 !important;  }  .vxs-mb-0 {   margin-bottom:0 !important;  }  .vxs-ml-0 {   margin-left:0 !important;  }  .vxs-mr-0 {   margin-right:0 !important;  }  .vxs-m-0 {   margin:0 !important;  }  .vxs-mx--5 {   margin-right:-5px !important;   margin-left:-5px !important;  }  .vxs-my--5 {   margin-top:-5px !important;   margin-bottom:-5px !important;  }  .vxs-mt--5 {   margin-top:-5px !important;  }  .vxs-mb--5 {   margin-bottom:-5px !important;  }  .vxs-ml--5 {   margin-left:-5px !important;  }  .vxs-mr--5 {   margin-right:-5px !important;  }  .vxs-mx--10 {   margin-right:-10px !important;   margin-left:-10px !important;  }  .vxs-my--10 {   margin-top:-10px !important;   margin-bottom:-10px !important;  }  .vxs-mt--10 {   margin-top:-10px !important;  }  .vxs-mb--10 {   margin-bottom:-10px !important;  }  .vxs-ml--10 {   margin-left:-10px !important;  }  .vxs-mr--10 {   margin-right:-10px !important;  }  .vxs-mx--15 {   margin-right:-15px !important;   margin-left:-15px !important;  }  .vxs-my--15 {   margin-top:-15px !important;   margin-bottom:-15px !important;  }  .vxs-mt--15 {   margin-top:-15px !important;  }  .vxs-mb--15 {   margin-bottom:-15px !important;  }  .vxs-ml--15 {   margin-left:-15px !important;  }  .vxs-mr--15 {   margin-right:-15px !important;  }  .vxs-mx--20 {   margin-right:-20px !important;   margin-left:-20px !important;  }  .vxs-my--20 {   margin-top:-20px !important;   margin-bottom:-20px !important;  }  .vxs-mt--20 {   margin-top:-20px !important;  }  .vxs-mb--20 {   margin-bottom:-20px !important;  }  .vxs-ml--20 {   margin-left:-20px !important;  }  .vxs-mr--20 {   margin-right:-20px !important;  }  .vxs-mx--25 {   margin-right:-25px !important;   margin-left:-25px !important;  }  .vxs-my--25 {   margin-top:-25px !important;   margin-bottom:-25px !important;  }  .vxs-mt--25 {   margin-top:-25px !important;  }  .vxs-mb--25 {   margin-bottom:-25px !important;  }  .vxs-ml--25 {   margin-left:-25px !important;  }  .vxs-mr--25 {   margin-right:-25px !important;  }  .vxs-mx--30 {   margin-right:-30px !important;   margin-left:-30px !important;  }  .vxs-my--30 {   margin-top:-30px !important;   margin-bottom:-30px !important;  }  .vxs-mt--30 {   margin-top:-30px !important;  }  .vxs-mb--30 {   margin-bottom:-30px !important;  }  .vxs-ml--30 {   margin-left:-30px !important;  }  .vxs-mr--30 {   margin-right:-30px !important;  }  .vxs-mx--35 {   margin-right:-35px !important;   margin-left:-35px !important;  }  .vxs-my--35 {   margin-top:-35px !important;   margin-bottom:-35px !important;  }  .vxs-mt--35 {   margin-top:-35px !important;  }  .vxs-mb--35 {   margin-bottom:-35px !important;  }  .vxs-ml--35 {   margin-left:-35px !important;  }  .vxs-mr--35 {   margin-right:-35px !important;  }  .vxs-mx--40 {   margin-right:-40px !important;   margin-left:-40px !important;  }  .vxs-my--40 {   margin-top:-40px !important;   margin-bottom:-40px !important;  }  .vxs-mt--40 {   margin-top:-40px !important;  }  .vxs-mb--40 {   margin-bottom:-40px !important;  }  .vxs-ml--40 {   margin-left:-40px !important;  }  .vxs-mr--40 {   margin-right:-40px !important;  }  .vxs-mx--45 {   margin-right:-45px !important;   margin-left:-45px !important;  }  .vxs-my--45 {   margin-top:-45px !important;   margin-bottom:-45px !important;  }  .vxs-mt--45 {   margin-top:-45px !important;  }  .vxs-mb--45 {   margin-bottom:-45px !important;  }  .vxs-ml--45 {   margin-left:-45px !important;  }  .vxs-mr--45 {   margin-right:-45px !important;  }  .vxs-mx--50 {   margin-right:-50px !important;   margin-left:-50px !important;  }  .vxs-my--50 {   margin-top:-50px !important;   margin-bottom:-50px !important;  }  .vxs-mt--50 {   margin-top:-50px !important;  }  .vxs-mb--50 {   margin-bottom:-50px !important;  }  .vxs-ml--50 {   margin-left:-50px !important;  }  .vxs-mr--50 {   margin-right:-50px !important;  }  .vxs-mx--55 {   margin-right:-55px !important;   margin-left:-55px !important;  }  .vxs-my--55 {   margin-top:-55px !important;   margin-bottom:-55px !important;  }  .vxs-mt--55 {   margin-top:-55px !important;  }  .vxs-mb--55 {   margin-bottom:-55px !important;  }  .vxs-ml--55 {   margin-left:-55px !important;  }  .vxs-mr--55 {   margin-right:-55px !important;  }  .vxs-mx--60 {   margin-right:-60px !important;   margin-left:-60px !important;  }  .vxs-my--60 {   margin-top:-60px !important;   margin-bottom:-60px !important;  }  .vxs-mt--60 {   margin-top:-60px !important;  }  .vxs-mb--60 {   margin-bottom:-60px !important;  }  .vxs-ml--60 {   margin-left:-60px !important;  }  .vxs-mr--60 {   margin-right:-60px !important;  }  .vxs-mx--65 {   margin-right:-65px !important;   margin-left:-65px !important;  }  .vxs-my--65 {   margin-top:-65px !important;   margin-bottom:-65px !important;  }  .vxs-mt--65 {   margin-top:-65px !important;  }  .vxs-mb--65 {   margin-bottom:-65px !important;  }  .vxs-ml--65 {   margin-left:-65px !important;  }  .vxs-mr--65 {   margin-right:-65px !important;  }  .vxs-mx--70 {   margin-right:-70px !important;   margin-left:-70px !important;  }  .vxs-my--70 {   margin-top:-70px !important;   margin-bottom:-70px !important;  }  .vxs-mt--70 {   margin-top:-70px !important;  }  .vxs-mb--70 {   margin-bottom:-70px !important;  }  .vxs-ml--70 {   margin-left:-70px !important;  }  .vxs-mr--70 {   margin-right:-70px !important;  }  .vxs-mx--75 {   margin-right:-75px !important;   margin-left:-75px !important;  }  .vxs-my--75 {   margin-top:-75px !important;   margin-bottom:-75px !important;  }  .vxs-mt--75 {   margin-top:-75px !important;  }  .vxs-mb--75 {   margin-bottom:-75px !important;  }  .vxs-ml--75 {   margin-left:-75px !important;  }  .vxs-mr--75 {   margin-right:-75px !important;  }  .vxs-mx--80 {   margin-right:-80px !important;   margin-left:-80px !important;  }  .vxs-my--80 {   margin-top:-80px !important;   margin-bottom:-80px !important;  }  .vxs-mt--80 {   margin-top:-80px !important;  }  .vxs-mb--80 {   margin-bottom:-80px !important;  }  .vxs-ml--80 {   margin-left:-80px !important;  }  .vxs-mr--80 {   margin-right:-80px !important;  }  .vxs-mx--85 {   margin-right:-85px !important;   margin-left:-85px !important;  }  .vxs-my--85 {   margin-top:-85px !important;   margin-bottom:-85px !important;  }  .vxs-mt--85 {   margin-top:-85px !important;  }  .vxs-mb--85 {   margin-bottom:-85px !important;  }  .vxs-ml--85 {   margin-left:-85px !important;  }  .vxs-mr--85 {   margin-right:-85px !important;  }  .vxs-mx--90 {   margin-right:-90px !important;   margin-left:-90px !important;  }  .vxs-my--90 {   margin-top:-90px !important;   margin-bottom:-90px !important;  }  .vxs-mt--90 {   margin-top:-90px !important;  }  .vxs-mb--90 {   margin-bottom:-90px !important;  }  .vxs-ml--90 {   margin-left:-90px !important;  }  .vxs-mr--90 {   margin-right:-90px !important;  }  .vxs-mx--95 {   margin-right:-95px !important;   margin-left:-95px !important;  }  .vxs-my--95 {   margin-top:-95px !important;   margin-bottom:-95px !important;  }  .vxs-mt--95 {   margin-top:-95px !important;  }  .vxs-mb--95 {   margin-bottom:-95px !important;  }  .vxs-ml--95 {   margin-left:-95px !important;  }  .vxs-mr--95 {   margin-right:-95px !important;  }  .vxs-mx--100 {   margin-right:-100px !important;   margin-left:-100px !important;  }  .vxs-my--100 {   margin-top:-100px !important;   margin-bottom:-100px !important;  }  .vxs-mt--100 {   margin-top:-100px !important;  }  .vxs-mb--100 {   margin-bottom:-100px !important;  }  .vxs-ml--100 {   margin-left:-100px !important;  }  .vxs-mr--100 {   margin-right:-100px !important;  }  .vxs-mx--105 {   margin-right:-105px !important;   margin-left:-105px !important;  }  .vxs-my--105 {   margin-top:-105px !important;   margin-bottom:-105px !important;  }  .vxs-mt--105 {   margin-top:-105px !important;  }  .vxs-mb--105 {   margin-bottom:-105px !important;  }  .vxs-ml--105 {   margin-left:-105px !important;  }  .vxs-mr--105 {   margin-right:-105px !important;  }  .vxs-mx--110 {   margin-right:-110px !important;   margin-left:-110px !important;  }  .vxs-my--110 {   margin-top:-110px !important;   margin-bottom:-110px !important;  }  .vxs-mt--110 {   margin-top:-110px !important;  }  .vxs-mb--110 {   margin-bottom:-110px !important;  }  .vxs-ml--110 {   margin-left:-110px !important;  }  .vxs-mr--110 {   margin-right:-110px !important;  }  .vxs-mx--115 {   margin-right:-115px !important;   margin-left:-115px !important;  }  .vxs-my--115 {   margin-top:-115px !important;   margin-bottom:-115px !important;  }  .vxs-mt--115 {   margin-top:-115px !important;  }  .vxs-mb--115 {   margin-bottom:-115px !important;  }  .vxs-ml--115 {   margin-left:-115px !important;  }  .vxs-mr--115 {   margin-right:-115px !important;  }  .vxs-mx--120 {   margin-right:-120px !important;   margin-left:-120px !important;  }  .vxs-my--120 {   margin-top:-120px !important;   margin-bottom:-120px !important;  }  .vxs-mt--120 {   margin-top:-120px !important;  }  .vxs-mb--120 {   margin-bottom:-120px !important;  }  .vxs-ml--120 {   margin-left:-120px !important;  }  .vxs-mr--120 {   margin-right:-120px !important;  }  .vxs-mx--125 {   margin-right:-125px !important;   margin-left:-125px !important;  }  .vxs-my--125 {   margin-top:-125px !important;   margin-bottom:-125px !important;  }  .vxs-mt--125 {   margin-top:-125px !important;  }  .vxs-mb--125 {   margin-bottom:-125px !important;  }  .vxs-ml--125 {   margin-left:-125px !important;  }  .vxs-mr--125 {   margin-right:-125px !important;  }  .vxs-mx--130 {   margin-right:-130px !important;   margin-left:-130px !important;  }  .vxs-my--130 {   margin-top:-130px !important;   margin-bottom:-130px !important;  }  .vxs-mt--130 {   margin-top:-130px !important;  }  .vxs-mb--130 {   margin-bottom:-130px !important;  }  .vxs-ml--130 {   margin-left:-130px !important;  }  .vxs-mr--130 {   margin-right:-130px !important;  }  .vxs-mx--135 {   margin-right:-135px !important;   margin-left:-135px !important;  }  .vxs-my--135 {   margin-top:-135px !important;   margin-bottom:-135px !important;  }  .vxs-mt--135 {   margin-top:-135px !important;  }  .vxs-mb--135 {   margin-bottom:-135px !important;  }  .vxs-ml--135 {   margin-left:-135px !important;  }  .vxs-mr--135 {   margin-right:-135px !important;  }  .vxs-mx--140 {   margin-right:-140px !important;   margin-left:-140px !important;  }  .vxs-my--140 {   margin-top:-140px !important;   margin-bottom:-140px !important;  }  .vxs-mt--140 {   margin-top:-140px !important;  }  .vxs-mb--140 {   margin-bottom:-140px !important;  }  .vxs-ml--140 {   margin-left:-140px !important;  }  .vxs-mr--140 {   margin-right:-140px !important;  }  .vxs-mx--145 {   margin-right:-145px !important;   margin-left:-145px !important;  }  .vxs-my--145 {   margin-top:-145px !important;   margin-bottom:-145px !important;  }  .vxs-mt--145 {   margin-top:-145px !important;  }  .vxs-mb--145 {   margin-bottom:-145px !important;  }  .vxs-ml--145 {   margin-left:-145px !important;  }  .vxs-mr--145 {   margin-right:-145px !important;  }  .vxs-mx--150 {   margin-right:-150px !important;   margin-left:-150px !important;  }  .vxs-my--150 {   margin-top:-150px !important;   margin-bottom:-150px !important;  }  .vxs-mt--150 {   margin-top:-150px !important;  }  .vxs-mb--150 {   margin-bottom:-150px !important;  }  .vxs-ml--150 {   margin-left:-150px !important;  }  .vxs-mr--150 {   margin-right:-150px !important;  } } @media (max-width:1280px) {  .ltl-mx-5 {   margin-right:5px !important;   margin-left:5px !important;  }  .ltl-my-5 {   margin-top:5px !important;   margin-bottom:5px !important;  }  .ltl-mt-5 {   margin-top:5px !important;  }  .ltl-mb-5 {   margin-bottom:5px !important;  }  .ltl-ml-5 {   margin-left:5px !important;  }  .ltl-mr-5 {   margin-right:5px !important;  }  .ltl-mx-10 {   margin-right:10px !important;   margin-left:10px !important;  }  .ltl-my-10 {   margin-top:10px !important;   margin-bottom:10px !important;  }  .ltl-mt-10 {   margin-top:10px !important;  }  .ltl-mb-10 {   margin-bottom:10px !important;  }  .ltl-ml-10 {   margin-left:10px !important;  }  .ltl-mr-10 {   margin-right:10px !important;  }  .ltl-mx-15 {   margin-right:15px !important;   margin-left:15px !important;  }  .ltl-my-15 {   margin-top:15px !important;   margin-bottom:15px !important;  }  .ltl-mt-15 {   margin-top:15px !important;  }  .ltl-mb-15 {   margin-bottom:15px !important;  }  .ltl-ml-15 {   margin-left:15px !important;  }  .ltl-mr-15 {   margin-right:15px !important;  }  .ltl-mx-20 {   margin-right:20px !important;   margin-left:20px !important;  }  .ltl-my-20 {   margin-top:20px !important;   margin-bottom:20px !important;  }  .ltl-mt-20 {   margin-top:20px !important;  }  .ltl-mb-20 {   margin-bottom:20px !important;  }  .ltl-ml-20 {   margin-left:20px !important;  }  .ltl-mr-20 {   margin-right:20px !important;  }  .ltl-mx-25 {   margin-right:25px !important;   margin-left:25px !important;  }  .ltl-my-25 {   margin-top:25px !important;   margin-bottom:25px !important;  }  .ltl-mt-25 {   margin-top:25px !important;  }  .ltl-mb-25 {   margin-bottom:25px !important;  }  .ltl-ml-25 {   margin-left:25px !important;  }  .ltl-mr-25 {   margin-right:25px !important;  }  .ltl-mx-30 {   margin-right:30px !important;   margin-left:30px !important;  }  .ltl-my-30 {   margin-top:30px !important;   margin-bottom:30px !important;  }  .ltl-mt-30 {   margin-top:30px !important;  }  .ltl-mb-30 {   margin-bottom:30px !important;  }  .ltl-ml-30 {   margin-left:30px !important;  }  .ltl-mr-30 {   margin-right:30px !important;  }  .ltl-mx-35 {   margin-right:35px !important;   margin-left:35px !important;  }  .ltl-my-35 {   margin-top:35px !important;   margin-bottom:35px !important;  }  .ltl-mt-35 {   margin-top:35px !important;  }  .ltl-mb-35 {   margin-bottom:35px !important;  }  .ltl-ml-35 {   margin-left:35px !important;  }  .ltl-mr-35 {   margin-right:35px !important;  }  .ltl-mx-40 {   margin-right:40px !important;   margin-left:40px !important;  }  .ltl-my-40 {   margin-top:40px !important;   margin-bottom:40px !important;  }  .ltl-mt-40 {   margin-top:40px !important;  }  .ltl-mb-40 {   margin-bottom:40px !important;  }  .ltl-ml-40 {   margin-left:40px !important;  }  .ltl-mr-40 {   margin-right:40px !important;  }  .ltl-mx-45 {   margin-right:45px !important;   margin-left:45px !important;  }  .ltl-my-45 {   margin-top:45px !important;   margin-bottom:45px !important;  }  .ltl-mt-45 {   margin-top:45px !important;  }  .ltl-mb-45 {   margin-bottom:45px !important;  }  .ltl-ml-45 {   margin-left:45px !important;  }  .ltl-mr-45 {   margin-right:45px !important;  }  .ltl-mx-50 {   margin-right:50px !important;   margin-left:50px !important;  }  .ltl-my-50 {   margin-top:50px !important;   margin-bottom:50px !important;  }  .ltl-mt-50 {   margin-top:50px !important;  }  .ltl-mb-50 {   margin-bottom:50px !important;  }  .ltl-ml-50 {   margin-left:50px !important;  }  .ltl-mr-50 {   margin-right:50px !important;  }  .ltl-mx-55 {   margin-right:55px !important;   margin-left:55px !important;  }  .ltl-my-55 {   margin-top:55px !important;   margin-bottom:55px !important;  }  .ltl-mt-55 {   margin-top:55px !important;  }  .ltl-mb-55 {   margin-bottom:55px !important;  }  .ltl-ml-55 {   margin-left:55px !important;  }  .ltl-mr-55 {   margin-right:55px !important;  }  .ltl-mx-60 {   margin-right:60px !important;   margin-left:60px !important;  }  .ltl-my-60 {   margin-top:60px !important;   margin-bottom:60px !important;  }  .ltl-mt-60 {   margin-top:60px !important;  }  .ltl-mb-60 {   margin-bottom:60px !important;  }  .ltl-ml-60 {   margin-left:60px !important;  }  .ltl-mr-60 {   margin-right:60px !important;  }  .ltl-mx-65 {   margin-right:65px !important;   margin-left:65px !important;  }  .ltl-my-65 {   margin-top:65px !important;   margin-bottom:65px !important;  }  .ltl-mt-65 {   margin-top:65px !important;  }  .ltl-mb-65 {   margin-bottom:65px !important;  }  .ltl-ml-65 {   margin-left:65px !important;  }  .ltl-mr-65 {   margin-right:65px !important;  }  .ltl-mx-70 {   margin-right:70px !important;   margin-left:70px !important;  }  .ltl-my-70 {   margin-top:70px !important;   margin-bottom:70px !important;  }  .ltl-mt-70 {   margin-top:70px !important;  }  .ltl-mb-70 {   margin-bottom:70px !important;  }  .ltl-ml-70 {   margin-left:70px !important;  }  .ltl-mr-70 {   margin-right:70px !important;  }  .ltl-mx-75 {   margin-right:75px !important;   margin-left:75px !important;  }  .ltl-my-75 {   margin-top:75px !important;   margin-bottom:75px !important;  }  .ltl-mt-75 {   margin-top:75px !important;  }  .ltl-mb-75 {   margin-bottom:75px !important;  }  .ltl-ml-75 {   margin-left:75px !important;  }  .ltl-mr-75 {   margin-right:75px !important;  }  .ltl-mx-80 {   margin-right:80px !important;   margin-left:80px !important;  }  .ltl-my-80 {   margin-top:80px !important;   margin-bottom:80px !important;  }  .ltl-mt-80 {   margin-top:80px !important;  }  .ltl-mb-80 {   margin-bottom:80px !important;  }  .ltl-ml-80 {   margin-left:80px !important;  }  .ltl-mr-80 {   margin-right:80px !important;  }  .ltl-mx-85 {   margin-right:85px !important;   margin-left:85px !important;  }  .ltl-my-85 {   margin-top:85px !important;   margin-bottom:85px !important;  }  .ltl-mt-85 {   margin-top:85px !important;  }  .ltl-mb-85 {   margin-bottom:85px !important;  }  .ltl-ml-85 {   margin-left:85px !important;  }  .ltl-mr-85 {   margin-right:85px !important;  }  .ltl-mx-90 {   margin-right:90px !important;   margin-left:90px !important;  }  .ltl-my-90 {   margin-top:90px !important;   margin-bottom:90px !important;  }  .ltl-mt-90 {   margin-top:90px !important;  }  .ltl-mb-90 {   margin-bottom:90px !important;  }  .ltl-ml-90 {   margin-left:90px !important;  }  .ltl-mr-90 {   margin-right:90px !important;  }  .ltl-mx-95 {   margin-right:95px !important;   margin-left:95px !important;  }  .ltl-my-95 {   margin-top:95px !important;   margin-bottom:95px !important;  }  .ltl-mt-95 {   margin-top:95px !important;  }  .ltl-mb-95 {   margin-bottom:95px !important;  }  .ltl-ml-95 {   margin-left:95px !important;  }  .ltl-mr-95 {   margin-right:95px !important;  }  .ltl-mx-100 {   margin-right:100px !important;   margin-left:100px !important;  }  .ltl-my-100 {   margin-top:100px !important;   margin-bottom:100px !important;  }  .ltl-mt-100 {   margin-top:100px !important;  }  .ltl-mb-100 {   margin-bottom:100px !important;  }  .ltl-ml-100 {   margin-left:100px !important;  }  .ltl-mr-100 {   margin-right:100px !important;  }  .ltl-mx-105 {   margin-right:105px !important;   margin-left:105px !important;  }  .ltl-my-105 {   margin-top:105px !important;   margin-bottom:105px !important;  }  .ltl-mt-105 {   margin-top:105px !important;  }  .ltl-mb-105 {   margin-bottom:105px !important;  }  .ltl-ml-105 {   margin-left:105px !important;  }  .ltl-mr-105 {   margin-right:105px !important;  }  .ltl-mx-110 {   margin-right:110px !important;   margin-left:110px !important;  }  .ltl-my-110 {   margin-top:110px !important;   margin-bottom:110px !important;  }  .ltl-mt-110 {   margin-top:110px !important;  }  .ltl-mb-110 {   margin-bottom:110px !important;  }  .ltl-ml-110 {   margin-left:110px !important;  }  .ltl-mr-110 {   margin-right:110px !important;  }  .ltl-mx-115 {   margin-right:115px !important;   margin-left:115px !important;  }  .ltl-my-115 {   margin-top:115px !important;   margin-bottom:115px !important;  }  .ltl-mt-115 {   margin-top:115px !important;  }  .ltl-mb-115 {   margin-bottom:115px !important;  }  .ltl-ml-115 {   margin-left:115px !important;  }  .ltl-mr-115 {   margin-right:115px !important;  }  .ltl-mx-120 {   margin-right:120px !important;   margin-left:120px !important;  }  .ltl-my-120 {   margin-top:120px !important;   margin-bottom:120px !important;  }  .ltl-mt-120 {   margin-top:120px !important;  }  .ltl-mb-120 {   margin-bottom:120px !important;  }  .ltl-ml-120 {   margin-left:120px !important;  }  .ltl-mr-120 {   margin-right:120px !important;  }  .ltl-mx-125 {   margin-right:125px !important;   margin-left:125px !important;  }  .ltl-my-125 {   margin-top:125px !important;   margin-bottom:125px !important;  }  .ltl-mt-125 {   margin-top:125px !important;  }  .ltl-mb-125 {   margin-bottom:125px !important;  }  .ltl-ml-125 {   margin-left:125px !important;  }  .ltl-mr-125 {   margin-right:125px !important;  }  .ltl-mx-130 {   margin-right:130px !important;   margin-left:130px !important;  }  .ltl-my-130 {   margin-top:130px !important;   margin-bottom:130px !important;  }  .ltl-mt-130 {   margin-top:130px !important;  }  .ltl-mb-130 {   margin-bottom:130px !important;  }  .ltl-ml-130 {   margin-left:130px !important;  }  .ltl-mr-130 {   margin-right:130px !important;  }  .ltl-mx-135 {   margin-right:135px !important;   margin-left:135px !important;  }  .ltl-my-135 {   margin-top:135px !important;   margin-bottom:135px !important;  }  .ltl-mt-135 {   margin-top:135px !important;  }  .ltl-mb-135 {   margin-bottom:135px !important;  }  .ltl-ml-135 {   margin-left:135px !important;  }  .ltl-mr-135 {   margin-right:135px !important;  }  .ltl-mx-140 {   margin-right:140px !important;   margin-left:140px !important;  }  .ltl-my-140 {   margin-top:140px !important;   margin-bottom:140px !important;  }  .ltl-mt-140 {   margin-top:140px !important;  }  .ltl-mb-140 {   margin-bottom:140px !important;  }  .ltl-ml-140 {   margin-left:140px !important;  }  .ltl-mr-140 {   margin-right:140px !important;  }  .ltl-mx-145 {   margin-right:145px !important;   margin-left:145px !important;  }  .ltl-my-145 {   margin-top:145px !important;   margin-bottom:145px !important;  }  .ltl-mt-145 {   margin-top:145px !important;  }  .ltl-mb-145 {   margin-bottom:145px !important;  }  .ltl-ml-145 {   margin-left:145px !important;  }  .ltl-mr-145 {   margin-right:145px !important;  }  .ltl-mx-150 {   margin-right:150px !important;   margin-left:150px !important;  }  .ltl-my-150 {   margin-top:150px !important;   margin-bottom:150px !important;  }  .ltl-mt-150 {   margin-top:150px !important;  }  .ltl-mb-150 {   margin-bottom:150px !important;  }  .ltl-ml-150 {   margin-left:150px !important;  }  .ltl-mr-150 {   margin-right:150px !important;  }  .ltl-mx-0 {   margin-right:0 !important;   margin-left:0 !important;  }  .ltl-my-0 {   margin-top:0 !important;   margin-bottom:0 !important;  }  .ltl-mt-0 {   margin-top:0 !important;  }  .ltl-mb-0 {   margin-bottom:0 !important;  }  .ltl-ml-0 {   margin-left:0 !important;  }  .ltl-mr-0 {   margin-right:0 !important;  }  .ltl-m-0 {   margin:0 !important;  }  .ltl-mx--5 {   margin-right:-5px !important;   margin-left:-5px !important;  }  .ltl-my--5 {   margin-top:-5px !important;   margin-bottom:-5px !important;  }  .ltl-mt--5 {   margin-top:-5px !important;  }  .ltl-mb--5 {   margin-bottom:-5px !important;  }  .ltl-ml--5 {   margin-left:-5px !important;  }  .ltl-mr--5 {   margin-right:-5px !important;  }  .ltl-mx--10 {   margin-right:-10px !important;   margin-left:-10px !important;  }  .ltl-my--10 {   margin-top:-10px !important;   margin-bottom:-10px !important;  }  .ltl-mt--10 {   margin-top:-10px !important;  }  .ltl-mb--10 {   margin-bottom:-10px !important;  }  .ltl-ml--10 {   margin-left:-10px !important;  }  .ltl-mr--10 {   margin-right:-10px !important;  }  .ltl-mx--15 {   margin-right:-15px !important;   margin-left:-15px !important;  }  .ltl-my--15 {   margin-top:-15px !important;   margin-bottom:-15px !important;  }  .ltl-mt--15 {   margin-top:-15px !important;  }  .ltl-mb--15 {   margin-bottom:-15px !important;  }  .ltl-ml--15 {   margin-left:-15px !important;  }  .ltl-mr--15 {   margin-right:-15px !important;  }  .ltl-mx--20 {   margin-right:-20px !important;   margin-left:-20px !important;  }  .ltl-my--20 {   margin-top:-20px !important;   margin-bottom:-20px !important;  }  .ltl-mt--20 {   margin-top:-20px !important;  }  .ltl-mb--20 {   margin-bottom:-20px !important;  }  .ltl-ml--20 {   margin-left:-20px !important;  }  .ltl-mr--20 {   margin-right:-20px !important;  }  .ltl-mx--25 {   margin-right:-25px !important;   margin-left:-25px !important;  }  .ltl-my--25 {   margin-top:-25px !important;   margin-bottom:-25px !important;  }  .ltl-mt--25 {   margin-top:-25px !important;  }  .ltl-mb--25 {   margin-bottom:-25px !important;  }  .ltl-ml--25 {   margin-left:-25px !important;  }  .ltl-mr--25 {   margin-right:-25px !important;  }  .ltl-mx--30 {   margin-right:-30px !important;   margin-left:-30px !important;  }  .ltl-my--30 {   margin-top:-30px !important;   margin-bottom:-30px !important;  }  .ltl-mt--30 {   margin-top:-30px !important;  }  .ltl-mb--30 {   margin-bottom:-30px !important;  }  .ltl-ml--30 {   margin-left:-30px !important;  }  .ltl-mr--30 {   margin-right:-30px !important;  }  .ltl-mx--35 {   margin-right:-35px !important;   margin-left:-35px !important;  }  .ltl-my--35 {   margin-top:-35px !important;   margin-bottom:-35px !important;  }  .ltl-mt--35 {   margin-top:-35px !important;  }  .ltl-mb--35 {   margin-bottom:-35px !important;  }  .ltl-ml--35 {   margin-left:-35px !important;  }  .ltl-mr--35 {   margin-right:-35px !important;  }  .ltl-mx--40 {   margin-right:-40px !important;   margin-left:-40px !important;  }  .ltl-my--40 {   margin-top:-40px !important;   margin-bottom:-40px !important;  }  .ltl-mt--40 {   margin-top:-40px !important;  }  .ltl-mb--40 {   margin-bottom:-40px !important;  }  .ltl-ml--40 {   margin-left:-40px !important;  }  .ltl-mr--40 {   margin-right:-40px !important;  }  .ltl-mx--45 {   margin-right:-45px !important;   margin-left:-45px !important;  }  .ltl-my--45 {   margin-top:-45px !important;   margin-bottom:-45px !important;  }  .ltl-mt--45 {   margin-top:-45px !important;  }  .ltl-mb--45 {   margin-bottom:-45px !important;  }  .ltl-ml--45 {   margin-left:-45px !important;  }  .ltl-mr--45 {   margin-right:-45px !important;  }  .ltl-mx--50 {   margin-right:-50px !important;   margin-left:-50px !important;  }  .ltl-my--50 {   margin-top:-50px !important;   margin-bottom:-50px !important;  }  .ltl-mt--50 {   margin-top:-50px !important;  }  .ltl-mb--50 {   margin-bottom:-50px !important;  }  .ltl-ml--50 {   margin-left:-50px !important;  }  .ltl-mr--50 {   margin-right:-50px !important;  }  .ltl-mx--55 {   margin-right:-55px !important;   margin-left:-55px !important;  }  .ltl-my--55 {   margin-top:-55px !important;   margin-bottom:-55px !important;  }  .ltl-mt--55 {   margin-top:-55px !important;  }  .ltl-mb--55 {   margin-bottom:-55px !important;  }  .ltl-ml--55 {   margin-left:-55px !important;  }  .ltl-mr--55 {   margin-right:-55px !important;  }  .ltl-mx--60 {   margin-right:-60px !important;   margin-left:-60px !important;  }  .ltl-my--60 {   margin-top:-60px !important;   margin-bottom:-60px !important;  }  .ltl-mt--60 {   margin-top:-60px !important;  }  .ltl-mb--60 {   margin-bottom:-60px !important;  }  .ltl-ml--60 {   margin-left:-60px !important;  }  .ltl-mr--60 {   margin-right:-60px !important;  }  .ltl-mx--65 {   margin-right:-65px !important;   margin-left:-65px !important;  }  .ltl-my--65 {   margin-top:-65px !important;   margin-bottom:-65px !important;  }  .ltl-mt--65 {   margin-top:-65px !important;  }  .ltl-mb--65 {   margin-bottom:-65px !important;  }  .ltl-ml--65 {   margin-left:-65px !important;  }  .ltl-mr--65 {   margin-right:-65px !important;  }  .ltl-mx--70 {   margin-right:-70px !important;   margin-left:-70px !important;  }  .ltl-my--70 {   margin-top:-70px !important;   margin-bottom:-70px !important;  }  .ltl-mt--70 {   margin-top:-70px !important;  }  .ltl-mb--70 {   margin-bottom:-70px !important;  }  .ltl-ml--70 {   margin-left:-70px !important;  }  .ltl-mr--70 {   margin-right:-70px !important;  }  .ltl-mx--75 {   margin-right:-75px !important;   margin-left:-75px !important;  }  .ltl-my--75 {   margin-top:-75px !important;   margin-bottom:-75px !important;  }  .ltl-mt--75 {   margin-top:-75px !important;  }  .ltl-mb--75 {   margin-bottom:-75px !important;  }  .ltl-ml--75 {   margin-left:-75px !important;  }  .ltl-mr--75 {   margin-right:-75px !important;  }  .ltl-mx--80 {   margin-right:-80px !important;   margin-left:-80px !important;  }  .ltl-my--80 {   margin-top:-80px !important;   margin-bottom:-80px !important;  }  .ltl-mt--80 {   margin-top:-80px !important;  }  .ltl-mb--80 {   margin-bottom:-80px !important;  }  .ltl-ml--80 {   margin-left:-80px !important;  }  .ltl-mr--80 {   margin-right:-80px !important;  }  .ltl-mx--85 {   margin-right:-85px !important;   margin-left:-85px !important;  }  .ltl-my--85 {   margin-top:-85px !important;   margin-bottom:-85px !important;  }  .ltl-mt--85 {   margin-top:-85px !important;  }  .ltl-mb--85 {   margin-bottom:-85px !important;  }  .ltl-ml--85 {   margin-left:-85px !important;  }  .ltl-mr--85 {   margin-right:-85px !important;  }  .ltl-mx--90 {   margin-right:-90px !important;   margin-left:-90px !important;  }  .ltl-my--90 {   margin-top:-90px !important;   margin-bottom:-90px !important;  }  .ltl-mt--90 {   margin-top:-90px !important;  }  .ltl-mb--90 {   margin-bottom:-90px !important;  }  .ltl-ml--90 {   margin-left:-90px !important;  }  .ltl-mr--90 {   margin-right:-90px !important;  }  .ltl-mx--95 {   margin-right:-95px !important;   margin-left:-95px !important;  }  .ltl-my--95 {   margin-top:-95px !important;   margin-bottom:-95px !important;  }  .ltl-mt--95 {   margin-top:-95px !important;  }  .ltl-mb--95 {   margin-bottom:-95px !important;  }  .ltl-ml--95 {   margin-left:-95px !important;  }  .ltl-mr--95 {   margin-right:-95px !important;  }  .ltl-mx--100 {   margin-right:-100px !important;   margin-left:-100px !important;  }  .ltl-my--100 {   margin-top:-100px !important;   margin-bottom:-100px !important;  }  .ltl-mt--100 {   margin-top:-100px !important;  }  .ltl-mb--100 {   margin-bottom:-100px !important;  }  .ltl-ml--100 {   margin-left:-100px !important;  }  .ltl-mr--100 {   margin-right:-100px !important;  }  .ltl-mx--105 {   margin-right:-105px !important;   margin-left:-105px !important;  }  .ltl-my--105 {   margin-top:-105px !important;   margin-bottom:-105px !important;  }  .ltl-mt--105 {   margin-top:-105px !important;  }  .ltl-mb--105 {   margin-bottom:-105px !important;  }  .ltl-ml--105 {   margin-left:-105px !important;  }  .ltl-mr--105 {   margin-right:-105px !important;  }  .ltl-mx--110 {   margin-right:-110px !important;   margin-left:-110px !important;  }  .ltl-my--110 {   margin-top:-110px !important;   margin-bottom:-110px !important;  }  .ltl-mt--110 {   margin-top:-110px !important;  }  .ltl-mb--110 {   margin-bottom:-110px !important;  }  .ltl-ml--110 {   margin-left:-110px !important;  }  .ltl-mr--110 {   margin-right:-110px !important;  }  .ltl-mx--115 {   margin-right:-115px !important;   margin-left:-115px !important;  }  .ltl-my--115 {   margin-top:-115px !important;   margin-bottom:-115px !important;  }  .ltl-mt--115 {   margin-top:-115px !important;  }  .ltl-mb--115 {   margin-bottom:-115px !important;  }  .ltl-ml--115 {   margin-left:-115px !important;  }  .ltl-mr--115 {   margin-right:-115px !important;  }  .ltl-mx--120 {   margin-right:-120px !important;   margin-left:-120px !important;  }  .ltl-my--120 {   margin-top:-120px !important;   margin-bottom:-120px !important;  }  .ltl-mt--120 {   margin-top:-120px !important;  }  .ltl-mb--120 {   margin-bottom:-120px !important;  }  .ltl-ml--120 {   margin-left:-120px !important;  }  .ltl-mr--120 {   margin-right:-120px !important;  }  .ltl-mx--125 {   margin-right:-125px !important;   margin-left:-125px !important;  }  .ltl-my--125 {   margin-top:-125px !important;   margin-bottom:-125px !important;  }  .ltl-mt--125 {   margin-top:-125px !important;  }  .ltl-mb--125 {   margin-bottom:-125px !important;  }  .ltl-ml--125 {   margin-left:-125px !important;  }  .ltl-mr--125 {   margin-right:-125px !important;  }  .ltl-mx--130 {   margin-right:-130px !important;   margin-left:-130px !important;  }  .ltl-my--130 {   margin-top:-130px !important;   margin-bottom:-130px !important;  }  .ltl-mt--130 {   margin-top:-130px !important;  }  .ltl-mb--130 {   margin-bottom:-130px !important;  }  .ltl-ml--130 {   margin-left:-130px !important;  }  .ltl-mr--130 {   margin-right:-130px !important;  }  .ltl-mx--135 {   margin-right:-135px !important;   margin-left:-135px !important;  }  .ltl-my--135 {   margin-top:-135px !important;   margin-bottom:-135px !important;  }  .ltl-mt--135 {   margin-top:-135px !important;  }  .ltl-mb--135 {   margin-bottom:-135px !important;  }  .ltl-ml--135 {   margin-left:-135px !important;  }  .ltl-mr--135 {   margin-right:-135px !important;  }  .ltl-mx--140 {   margin-right:-140px !important;   margin-left:-140px !important;  }  .ltl-my--140 {   margin-top:-140px !important;   margin-bottom:-140px !important;  }  .ltl-mt--140 {   margin-top:-140px !important;  }  .ltl-mb--140 {   margin-bottom:-140px !important;  }  .ltl-ml--140 {   margin-left:-140px !important;  }  .ltl-mr--140 {   margin-right:-140px !important;  }  .ltl-mx--145 {   margin-right:-145px !important;   margin-left:-145px !important;  }  .ltl-my--145 {   margin-top:-145px !important;   margin-bottom:-145px !important;  }  .ltl-mt--145 {   margin-top:-145px !important;  }  .ltl-mb--145 {   margin-bottom:-145px !important;  }  .ltl-ml--145 {   margin-left:-145px !important;  }  .ltl-mr--145 {   margin-right:-145px !important;  }  .ltl-mx--150 {   margin-right:-150px !important;   margin-left:-150px !important;  }  .ltl-my--150 {   margin-top:-150px !important;   margin-bottom:-150px !important;  }  .ltl-mt--150 {   margin-top:-150px !important;  }  .ltl-mb--150 {   margin-bottom:-150px !important;  }  .ltl-ml--150 {   margin-left:-150px !important;  }  .ltl-mr--150 {   margin-right:-150px !important;  } } @media (max-width:1024px) {  .ltm-mx-5 {   margin-right:5px !important;   margin-left:5px !important;  }  .ltm-my-5 {   margin-top:5px !important;   margin-bottom:5px !important;  }  .ltm-mt-5 {   margin-top:5px !important;  }  .ltm-mb-5 {   margin-bottom:5px !important;  }  .ltm-ml-5 {   margin-left:5px !important;  }  .ltm-mr-5 {   margin-right:5px !important;  }  .ltm-mx-10 {   margin-right:10px !important;   margin-left:10px !important;  }  .ltm-my-10 {   margin-top:10px !important;   margin-bottom:10px !important;  }  .ltm-mt-10 {   margin-top:10px !important;  }  .ltm-mb-10 {   margin-bottom:10px !important;  }  .ltm-ml-10 {   margin-left:10px !important;  }  .ltm-mr-10 {   margin-right:10px !important;  }  .ltm-mx-15 {   margin-right:15px !important;   margin-left:15px !important;  }  .ltm-my-15 {   margin-top:15px !important;   margin-bottom:15px !important;  }  .ltm-mt-15 {   margin-top:15px !important;  }  .ltm-mb-15 {   margin-bottom:15px !important;  }  .ltm-ml-15 {   margin-left:15px !important;  }  .ltm-mr-15 {   margin-right:15px !important;  }  .ltm-mx-20 {   margin-right:20px !important;   margin-left:20px !important;  }  .ltm-my-20 {   margin-top:20px !important;   margin-bottom:20px !important;  }  .ltm-mt-20 {   margin-top:20px !important;  }  .ltm-mb-20 {   margin-bottom:20px !important;  }  .ltm-ml-20 {   margin-left:20px !important;  }  .ltm-mr-20 {   margin-right:20px !important;  }  .ltm-mx-25 {   margin-right:25px !important;   margin-left:25px !important;  }  .ltm-my-25 {   margin-top:25px !important;   margin-bottom:25px !important;  }  .ltm-mt-25 {   margin-top:25px !important;  }  .ltm-mb-25 {   margin-bottom:25px !important;  }  .ltm-ml-25 {   margin-left:25px !important;  }  .ltm-mr-25 {   margin-right:25px !important;  }  .ltm-mx-30 {   margin-right:30px !important;   margin-left:30px !important;  }  .ltm-my-30 {   margin-top:30px !important;   margin-bottom:30px !important;  }  .ltm-mt-30 {   margin-top:30px !important;  }  .ltm-mb-30 {   margin-bottom:30px !important;  }  .ltm-ml-30 {   margin-left:30px !important;  }  .ltm-mr-30 {   margin-right:30px !important;  }  .ltm-mx-35 {   margin-right:35px !important;   margin-left:35px !important;  }  .ltm-my-35 {   margin-top:35px !important;   margin-bottom:35px !important;  }  .ltm-mt-35 {   margin-top:35px !important;  }  .ltm-mb-35 {   margin-bottom:35px !important;  }  .ltm-ml-35 {   margin-left:35px !important;  }  .ltm-mr-35 {   margin-right:35px !important;  }  .ltm-mx-40 {   margin-right:40px !important;   margin-left:40px !important;  }  .ltm-my-40 {   margin-top:40px !important;   margin-bottom:40px !important;  }  .ltm-mt-40 {   margin-top:40px !important;  }  .ltm-mb-40 {   margin-bottom:40px !important;  }  .ltm-ml-40 {   margin-left:40px !important;  }  .ltm-mr-40 {   margin-right:40px !important;  }  .ltm-mx-45 {   margin-right:45px !important;   margin-left:45px !important;  }  .ltm-my-45 {   margin-top:45px !important;   margin-bottom:45px !important;  }  .ltm-mt-45 {   margin-top:45px !important;  }  .ltm-mb-45 {   margin-bottom:45px !important;  }  .ltm-ml-45 {   margin-left:45px !important;  }  .ltm-mr-45 {   margin-right:45px !important;  }  .ltm-mx-50 {   margin-right:50px !important;   margin-left:50px !important;  }  .ltm-my-50 {   margin-top:50px !important;   margin-bottom:50px !important;  }  .ltm-mt-50 {   margin-top:50px !important;  }  .ltm-mb-50 {   margin-bottom:50px !important;  }  .ltm-ml-50 {   margin-left:50px !important;  }  .ltm-mr-50 {   margin-right:50px !important;  }  .ltm-mx-55 {   margin-right:55px !important;   margin-left:55px !important;  }  .ltm-my-55 {   margin-top:55px !important;   margin-bottom:55px !important;  }  .ltm-mt-55 {   margin-top:55px !important;  }  .ltm-mb-55 {   margin-bottom:55px !important;  }  .ltm-ml-55 {   margin-left:55px !important;  }  .ltm-mr-55 {   margin-right:55px !important;  }  .ltm-mx-60 {   margin-right:60px !important;   margin-left:60px !important;  }  .ltm-my-60 {   margin-top:60px !important;   margin-bottom:60px !important;  }  .ltm-mt-60 {   margin-top:60px !important;  }  .ltm-mb-60 {   margin-bottom:60px !important;  }  .ltm-ml-60 {   margin-left:60px !important;  }  .ltm-mr-60 {   margin-right:60px !important;  }  .ltm-mx-65 {   margin-right:65px !important;   margin-left:65px !important;  }  .ltm-my-65 {   margin-top:65px !important;   margin-bottom:65px !important;  }  .ltm-mt-65 {   margin-top:65px !important;  }  .ltm-mb-65 {   margin-bottom:65px !important;  }  .ltm-ml-65 {   margin-left:65px !important;  }  .ltm-mr-65 {   margin-right:65px !important;  }  .ltm-mx-70 {   margin-right:70px !important;   margin-left:70px !important;  }  .ltm-my-70 {   margin-top:70px !important;   margin-bottom:70px !important;  }  .ltm-mt-70 {   margin-top:70px !important;  }  .ltm-mb-70 {   margin-bottom:70px !important;  }  .ltm-ml-70 {   margin-left:70px !important;  }  .ltm-mr-70 {   margin-right:70px !important;  }  .ltm-mx-75 {   margin-right:75px !important;   margin-left:75px !important;  }  .ltm-my-75 {   margin-top:75px !important;   margin-bottom:75px !important;  }  .ltm-mt-75 {   margin-top:75px !important;  }  .ltm-mb-75 {   margin-bottom:75px !important;  }  .ltm-ml-75 {   margin-left:75px !important;  }  .ltm-mr-75 {   margin-right:75px !important;  }  .ltm-mx-80 {   margin-right:80px !important;   margin-left:80px !important;  }  .ltm-my-80 {   margin-top:80px !important;   margin-bottom:80px !important;  }  .ltm-mt-80 {   margin-top:80px !important;  }  .ltm-mb-80 {   margin-bottom:80px !important;  }  .ltm-ml-80 {   margin-left:80px !important;  }  .ltm-mr-80 {   margin-right:80px !important;  }  .ltm-mx-85 {   margin-right:85px !important;   margin-left:85px !important;  }  .ltm-my-85 {   margin-top:85px !important;   margin-bottom:85px !important;  }  .ltm-mt-85 {   margin-top:85px !important;  }  .ltm-mb-85 {   margin-bottom:85px !important;  }  .ltm-ml-85 {   margin-left:85px !important;  }  .ltm-mr-85 {   margin-right:85px !important;  }  .ltm-mx-90 {   margin-right:90px !important;   margin-left:90px !important;  }  .ltm-my-90 {   margin-top:90px !important;   margin-bottom:90px !important;  }  .ltm-mt-90 {   margin-top:90px !important;  }  .ltm-mb-90 {   margin-bottom:90px !important;  }  .ltm-ml-90 {   margin-left:90px !important;  }  .ltm-mr-90 {   margin-right:90px !important;  }  .ltm-mx-95 {   margin-right:95px !important;   margin-left:95px !important;  }  .ltm-my-95 {   margin-top:95px !important;   margin-bottom:95px !important;  }  .ltm-mt-95 {   margin-top:95px !important;  }  .ltm-mb-95 {   margin-bottom:95px !important;  }  .ltm-ml-95 {   margin-left:95px !important;  }  .ltm-mr-95 {   margin-right:95px !important;  }  .ltm-mx-100 {   margin-right:100px !important;   margin-left:100px !important;  }  .ltm-my-100 {   margin-top:100px !important;   margin-bottom:100px !important;  }  .ltm-mt-100 {   margin-top:100px !important;  }  .ltm-mb-100 {   margin-bottom:100px !important;  }  .ltm-ml-100 {   margin-left:100px !important;  }  .ltm-mr-100 {   margin-right:100px !important;  }  .ltm-mx-105 {   margin-right:105px !important;   margin-left:105px !important;  }  .ltm-my-105 {   margin-top:105px !important;   margin-bottom:105px !important;  }  .ltm-mt-105 {   margin-top:105px !important;  }  .ltm-mb-105 {   margin-bottom:105px !important;  }  .ltm-ml-105 {   margin-left:105px !important;  }  .ltm-mr-105 {   margin-right:105px !important;  }  .ltm-mx-110 {   margin-right:110px !important;   margin-left:110px !important;  }  .ltm-my-110 {   margin-top:110px !important;   margin-bottom:110px !important;  }  .ltm-mt-110 {   margin-top:110px !important;  }  .ltm-mb-110 {   margin-bottom:110px !important;  }  .ltm-ml-110 {   margin-left:110px !important;  }  .ltm-mr-110 {   margin-right:110px !important;  }  .ltm-mx-115 {   margin-right:115px !important;   margin-left:115px !important;  }  .ltm-my-115 {   margin-top:115px !important;   margin-bottom:115px !important;  }  .ltm-mt-115 {   margin-top:115px !important;  }  .ltm-mb-115 {   margin-bottom:115px !important;  }  .ltm-ml-115 {   margin-left:115px !important;  }  .ltm-mr-115 {   margin-right:115px !important;  }  .ltm-mx-120 {   margin-right:120px !important;   margin-left:120px !important;  }  .ltm-my-120 {   margin-top:120px !important;   margin-bottom:120px !important;  }  .ltm-mt-120 {   margin-top:120px !important;  }  .ltm-mb-120 {   margin-bottom:120px !important;  }  .ltm-ml-120 {   margin-left:120px !important;  }  .ltm-mr-120 {   margin-right:120px !important;  }  .ltm-mx-125 {   margin-right:125px !important;   margin-left:125px !important;  }  .ltm-my-125 {   margin-top:125px !important;   margin-bottom:125px !important;  }  .ltm-mt-125 {   margin-top:125px !important;  }  .ltm-mb-125 {   margin-bottom:125px !important;  }  .ltm-ml-125 {   margin-left:125px !important;  }  .ltm-mr-125 {   margin-right:125px !important;  }  .ltm-mx-130 {   margin-right:130px !important;   margin-left:130px !important;  }  .ltm-my-130 {   margin-top:130px !important;   margin-bottom:130px !important;  }  .ltm-mt-130 {   margin-top:130px !important;  }  .ltm-mb-130 {   margin-bottom:130px !important;  }  .ltm-ml-130 {   margin-left:130px !important;  }  .ltm-mr-130 {   margin-right:130px !important;  }  .ltm-mx-135 {   margin-right:135px !important;   margin-left:135px !important;  }  .ltm-my-135 {   margin-top:135px !important;   margin-bottom:135px !important;  }  .ltm-mt-135 {   margin-top:135px !important;  }  .ltm-mb-135 {   margin-bottom:135px !important;  }  .ltm-ml-135 {   margin-left:135px !important;  }  .ltm-mr-135 {   margin-right:135px !important;  }  .ltm-mx-140 {   margin-right:140px !important;   margin-left:140px !important;  }  .ltm-my-140 {   margin-top:140px !important;   margin-bottom:140px !important;  }  .ltm-mt-140 {   margin-top:140px !important;  }  .ltm-mb-140 {   margin-bottom:140px !important;  }  .ltm-ml-140 {   margin-left:140px !important;  }  .ltm-mr-140 {   margin-right:140px !important;  }  .ltm-mx-145 {   margin-right:145px !important;   margin-left:145px !important;  }  .ltm-my-145 {   margin-top:145px !important;   margin-bottom:145px !important;  }  .ltm-mt-145 {   margin-top:145px !important;  }  .ltm-mb-145 {   margin-bottom:145px !important;  }  .ltm-ml-145 {   margin-left:145px !important;  }  .ltm-mr-145 {   margin-right:145px !important;  }  .ltm-mx-150 {   margin-right:150px !important;   margin-left:150px !important;  }  .ltm-my-150 {   margin-top:150px !important;   margin-bottom:150px !important;  }  .ltm-mt-150 {   margin-top:150px !important;  }  .ltm-mb-150 {   margin-bottom:150px !important;  }  .ltm-ml-150 {   margin-left:150px !important;  }  .ltm-mr-150 {   margin-right:150px !important;  }  .ltm-mx-0 {   margin-right:0 !important;   margin-left:0 !important;  }  .ltm-my-0 {   margin-top:0 !important;   margin-bottom:0 !important;  }  .ltm-mt-0 {   margin-top:0 !important;  }  .ltm-mb-0 {   margin-bottom:0 !important;  }  .ltm-ml-0 {   margin-left:0 !important;  }  .ltm-mr-0 {   margin-right:0 !important;  }  .ltm-m-0 {   margin:0 !important;  }  .ltm-mx--5 {   margin-right:-5px !important;   margin-left:-5px !important;  }  .ltm-my--5 {   margin-top:-5px !important;   margin-bottom:-5px !important;  }  .ltm-mt--5 {   margin-top:-5px !important;  }  .ltm-mb--5 {   margin-bottom:-5px !important;  }  .ltm-ml--5 {   margin-left:-5px !important;  }  .ltm-mr--5 {   margin-right:-5px !important;  }  .ltm-mx--10 {   margin-right:-10px !important;   margin-left:-10px !important;  }  .ltm-my--10 {   margin-top:-10px !important;   margin-bottom:-10px !important;  }  .ltm-mt--10 {   margin-top:-10px !important;  }  .ltm-mb--10 {   margin-bottom:-10px !important;  }  .ltm-ml--10 {   margin-left:-10px !important;  }  .ltm-mr--10 {   margin-right:-10px !important;  }  .ltm-mx--15 {   margin-right:-15px !important;   margin-left:-15px !important;  }  .ltm-my--15 {   margin-top:-15px !important;   margin-bottom:-15px !important;  }  .ltm-mt--15 {   margin-top:-15px !important;  }  .ltm-mb--15 {   margin-bottom:-15px !important;  }  .ltm-ml--15 {   margin-left:-15px !important;  }  .ltm-mr--15 {   margin-right:-15px !important;  }  .ltm-mx--20 {   margin-right:-20px !important;   margin-left:-20px !important;  }  .ltm-my--20 {   margin-top:-20px !important;   margin-bottom:-20px !important;  }  .ltm-mt--20 {   margin-top:-20px !important;  }  .ltm-mb--20 {   margin-bottom:-20px !important;  }  .ltm-ml--20 {   margin-left:-20px !important;  }  .ltm-mr--20 {   margin-right:-20px !important;  }  .ltm-mx--25 {   margin-right:-25px !important;   margin-left:-25px !important;  }  .ltm-my--25 {   margin-top:-25px !important;   margin-bottom:-25px !important;  }  .ltm-mt--25 {   margin-top:-25px !important;  }  .ltm-mb--25 {   margin-bottom:-25px !important;  }  .ltm-ml--25 {   margin-left:-25px !important;  }  .ltm-mr--25 {   margin-right:-25px !important;  }  .ltm-mx--30 {   margin-right:-30px !important;   margin-left:-30px !important;  }  .ltm-my--30 {   margin-top:-30px !important;   margin-bottom:-30px !important;  }  .ltm-mt--30 {   margin-top:-30px !important;  }  .ltm-mb--30 {   margin-bottom:-30px !important;  }  .ltm-ml--30 {   margin-left:-30px !important;  }  .ltm-mr--30 {   margin-right:-30px !important;  }  .ltm-mx--35 {   margin-right:-35px !important;   margin-left:-35px !important;  }  .ltm-my--35 {   margin-top:-35px !important;   margin-bottom:-35px !important;  }  .ltm-mt--35 {   margin-top:-35px !important;  }  .ltm-mb--35 {   margin-bottom:-35px !important;  }  .ltm-ml--35 {   margin-left:-35px !important;  }  .ltm-mr--35 {   margin-right:-35px !important;  }  .ltm-mx--40 {   margin-right:-40px !important;   margin-left:-40px !important;  }  .ltm-my--40 {   margin-top:-40px !important;   margin-bottom:-40px !important;  }  .ltm-mt--40 {   margin-top:-40px !important;  }  .ltm-mb--40 {   margin-bottom:-40px !important;  }  .ltm-ml--40 {   margin-left:-40px !important;  }  .ltm-mr--40 {   margin-right:-40px !important;  }  .ltm-mx--45 {   margin-right:-45px !important;   margin-left:-45px !important;  }  .ltm-my--45 {   margin-top:-45px !important;   margin-bottom:-45px !important;  }  .ltm-mt--45 {   margin-top:-45px !important;  }  .ltm-mb--45 {   margin-bottom:-45px !important;  }  .ltm-ml--45 {   margin-left:-45px !important;  }  .ltm-mr--45 {   margin-right:-45px !important;  }  .ltm-mx--50 {   margin-right:-50px !important;   margin-left:-50px !important;  }  .ltm-my--50 {   margin-top:-50px !important;   margin-bottom:-50px !important;  }  .ltm-mt--50 {   margin-top:-50px !important;  }  .ltm-mb--50 {   margin-bottom:-50px !important;  }  .ltm-ml--50 {   margin-left:-50px !important;  }  .ltm-mr--50 {   margin-right:-50px !important;  }  .ltm-mx--55 {   margin-right:-55px !important;   margin-left:-55px !important;  }  .ltm-my--55 {   margin-top:-55px !important;   margin-bottom:-55px !important;  }  .ltm-mt--55 {   margin-top:-55px !important;  }  .ltm-mb--55 {   margin-bottom:-55px !important;  }  .ltm-ml--55 {   margin-left:-55px !important;  }  .ltm-mr--55 {   margin-right:-55px !important;  }  .ltm-mx--60 {   margin-right:-60px !important;   margin-left:-60px !important;  }  .ltm-my--60 {   margin-top:-60px !important;   margin-bottom:-60px !important;  }  .ltm-mt--60 {   margin-top:-60px !important;  }  .ltm-mb--60 {   margin-bottom:-60px !important;  }  .ltm-ml--60 {   margin-left:-60px !important;  }  .ltm-mr--60 {   margin-right:-60px !important;  }  .ltm-mx--65 {   margin-right:-65px !important;   margin-left:-65px !important;  }  .ltm-my--65 {   margin-top:-65px !important;   margin-bottom:-65px !important;  }  .ltm-mt--65 {   margin-top:-65px !important;  }  .ltm-mb--65 {   margin-bottom:-65px !important;  }  .ltm-ml--65 {   margin-left:-65px !important;  }  .ltm-mr--65 {   margin-right:-65px !important;  }  .ltm-mx--70 {   margin-right:-70px !important;   margin-left:-70px !important;  }  .ltm-my--70 {   margin-top:-70px !important;   margin-bottom:-70px !important;  }  .ltm-mt--70 {   margin-top:-70px !important;  }  .ltm-mb--70 {   margin-bottom:-70px !important;  }  .ltm-ml--70 {   margin-left:-70px !important;  }  .ltm-mr--70 {   margin-right:-70px !important;  }  .ltm-mx--75 {   margin-right:-75px !important;   margin-left:-75px !important;  }  .ltm-my--75 {   margin-top:-75px !important;   margin-bottom:-75px !important;  }  .ltm-mt--75 {   margin-top:-75px !important;  }  .ltm-mb--75 {   margin-bottom:-75px !important;  }  .ltm-ml--75 {   margin-left:-75px !important;  }  .ltm-mr--75 {   margin-right:-75px !important;  }  .ltm-mx--80 {   margin-right:-80px !important;   margin-left:-80px !important;  }  .ltm-my--80 {   margin-top:-80px !important;   margin-bottom:-80px !important;  }  .ltm-mt--80 {   margin-top:-80px !important;  }  .ltm-mb--80 {   margin-bottom:-80px !important;  }  .ltm-ml--80 {   margin-left:-80px !important;  }  .ltm-mr--80 {   margin-right:-80px !important;  }  .ltm-mx--85 {   margin-right:-85px !important;   margin-left:-85px !important;  }  .ltm-my--85 {   margin-top:-85px !important;   margin-bottom:-85px !important;  }  .ltm-mt--85 {   margin-top:-85px !important;  }  .ltm-mb--85 {   margin-bottom:-85px !important;  }  .ltm-ml--85 {   margin-left:-85px !important;  }  .ltm-mr--85 {   margin-right:-85px !important;  }  .ltm-mx--90 {   margin-right:-90px !important;   margin-left:-90px !important;  }  .ltm-my--90 {   margin-top:-90px !important;   margin-bottom:-90px !important;  }  .ltm-mt--90 {   margin-top:-90px !important;  }  .ltm-mb--90 {   margin-bottom:-90px !important;  }  .ltm-ml--90 {   margin-left:-90px !important;  }  .ltm-mr--90 {   margin-right:-90px !important;  }  .ltm-mx--95 {   margin-right:-95px !important;   margin-left:-95px !important;  }  .ltm-my--95 {   margin-top:-95px !important;   margin-bottom:-95px !important;  }  .ltm-mt--95 {   margin-top:-95px !important;  }  .ltm-mb--95 {   margin-bottom:-95px !important;  }  .ltm-ml--95 {   margin-left:-95px !important;  }  .ltm-mr--95 {   margin-right:-95px !important;  }  .ltm-mx--100 {   margin-right:-100px !important;   margin-left:-100px !important;  }  .ltm-my--100 {   margin-top:-100px !important;   margin-bottom:-100px !important;  }  .ltm-mt--100 {   margin-top:-100px !important;  }  .ltm-mb--100 {   margin-bottom:-100px !important;  }  .ltm-ml--100 {   margin-left:-100px !important;  }  .ltm-mr--100 {   margin-right:-100px !important;  }  .ltm-mx--105 {   margin-right:-105px !important;   margin-left:-105px !important;  }  .ltm-my--105 {   margin-top:-105px !important;   margin-bottom:-105px !important;  }  .ltm-mt--105 {   margin-top:-105px !important;  }  .ltm-mb--105 {   margin-bottom:-105px !important;  }  .ltm-ml--105 {   margin-left:-105px !important;  }  .ltm-mr--105 {   margin-right:-105px !important;  }  .ltm-mx--110 {   margin-right:-110px !important;   margin-left:-110px !important;  }  .ltm-my--110 {   margin-top:-110px !important;   margin-bottom:-110px !important;  }  .ltm-mt--110 {   margin-top:-110px !important;  }  .ltm-mb--110 {   margin-bottom:-110px !important;  }  .ltm-ml--110 {   margin-left:-110px !important;  }  .ltm-mr--110 {   margin-right:-110px !important;  }  .ltm-mx--115 {   margin-right:-115px !important;   margin-left:-115px !important;  }  .ltm-my--115 {   margin-top:-115px !important;   margin-bottom:-115px !important;  }  .ltm-mt--115 {   margin-top:-115px !important;  }  .ltm-mb--115 {   margin-bottom:-115px !important;  }  .ltm-ml--115 {   margin-left:-115px !important;  }  .ltm-mr--115 {   margin-right:-115px !important;  }  .ltm-mx--120 {   margin-right:-120px !important;   margin-left:-120px !important;  }  .ltm-my--120 {   margin-top:-120px !important;   margin-bottom:-120px !important;  }  .ltm-mt--120 {   margin-top:-120px !important;  }  .ltm-mb--120 {   margin-bottom:-120px !important;  }  .ltm-ml--120 {   margin-left:-120px !important;  }  .ltm-mr--120 {   margin-right:-120px !important;  }  .ltm-mx--125 {   margin-right:-125px !important;   margin-left:-125px !important;  }  .ltm-my--125 {   margin-top:-125px !important;   margin-bottom:-125px !important;  }  .ltm-mt--125 {   margin-top:-125px !important;  }  .ltm-mb--125 {   margin-bottom:-125px !important;  }  .ltm-ml--125 {   margin-left:-125px !important;  }  .ltm-mr--125 {   margin-right:-125px !important;  }  .ltm-mx--130 {   margin-right:-130px !important;   margin-left:-130px !important;  }  .ltm-my--130 {   margin-top:-130px !important;   margin-bottom:-130px !important;  }  .ltm-mt--130 {   margin-top:-130px !important;  }  .ltm-mb--130 {   margin-bottom:-130px !important;  }  .ltm-ml--130 {   margin-left:-130px !important;  }  .ltm-mr--130 {   margin-right:-130px !important;  }  .ltm-mx--135 {   margin-right:-135px !important;   margin-left:-135px !important;  }  .ltm-my--135 {   margin-top:-135px !important;   margin-bottom:-135px !important;  }  .ltm-mt--135 {   margin-top:-135px !important;  }  .ltm-mb--135 {   margin-bottom:-135px !important;  }  .ltm-ml--135 {   margin-left:-135px !important;  }  .ltm-mr--135 {   margin-right:-135px !important;  }  .ltm-mx--140 {   margin-right:-140px !important;   margin-left:-140px !important;  }  .ltm-my--140 {   margin-top:-140px !important;   margin-bottom:-140px !important;  }  .ltm-mt--140 {   margin-top:-140px !important;  }  .ltm-mb--140 {   margin-bottom:-140px !important;  }  .ltm-ml--140 {   margin-left:-140px !important;  }  .ltm-mr--140 {   margin-right:-140px !important;  }  .ltm-mx--145 {   margin-right:-145px !important;   margin-left:-145px !important;  }  .ltm-my--145 {   margin-top:-145px !important;   margin-bottom:-145px !important;  }  .ltm-mt--145 {   margin-top:-145px !important;  }  .ltm-mb--145 {   margin-bottom:-145px !important;  }  .ltm-ml--145 {   margin-left:-145px !important;  }  .ltm-mr--145 {   margin-right:-145px !important;  }  .ltm-mx--150 {   margin-right:-150px !important;   margin-left:-150px !important;  }  .ltm-my--150 {   margin-top:-150px !important;   margin-bottom:-150px !important;  }  .ltm-mt--150 {   margin-top:-150px !important;  }  .ltm-mb--150 {   margin-bottom:-150px !important;  }  .ltm-ml--150 {   margin-left:-150px !important;  }  .ltm-mr--150 {   margin-right:-150px !important;  } } @media (min-width:992px) and (max-width:1024px) {  .nhb-mx-5 {   margin-right:5px !important;   margin-left:5px !important;  }  .nhb-my-5 {   margin-top:5px !important;   margin-bottom:5px !important;  }  .nhb-mt-5 {   margin-top:5px !important;  }  .nhb-mb-5 {   margin-bottom:5px !important;  }  .nhb-ml-5 {   margin-left:5px !important;  }  .nhb-mr-5 {   margin-right:5px !important;  }  .nhb-mx-10 {   margin-right:10px !important;   margin-left:10px !important;  }  .nhb-my-10 {   margin-top:10px !important;   margin-bottom:10px !important;  }  .nhb-mt-10 {   margin-top:10px !important;  }  .nhb-mb-10 {   margin-bottom:10px !important;  }  .nhb-ml-10 {   margin-left:10px !important;  }  .nhb-mr-10 {   margin-right:10px !important;  }  .nhb-mx-15 {   margin-right:15px !important;   margin-left:15px !important;  }  .nhb-my-15 {   margin-top:15px !important;   margin-bottom:15px !important;  }  .nhb-mt-15 {   margin-top:15px !important;  }  .nhb-mb-15 {   margin-bottom:15px !important;  }  .nhb-ml-15 {   margin-left:15px !important;  }  .nhb-mr-15 {   margin-right:15px !important;  }  .nhb-mx-20 {   margin-right:20px !important;   margin-left:20px !important;  }  .nhb-my-20 {   margin-top:20px !important;   margin-bottom:20px !important;  }  .nhb-mt-20 {   margin-top:20px !important;  }  .nhb-mb-20 {   margin-bottom:20px !important;  }  .nhb-ml-20 {   margin-left:20px !important;  }  .nhb-mr-20 {   margin-right:20px !important;  }  .nhb-mx-25 {   margin-right:25px !important;   margin-left:25px !important;  }  .nhb-my-25 {   margin-top:25px !important;   margin-bottom:25px !important;  }  .nhb-mt-25 {   margin-top:25px !important;  }  .nhb-mb-25 {   margin-bottom:25px !important;  }  .nhb-ml-25 {   margin-left:25px !important;  }  .nhb-mr-25 {   margin-right:25px !important;  }  .nhb-mx-30 {   margin-right:30px !important;   margin-left:30px !important;  }  .nhb-my-30 {   margin-top:30px !important;   margin-bottom:30px !important;  }  .nhb-mt-30 {   margin-top:30px !important;  }  .nhb-mb-30 {   margin-bottom:30px !important;  }  .nhb-ml-30 {   margin-left:30px !important;  }  .nhb-mr-30 {   margin-right:30px !important;  }  .nhb-mx-35 {   margin-right:35px !important;   margin-left:35px !important;  }  .nhb-my-35 {   margin-top:35px !important;   margin-bottom:35px !important;  }  .nhb-mt-35 {   margin-top:35px !important;  }  .nhb-mb-35 {   margin-bottom:35px !important;  }  .nhb-ml-35 {   margin-left:35px !important;  }  .nhb-mr-35 {   margin-right:35px !important;  }  .nhb-mx-40 {   margin-right:40px !important;   margin-left:40px !important;  }  .nhb-my-40 {   margin-top:40px !important;   margin-bottom:40px !important;  }  .nhb-mt-40 {   margin-top:40px !important;  }  .nhb-mb-40 {   margin-bottom:40px !important;  }  .nhb-ml-40 {   margin-left:40px !important;  }  .nhb-mr-40 {   margin-right:40px !important;  }  .nhb-mx-45 {   margin-right:45px !important;   margin-left:45px !important;  }  .nhb-my-45 {   margin-top:45px !important;   margin-bottom:45px !important;  }  .nhb-mt-45 {   margin-top:45px !important;  }  .nhb-mb-45 {   margin-bottom:45px !important;  }  .nhb-ml-45 {   margin-left:45px !important;  }  .nhb-mr-45 {   margin-right:45px !important;  }  .nhb-mx-50 {   margin-right:50px !important;   margin-left:50px !important;  }  .nhb-my-50 {   margin-top:50px !important;   margin-bottom:50px !important;  }  .nhb-mt-50 {   margin-top:50px !important;  }  .nhb-mb-50 {   margin-bottom:50px !important;  }  .nhb-ml-50 {   margin-left:50px !important;  }  .nhb-mr-50 {   margin-right:50px !important;  }  .nhb-mx-55 {   margin-right:55px !important;   margin-left:55px !important;  }  .nhb-my-55 {   margin-top:55px !important;   margin-bottom:55px !important;  }  .nhb-mt-55 {   margin-top:55px !important;  }  .nhb-mb-55 {   margin-bottom:55px !important;  }  .nhb-ml-55 {   margin-left:55px !important;  }  .nhb-mr-55 {   margin-right:55px !important;  }  .nhb-mx-60 {   margin-right:60px !important;   margin-left:60px !important;  }  .nhb-my-60 {   margin-top:60px !important;   margin-bottom:60px !important;  }  .nhb-mt-60 {   margin-top:60px !important;  }  .nhb-mb-60 {   margin-bottom:60px !important;  }  .nhb-ml-60 {   margin-left:60px !important;  }  .nhb-mr-60 {   margin-right:60px !important;  }  .nhb-mx-65 {   margin-right:65px !important;   margin-left:65px !important;  }  .nhb-my-65 {   margin-top:65px !important;   margin-bottom:65px !important;  }  .nhb-mt-65 {   margin-top:65px !important;  }  .nhb-mb-65 {   margin-bottom:65px !important;  }  .nhb-ml-65 {   margin-left:65px !important;  }  .nhb-mr-65 {   margin-right:65px !important;  }  .nhb-mx-70 {   margin-right:70px !important;   margin-left:70px !important;  }  .nhb-my-70 {   margin-top:70px !important;   margin-bottom:70px !important;  }  .nhb-mt-70 {   margin-top:70px !important;  }  .nhb-mb-70 {   margin-bottom:70px !important;  }  .nhb-ml-70 {   margin-left:70px !important;  }  .nhb-mr-70 {   margin-right:70px !important;  }  .nhb-mx-75 {   margin-right:75px !important;   margin-left:75px !important;  }  .nhb-my-75 {   margin-top:75px !important;   margin-bottom:75px !important;  }  .nhb-mt-75 {   margin-top:75px !important;  }  .nhb-mb-75 {   margin-bottom:75px !important;  }  .nhb-ml-75 {   margin-left:75px !important;  }  .nhb-mr-75 {   margin-right:75px !important;  }  .nhb-mx-80 {   margin-right:80px !important;   margin-left:80px !important;  }  .nhb-my-80 {   margin-top:80px !important;   margin-bottom:80px !important;  }  .nhb-mt-80 {   margin-top:80px !important;  }  .nhb-mb-80 {   margin-bottom:80px !important;  }  .nhb-ml-80 {   margin-left:80px !important;  }  .nhb-mr-80 {   margin-right:80px !important;  }  .nhb-mx-85 {   margin-right:85px !important;   margin-left:85px !important;  }  .nhb-my-85 {   margin-top:85px !important;   margin-bottom:85px !important;  }  .nhb-mt-85 {   margin-top:85px !important;  }  .nhb-mb-85 {   margin-bottom:85px !important;  }  .nhb-ml-85 {   margin-left:85px !important;  }  .nhb-mr-85 {   margin-right:85px !important;  }  .nhb-mx-90 {   margin-right:90px !important;   margin-left:90px !important;  }  .nhb-my-90 {   margin-top:90px !important;   margin-bottom:90px !important;  }  .nhb-mt-90 {   margin-top:90px !important;  }  .nhb-mb-90 {   margin-bottom:90px !important;  }  .nhb-ml-90 {   margin-left:90px !important;  }  .nhb-mr-90 {   margin-right:90px !important;  }  .nhb-mx-95 {   margin-right:95px !important;   margin-left:95px !important;  }  .nhb-my-95 {   margin-top:95px !important;   margin-bottom:95px !important;  }  .nhb-mt-95 {   margin-top:95px !important;  }  .nhb-mb-95 {   margin-bottom:95px !important;  }  .nhb-ml-95 {   margin-left:95px !important;  }  .nhb-mr-95 {   margin-right:95px !important;  }  .nhb-mx-100 {   margin-right:100px !important;   margin-left:100px !important;  }  .nhb-my-100 {   margin-top:100px !important;   margin-bottom:100px !important;  }  .nhb-mt-100 {   margin-top:100px !important;  }  .nhb-mb-100 {   margin-bottom:100px !important;  }  .nhb-ml-100 {   margin-left:100px !important;  }  .nhb-mr-100 {   margin-right:100px !important;  }  .nhb-mx-105 {   margin-right:105px !important;   margin-left:105px !important;  }  .nhb-my-105 {   margin-top:105px !important;   margin-bottom:105px !important;  }  .nhb-mt-105 {   margin-top:105px !important;  }  .nhb-mb-105 {   margin-bottom:105px !important;  }  .nhb-ml-105 {   margin-left:105px !important;  }  .nhb-mr-105 {   margin-right:105px !important;  }  .nhb-mx-110 {   margin-right:110px !important;   margin-left:110px !important;  }  .nhb-my-110 {   margin-top:110px !important;   margin-bottom:110px !important;  }  .nhb-mt-110 {   margin-top:110px !important;  }  .nhb-mb-110 {   margin-bottom:110px !important;  }  .nhb-ml-110 {   margin-left:110px !important;  }  .nhb-mr-110 {   margin-right:110px !important;  }  .nhb-mx-115 {   margin-right:115px !important;   margin-left:115px !important;  }  .nhb-my-115 {   margin-top:115px !important;   margin-bottom:115px !important;  }  .nhb-mt-115 {   margin-top:115px !important;  }  .nhb-mb-115 {   margin-bottom:115px !important;  }  .nhb-ml-115 {   margin-left:115px !important;  }  .nhb-mr-115 {   margin-right:115px !important;  }  .nhb-mx-120 {   margin-right:120px !important;   margin-left:120px !important;  }  .nhb-my-120 {   margin-top:120px !important;   margin-bottom:120px !important;  }  .nhb-mt-120 {   margin-top:120px !important;  }  .nhb-mb-120 {   margin-bottom:120px !important;  }  .nhb-ml-120 {   margin-left:120px !important;  }  .nhb-mr-120 {   margin-right:120px !important;  }  .nhb-mx-125 {   margin-right:125px !important;   margin-left:125px !important;  }  .nhb-my-125 {   margin-top:125px !important;   margin-bottom:125px !important;  }  .nhb-mt-125 {   margin-top:125px !important;  }  .nhb-mb-125 {   margin-bottom:125px !important;  }  .nhb-ml-125 {   margin-left:125px !important;  }  .nhb-mr-125 {   margin-right:125px !important;  }  .nhb-mx-130 {   margin-right:130px !important;   margin-left:130px !important;  }  .nhb-my-130 {   margin-top:130px !important;   margin-bottom:130px !important;  }  .nhb-mt-130 {   margin-top:130px !important;  }  .nhb-mb-130 {   margin-bottom:130px !important;  }  .nhb-ml-130 {   margin-left:130px !important;  }  .nhb-mr-130 {   margin-right:130px !important;  }  .nhb-mx-135 {   margin-right:135px !important;   margin-left:135px !important;  }  .nhb-my-135 {   margin-top:135px !important;   margin-bottom:135px !important;  }  .nhb-mt-135 {   margin-top:135px !important;  }  .nhb-mb-135 {   margin-bottom:135px !important;  }  .nhb-ml-135 {   margin-left:135px !important;  }  .nhb-mr-135 {   margin-right:135px !important;  }  .nhb-mx-140 {   margin-right:140px !important;   margin-left:140px !important;  }  .nhb-my-140 {   margin-top:140px !important;   margin-bottom:140px !important;  }  .nhb-mt-140 {   margin-top:140px !important;  }  .nhb-mb-140 {   margin-bottom:140px !important;  }  .nhb-ml-140 {   margin-left:140px !important;  }  .nhb-mr-140 {   margin-right:140px !important;  }  .nhb-mx-145 {   margin-right:145px !important;   margin-left:145px !important;  }  .nhb-my-145 {   margin-top:145px !important;   margin-bottom:145px !important;  }  .nhb-mt-145 {   margin-top:145px !important;  }  .nhb-mb-145 {   margin-bottom:145px !important;  }  .nhb-ml-145 {   margin-left:145px !important;  }  .nhb-mr-145 {   margin-right:145px !important;  }  .nhb-mx-150 {   margin-right:150px !important;   margin-left:150px !important;  }  .nhb-my-150 {   margin-top:150px !important;   margin-bottom:150px !important;  }  .nhb-mt-150 {   margin-top:150px !important;  }  .nhb-mb-150 {   margin-bottom:150px !important;  }  .nhb-ml-150 {   margin-left:150px !important;  }  .nhb-mr-150 {   margin-right:150px !important;  }  .nhb-mx-0 {   margin-right:0 !important;   margin-left:0 !important;  }  .nhb-my-0 {   margin-top:0 !important;   margin-bottom:0 !important;  }  .nhb-mt-0 {   margin-top:0 !important;  }  .nhb-mb-0 {   margin-bottom:0 !important;  }  .nhb-ml-0 {   margin-left:0 !important;  }  .nhb-mr-0 {   margin-right:0 !important;  }  .nhb-m-0 {   margin:0 !important;  }  .nhb-mx--5 {   margin-right:-5px !important;   margin-left:-5px !important;  }  .nhb-my--5 {   margin-top:-5px !important;   margin-bottom:-5px !important;  }  .nhb-mt--5 {   margin-top:-5px !important;  }  .nhb-mb--5 {   margin-bottom:-5px !important;  }  .nhb-ml--5 {   margin-left:-5px !important;  }  .nhb-mr--5 {   margin-right:-5px !important;  }  .nhb-mx--10 {   margin-right:-10px !important;   margin-left:-10px !important;  }  .nhb-my--10 {   margin-top:-10px !important;   margin-bottom:-10px !important;  }  .nhb-mt--10 {   margin-top:-10px !important;  }  .nhb-mb--10 {   margin-bottom:-10px !important;  }  .nhb-ml--10 {   margin-left:-10px !important;  }  .nhb-mr--10 {   margin-right:-10px !important;  }  .nhb-mx--15 {   margin-right:-15px !important;   margin-left:-15px !important;  }  .nhb-my--15 {   margin-top:-15px !important;   margin-bottom:-15px !important;  }  .nhb-mt--15 {   margin-top:-15px !important;  }  .nhb-mb--15 {   margin-bottom:-15px !important;  }  .nhb-ml--15 {   margin-left:-15px !important;  }  .nhb-mr--15 {   margin-right:-15px !important;  }  .nhb-mx--20 {   margin-right:-20px !important;   margin-left:-20px !important;  }  .nhb-my--20 {   margin-top:-20px !important;   margin-bottom:-20px !important;  }  .nhb-mt--20 {   margin-top:-20px !important;  }  .nhb-mb--20 {   margin-bottom:-20px !important;  }  .nhb-ml--20 {   margin-left:-20px !important;  }  .nhb-mr--20 {   margin-right:-20px !important;  }  .nhb-mx--25 {   margin-right:-25px !important;   margin-left:-25px !important;  }  .nhb-my--25 {   margin-top:-25px !important;   margin-bottom:-25px !important;  }  .nhb-mt--25 {   margin-top:-25px !important;  }  .nhb-mb--25 {   margin-bottom:-25px !important;  }  .nhb-ml--25 {   margin-left:-25px !important;  }  .nhb-mr--25 {   margin-right:-25px !important;  }  .nhb-mx--30 {   margin-right:-30px !important;   margin-left:-30px !important;  }  .nhb-my--30 {   margin-top:-30px !important;   margin-bottom:-30px !important;  }  .nhb-mt--30 {   margin-top:-30px !important;  }  .nhb-mb--30 {   margin-bottom:-30px !important;  }  .nhb-ml--30 {   margin-left:-30px !important;  }  .nhb-mr--30 {   margin-right:-30px !important;  }  .nhb-mx--35 {   margin-right:-35px !important;   margin-left:-35px !important;  }  .nhb-my--35 {   margin-top:-35px !important;   margin-bottom:-35px !important;  }  .nhb-mt--35 {   margin-top:-35px !important;  }  .nhb-mb--35 {   margin-bottom:-35px !important;  }  .nhb-ml--35 {   margin-left:-35px !important;  }  .nhb-mr--35 {   margin-right:-35px !important;  }  .nhb-mx--40 {   margin-right:-40px !important;   margin-left:-40px !important;  }  .nhb-my--40 {   margin-top:-40px !important;   margin-bottom:-40px !important;  }  .nhb-mt--40 {   margin-top:-40px !important;  }  .nhb-mb--40 {   margin-bottom:-40px !important;  }  .nhb-ml--40 {   margin-left:-40px !important;  }  .nhb-mr--40 {   margin-right:-40px !important;  }  .nhb-mx--45 {   margin-right:-45px !important;   margin-left:-45px !important;  }  .nhb-my--45 {   margin-top:-45px !important;   margin-bottom:-45px !important;  }  .nhb-mt--45 {   margin-top:-45px !important;  }  .nhb-mb--45 {   margin-bottom:-45px !important;  }  .nhb-ml--45 {   margin-left:-45px !important;  }  .nhb-mr--45 {   margin-right:-45px !important;  }  .nhb-mx--50 {   margin-right:-50px !important;   margin-left:-50px !important;  }  .nhb-my--50 {   margin-top:-50px !important;   margin-bottom:-50px !important;  }  .nhb-mt--50 {   margin-top:-50px !important;  }  .nhb-mb--50 {   margin-bottom:-50px !important;  }  .nhb-ml--50 {   margin-left:-50px !important;  }  .nhb-mr--50 {   margin-right:-50px !important;  }  .nhb-mx--55 {   margin-right:-55px !important;   margin-left:-55px !important;  }  .nhb-my--55 {   margin-top:-55px !important;   margin-bottom:-55px !important;  }  .nhb-mt--55 {   margin-top:-55px !important;  }  .nhb-mb--55 {   margin-bottom:-55px !important;  }  .nhb-ml--55 {   margin-left:-55px !important;  }  .nhb-mr--55 {   margin-right:-55px !important;  }  .nhb-mx--60 {   margin-right:-60px !important;   margin-left:-60px !important;  }  .nhb-my--60 {   margin-top:-60px !important;   margin-bottom:-60px !important;  }  .nhb-mt--60 {   margin-top:-60px !important;  }  .nhb-mb--60 {   margin-bottom:-60px !important;  }  .nhb-ml--60 {   margin-left:-60px !important;  }  .nhb-mr--60 {   margin-right:-60px !important;  }  .nhb-mx--65 {   margin-right:-65px !important;   margin-left:-65px !important;  }  .nhb-my--65 {   margin-top:-65px !important;   margin-bottom:-65px !important;  }  .nhb-mt--65 {   margin-top:-65px !important;  }  .nhb-mb--65 {   margin-bottom:-65px !important;  }  .nhb-ml--65 {   margin-left:-65px !important;  }  .nhb-mr--65 {   margin-right:-65px !important;  }  .nhb-mx--70 {   margin-right:-70px !important;   margin-left:-70px !important;  }  .nhb-my--70 {   margin-top:-70px !important;   margin-bottom:-70px !important;  }  .nhb-mt--70 {   margin-top:-70px !important;  }  .nhb-mb--70 {   margin-bottom:-70px !important;  }  .nhb-ml--70 {   margin-left:-70px !important;  }  .nhb-mr--70 {   margin-right:-70px !important;  }  .nhb-mx--75 {   margin-right:-75px !important;   margin-left:-75px !important;  }  .nhb-my--75 {   margin-top:-75px !important;   margin-bottom:-75px !important;  }  .nhb-mt--75 {   margin-top:-75px !important;  }  .nhb-mb--75 {   margin-bottom:-75px !important;  }  .nhb-ml--75 {   margin-left:-75px !important;  }  .nhb-mr--75 {   margin-right:-75px !important;  }  .nhb-mx--80 {   margin-right:-80px !important;   margin-left:-80px !important;  }  .nhb-my--80 {   margin-top:-80px !important;   margin-bottom:-80px !important;  }  .nhb-mt--80 {   margin-top:-80px !important;  }  .nhb-mb--80 {   margin-bottom:-80px !important;  }  .nhb-ml--80 {   margin-left:-80px !important;  }  .nhb-mr--80 {   margin-right:-80px !important;  }  .nhb-mx--85 {   margin-right:-85px !important;   margin-left:-85px !important;  }  .nhb-my--85 {   margin-top:-85px !important;   margin-bottom:-85px !important;  }  .nhb-mt--85 {   margin-top:-85px !important;  }  .nhb-mb--85 {   margin-bottom:-85px !important;  }  .nhb-ml--85 {   margin-left:-85px !important;  }  .nhb-mr--85 {   margin-right:-85px !important;  }  .nhb-mx--90 {   margin-right:-90px !important;   margin-left:-90px !important;  }  .nhb-my--90 {   margin-top:-90px !important;   margin-bottom:-90px !important;  }  .nhb-mt--90 {   margin-top:-90px !important;  }  .nhb-mb--90 {   margin-bottom:-90px !important;  }  .nhb-ml--90 {   margin-left:-90px !important;  }  .nhb-mr--90 {   margin-right:-90px !important;  }  .nhb-mx--95 {   margin-right:-95px !important;   margin-left:-95px !important;  }  .nhb-my--95 {   margin-top:-95px !important;   margin-bottom:-95px !important;  }  .nhb-mt--95 {   margin-top:-95px !important;  }  .nhb-mb--95 {   margin-bottom:-95px !important;  }  .nhb-ml--95 {   margin-left:-95px !important;  }  .nhb-mr--95 {   margin-right:-95px !important;  }  .nhb-mx--100 {   margin-right:-100px !important;   margin-left:-100px !important;  }  .nhb-my--100 {   margin-top:-100px !important;   margin-bottom:-100px !important;  }  .nhb-mt--100 {   margin-top:-100px !important;  }  .nhb-mb--100 {   margin-bottom:-100px !important;  }  .nhb-ml--100 {   margin-left:-100px !important;  }  .nhb-mr--100 {   margin-right:-100px !important;  }  .nhb-mx--105 {   margin-right:-105px !important;   margin-left:-105px !important;  }  .nhb-my--105 {   margin-top:-105px !important;   margin-bottom:-105px !important;  }  .nhb-mt--105 {   margin-top:-105px !important;  }  .nhb-mb--105 {   margin-bottom:-105px !important;  }  .nhb-ml--105 {   margin-left:-105px !important;  }  .nhb-mr--105 {   margin-right:-105px !important;  }  .nhb-mx--110 {   margin-right:-110px !important;   margin-left:-110px !important;  }  .nhb-my--110 {   margin-top:-110px !important;   margin-bottom:-110px !important;  }  .nhb-mt--110 {   margin-top:-110px !important;  }  .nhb-mb--110 {   margin-bottom:-110px !important;  }  .nhb-ml--110 {   margin-left:-110px !important;  }  .nhb-mr--110 {   margin-right:-110px !important;  }  .nhb-mx--115 {   margin-right:-115px !important;   margin-left:-115px !important;  }  .nhb-my--115 {   margin-top:-115px !important;   margin-bottom:-115px !important;  }  .nhb-mt--115 {   margin-top:-115px !important;  }  .nhb-mb--115 {   margin-bottom:-115px !important;  }  .nhb-ml--115 {   margin-left:-115px !important;  }  .nhb-mr--115 {   margin-right:-115px !important;  }  .nhb-mx--120 {   margin-right:-120px !important;   margin-left:-120px !important;  }  .nhb-my--120 {   margin-top:-120px !important;   margin-bottom:-120px !important;  }  .nhb-mt--120 {   margin-top:-120px !important;  }  .nhb-mb--120 {   margin-bottom:-120px !important;  }  .nhb-ml--120 {   margin-left:-120px !important;  }  .nhb-mr--120 {   margin-right:-120px !important;  }  .nhb-mx--125 {   margin-right:-125px !important;   margin-left:-125px !important;  }  .nhb-my--125 {   margin-top:-125px !important;   margin-bottom:-125px !important;  }  .nhb-mt--125 {   margin-top:-125px !important;  }  .nhb-mb--125 {   margin-bottom:-125px !important;  }  .nhb-ml--125 {   margin-left:-125px !important;  }  .nhb-mr--125 {   margin-right:-125px !important;  }  .nhb-mx--130 {   margin-right:-130px !important;   margin-left:-130px !important;  }  .nhb-my--130 {   margin-top:-130px !important;   margin-bottom:-130px !important;  }  .nhb-mt--130 {   margin-top:-130px !important;  }  .nhb-mb--130 {   margin-bottom:-130px !important;  }  .nhb-ml--130 {   margin-left:-130px !important;  }  .nhb-mr--130 {   margin-right:-130px !important;  }  .nhb-mx--135 {   margin-right:-135px !important;   margin-left:-135px !important;  }  .nhb-my--135 {   margin-top:-135px !important;   margin-bottom:-135px !important;  }  .nhb-mt--135 {   margin-top:-135px !important;  }  .nhb-mb--135 {   margin-bottom:-135px !important;  }  .nhb-ml--135 {   margin-left:-135px !important;  }  .nhb-mr--135 {   margin-right:-135px !important;  }  .nhb-mx--140 {   margin-right:-140px !important;   margin-left:-140px !important;  }  .nhb-my--140 {   margin-top:-140px !important;   margin-bottom:-140px !important;  }  .nhb-mt--140 {   margin-top:-140px !important;  }  .nhb-mb--140 {   margin-bottom:-140px !important;  }  .nhb-ml--140 {   margin-left:-140px !important;  }  .nhb-mr--140 {   margin-right:-140px !important;  }  .nhb-mx--145 {   margin-right:-145px !important;   margin-left:-145px !important;  }  .nhb-my--145 {   margin-top:-145px !important;   margin-bottom:-145px !important;  }  .nhb-mt--145 {   margin-top:-145px !important;  }  .nhb-mb--145 {   margin-bottom:-145px !important;  }  .nhb-ml--145 {   margin-left:-145px !important;  }  .nhb-mr--145 {   margin-right:-145px !important;  }  .nhb-mx--150 {   margin-right:-150px !important;   margin-left:-150px !important;  }  .nhb-my--150 {   margin-top:-150px !important;   margin-bottom:-150px !important;  }  .nhb-mt--150 {   margin-top:-150px !important;  }  .nhb-mb--150 {   margin-bottom:-150px !important;  }  .nhb-ml--150 {   margin-left:-150px !important;  }  .nhb-mr--150 {   margin-right:-150px !important;  } } .br-5 {  border-radius:5px !important; } .br-10 {  border-radius:10px !important; } .br-15 {  border-radius:15px !important; } .br-20 {  border-radius:20px !important; } .br-25 {  border-radius:25px !important; } .br-30 {  border-radius:30px !important; } .br-35 {  border-radius:35px !important; } .br-40 {  border-radius:40px !important; } .br-45 {  border-radius:45px !important; } .br-50 {  border-radius:50px !important; } .br-55 {  border-radius:55px !important; } .br-60 {  border-radius:60px !important; } .br-65 {  border-radius:65px !important; } .br-70 {  border-radius:70px !important; } .br-75 {  border-radius:75px !important; } .br-80 {  border-radius:80px !important; } .br-85 {  border-radius:85px !important; } .br-90 {  border-radius:90px !important; } .br-95 {  border-radius:95px !important; } .br-100 {  border-radius:100px !important; } .br-105 {  border-radius:105px !important; } .br-110 {  border-radius:110px !important; } .br-115 {  border-radius:115px !important; } .br-120 {  border-radius:120px !important; } .br-125 {  border-radius:125px !important; } .br-130 {  border-radius:130px !important; } .br-135 {  border-radius:135px !important; } .br-140 {  border-radius:140px !important; } .br-145 {  border-radius:145px !important; } .br-150 {  border-radius:150px !important; }  .br_tl-5 {  border-top-left-radius:5px !important; } .br_tl-10 {  border-top-left-radius:10px !important; } .br_tl-15 {  border-top-left-radius:15px !important; } .br_tl-20 {  border-top-left-radius:20px !important; } .br_tl-25 {  border-top-left-radius:25px !important; } .br_tl-30 {  border-top-left-radius:30px !important; } .br_tl-35 {  border-top-left-radius:35px !important; } .br_tl-40 {  border-top-left-radius:40px !important; } .br_tl-45 {  border-top-left-radius:45px !important; } .br_tl-50 {  border-top-left-radius:50px !important; } .br_tl-55 {  border-top-left-radius:55px !important; } .br_tl-60 {  border-top-left-radius:60px !important; } .br_tl-65 {  border-top-left-radius:65px !important; } .br_tl-70 {  border-top-left-radius:70px !important; } .br_tl-75 {  border-top-left-radius:75px !important; } .br_tl-80 {  border-top-left-radius:80px !important; } .br_tl-85 {  border-top-left-radius:85px !important; } .br_tl-90 {  border-top-left-radius:90px !important; } .br_tl-95 {  border-top-left-radius:95px !important; } .br_tl-100 {  border-top-left-radius:100px !important; } .br_tl-105 {  border-top-left-radius:105px !important; } .br_tl-110 {  border-top-left-radius:110px !important; } .br_tl-115 {  border-top-left-radius:115px !important; } .br_tl-120 {  border-top-left-radius:120px !important; } .br_tl-125 {  border-top-left-radius:125px !important; } .br_tl-130 {  border-top-left-radius:130px !important; } .br_tl-135 {  border-top-left-radius:135px !important; } .br_tl-140 {  border-top-left-radius:140px !important; } .br_tl-145 {  border-top-left-radius:145px !important; } .br_tl-150 {  border-top-left-radius:150px !important; }  .br_tr-5 {  border-top-right-radius:5px !important; } .br_tr-10 {  border-top-right-radius:10px !important; } .br_tr-15 {  border-top-right-radius:15px !important; } .br_tr-20 {  border-top-right-radius:20px !important; } .br_tr-25 {  border-top-right-radius:25px !important; } .br_tr-30 {  border-top-right-radius:30px !important; } .br_tr-35 {  border-top-right-radius:35px !important; } .br_tr-40 {  border-top-right-radius:40px !important; } .br_tr-45 {  border-top-right-radius:45px !important; } .br_tr-50 {  border-top-right-radius:50px !important; } .br_tr-55 {  border-top-right-radius:55px !important; } .br_tr-60 {  border-top-right-radius:60px !important; } .br_tr-65 {  border-top-right-radius:65px !important; } .br_tr-70 {  border-top-right-radius:70px !important; } .br_tr-75 {  border-top-right-radius:75px !important; } .br_tr-80 {  border-top-right-radius:80px !important; } .br_tr-85 {  border-top-right-radius:85px !important; } .br_tr-90 {  border-top-right-radius:90px !important; } .br_tr-95 {  border-top-right-radius:95px !important; } .br_tr-100 {  border-top-right-radius:100px !important; } .br_tr-105 {  border-top-right-radius:105px !important; } .br_tr-110 {  border-top-right-radius:110px !important; } .br_tr-115 {  border-top-right-radius:115px !important; } .br_tr-120 {  border-top-right-radius:120px !important; } .br_tr-125 {  border-top-right-radius:125px !important; } .br_tr-130 {  border-top-right-radius:130px !important; } .br_tr-135 {  border-top-right-radius:135px !important; } .br_tr-140 {  border-top-right-radius:140px !important; } .br_tr-145 {  border-top-right-radius:145px !important; } .br_tr-150 {  border-top-right-radius:150px !important; }  .br_bl-5 {  border-bottom-left-radius:5px !important; } .br_bl-10 {  border-bottom-left-radius:10px !important; } .br_bl-15 {  border-bottom-left-radius:15px !important; } .br_bl-20 {  border-bottom-left-radius:20px !important; } .br_bl-25 {  border-bottom-left-radius:25px !important; } .br_bl-30 {  border-bottom-left-radius:30px !important; } .br_bl-35 {  border-bottom-left-radius:35px !important; } .br_bl-40 {  border-bottom-left-radius:40px !important; } .br_bl-45 {  border-bottom-left-radius:45px !important; } .br_bl-50 {  border-bottom-left-radius:50px !important; } .br_bl-55 {  border-bottom-left-radius:55px !important; } .br_bl-60 {  border-bottom-left-radius:60px !important; } .br_bl-65 {  border-bottom-left-radius:65px !important; } .br_bl-70 {  border-bottom-left-radius:70px !important; } .br_bl-75 {  border-bottom-left-radius:75px !important; } .br_bl-80 {  border-bottom-left-radius:80px !important; } .br_bl-85 {  border-bottom-left-radius:85px !important; } .br_bl-90 {  border-bottom-left-radius:90px !important; } .br_bl-95 {  border-bottom-left-radius:95px !important; } .br_bl-100 {  border-bottom-left-radius:100px !important; } .br_bl-105 {  border-bottom-left-radius:105px !important; } .br_bl-110 {  border-bottom-left-radius:110px !important; } .br_bl-115 {  border-bottom-left-radius:115px !important; } .br_bl-120 {  border-bottom-left-radius:120px !important; } .br_bl-125 {  border-bottom-left-radius:125px !important; } .br_bl-130 {  border-bottom-left-radius:130px !important; } .br_bl-135 {  border-bottom-left-radius:135px !important; } .br_bl-140 {  border-bottom-left-radius:140px !important; } .br_bl-145 {  border-bottom-left-radius:145px !important; } .br_bl-150 {  border-bottom-left-radius:150px !important; }  .br_br-5 {  border-bottom-right-radius:5px !important; } .br_br-10 {  border-bottom-right-radius:10px !important; } .br_br-15 {  border-bottom-right-radius:15px !important; } .br_br-20 {  border-bottom-right-radius:20px !important; } .br_br-25 {  border-bottom-right-radius:25px !important; } .br_br-30 {  border-bottom-right-radius:30px !important; } .br_br-35 {  border-bottom-right-radius:35px !important; } .br_br-40 {  border-bottom-right-radius:40px !important; } .br_br-45 {  border-bottom-right-radius:45px !important; } .br_br-50 {  border-bottom-right-radius:50px !important; } .br_br-55 {  border-bottom-right-radius:55px !important; } .br_br-60 {  border-bottom-right-radius:60px !important; } .br_br-65 {  border-bottom-right-radius:65px !important; } .br_br-70 {  border-bottom-right-radius:70px !important; } .br_br-75 {  border-bottom-right-radius:75px !important; } .br_br-80 {  border-bottom-right-radius:80px !important; } .br_br-85 {  border-bottom-right-radius:85px !important; } .br_br-90 {  border-bottom-right-radius:90px !important; } .br_br-95 {  border-bottom-right-radius:95px !important; } .br_br-100 {  border-bottom-right-radius:100px !important; } .br_br-105 {  border-bottom-right-radius:105px !important; } .br_br-110 {  border-bottom-right-radius:110px !important; } .br_br-115 {  border-bottom-right-radius:115px !important; } .br_br-120 {  border-bottom-right-radius:120px !important; } .br_br-125 {  border-bottom-right-radius:125px !important; } .br_br-130 {  border-bottom-right-radius:130px !important; } .br_br-135 {  border-bottom-right-radius:135px !important; } .br_br-140 {  border-bottom-right-radius:140px !important; } .br_br-145 {  border-bottom-right-radius:145px !important; } .br_br-150 {  border-bottom-right-radius:150px !important; } .text-center {  text-align:center !important; } .text-left {  text-align:left !important; } .text-right {  text-align:right !important; }  @media (min-width:1922px) {  .hd-text-center {   text-align:center !important;  }  .hd-text-left {   text-align:left !important;  }  .hd-text-right {   text-align:right !important;  }  .hd-d-none {   display:none !important;  }  .hd-d-block {   display:block !important;  }  .hd-d-flex {   display:flex !important;  }  .hd-d-inline-block {   display:inline-block !important;  } } @media (max-width:1500px) {  .xxl-text-center {   text-align:center !important;  }  .xxl-text-left {   text-align:left !important;  }  .xxl-text-right {   text-align:right !important;  }  .xxl-d-none {   display:none !important;  }  .xxl-d-block {   display:block !important;  }  .xxl-d-flex {   display:flex !important;  }  .xxl-d-inline-block {   display:inline-block !important;  } } @media (max-width:1399px) {  .ml-text-center {   text-align:center !important;  }  .ml-text-left {   text-align:left !important;  }  .ml-text-right {   text-align:right !important;  }  .ml-d-none {   display:none !important;  }  .ml-d-block {   display:block !important;  }  .ml-d-flex {   display:flex !important;  }  .ml-d-inline-block {   display:inline-block !important;  } } @media (max-width:1299px) {  .xl-text-center {   text-align:center !important;  }  .xl-text-left {   text-align:left !important;  }  .xl-text-right {   text-align:right !important;  }  .xl-d-none {   display:none !important;  }  .xl-d-block {   display:block !important;  }  .xl-d-flex {   display:flex !important;  }  .xl-d-inline-block {   display:inline-block !important;  } } @media (max-width:1199px) {  .lg-text-center {   text-align:center !important;  }  .lg-text-left {   text-align:left !important;  }  .lg-text-right {   text-align:right !important;  }  .lg-d-none {   display:none !important;  }  .lg-d-block {   display:block !important;  }  .lg-d-flex {   display:flex !important;  }  .lg-d-inline-block {   display:inline-block !important;  } } @media (max-width:991px) {  .md-text-center {   text-align:center !important;  }  .md-text-left {   text-align:left !important;  }  .md-text-right {   text-align:right !important;  }  .md-d-none {   display:none !important;  }  .md-d-block {   display:block !important;  }  .md-d-flex {   display:flex !important;  }  .md-d-inline-block {   display:inline-block !important;  } } @media (max-width:767px) {  .sm-text-center {   text-align:center !important;  }  .sm-text-left {   text-align:left !important;  }  .sm-text-right {   text-align:right !important;  }  .sm-d-none {   display:none !important;  }  .sm-d-block {   display:block !important;  }  .sm-d-flex {   display:flex !important;  }  .sm-d-inline-block {   display:inline-block !important;  } } @media (max-width:575px) {  .xs-text-center {   text-align:center !important;  }  .xs-text-left {   text-align:left !important;  }  .xs-text-right {   text-align:right !important;  }  .xs-d-none {   display:none !important;  }  .xs-d-block {   display:block !important;  }  .xs-d-flex {   display:flex !important;  }  .xs-d-inline-block {   display:inline-block !important;  } } @media (max-width:375px) {  .vxs-text-center {   text-align:center !important;  }  .vxs-text-left {   text-align:left !important;  }  .vxs-text-right {   text-align:right !important;  }  .vxs-d-none {   display:none !important;  }  .vxs-d-block {   display:block !important;  }  .vxs-d-flex {   display:flex !important;  }  .vxs-d-inline-block {   display:inline-block !important;  } } .gap-0 {  gap:0 !important; } .gap-5 {  gap:5px !important; } .gap-10 {  gap:10px !important; } .gap-15 {  gap:15px !important; } .gap-20 {  gap:20px !important; } .gap-25 {  gap:25px !important; } .gap-30 {  gap:30px !important; } .gap-35 {  gap:35px !important; } .gap-40 {  gap:40px !important; } .gap-45 {  gap:45px !important; } .gap-50 {  gap:50px !important; } .gap-55 {  gap:55px !important; } .gap-60 {  gap:60px !important; } .gap-65 {  gap:65px !important; } .gap-70 {  gap:70px !important; } .gap-75 {  gap:75px !important; } .gap-80 {  gap:80px !important; } .gap-85 {  gap:85px !important; } .gap-90 {  gap:90px !important; } .gap-95 {  gap:95px !important; } .gap-100 {  gap:100px !important; } .gap-105 {  gap:105px !important; } .gap-110 {  gap:110px !important; } .gap-115 {  gap:115px !important; } .gap-120 {  gap:120px !important; } .gap-125 {  gap:125px !important; } .gap-130 {  gap:130px !important; } .gap-135 {  gap:135px !important; } .gap-140 {  gap:140px !important; } .gap-145 {  gap:145px !important; } .gap-150 {  gap:150px !important; } .-gap-5 {  gap:5px !important; } .-gap-10 {  gap:10px !important; } .-gap-15 {  gap:15px !important; } .-gap-20 {  gap:20px !important; } .-gap-25 {  gap:25px !important; } .-gap-30 {  gap:30px !important; } .-gap-35 {  gap:35px !important; } .-gap-40 {  gap:40px !important; } .-gap-45 {  gap:45px !important; } .-gap-50 {  gap:50px !important; } .-gap-55 {  gap:55px !important; } .-gap-60 {  gap:60px !important; } .-gap-65 {  gap:65px !important; } .-gap-70 {  gap:70px !important; } .-gap-75 {  gap:75px !important; } .-gap-80 {  gap:80px !important; } .-gap-85 {  gap:85px !important; } .-gap-90 {  gap:90px !important; } .-gap-95 {  gap:95px !important; } .-gap-100 {  gap:100px !important; } .-gap-105 {  gap:105px !important; } .-gap-110 {  gap:110px !important; } .-gap-115 {  gap:115px !important; } .-gap-120 {  gap:120px !important; } .-gap-125 {  gap:125px !important; } .-gap-130 {  gap:130px !important; } .-gap-135 {  gap:135px !important; } .-gap-140 {  gap:140px !important; } .-gap-145 {  gap:145px !important; } .-gap-150 {  gap:150px !important; }  @media (min-width:1922px) {  .hd-gap-5 {   gap:5px !important;  }  .hd-gap-10 {   gap:10px !important;  }  .hd-gap-15 {   gap:15px !important;  }  .hd-gap-20 {   gap:20px !important;  }  .hd-gap-25 {   gap:25px !important;  }  .hd-gap-30 {   gap:30px !important;  }  .hd-gap-35 {   gap:35px !important;  }  .hd-gap-40 {   gap:40px !important;  }  .hd-gap-45 {   gap:45px !important;  }  .hd-gap-50 {   gap:50px !important;  }  .hd-gap-55 {   gap:55px !important;  }  .hd-gap-60 {   gap:60px !important;  }  .hd-gap-65 {   gap:65px !important;  }  .hd-gap-70 {   gap:70px !important;  }  .hd-gap-75 {   gap:75px !important;  }  .hd-gap-80 {   gap:80px !important;  }  .hd-gap-85 {   gap:85px !important;  }  .hd-gap-90 {   gap:90px !important;  }  .hd-gap-95 {   gap:95px !important;  }  .hd-gap-100 {   gap:100px !important;  }  .hd-gap-105 {   gap:105px !important;  }  .hd-gap-110 {   gap:110px !important;  }  .hd-gap-115 {   gap:115px !important;  }  .hd-gap-120 {   gap:120px !important;  }  .hd-gap-125 {   gap:125px !important;  }  .hd-gap-130 {   gap:130px !important;  }  .hd-gap-135 {   gap:135px !important;  }  .hd-gap-140 {   gap:140px !important;  }  .hd-gap-145 {   gap:145px !important;  }  .hd-gap-150 {   gap:150px !important;  } } @media (max-width:1500px) {  .xxl-gap-5 {   gap:5px !important;  }  .xxl-gap-10 {   gap:10px !important;  }  .xxl-gap-15 {   gap:15px !important;  }  .xxl-gap-20 {   gap:20px !important;  }  .xxl-gap-25 {   gap:25px !important;  }  .xxl-gap-30 {   gap:30px !important;  }  .xxl-gap-35 {   gap:35px !important;  }  .xxl-gap-40 {   gap:40px !important;  }  .xxl-gap-45 {   gap:45px !important;  }  .xxl-gap-50 {   gap:50px !important;  }  .xxl-gap-55 {   gap:55px !important;  }  .xxl-gap-60 {   gap:60px !important;  }  .xxl-gap-65 {   gap:65px !important;  }  .xxl-gap-70 {   gap:70px !important;  }  .xxl-gap-75 {   gap:75px !important;  }  .xxl-gap-80 {   gap:80px !important;  }  .xxl-gap-85 {   gap:85px !important;  }  .xxl-gap-90 {   gap:90px !important;  }  .xxl-gap-95 {   gap:95px !important;  }  .xxl-gap-100 {   gap:100px !important;  }  .xxl-gap-105 {   gap:105px !important;  }  .xxl-gap-110 {   gap:110px !important;  }  .xxl-gap-115 {   gap:115px !important;  }  .xxl-gap-120 {   gap:120px !important;  }  .xxl-gap-125 {   gap:125px !important;  }  .xxl-gap-130 {   gap:130px !important;  }  .xxl-gap-135 {   gap:135px !important;  }  .xxl-gap-140 {   gap:140px !important;  }  .xxl-gap-145 {   gap:145px !important;  }  .xxl-gap-150 {   gap:150px !important;  } } @media (max-width:1299px) {  .xl-gap-5 {   gap:5px !important;  }  .xl-gap-10 {   gap:10px !important;  }  .xl-gap-15 {   gap:15px !important;  }  .xl-gap-20 {   gap:20px !important;  }  .xl-gap-25 {   gap:25px !important;  }  .xl-gap-30 {   gap:30px !important;  }  .xl-gap-35 {   gap:35px !important;  }  .xl-gap-40 {   gap:40px !important;  }  .xl-gap-45 {   gap:45px !important;  }  .xl-gap-50 {   gap:50px !important;  }  .xl-gap-55 {   gap:55px !important;  }  .xl-gap-60 {   gap:60px !important;  }  .xl-gap-65 {   gap:65px !important;  }  .xl-gap-70 {   gap:70px !important;  }  .xl-gap-75 {   gap:75px !important;  }  .xl-gap-80 {   gap:80px !important;  }  .xl-gap-85 {   gap:85px !important;  }  .xl-gap-90 {   gap:90px !important;  }  .xl-gap-95 {   gap:95px !important;  }  .xl-gap-100 {   gap:100px !important;  }  .xl-gap-105 {   gap:105px !important;  }  .xl-gap-110 {   gap:110px !important;  }  .xl-gap-115 {   gap:115px !important;  }  .xl-gap-120 {   gap:120px !important;  }  .xl-gap-125 {   gap:125px !important;  }  .xl-gap-130 {   gap:130px !important;  }  .xl-gap-135 {   gap:135px !important;  }  .xl-gap-140 {   gap:140px !important;  }  .xl-gap-145 {   gap:145px !important;  }  .xl-gap-150 {   gap:150px !important;  } } @media (max-width:1199px) {  .lg-gap-5 {   gap:5px !important;  }  .lg-gap-10 {   gap:10px !important;  }  .lg-gap-15 {   gap:15px !important;  }  .lg-gap-20 {   gap:20px !important;  }  .lg-gap-25 {   gap:25px !important;  }  .lg-gap-30 {   gap:30px !important;  }  .lg-gap-35 {   gap:35px !important;  }  .lg-gap-40 {   gap:40px !important;  }  .lg-gap-45 {   gap:45px !important;  }  .lg-gap-50 {   gap:50px !important;  }  .lg-gap-55 {   gap:55px !important;  }  .lg-gap-60 {   gap:60px !important;  }  .lg-gap-65 {   gap:65px !important;  }  .lg-gap-70 {   gap:70px !important;  }  .lg-gap-75 {   gap:75px !important;  }  .lg-gap-80 {   gap:80px !important;  }  .lg-gap-85 {   gap:85px !important;  }  .lg-gap-90 {   gap:90px !important;  }  .lg-gap-95 {   gap:95px !important;  }  .lg-gap-100 {   gap:100px !important;  }  .lg-gap-105 {   gap:105px !important;  }  .lg-gap-110 {   gap:110px !important;  }  .lg-gap-115 {   gap:115px !important;  }  .lg-gap-120 {   gap:120px !important;  }  .lg-gap-125 {   gap:125px !important;  }  .lg-gap-130 {   gap:130px !important;  }  .lg-gap-135 {   gap:135px !important;  }  .lg-gap-140 {   gap:140px !important;  }  .lg-gap-145 {   gap:145px !important;  }  .lg-gap-150 {   gap:150px !important;  } } @media (max-width:991px) {  .md-gap-5 {   gap:5px !important;  }  .md-gap-10 {   gap:10px !important;  }  .md-gap-15 {   gap:15px !important;  }  .md-gap-20 {   gap:20px !important;  }  .md-gap-25 {   gap:25px !important;  }  .md-gap-30 {   gap:30px !important;  }  .md-gap-35 {   gap:35px !important;  }  .md-gap-40 {   gap:40px !important;  }  .md-gap-45 {   gap:45px !important;  }  .md-gap-50 {   gap:50px !important;  }  .md-gap-55 {   gap:55px !important;  }  .md-gap-60 {   gap:60px !important;  }  .md-gap-65 {   gap:65px !important;  }  .md-gap-70 {   gap:70px !important;  }  .md-gap-75 {   gap:75px !important;  }  .md-gap-80 {   gap:80px !important;  }  .md-gap-85 {   gap:85px !important;  }  .md-gap-90 {   gap:90px !important;  }  .md-gap-95 {   gap:95px !important;  }  .md-gap-100 {   gap:100px !important;  }  .md-gap-105 {   gap:105px !important;  }  .md-gap-110 {   gap:110px !important;  }  .md-gap-115 {   gap:115px !important;  }  .md-gap-120 {   gap:120px !important;  }  .md-gap-125 {   gap:125px !important;  }  .md-gap-130 {   gap:130px !important;  }  .md-gap-135 {   gap:135px !important;  }  .md-gap-140 {   gap:140px !important;  }  .md-gap-145 {   gap:145px !important;  }  .md-gap-150 {   gap:150px !important;  } } @media (max-width:767px) {  .sm-gap-5 {   gap:5px !important;  }  .sm-gap-10 {   gap:10px !important;  }  .sm-gap-15 {   gap:15px !important;  }  .sm-gap-20 {   gap:20px !important;  }  .sm-gap-25 {   gap:25px !important;  }  .sm-gap-30 {   gap:30px !important;  }  .sm-gap-35 {   gap:35px !important;  }  .sm-gap-40 {   gap:40px !important;  }  .sm-gap-45 {   gap:45px !important;  }  .sm-gap-50 {   gap:50px !important;  }  .sm-gap-55 {   gap:55px !important;  }  .sm-gap-60 {   gap:60px !important;  }  .sm-gap-65 {   gap:65px !important;  }  .sm-gap-70 {   gap:70px !important;  }  .sm-gap-75 {   gap:75px !important;  }  .sm-gap-80 {   gap:80px !important;  }  .sm-gap-85 {   gap:85px !important;  }  .sm-gap-90 {   gap:90px !important;  }  .sm-gap-95 {   gap:95px !important;  }  .sm-gap-100 {   gap:100px !important;  }  .sm-gap-105 {   gap:105px !important;  }  .sm-gap-110 {   gap:110px !important;  }  .sm-gap-115 {   gap:115px !important;  }  .sm-gap-120 {   gap:120px !important;  }  .sm-gap-125 {   gap:125px !important;  }  .sm-gap-130 {   gap:130px !important;  }  .sm-gap-135 {   gap:135px !important;  }  .sm-gap-140 {   gap:140px !important;  }  .sm-gap-145 {   gap:145px !important;  }  .sm-gap-150 {   gap:150px !important;  } } @media (max-width:575px) {  .xs-gap-5 {   gap:5px !important;  }  .xs-gap-10 {   gap:10px !important;  }  .xs-gap-15 {   gap:15px !important;  }  .xs-gap-20 {   gap:20px !important;  }  .xs-gap-25 {   gap:25px !important;  }  .xs-gap-30 {   gap:30px !important;  }  .xs-gap-35 {   gap:35px !important;  }  .xs-gap-40 {   gap:40px !important;  }  .xs-gap-45 {   gap:45px !important;  }  .xs-gap-50 {   gap:50px !important;  }  .xs-gap-55 {   gap:55px !important;  }  .xs-gap-60 {   gap:60px !important;  }  .xs-gap-65 {   gap:65px !important;  }  .xs-gap-70 {   gap:70px !important;  }  .xs-gap-75 {   gap:75px !important;  }  .xs-gap-80 {   gap:80px !important;  }  .xs-gap-85 {   gap:85px !important;  }  .xs-gap-90 {   gap:90px !important;  }  .xs-gap-95 {   gap:95px !important;  }  .xs-gap-100 {   gap:100px !important;  }  .xs-gap-105 {   gap:105px !important;  }  .xs-gap-110 {   gap:110px !important;  }  .xs-gap-115 {   gap:115px !important;  }  .xs-gap-120 {   gap:120px !important;  }  .xs-gap-125 {   gap:125px !important;  }  .xs-gap-130 {   gap:130px !important;  }  .xs-gap-135 {   gap:135px !important;  }  .xs-gap-140 {   gap:140px !important;  }  .xs-gap-145 {   gap:145px !important;  }  .xs-gap-150 {   gap:150px !important;  } } @media (max-width:375px) {  .vxs-gap-5 {   gap:5px !important;  }  .vxs-gap-10 {   gap:10px !important;  }  .vxs-gap-15 {   gap:15px !important;  }  .vxs-gap-20 {   gap:20px !important;  }  .vxs-gap-25 {   gap:25px !important;  }  .vxs-gap-30 {   gap:30px !important;  }  .vxs-gap-35 {   gap:35px !important;  }  .vxs-gap-40 {   gap:40px !important;  }  .vxs-gap-45 {   gap:45px !important;  }  .vxs-gap-50 {   gap:50px !important;  }  .vxs-gap-55 {   gap:55px !important;  }  .vxs-gap-60 {   gap:60px !important;  }  .vxs-gap-65 {   gap:65px !important;  }  .vxs-gap-70 {   gap:70px !important;  }  .vxs-gap-75 {   gap:75px !important;  }  .vxs-gap-80 {   gap:80px !important;  }  .vxs-gap-85 {   gap:85px !important;  }  .vxs-gap-90 {   gap:90px !important;  }  .vxs-gap-95 {   gap:95px !important;  }  .vxs-gap-100 {   gap:100px !important;  }  .vxs-gap-105 {   gap:105px !important;  }  .vxs-gap-110 {   gap:110px !important;  }  .vxs-gap-115 {   gap:115px !important;  }  .vxs-gap-120 {   gap:120px !important;  }  .vxs-gap-125 {   gap:125px !important;  }  .vxs-gap-130 {   gap:130px !important;  }  .vxs-gap-135 {   gap:135px !important;  }  .vxs-gap-140 {   gap:140px !important;  }  .vxs-gap-145 {   gap:145px !important;  }  .vxs-gap-150 {   gap:150px !important;  } } @media (max-width:1280px) {  .ltp-l-gap-5 {   gap:5px !important;  }  .ltp-l-gap-10 {   gap:10px !important;  }  .ltp-l-gap-15 {   gap:15px !important;  }  .ltp-l-gap-20 {   gap:20px !important;  }  .ltp-l-gap-25 {   gap:25px !important;  }  .ltp-l-gap-30 {   gap:30px !important;  }  .ltp-l-gap-35 {   gap:35px !important;  }  .ltp-l-gap-40 {   gap:40px !important;  }  .ltp-l-gap-45 {   gap:45px !important;  }  .ltp-l-gap-50 {   gap:50px !important;  }  .ltp-l-gap-55 {   gap:55px !important;  }  .ltp-l-gap-60 {   gap:60px !important;  }  .ltp-l-gap-65 {   gap:65px !important;  }  .ltp-l-gap-70 {   gap:70px !important;  }  .ltp-l-gap-75 {   gap:75px !important;  }  .ltp-l-gap-80 {   gap:80px !important;  }  .ltp-l-gap-85 {   gap:85px !important;  }  .ltp-l-gap-90 {   gap:90px !important;  }  .ltp-l-gap-95 {   gap:95px !important;  }  .ltp-l-gap-100 {   gap:100px !important;  }  .ltp-l-gap-105 {   gap:105px !important;  }  .ltp-l-gap-110 {   gap:110px !important;  }  .ltp-l-gap-115 {   gap:115px !important;  }  .ltp-l-gap-120 {   gap:120px !important;  }  .ltp-l-gap-125 {   gap:125px !important;  }  .ltp-l-gap-130 {   gap:130px !important;  }  .ltp-l-gap-135 {   gap:135px !important;  }  .ltp-l-gap-140 {   gap:140px !important;  }  .ltp-l-gap-145 {   gap:145px !important;  }  .ltp-l-gap-150 {   gap:150px !important;  } } @media (max-width:1024px) {  .ltp-m-gap-5 {   gap:5px !important;  }  .ltp-m-gap-10 {   gap:10px !important;  }  .ltp-m-gap-15 {   gap:15px !important;  }  .ltp-m-gap-20 {   gap:20px !important;  }  .ltp-m-gap-25 {   gap:25px !important;  }  .ltp-m-gap-30 {   gap:30px !important;  }  .ltp-m-gap-35 {   gap:35px !important;  }  .ltp-m-gap-40 {   gap:40px !important;  }  .ltp-m-gap-45 {   gap:45px !important;  }  .ltp-m-gap-50 {   gap:50px !important;  }  .ltp-m-gap-55 {   gap:55px !important;  }  .ltp-m-gap-60 {   gap:60px !important;  }  .ltp-m-gap-65 {   gap:65px !important;  }  .ltp-m-gap-70 {   gap:70px !important;  }  .ltp-m-gap-75 {   gap:75px !important;  }  .ltp-m-gap-80 {   gap:80px !important;  }  .ltp-m-gap-85 {   gap:85px !important;  }  .ltp-m-gap-90 {   gap:90px !important;  }  .ltp-m-gap-95 {   gap:95px !important;  }  .ltp-m-gap-100 {   gap:100px !important;  }  .ltp-m-gap-105 {   gap:105px !important;  }  .ltp-m-gap-110 {   gap:110px !important;  }  .ltp-m-gap-115 {   gap:115px !important;  }  .ltp-m-gap-120 {   gap:120px !important;  }  .ltp-m-gap-125 {   gap:125px !important;  }  .ltp-m-gap-130 {   gap:130px !important;  }  .ltp-m-gap-135 {   gap:135px !important;  }  .ltp-m-gap-140 {   gap:140px !important;  }  .ltp-m-gap-145 {   gap:145px !important;  }  .ltp-m-gap-150 {   gap:150px !important;  } } .gx-5 {  --bs-gutter-x:5px; } .gy-5 {  --bs-gutter-y:5px; } .gx-10 {  --bs-gutter-x:10px; } .gy-10 {  --bs-gutter-y:10px; } .gx-15 {  --bs-gutter-x:15px; } .gy-15 {  --bs-gutter-y:15px; } .gx-20 {  --bs-gutter-x:20px; } .gy-20 {  --bs-gutter-y:20px; } .gx-25 {  --bs-gutter-x:25px; } .gy-25 {  --bs-gutter-y:25px; } .gx-30 {  --bs-gutter-x:30px; } .gy-30 {  --bs-gutter-y:30px; } .gx-35 {  --bs-gutter-x:35px; } .gy-35 {  --bs-gutter-y:35px; } .gx-40 {  --bs-gutter-x:40px; } .gy-40 {  --bs-gutter-y:40px; } .gx-45 {  --bs-gutter-x:45px; } .gy-45 {  --bs-gutter-y:45px; } .gx-50 {  --bs-gutter-x:50px; } .gy-50 {  --bs-gutter-y:50px; } .gx-55 {  --bs-gutter-x:55px; } .gy-55 {  --bs-gutter-y:55px; } .gx-60 {  --bs-gutter-x:60px; } .gy-60 {  --bs-gutter-y:60px; } .gx-65 {  --bs-gutter-x:65px; } .gy-65 {  --bs-gutter-y:65px; } .gx-70 {  --bs-gutter-x:70px; } .gy-70 {  --bs-gutter-y:70px; } .gx-75 {  --bs-gutter-x:75px; } .gy-75 {  --bs-gutter-y:75px; } .gx-80 {  --bs-gutter-x:80px; } .gy-80 {  --bs-gutter-y:80px; } .gx-85 {  --bs-gutter-x:85px; } .gy-85 {  --bs-gutter-y:85px; } .gx-90 {  --bs-gutter-x:90px; } .gy-90 {  --bs-gutter-y:90px; } .gx-95 {  --bs-gutter-x:95px; } .gy-95 {  --bs-gutter-y:95px; } .gx-100 {  --bs-gutter-x:100px; } .gy-100 {  --bs-gutter-y:100px; } .gx-105 {  --bs-gutter-x:105px; } .gy-105 {  --bs-gutter-y:105px; } .gx-110 {  --bs-gutter-x:110px; } .gy-110 {  --bs-gutter-y:110px; } .gx-115 {  --bs-gutter-x:115px; } .gy-115 {  --bs-gutter-y:115px; } .gx-120 {  --bs-gutter-x:120px; } .gy-120 {  --bs-gutter-y:120px; } .gx-125 {  --bs-gutter-x:125px; } .gy-125 {  --bs-gutter-y:125px; } .gx-130 {  --bs-gutter-x:130px; } .gy-130 {  --bs-gutter-y:130px; } .gx-135 {  --bs-gutter-x:135px; } .gy-135 {  --bs-gutter-y:135px; } .gx-140 {  --bs-gutter-x:140px; } .gy-140 {  --bs-gutter-y:140px; } .gx-145 {  --bs-gutter-x:145px; } .gy-145 {  --bs-gutter-y:145px; } .gx-150 {  --bs-gutter-x:150px; } .gy-150 {  --bs-gutter-y:150px; } .-gx-5 {  --bs-gutter-x:5px; } .-gy-5 {  --bs-gutter-y:5px; } .-gx-10 {  --bs-gutter-x:10px; } .-gy-10 {  --bs-gutter-y:10px; } .-gx-15 {  --bs-gutter-x:15px; } .-gy-15 {  --bs-gutter-y:15px; } .-gx-20 {  --bs-gutter-x:20px; } .-gy-20 {  --bs-gutter-y:20px; } .-gx-25 {  --bs-gutter-x:25px; } .-gy-25 {  --bs-gutter-y:25px; } .-gx-30 {  --bs-gutter-x:30px; } .-gy-30 {  --bs-gutter-y:30px; } .-gx-35 {  --bs-gutter-x:35px; } .-gy-35 {  --bs-gutter-y:35px; } .-gx-40 {  --bs-gutter-x:40px; } .-gy-40 {  --bs-gutter-y:40px; } .-gx-45 {  --bs-gutter-x:45px; } .-gy-45 {  --bs-gutter-y:45px; } .-gx-50 {  --bs-gutter-x:50px; } .-gy-50 {  --bs-gutter-y:50px; } .-gx-55 {  --bs-gutter-x:55px; } .-gy-55 {  --bs-gutter-y:55px; } .-gx-60 {  --bs-gutter-x:60px; } .-gy-60 {  --bs-gutter-y:60px; } .-gx-65 {  --bs-gutter-x:65px; } .-gy-65 {  --bs-gutter-y:65px; } .-gx-70 {  --bs-gutter-x:70px; } .-gy-70 {  --bs-gutter-y:70px; } .-gx-75 {  --bs-gutter-x:75px; } .-gy-75 {  --bs-gutter-y:75px; } .-gx-80 {  --bs-gutter-x:80px; } .-gy-80 {  --bs-gutter-y:80px; } .-gx-85 {  --bs-gutter-x:85px; } .-gy-85 {  --bs-gutter-y:85px; } .-gx-90 {  --bs-gutter-x:90px; } .-gy-90 {  --bs-gutter-y:90px; } .-gx-95 {  --bs-gutter-x:95px; } .-gy-95 {  --bs-gutter-y:95px; } .-gx-100 {  --bs-gutter-x:100px; } .-gy-100 {  --bs-gutter-y:100px; } .-gx-105 {  --bs-gutter-x:105px; } .-gy-105 {  --bs-gutter-y:105px; } .-gx-110 {  --bs-gutter-x:110px; } .-gy-110 {  --bs-gutter-y:110px; } .-gx-115 {  --bs-gutter-x:115px; } .-gy-115 {  --bs-gutter-y:115px; } .-gx-120 {  --bs-gutter-x:120px; } .-gy-120 {  --bs-gutter-y:120px; } .-gx-125 {  --bs-gutter-x:125px; } .-gy-125 {  --bs-gutter-y:125px; } .-gx-130 {  --bs-gutter-x:130px; } .-gy-130 {  --bs-gutter-y:130px; } .-gx-135 {  --bs-gutter-x:135px; } .-gy-135 {  --bs-gutter-y:135px; } .-gx-140 {  --bs-gutter-x:140px; } .-gy-140 {  --bs-gutter-y:140px; } .-gx-145 {  --bs-gutter-x:145px; } .-gy-145 {  --bs-gutter-y:145px; } .-gx-150 {  --bs-gutter-x:150px; } .-gy-150 {  --bs-gutter-y:150px; }  @media (max-width:1399px) {  .ml-gx-5 {   --bs-gutter-x:5px;  }  .ml-gy-5 {   --bs-gutter-y:5px;  }  .ml-gx-10 {   --bs-gutter-x:10px;  }  .ml-gy-10 {   --bs-gutter-y:10px;  }  .ml-gx-15 {   --bs-gutter-x:15px;  }  .ml-gy-15 {   --bs-gutter-y:15px;  }  .ml-gx-20 {   --bs-gutter-x:20px;  }  .ml-gy-20 {   --bs-gutter-y:20px;  }  .ml-gx-25 {   --bs-gutter-x:25px;  }  .ml-gy-25 {   --bs-gutter-y:25px;  }  .ml-gx-30 {   --bs-gutter-x:30px;  }  .ml-gy-30 {   --bs-gutter-y:30px;  }  .ml-gx-35 {   --bs-gutter-x:35px;  }  .ml-gy-35 {   --bs-gutter-y:35px;  }  .ml-gx-40 {   --bs-gutter-x:40px;  }  .ml-gy-40 {   --bs-gutter-y:40px;  }  .ml-gx-45 {   --bs-gutter-x:45px;  }  .ml-gy-45 {   --bs-gutter-y:45px;  }  .ml-gx-50 {   --bs-gutter-x:50px;  }  .ml-gy-50 {   --bs-gutter-y:50px;  }  .ml-gx-55 {   --bs-gutter-x:55px;  }  .ml-gy-55 {   --bs-gutter-y:55px;  }  .ml-gx-60 {   --bs-gutter-x:60px;  }  .ml-gy-60 {   --bs-gutter-y:60px;  }  .ml-gx-65 {   --bs-gutter-x:65px;  }  .ml-gy-65 {   --bs-gutter-y:65px;  }  .ml-gx-70 {   --bs-gutter-x:70px;  }  .ml-gy-70 {   --bs-gutter-y:70px;  }  .ml-gx-75 {   --bs-gutter-x:75px;  }  .ml-gy-75 {   --bs-gutter-y:75px;  }  .ml-gx-80 {   --bs-gutter-x:80px;  }  .ml-gy-80 {   --bs-gutter-y:80px;  }  .ml-gx-85 {   --bs-gutter-x:85px;  }  .ml-gy-85 {   --bs-gutter-y:85px;  }  .ml-gx-90 {   --bs-gutter-x:90px;  }  .ml-gy-90 {   --bs-gutter-y:90px;  }  .ml-gx-95 {   --bs-gutter-x:95px;  }  .ml-gy-95 {   --bs-gutter-y:95px;  }  .ml-gx-100 {   --bs-gutter-x:100px;  }  .ml-gy-100 {   --bs-gutter-y:100px;  }  .ml-gx-105 {   --bs-gutter-x:105px;  }  .ml-gy-105 {   --bs-gutter-y:105px;  }  .ml-gx-110 {   --bs-gutter-x:110px;  }  .ml-gy-110 {   --bs-gutter-y:110px;  }  .ml-gx-115 {   --bs-gutter-x:115px;  }  .ml-gy-115 {   --bs-gutter-y:115px;  }  .ml-gx-120 {   --bs-gutter-x:120px;  }  .ml-gy-120 {   --bs-gutter-y:120px;  }  .ml-gx-125 {   --bs-gutter-x:125px;  }  .ml-gy-125 {   --bs-gutter-y:125px;  }  .ml-gx-130 {   --bs-gutter-x:130px;  }  .ml-gy-130 {   --bs-gutter-y:130px;  }  .ml-gx-135 {   --bs-gutter-x:135px;  }  .ml-gy-135 {   --bs-gutter-y:135px;  }  .ml-gx-140 {   --bs-gutter-x:140px;  }  .ml-gy-140 {   --bs-gutter-y:140px;  }  .ml-gx-145 {   --bs-gutter-x:145px;  }  .ml-gy-145 {   --bs-gutter-y:145px;  }  .ml-gx-150 {   --bs-gutter-x:150px;  }  .ml-gy-150 {   --bs-gutter-y:150px;  } } @media (max-width:1299px) {  .xl-gx-5 {   --bs-gutter-x:5px;  }  .xl-gy-5 {   --bs-gutter-y:5px;  }  .xl-gx-10 {   --bs-gutter-x:10px;  }  .xl-gy-10 {   --bs-gutter-y:10px;  }  .xl-gx-15 {   --bs-gutter-x:15px;  }  .xl-gy-15 {   --bs-gutter-y:15px;  }  .xl-gx-20 {   --bs-gutter-x:20px;  }  .xl-gy-20 {   --bs-gutter-y:20px;  }  .xl-gx-25 {   --bs-gutter-x:25px;  }  .xl-gy-25 {   --bs-gutter-y:25px;  }  .xl-gx-30 {   --bs-gutter-x:30px;  }  .xl-gy-30 {   --bs-gutter-y:30px;  }  .xl-gx-35 {   --bs-gutter-x:35px;  }  .xl-gy-35 {   --bs-gutter-y:35px;  }  .xl-gx-40 {   --bs-gutter-x:40px;  }  .xl-gy-40 {   --bs-gutter-y:40px;  }  .xl-gx-45 {   --bs-gutter-x:45px;  }  .xl-gy-45 {   --bs-gutter-y:45px;  }  .xl-gx-50 {   --bs-gutter-x:50px;  }  .xl-gy-50 {   --bs-gutter-y:50px;  }  .xl-gx-55 {   --bs-gutter-x:55px;  }  .xl-gy-55 {   --bs-gutter-y:55px;  }  .xl-gx-60 {   --bs-gutter-x:60px;  }  .xl-gy-60 {   --bs-gutter-y:60px;  }  .xl-gx-65 {   --bs-gutter-x:65px;  }  .xl-gy-65 {   --bs-gutter-y:65px;  }  .xl-gx-70 {   --bs-gutter-x:70px;  }  .xl-gy-70 {   --bs-gutter-y:70px;  }  .xl-gx-75 {   --bs-gutter-x:75px;  }  .xl-gy-75 {   --bs-gutter-y:75px;  }  .xl-gx-80 {   --bs-gutter-x:80px;  }  .xl-gy-80 {   --bs-gutter-y:80px;  }  .xl-gx-85 {   --bs-gutter-x:85px;  }  .xl-gy-85 {   --bs-gutter-y:85px;  }  .xl-gx-90 {   --bs-gutter-x:90px;  }  .xl-gy-90 {   --bs-gutter-y:90px;  }  .xl-gx-95 {   --bs-gutter-x:95px;  }  .xl-gy-95 {   --bs-gutter-y:95px;  }  .xl-gx-100 {   --bs-gutter-x:100px;  }  .xl-gy-100 {   --bs-gutter-y:100px;  }  .xl-gx-105 {   --bs-gutter-x:105px;  }  .xl-gy-105 {   --bs-gutter-y:105px;  }  .xl-gx-110 {   --bs-gutter-x:110px;  }  .xl-gy-110 {   --bs-gutter-y:110px;  }  .xl-gx-115 {   --bs-gutter-x:115px;  }  .xl-gy-115 {   --bs-gutter-y:115px;  }  .xl-gx-120 {   --bs-gutter-x:120px;  }  .xl-gy-120 {   --bs-gutter-y:120px;  }  .xl-gx-125 {   --bs-gutter-x:125px;  }  .xl-gy-125 {   --bs-gutter-y:125px;  }  .xl-gx-130 {   --bs-gutter-x:130px;  }  .xl-gy-130 {   --bs-gutter-y:130px;  }  .xl-gx-135 {   --bs-gutter-x:135px;  }  .xl-gy-135 {   --bs-gutter-y:135px;  }  .xl-gx-140 {   --bs-gutter-x:140px;  }  .xl-gy-140 {   --bs-gutter-y:140px;  }  .xl-gx-145 {   --bs-gutter-x:145px;  }  .xl-gy-145 {   --bs-gutter-y:145px;  }  .xl-gx-150 {   --bs-gutter-x:150px;  }  .xl-gy-150 {   --bs-gutter-y:150px;  } } @media (max-width:1199px) {  .lg-gx-5 {   --bs-gutter-x:5px;  }  .lg-gy-5 {   --bs-gutter-y:5px;  }  .lg-gx-10 {   --bs-gutter-x:10px;  }  .lg-gy-10 {   --bs-gutter-y:10px;  }  .lg-gx-15 {   --bs-gutter-x:15px;  }  .lg-gy-15 {   --bs-gutter-y:15px;  }  .lg-gx-20 {   --bs-gutter-x:20px;  }  .lg-gy-20 {   --bs-gutter-y:20px;  }  .lg-gx-25 {   --bs-gutter-x:25px;  }  .lg-gy-25 {   --bs-gutter-y:25px;  }  .lg-gx-30 {   --bs-gutter-x:30px;  }  .lg-gy-30 {   --bs-gutter-y:30px;  }  .lg-gx-35 {   --bs-gutter-x:35px;  }  .lg-gy-35 {   --bs-gutter-y:35px;  }  .lg-gx-40 {   --bs-gutter-x:40px;  }  .lg-gy-40 {   --bs-gutter-y:40px;  }  .lg-gx-45 {   --bs-gutter-x:45px;  }  .lg-gy-45 {   --bs-gutter-y:45px;  }  .lg-gx-50 {   --bs-gutter-x:50px;  }  .lg-gy-50 {   --bs-gutter-y:50px;  }  .lg-gx-55 {   --bs-gutter-x:55px;  }  .lg-gy-55 {   --bs-gutter-y:55px;  }  .lg-gx-60 {   --bs-gutter-x:60px;  }  .lg-gy-60 {   --bs-gutter-y:60px;  }  .lg-gx-65 {   --bs-gutter-x:65px;  }  .lg-gy-65 {   --bs-gutter-y:65px;  }  .lg-gx-70 {   --bs-gutter-x:70px;  }  .lg-gy-70 {   --bs-gutter-y:70px;  }  .lg-gx-75 {   --bs-gutter-x:75px;  }  .lg-gy-75 {   --bs-gutter-y:75px;  }  .lg-gx-80 {   --bs-gutter-x:80px;  }  .lg-gy-80 {   --bs-gutter-y:80px;  }  .lg-gx-85 {   --bs-gutter-x:85px;  }  .lg-gy-85 {   --bs-gutter-y:85px;  }  .lg-gx-90 {   --bs-gutter-x:90px;  }  .lg-gy-90 {   --bs-gutter-y:90px;  }  .lg-gx-95 {   --bs-gutter-x:95px;  }  .lg-gy-95 {   --bs-gutter-y:95px;  }  .lg-gx-100 {   --bs-gutter-x:100px;  }  .lg-gy-100 {   --bs-gutter-y:100px;  }  .lg-gx-105 {   --bs-gutter-x:105px;  }  .lg-gy-105 {   --bs-gutter-y:105px;  }  .lg-gx-110 {   --bs-gutter-x:110px;  }  .lg-gy-110 {   --bs-gutter-y:110px;  }  .lg-gx-115 {   --bs-gutter-x:115px;  }  .lg-gy-115 {   --bs-gutter-y:115px;  }  .lg-gx-120 {   --bs-gutter-x:120px;  }  .lg-gy-120 {   --bs-gutter-y:120px;  }  .lg-gx-125 {   --bs-gutter-x:125px;  }  .lg-gy-125 {   --bs-gutter-y:125px;  }  .lg-gx-130 {   --bs-gutter-x:130px;  }  .lg-gy-130 {   --bs-gutter-y:130px;  }  .lg-gx-135 {   --bs-gutter-x:135px;  }  .lg-gy-135 {   --bs-gutter-y:135px;  }  .lg-gx-140 {   --bs-gutter-x:140px;  }  .lg-gy-140 {   --bs-gutter-y:140px;  }  .lg-gx-145 {   --bs-gutter-x:145px;  }  .lg-gy-145 {   --bs-gutter-y:145px;  }  .lg-gx-150 {   --bs-gutter-x:150px;  }  .lg-gy-150 {   --bs-gutter-y:150px;  } } @media (max-width:991px) {  .md-gx-5 {   --bs-gutter-x:5px;  }  .md-gy-5 {   --bs-gutter-y:5px;  }  .md-gx-10 {   --bs-gutter-x:10px;  }  .md-gy-10 {   --bs-gutter-y:10px;  }  .md-gx-15 {   --bs-gutter-x:15px;  }  .md-gy-15 {   --bs-gutter-y:15px;  }  .md-gx-20 {   --bs-gutter-x:20px;  }  .md-gy-20 {   --bs-gutter-y:20px;  }  .md-gx-25 {   --bs-gutter-x:25px;  }  .md-gy-25 {   --bs-gutter-y:25px;  }  .md-gx-30 {   --bs-gutter-x:30px;  }  .md-gy-30 {   --bs-gutter-y:30px;  }  .md-gx-35 {   --bs-gutter-x:35px;  }  .md-gy-35 {   --bs-gutter-y:35px;  }  .md-gx-40 {   --bs-gutter-x:40px;  }  .md-gy-40 {   --bs-gutter-y:40px;  }  .md-gx-45 {   --bs-gutter-x:45px;  }  .md-gy-45 {   --bs-gutter-y:45px;  }  .md-gx-50 {   --bs-gutter-x:50px;  }  .md-gy-50 {   --bs-gutter-y:50px;  }  .md-gx-55 {   --bs-gutter-x:55px;  }  .md-gy-55 {   --bs-gutter-y:55px;  }  .md-gx-60 {   --bs-gutter-x:60px;  }  .md-gy-60 {   --bs-gutter-y:60px;  }  .md-gx-65 {   --bs-gutter-x:65px;  }  .md-gy-65 {   --bs-gutter-y:65px;  }  .md-gx-70 {   --bs-gutter-x:70px;  }  .md-gy-70 {   --bs-gutter-y:70px;  }  .md-gx-75 {   --bs-gutter-x:75px;  }  .md-gy-75 {   --bs-gutter-y:75px;  }  .md-gx-80 {   --bs-gutter-x:80px;  }  .md-gy-80 {   --bs-gutter-y:80px;  }  .md-gx-85 {   --bs-gutter-x:85px;  }  .md-gy-85 {   --bs-gutter-y:85px;  }  .md-gx-90 {   --bs-gutter-x:90px;  }  .md-gy-90 {   --bs-gutter-y:90px;  }  .md-gx-95 {   --bs-gutter-x:95px;  }  .md-gy-95 {   --bs-gutter-y:95px;  }  .md-gx-100 {   --bs-gutter-x:100px;  }  .md-gy-100 {   --bs-gutter-y:100px;  }  .md-gx-105 {   --bs-gutter-x:105px;  }  .md-gy-105 {   --bs-gutter-y:105px;  }  .md-gx-110 {   --bs-gutter-x:110px;  }  .md-gy-110 {   --bs-gutter-y:110px;  }  .md-gx-115 {   --bs-gutter-x:115px;  }  .md-gy-115 {   --bs-gutter-y:115px;  }  .md-gx-120 {   --bs-gutter-x:120px;  }  .md-gy-120 {   --bs-gutter-y:120px;  }  .md-gx-125 {   --bs-gutter-x:125px;  }  .md-gy-125 {   --bs-gutter-y:125px;  }  .md-gx-130 {   --bs-gutter-x:130px;  }  .md-gy-130 {   --bs-gutter-y:130px;  }  .md-gx-135 {   --bs-gutter-x:135px;  }  .md-gy-135 {   --bs-gutter-y:135px;  }  .md-gx-140 {   --bs-gutter-x:140px;  }  .md-gy-140 {   --bs-gutter-y:140px;  }  .md-gx-145 {   --bs-gutter-x:145px;  }  .md-gy-145 {   --bs-gutter-y:145px;  }  .md-gx-150 {   --bs-gutter-x:150px;  }  .md-gy-150 {   --bs-gutter-y:150px;  } } @media (max-width:767px) {  .sm-gx-5 {   --bs-gutter-x:5px;  }  .sm-gy-5 {   --bs-gutter-y:5px;  }  .sm-gx-10 {   --bs-gutter-x:10px;  }  .sm-gy-10 {   --bs-gutter-y:10px;  }  .sm-gx-15 {   --bs-gutter-x:15px;  }  .sm-gy-15 {   --bs-gutter-y:15px;  }  .sm-gx-20 {   --bs-gutter-x:20px;  }  .sm-gy-20 {   --bs-gutter-y:20px;  }  .sm-gx-25 {   --bs-gutter-x:25px;  }  .sm-gy-25 {   --bs-gutter-y:25px;  }  .sm-gx-30 {   --bs-gutter-x:30px;  }  .sm-gy-30 {   --bs-gutter-y:30px;  }  .sm-gx-35 {   --bs-gutter-x:35px;  }  .sm-gy-35 {   --bs-gutter-y:35px;  }  .sm-gx-40 {   --bs-gutter-x:40px;  }  .sm-gy-40 {   --bs-gutter-y:40px;  }  .sm-gx-45 {   --bs-gutter-x:45px;  }  .sm-gy-45 {   --bs-gutter-y:45px;  }  .sm-gx-50 {   --bs-gutter-x:50px;  }  .sm-gy-50 {   --bs-gutter-y:50px;  }  .sm-gx-55 {   --bs-gutter-x:55px;  }  .sm-gy-55 {   --bs-gutter-y:55px;  }  .sm-gx-60 {   --bs-gutter-x:60px;  }  .sm-gy-60 {   --bs-gutter-y:60px;  }  .sm-gx-65 {   --bs-gutter-x:65px;  }  .sm-gy-65 {   --bs-gutter-y:65px;  }  .sm-gx-70 {   --bs-gutter-x:70px;  }  .sm-gy-70 {   --bs-gutter-y:70px;  }  .sm-gx-75 {   --bs-gutter-x:75px;  }  .sm-gy-75 {   --bs-gutter-y:75px;  }  .sm-gx-80 {   --bs-gutter-x:80px;  }  .sm-gy-80 {   --bs-gutter-y:80px;  }  .sm-gx-85 {   --bs-gutter-x:85px;  }  .sm-gy-85 {   --bs-gutter-y:85px;  }  .sm-gx-90 {   --bs-gutter-x:90px;  }  .sm-gy-90 {   --bs-gutter-y:90px;  }  .sm-gx-95 {   --bs-gutter-x:95px;  }  .sm-gy-95 {   --bs-gutter-y:95px;  }  .sm-gx-100 {   --bs-gutter-x:100px;  }  .sm-gy-100 {   --bs-gutter-y:100px;  }  .sm-gx-105 {   --bs-gutter-x:105px;  }  .sm-gy-105 {   --bs-gutter-y:105px;  }  .sm-gx-110 {   --bs-gutter-x:110px;  }  .sm-gy-110 {   --bs-gutter-y:110px;  }  .sm-gx-115 {   --bs-gutter-x:115px;  }  .sm-gy-115 {   --bs-gutter-y:115px;  }  .sm-gx-120 {   --bs-gutter-x:120px;  }  .sm-gy-120 {   --bs-gutter-y:120px;  }  .sm-gx-125 {   --bs-gutter-x:125px;  }  .sm-gy-125 {   --bs-gutter-y:125px;  }  .sm-gx-130 {   --bs-gutter-x:130px;  }  .sm-gy-130 {   --bs-gutter-y:130px;  }  .sm-gx-135 {   --bs-gutter-x:135px;  }  .sm-gy-135 {   --bs-gutter-y:135px;  }  .sm-gx-140 {   --bs-gutter-x:140px;  }  .sm-gy-140 {   --bs-gutter-y:140px;  }  .sm-gx-145 {   --bs-gutter-x:145px;  }  .sm-gy-145 {   --bs-gutter-y:145px;  }  .sm-gx-150 {   --bs-gutter-x:150px;  }  .sm-gy-150 {   --bs-gutter-y:150px;  } } .space, .space-top {  padding-top:var(--section-space); } .space, .space-bottom {  padding-bottom:var(--section-space); } .space-minimize, .space-minimize-top {  padding-top:calc(var(--section-space) - 26px); } .space-minimize, .space-minimize-bottom {  padding-bottom:var(--section-space); } .space-extra, .space-extra-top {  padding-top:calc(var(--section-space) - 30px); } .space-extra, .space-extra-bottom {  padding-bottom:calc(var(--section-space) - 30px); } .space-extra2, .space-extra2-top {  padding-top:calc(var(--section-space) - 40px); } .space-extra2, .space-extra2-bottom {  padding-bottom:calc(var(--section-space) - 40px); }  @media (max-width:1199px) {  .space,  .space-top {   padding-top:calc(var(--section-space) - 30px);  }  .space,  .space-bottom {   padding-bottom:calc(var(--section-space) - 30px);  } } @media (max-width:991px) {  .space,  .space-top {   padding-top:var(--section-space-mobile);  }  .space,  .space-bottom {   padding-bottom:var(--section-space-mobile);  }  .space-minimize,  .space-minimize-top {   padding-top:calc(var(--section-space-mobile) - 22px);  }  .space-minimize,  .space-minimize-bottom {   padding-bottom:var(--section-space-mobile);  }  .space-extra,  .space-extra-top {   padding-top:calc(var(--section-space-mobile) - 30px);  }  .space-extra,  .space-extra-bottom {   padding-bottom:calc(var(--section-space-mobile) - 30px);  }  .space-top-md-none {   padding-top:0;  }  .space-extra2,  .space-extra2-top {   padding-top:70px;  }  .space-extra2,  .space-extra2-bottom {   padding-bottom:70px;  }  .pb-105 {   padding-bottom:65px;  }  .pt-105 {   padding-top:65px;  } } @media (max-width:375px) {  .space,  .space-top {   padding-top:var(--section-space-small-mobile);  }  .space,  .space-bottom {   padding-bottom:var(--section-space-small-mobile);  }  .space-minimize,  .space-minimize-top {   padding-top:calc(var(--section-space-small-mobile) - 22px);  }  .space-minimize,  .space-minimize-bottom {   padding-bottom:var(--section-space-small-mobile);  }  .space-extra,  .space-extra-top {   padding-top:calc(var(--section-space-mobile) - 30px);  }  .space-extra,  .space-extra-bottom {   padding-bottom:calc(var(--section-space-mobile) - 30px);  }  .space-top-md-none {   padding-top:0;  }  .space-extra2,  .space-extra2-top {   padding-top:70px;  }  .space-extra2,  .space-extra2-bottom {   padding-bottom:70px;  } } .space-tm-5 {  padding-top:calc(var(--section-space) - 5px) !important; } .space-bm-5 {  padding-bottom:calc(var(--section-space) - 5px) !important; } .space-tp-5 {  padding-top:calc(var(--section-space) + 5px) !important; } .space-bp-5 {  padding-bottom:calc(var(--section-space) + 5px) !important; } .space-tm-10 {  padding-top:calc(var(--section-space) - 10px) !important; } .space-bm-10 {  padding-bottom:calc(var(--section-space) - 10px) !important; } .space-tp-10 {  padding-top:calc(var(--section-space) + 10px) !important; } .space-bp-10 {  padding-bottom:calc(var(--section-space) + 10px) !important; } .space-tm-15 {  padding-top:calc(var(--section-space) - 15px) !important; } .space-bm-15 {  padding-bottom:calc(var(--section-space) - 15px) !important; } .space-tp-15 {  padding-top:calc(var(--section-space) + 15px) !important; } .space-bp-15 {  padding-bottom:calc(var(--section-space) + 15px) !important; } .space-tm-20 {  padding-top:calc(var(--section-space) - 20px) !important; } .space-bm-20 {  padding-bottom:calc(var(--section-space) - 20px) !important; } .space-tp-20 {  padding-top:calc(var(--section-space) + 20px) !important; } .space-bp-20 {  padding-bottom:calc(var(--section-space) + 20px) !important; } .space-tm-25 {  padding-top:calc(var(--section-space) - 25px) !important; } .space-bm-25 {  padding-bottom:calc(var(--section-space) - 25px) !important; } .space-tp-25 {  padding-top:calc(var(--section-space) + 25px) !important; } .space-bp-25 {  padding-bottom:calc(var(--section-space) + 25px) !important; } .space-tm-30 {  padding-top:calc(var(--section-space) - 30px) !important; } .space-bm-30 {  padding-bottom:calc(var(--section-space) - 30px) !important; } .space-tp-30 {  padding-top:calc(var(--section-space) + 30px) !important; } .space-bp-30 {  padding-bottom:calc(var(--section-space) + 30px) !important; } .space-tm-35 {  padding-top:calc(var(--section-space) - 35px) !important; } .space-bm-35 {  padding-bottom:calc(var(--section-space) - 35px) !important; } .space-tp-35 {  padding-top:calc(var(--section-space) + 35px) !important; } .space-bp-35 {  padding-bottom:calc(var(--section-space) + 35px) !important; } .space-tm-40 {  padding-top:calc(var(--section-space) - 40px) !important; } .space-bm-40 {  padding-bottom:calc(var(--section-space) - 40px) !important; } .space-tp-40 {  padding-top:calc(var(--section-space) + 40px) !important; } .space-bp-40 {  padding-bottom:calc(var(--section-space) + 40px) !important; } .space-tm-45 {  padding-top:calc(var(--section-space) - 45px) !important; } .space-bm-45 {  padding-bottom:calc(var(--section-space) - 45px) !important; } .space-tp-45 {  padding-top:calc(var(--section-space) + 45px) !important; } .space-bp-45 {  padding-bottom:calc(var(--section-space) + 45px) !important; } .space-tm-50 {  padding-top:calc(var(--section-space) - 50px) !important; } .space-bm-50 {  padding-bottom:calc(var(--section-space) - 50px) !important; } .space-tp-50 {  padding-top:calc(var(--section-space) + 50px) !important; } .space-bp-50 {  padding-bottom:calc(var(--section-space) + 50px) !important; } .space-tm-55 {  padding-top:calc(var(--section-space) - 55px) !important; } .space-bm-55 {  padding-bottom:calc(var(--section-space) - 55px) !important; } .space-tp-55 {  padding-top:calc(var(--section-space) + 55px) !important; } .space-bp-55 {  padding-bottom:calc(var(--section-space) + 55px) !important; } .space-tm-60 {  padding-top:calc(var(--section-space) - 60px) !important; } .space-bm-60 {  padding-bottom:calc(var(--section-space) - 60px) !important; } .space-tp-60 {  padding-top:calc(var(--section-space) + 60px) !important; } .space-bp-60 {  padding-bottom:calc(var(--section-space) + 60px) !important; } .space-tm-65 {  padding-top:calc(var(--section-space) - 65px) !important; } .space-bm-65 {  padding-bottom:calc(var(--section-space) - 65px) !important; } .space-tp-65 {  padding-top:calc(var(--section-space) + 65px) !important; } .space-bp-65 {  padding-bottom:calc(var(--section-space) + 65px) !important; } .space-tm-70 {  padding-top:calc(var(--section-space) - 70px) !important; } .space-bm-70 {  padding-bottom:calc(var(--section-space) - 70px) !important; } .space-tp-70 {  padding-top:calc(var(--section-space) + 70px) !important; } .space-bp-70 {  padding-bottom:calc(var(--section-space) + 70px) !important; } .space-tm-75 {  padding-top:calc(var(--section-space) - 75px) !important; } .space-bm-75 {  padding-bottom:calc(var(--section-space) - 75px) !important; } .space-tp-75 {  padding-top:calc(var(--section-space) + 75px) !important; } .space-bp-75 {  padding-bottom:calc(var(--section-space) + 75px) !important; } .space-tm-80 {  padding-top:calc(var(--section-space) - 80px) !important; } .space-bm-80 {  padding-bottom:calc(var(--section-space) - 80px) !important; } .space-tp-80 {  padding-top:calc(var(--section-space) + 80px) !important; } .space-bp-80 {  padding-bottom:calc(var(--section-space) + 80px) !important; } .space-tm-85 {  padding-top:calc(var(--section-space) - 85px) !important; } .space-bm-85 {  padding-bottom:calc(var(--section-space) - 85px) !important; } .space-tp-85 {  padding-top:calc(var(--section-space) + 85px) !important; } .space-bp-85 {  padding-bottom:calc(var(--section-space) + 85px) !important; } .space-tm-90 {  padding-top:calc(var(--section-space) - 90px) !important; } .space-bm-90 {  padding-bottom:calc(var(--section-space) - 90px) !important; } .space-tp-90 {  padding-top:calc(var(--section-space) + 90px) !important; } .space-bp-90 {  padding-bottom:calc(var(--section-space) + 90px) !important; } .space-tm-95 {  padding-top:calc(var(--section-space) - 95px) !important; } .space-bm-95 {  padding-bottom:calc(var(--section-space) - 95px) !important; } .space-tp-95 {  padding-top:calc(var(--section-space) + 95px) !important; } .space-bp-95 {  padding-bottom:calc(var(--section-space) + 95px) !important; } .space-tm-100 {  padding-top:calc(var(--section-space) - 100px) !important; } .space-bm-100 {  padding-bottom:calc(var(--section-space) - 100px) !important; } .space-tp-100 {  padding-top:calc(var(--section-space) + 100px) !important; } .space-bp-100 {  padding-bottom:calc(var(--section-space) + 100px) !important; } .space-tm-105 {  padding-top:calc(var(--section-space) - 105px) !important; } .space-bm-105 {  padding-bottom:calc(var(--section-space) - 105px) !important; } .space-tp-105 {  padding-top:calc(var(--section-space) + 105px) !important; } .space-bp-105 {  padding-bottom:calc(var(--section-space) + 105px) !important; } .space-tm-110 {  padding-top:calc(var(--section-space) - 110px) !important; } .space-bm-110 {  padding-bottom:calc(var(--section-space) - 110px) !important; } .space-tp-110 {  padding-top:calc(var(--section-space) + 110px) !important; } .space-bp-110 {  padding-bottom:calc(var(--section-space) + 110px) !important; } .space-tm-115 {  padding-top:calc(var(--section-space) - 115px) !important; } .space-bm-115 {  padding-bottom:calc(var(--section-space) - 115px) !important; } .space-tp-115 {  padding-top:calc(var(--section-space) + 115px) !important; } .space-bp-115 {  padding-bottom:calc(var(--section-space) + 115px) !important; } .space-tm-120 {  padding-top:calc(var(--section-space) - 120px) !important; } .space-bm-120 {  padding-bottom:calc(var(--section-space) - 120px) !important; } .space-tp-120 {  padding-top:calc(var(--section-space) + 120px) !important; } .space-bp-120 {  padding-bottom:calc(var(--section-space) + 120px) !important; } .space-tm-125 {  padding-top:calc(var(--section-space) - 125px) !important; } .space-bm-125 {  padding-bottom:calc(var(--section-space) - 125px) !important; } .space-tp-125 {  padding-top:calc(var(--section-space) + 125px) !important; } .space-bp-125 {  padding-bottom:calc(var(--section-space) + 125px) !important; } .space-tm-130 {  padding-top:calc(var(--section-space) - 130px) !important; } .space-bm-130 {  padding-bottom:calc(var(--section-space) - 130px) !important; } .space-tp-130 {  padding-top:calc(var(--section-space) + 130px) !important; } .space-bp-130 {  padding-bottom:calc(var(--section-space) + 130px) !important; } .space-tm-135 {  padding-top:calc(var(--section-space) - 135px) !important; } .space-bm-135 {  padding-bottom:calc(var(--section-space) - 135px) !important; } .space-tp-135 {  padding-top:calc(var(--section-space) + 135px) !important; } .space-bp-135 {  padding-bottom:calc(var(--section-space) + 135px) !important; } .space-tm-140 {  padding-top:calc(var(--section-space) - 140px) !important; } .space-bm-140 {  padding-bottom:calc(var(--section-space) - 140px) !important; } .space-tp-140 {  padding-top:calc(var(--section-space) + 140px) !important; } .space-bp-140 {  padding-bottom:calc(var(--section-space) + 140px) !important; } .space-tm-145 {  padding-top:calc(var(--section-space) - 145px) !important; } .space-bm-145 {  padding-bottom:calc(var(--section-space) - 145px) !important; } .space-tp-145 {  padding-top:calc(var(--section-space) + 145px) !important; } .space-bp-145 {  padding-bottom:calc(var(--section-space) + 145px) !important; } .space-tm-150 {  padding-top:calc(var(--section-space) - 150px) !important; } .space-bm-150 {  padding-bottom:calc(var(--section-space) - 150px) !important; } .space-tp-150 {  padding-top:calc(var(--section-space) + 150px) !important; } .space-bp-150 {  padding-bottom:calc(var(--section-space) + 150px) !important; } .space-tm-155 {  padding-top:calc(var(--section-space) - 155px) !important; } .space-bm-155 {  padding-bottom:calc(var(--section-space) - 155px) !important; } .space-tp-155 {  padding-top:calc(var(--section-space) + 155px) !important; } .space-bp-155 {  padding-bottom:calc(var(--section-space) + 155px) !important; } .space-tm-160 {  padding-top:calc(var(--section-space) - 160px) !important; } .space-bm-160 {  padding-bottom:calc(var(--section-space) - 160px) !important; } .space-tp-160 {  padding-top:calc(var(--section-space) + 160px) !important; } .space-bp-160 {  padding-bottom:calc(var(--section-space) + 160px) !important; } .space-tm-165 {  padding-top:calc(var(--section-space) - 165px) !important; } .space-bm-165 {  padding-bottom:calc(var(--section-space) - 165px) !important; } .space-tp-165 {  padding-top:calc(var(--section-space) + 165px) !important; } .space-bp-165 {  padding-bottom:calc(var(--section-space) + 165px) !important; } .space-tm-170 {  padding-top:calc(var(--section-space) - 170px) !important; } .space-bm-170 {  padding-bottom:calc(var(--section-space) - 170px) !important; } .space-tp-170 {  padding-top:calc(var(--section-space) + 170px) !important; } .space-bp-170 {  padding-bottom:calc(var(--section-space) + 170px) !important; } .space-tm-175 {  padding-top:calc(var(--section-space) - 175px) !important; } .space-bm-175 {  padding-bottom:calc(var(--section-space) - 175px) !important; } .space-tp-175 {  padding-top:calc(var(--section-space) + 175px) !important; } .space-bp-175 {  padding-bottom:calc(var(--section-space) + 175px) !important; } .space-tm-180 {  padding-top:calc(var(--section-space) - 180px) !important; } .space-bm-180 {  padding-bottom:calc(var(--section-space) - 180px) !important; } .space-tp-180 {  padding-top:calc(var(--section-space) + 180px) !important; } .space-bp-180 {  padding-bottom:calc(var(--section-space) + 180px) !important; } .space-tm-185 {  padding-top:calc(var(--section-space) - 185px) !important; } .space-bm-185 {  padding-bottom:calc(var(--section-space) - 185px) !important; } .space-tp-185 {  padding-top:calc(var(--section-space) + 185px) !important; } .space-bp-185 {  padding-bottom:calc(var(--section-space) + 185px) !important; } .space-tm-190 {  padding-top:calc(var(--section-space) - 190px) !important; } .space-bm-190 {  padding-bottom:calc(var(--section-space) - 190px) !important; } .space-tp-190 {  padding-top:calc(var(--section-space) + 190px) !important; } .space-bp-190 {  padding-bottom:calc(var(--section-space) + 190px) !important; } .space-tm-195 {  padding-top:calc(var(--section-space) - 195px) !important; } .space-bm-195 {  padding-bottom:calc(var(--section-space) - 195px) !important; } .space-tp-195 {  padding-top:calc(var(--section-space) + 195px) !important; } .space-bp-195 {  padding-bottom:calc(var(--section-space) + 195px) !important; } .space-tm-200 {  padding-top:calc(var(--section-space) - 200px) !important; } .space-bm-200 {  padding-bottom:calc(var(--section-space) - 200px) !important; } .space-tp-200 {  padding-top:calc(var(--section-space) + 200px) !important; } .space-bp-200 {  padding-bottom:calc(var(--section-space) + 200px) !important; } .space-tm-205 {  padding-top:calc(var(--section-space) - 205px) !important; } .space-bm-205 {  padding-bottom:calc(var(--section-space) - 205px) !important; } .space-tp-205 {  padding-top:calc(var(--section-space) + 205px) !important; } .space-bp-205 {  padding-bottom:calc(var(--section-space) + 205px) !important; } .space-tm-210 {  padding-top:calc(var(--section-space) - 210px) !important; } .space-bm-210 {  padding-bottom:calc(var(--section-space) - 210px) !important; } .space-tp-210 {  padding-top:calc(var(--section-space) + 210px) !important; } .space-bp-210 {  padding-bottom:calc(var(--section-space) + 210px) !important; } .space-tm-215 {  padding-top:calc(var(--section-space) - 215px) !important; } .space-bm-215 {  padding-bottom:calc(var(--section-space) - 215px) !important; } .space-tp-215 {  padding-top:calc(var(--section-space) + 215px) !important; } .space-bp-215 {  padding-bottom:calc(var(--section-space) + 215px) !important; } .space-tm-220 {  padding-top:calc(var(--section-space) - 220px) !important; } .space-bm-220 {  padding-bottom:calc(var(--section-space) - 220px) !important; } .space-tp-220 {  padding-top:calc(var(--section-space) + 220px) !important; } .space-bp-220 {  padding-bottom:calc(var(--section-space) + 220px) !important; } .space-tm-225 {  padding-top:calc(var(--section-space) - 225px) !important; } .space-bm-225 {  padding-bottom:calc(var(--section-space) - 225px) !important; } .space-tp-225 {  padding-top:calc(var(--section-space) + 225px) !important; } .space-bp-225 {  padding-bottom:calc(var(--section-space) + 225px) !important; } .space-tm-230 {  padding-top:calc(var(--section-space) - 230px) !important; } .space-bm-230 {  padding-bottom:calc(var(--section-space) - 230px) !important; } .space-tp-230 {  padding-top:calc(var(--section-space) + 230px) !important; } .space-bp-230 {  padding-bottom:calc(var(--section-space) + 230px) !important; } .space-tm-235 {  padding-top:calc(var(--section-space) - 235px) !important; } .space-bm-235 {  padding-bottom:calc(var(--section-space) - 235px) !important; } .space-tp-235 {  padding-top:calc(var(--section-space) + 235px) !important; } .space-bp-235 {  padding-bottom:calc(var(--section-space) + 235px) !important; } .space-tm-240 {  padding-top:calc(var(--section-space) - 240px) !important; } .space-bm-240 {  padding-bottom:calc(var(--section-space) - 240px) !important; } .space-tp-240 {  padding-top:calc(var(--section-space) + 240px) !important; } .space-bp-240 {  padding-bottom:calc(var(--section-space) + 240px) !important; } .space-tm-245 {  padding-top:calc(var(--section-space) - 245px) !important; } .space-bm-245 {  padding-bottom:calc(var(--section-space) - 245px) !important; } .space-tp-245 {  padding-top:calc(var(--section-space) + 245px) !important; } .space-bp-245 {  padding-bottom:calc(var(--section-space) + 245px) !important; } .space-tm-250 {  padding-top:calc(var(--section-space) - 250px) !important; } .space-bm-250 {  padding-bottom:calc(var(--section-space) - 250px) !important; } .space-tp-250 {  padding-top:calc(var(--section-space) + 250px) !important; } .space-bp-250 {  padding-bottom:calc(var(--section-space) + 250px) !important; } .space-tm-255 {  padding-top:calc(var(--section-space) - 255px) !important; } .space-bm-255 {  padding-bottom:calc(var(--section-space) - 255px) !important; } .space-tp-255 {  padding-top:calc(var(--section-space) + 255px) !important; } .space-bp-255 {  padding-bottom:calc(var(--section-space) + 255px) !important; } .space-tm-260 {  padding-top:calc(var(--section-space) - 260px) !important; } .space-bm-260 {  padding-bottom:calc(var(--section-space) - 260px) !important; } .space-tp-260 {  padding-top:calc(var(--section-space) + 260px) !important; } .space-bp-260 {  padding-bottom:calc(var(--section-space) + 260px) !important; } .space-tm-265 {  padding-top:calc(var(--section-space) - 265px) !important; } .space-bm-265 {  padding-bottom:calc(var(--section-space) - 265px) !important; } .space-tp-265 {  padding-top:calc(var(--section-space) + 265px) !important; } .space-bp-265 {  padding-bottom:calc(var(--section-space) + 265px) !important; } .space-tm-270 {  padding-top:calc(var(--section-space) - 270px) !important; } .space-bm-270 {  padding-bottom:calc(var(--section-space) - 270px) !important; } .space-tp-270 {  padding-top:calc(var(--section-space) + 270px) !important; } .space-bp-270 {  padding-bottom:calc(var(--section-space) + 270px) !important; } .space-tm-275 {  padding-top:calc(var(--section-space) - 275px) !important; } .space-bm-275 {  padding-bottom:calc(var(--section-space) - 275px) !important; } .space-tp-275 {  padding-top:calc(var(--section-space) + 275px) !important; } .space-bp-275 {  padding-bottom:calc(var(--section-space) + 275px) !important; } .space-tm-280 {  padding-top:calc(var(--section-space) - 280px) !important; } .space-bm-280 {  padding-bottom:calc(var(--section-space) - 280px) !important; } .space-tp-280 {  padding-top:calc(var(--section-space) + 280px) !important; } .space-bp-280 {  padding-bottom:calc(var(--section-space) + 280px) !important; } .space-tm-285 {  padding-top:calc(var(--section-space) - 285px) !important; } .space-bm-285 {  padding-bottom:calc(var(--section-space) - 285px) !important; } .space-tp-285 {  padding-top:calc(var(--section-space) + 285px) !important; } .space-bp-285 {  padding-bottom:calc(var(--section-space) + 285px) !important; } .space-tm-290 {  padding-top:calc(var(--section-space) - 290px) !important; } .space-bm-290 {  padding-bottom:calc(var(--section-space) - 290px) !important; } .space-tp-290 {  padding-top:calc(var(--section-space) + 290px) !important; } .space-bp-290 {  padding-bottom:calc(var(--section-space) + 290px) !important; } .space-tm-295 {  padding-top:calc(var(--section-space) - 295px) !important; } .space-bm-295 {  padding-bottom:calc(var(--section-space) - 295px) !important; } .space-tp-295 {  padding-top:calc(var(--section-space) + 295px) !important; } .space-bp-295 {  padding-bottom:calc(var(--section-space) + 295px) !important; } .space-tm-300 {  padding-top:calc(var(--section-space) - 300px) !important; } .space-bm-300 {  padding-bottom:calc(var(--section-space) - 300px) !important; } .space-tp-300 {  padding-top:calc(var(--section-space) + 300px) !important; } .space-bp-300 {  padding-bottom:calc(var(--section-space) + 300px) !important; }  @media (max-width:991px) {  .space-tm-5 {   padding-top:calc(var(--section-space-mobile) - 5px) !important;  }  .space-bm-5 {   padding-bottom:calc(var(--section-space-mobile) - 5px) !important;  }  .space-tp-5 {   padding-top:calc(var(--section-space-mobile) + 5px) !important;  }  .space-bp-5 {   padding-bottom:calc(var(--section-space-mobile) + 5px) !important;  }  .space-tm-10 {   padding-top:calc(var(--section-space-mobile) - 10px) !important;  }  .space-bm-10 {   padding-bottom:calc(var(--section-space-mobile) - 10px) !important;  }  .space-tp-10 {   padding-top:calc(var(--section-space-mobile) + 10px) !important;  }  .space-bp-10 {   padding-bottom:calc(var(--section-space-mobile) + 10px) !important;  }  .space-tm-15 {   padding-top:calc(var(--section-space-mobile) - 15px) !important;  }  .space-bm-15 {   padding-bottom:calc(var(--section-space-mobile) - 15px) !important;  }  .space-tp-15 {   padding-top:calc(var(--section-space-mobile) + 15px) !important;  }  .space-bp-15 {   padding-bottom:calc(var(--section-space-mobile) + 15px) !important;  }  .space-tm-20 {   padding-top:calc(var(--section-space-mobile) - 20px) !important;  }  .space-bm-20 {   padding-bottom:calc(var(--section-space-mobile) - 20px) !important;  }  .space-tp-20 {   padding-top:calc(var(--section-space-mobile) + 20px) !important;  }  .space-bp-20 {   padding-bottom:calc(var(--section-space-mobile) + 20px) !important;  }  .space-tm-25 {   padding-top:calc(var(--section-space-mobile) - 25px) !important;  }  .space-bm-25 {   padding-bottom:calc(var(--section-space-mobile) - 25px) !important;  }  .space-tp-25 {   padding-top:calc(var(--section-space-mobile) + 25px) !important;  }  .space-bp-25 {   padding-bottom:calc(var(--section-space-mobile) + 25px) !important;  }  .space-tm-30 {   padding-top:calc(var(--section-space-mobile) - 30px) !important;  }  .space-bm-30 {   padding-bottom:calc(var(--section-space-mobile) - 30px) !important;  }  .space-tp-30 {   padding-top:calc(var(--section-space-mobile) + 30px) !important;  }  .space-bp-30 {   padding-bottom:calc(var(--section-space-mobile) + 30px) !important;  }  .space-tm-35 {   padding-top:calc(var(--section-space-mobile) - 35px) !important;  }  .space-bm-35 {   padding-bottom:calc(var(--section-space-mobile) - 35px) !important;  }  .space-tp-35 {   padding-top:calc(var(--section-space-mobile) + 35px) !important;  }  .space-bp-35 {   padding-bottom:calc(var(--section-space-mobile) + 35px) !important;  }  .space-tm-40 {   padding-top:calc(var(--section-space-mobile) - 40px) !important;  }  .space-bm-40 {   padding-bottom:calc(var(--section-space-mobile) - 40px) !important;  }  .space-tp-40 {   padding-top:calc(var(--section-space-mobile) + 40px) !important;  }  .space-bp-40 {   padding-bottom:calc(var(--section-space-mobile) + 40px) !important;  }  .space-tm-45 {   padding-top:calc(var(--section-space-mobile) - 45px) !important;  }  .space-bm-45 {   padding-bottom:calc(var(--section-space-mobile) - 45px) !important;  }  .space-tp-45 {   padding-top:calc(var(--section-space-mobile) + 45px) !important;  }  .space-bp-45 {   padding-bottom:calc(var(--section-space-mobile) + 45px) !important;  }  .space-tm-50 {   padding-top:calc(var(--section-space-mobile) - 50px) !important;  }  .space-bm-50 {   padding-bottom:calc(var(--section-space-mobile) - 50px) !important;  }  .space-tp-50 {   padding-top:calc(var(--section-space-mobile) + 50px) !important;  }  .space-bp-50 {   padding-bottom:calc(var(--section-space-mobile) + 50px) !important;  }  .space-tm-55 {   padding-top:calc(var(--section-space-mobile) - 55px) !important;  }  .space-bm-55 {   padding-bottom:calc(var(--section-space-mobile) - 55px) !important;  }  .space-tp-55 {   padding-top:calc(var(--section-space-mobile) + 55px) !important;  }  .space-bp-55 {   padding-bottom:calc(var(--section-space-mobile) + 55px) !important;  }  .space-tm-60 {   padding-top:calc(var(--section-space-mobile) - 60px) !important;  }  .space-bm-60 {   padding-bottom:calc(var(--section-space-mobile) - 60px) !important;  }  .space-tp-60 {   padding-top:calc(var(--section-space-mobile) + 60px) !important;  }  .space-bp-60 {   padding-bottom:calc(var(--section-space-mobile) + 60px) !important;  }  .space-tm-65 {   padding-top:calc(var(--section-space-mobile) - 65px) !important;  }  .space-bm-65 {   padding-bottom:calc(var(--section-space-mobile) - 65px) !important;  }  .space-tp-65 {   padding-top:calc(var(--section-space-mobile) + 65px) !important;  }  .space-bp-65 {   padding-bottom:calc(var(--section-space-mobile) + 65px) !important;  }  .space-tm-70 {   padding-top:calc(var(--section-space-mobile) - 70px) !important;  }  .space-bm-70 {   padding-bottom:calc(var(--section-space-mobile) - 70px) !important;  }  .space-tp-70 {   padding-top:calc(var(--section-space-mobile) + 70px) !important;  }  .space-bp-70 {   padding-bottom:calc(var(--section-space-mobile) + 70px) !important;  }  .space-tm-75 {   padding-top:calc(var(--section-space-mobile) - 75px) !important;  }  .space-bm-75 {   padding-bottom:calc(var(--section-space-mobile) - 75px) !important;  }  .space-tp-75 {   padding-top:calc(var(--section-space-mobile) + 75px) !important;  }  .space-bp-75 {   padding-bottom:calc(var(--section-space-mobile) + 75px) !important;  }  .space-tm-80 {   padding-top:calc(var(--section-space-mobile) - 80px) !important;  }  .space-bm-80 {   padding-bottom:calc(var(--section-space-mobile) - 80px) !important;  }  .space-tp-80 {   padding-top:calc(var(--section-space-mobile) + 80px) !important;  }  .space-bp-80 {   padding-bottom:calc(var(--section-space-mobile) + 80px) !important;  }  .space-tm-85 {   padding-top:calc(var(--section-space-mobile) - 85px) !important;  }  .space-bm-85 {   padding-bottom:calc(var(--section-space-mobile) - 85px) !important;  }  .space-tp-85 {   padding-top:calc(var(--section-space-mobile) + 85px) !important;  }  .space-bp-85 {   padding-bottom:calc(var(--section-space-mobile) + 85px) !important;  }  .space-tm-90 {   padding-top:calc(var(--section-space-mobile) - 90px) !important;  }  .space-bm-90 {   padding-bottom:calc(var(--section-space-mobile) - 90px) !important;  }  .space-tp-90 {   padding-top:calc(var(--section-space-mobile) + 90px) !important;  }  .space-bp-90 {   padding-bottom:calc(var(--section-space-mobile) + 90px) !important;  }  .space-tm-95 {   padding-top:calc(var(--section-space-mobile) - 95px) !important;  }  .space-bm-95 {   padding-bottom:calc(var(--section-space-mobile) - 95px) !important;  }  .space-tp-95 {   padding-top:calc(var(--section-space-mobile) + 95px) !important;  }  .space-bp-95 {   padding-bottom:calc(var(--section-space-mobile) + 95px) !important;  }  .space-tm-100 {   padding-top:calc(var(--section-space-mobile) - 100px) !important;  }  .space-bm-100 {   padding-bottom:calc(var(--section-space-mobile) - 100px) !important;  }  .space-tp-100 {   padding-top:calc(var(--section-space-mobile) + 100px) !important;  }  .space-bp-100 {   padding-bottom:calc(var(--section-space-mobile) + 100px) !important;  }  .space-tm-105 {   padding-top:calc(var(--section-space-mobile) - 105px) !important;  }  .space-bm-105 {   padding-bottom:calc(var(--section-space-mobile) - 105px) !important;  }  .space-tp-105 {   padding-top:calc(var(--section-space-mobile) + 105px) !important;  }  .space-bp-105 {   padding-bottom:calc(var(--section-space-mobile) + 105px) !important;  }  .space-tm-110 {   padding-top:calc(var(--section-space-mobile) - 110px) !important;  }  .space-bm-110 {   padding-bottom:calc(var(--section-space-mobile) - 110px) !important;  }  .space-tp-110 {   padding-top:calc(var(--section-space-mobile) + 110px) !important;  }  .space-bp-110 {   padding-bottom:calc(var(--section-space-mobile) + 110px) !important;  }  .space-tm-115 {   padding-top:calc(var(--section-space-mobile) - 115px) !important;  }  .space-bm-115 {   padding-bottom:calc(var(--section-space-mobile) - 115px) !important;  }  .space-tp-115 {   padding-top:calc(var(--section-space-mobile) + 115px) !important;  }  .space-bp-115 {   padding-bottom:calc(var(--section-space-mobile) + 115px) !important;  }  .space-tm-120 {   padding-top:calc(var(--section-space-mobile) - 120px) !important;  }  .space-bm-120 {   padding-bottom:calc(var(--section-space-mobile) - 120px) !important;  }  .space-tp-120 {   padding-top:calc(var(--section-space-mobile) + 120px) !important;  }  .space-bp-120 {   padding-bottom:calc(var(--section-space-mobile) + 120px) !important;  }  .space-tm-125 {   padding-top:calc(var(--section-space-mobile) - 125px) !important;  }  .space-bm-125 {   padding-bottom:calc(var(--section-space-mobile) - 125px) !important;  }  .space-tp-125 {   padding-top:calc(var(--section-space-mobile) + 125px) !important;  }  .space-bp-125 {   padding-bottom:calc(var(--section-space-mobile) + 125px) !important;  }  .space-tm-130 {   padding-top:calc(var(--section-space-mobile) - 130px) !important;  }  .space-bm-130 {   padding-bottom:calc(var(--section-space-mobile) - 130px) !important;  }  .space-tp-130 {   padding-top:calc(var(--section-space-mobile) + 130px) !important;  }  .space-bp-130 {   padding-bottom:calc(var(--section-space-mobile) + 130px) !important;  }  .space-tm-135 {   padding-top:calc(var(--section-space-mobile) - 135px) !important;  }  .space-bm-135 {   padding-bottom:calc(var(--section-space-mobile) - 135px) !important;  }  .space-tp-135 {   padding-top:calc(var(--section-space-mobile) + 135px) !important;  }  .space-bp-135 {   padding-bottom:calc(var(--section-space-mobile) + 135px) !important;  }  .space-tm-140 {   padding-top:calc(var(--section-space-mobile) - 140px) !important;  }  .space-bm-140 {   padding-bottom:calc(var(--section-space-mobile) - 140px) !important;  }  .space-tp-140 {   padding-top:calc(var(--section-space-mobile) + 140px) !important;  }  .space-bp-140 {   padding-bottom:calc(var(--section-space-mobile) + 140px) !important;  }  .space-tm-145 {   padding-top:calc(var(--section-space-mobile) - 145px) !important;  }  .space-bm-145 {   padding-bottom:calc(var(--section-space-mobile) - 145px) !important;  }  .space-tp-145 {   padding-top:calc(var(--section-space-mobile) + 145px) !important;  }  .space-bp-145 {   padding-bottom:calc(var(--section-space-mobile) + 145px) !important;  }  .space-tm-150 {   padding-top:calc(var(--section-space-mobile) - 150px) !important;  }  .space-bm-150 {   padding-bottom:calc(var(--section-space-mobile) - 150px) !important;  }  .space-tp-150 {   padding-top:calc(var(--section-space-mobile) + 150px) !important;  }  .space-bp-150 {   padding-bottom:calc(var(--section-space-mobile) + 150px) !important;  }  .space-tm-155 {   padding-top:calc(var(--section-space-mobile) - 155px) !important;  }  .space-bm-155 {   padding-bottom:calc(var(--section-space-mobile) - 155px) !important;  }  .space-tp-155 {   padding-top:calc(var(--section-space-mobile) + 155px) !important;  }  .space-bp-155 {   padding-bottom:calc(var(--section-space-mobile) + 155px) !important;  }  .space-tm-160 {   padding-top:calc(var(--section-space-mobile) - 160px) !important;  }  .space-bm-160 {   padding-bottom:calc(var(--section-space-mobile) - 160px) !important;  }  .space-tp-160 {   padding-top:calc(var(--section-space-mobile) + 160px) !important;  }  .space-bp-160 {   padding-bottom:calc(var(--section-space-mobile) + 160px) !important;  }  .space-tm-165 {   padding-top:calc(var(--section-space-mobile) - 165px) !important;  }  .space-bm-165 {   padding-bottom:calc(var(--section-space-mobile) - 165px) !important;  }  .space-tp-165 {   padding-top:calc(var(--section-space-mobile) + 165px) !important;  }  .space-bp-165 {   padding-bottom:calc(var(--section-space-mobile) + 165px) !important;  }  .space-tm-170 {   padding-top:calc(var(--section-space-mobile) - 170px) !important;  }  .space-bm-170 {   padding-bottom:calc(var(--section-space-mobile) - 170px) !important;  }  .space-tp-170 {   padding-top:calc(var(--section-space-mobile) + 170px) !important;  }  .space-bp-170 {   padding-bottom:calc(var(--section-space-mobile) + 170px) !important;  }  .space-tm-175 {   padding-top:calc(var(--section-space-mobile) - 175px) !important;  }  .space-bm-175 {   padding-bottom:calc(var(--section-space-mobile) - 175px) !important;  }  .space-tp-175 {   padding-top:calc(var(--section-space-mobile) + 175px) !important;  }  .space-bp-175 {   padding-bottom:calc(var(--section-space-mobile) + 175px) !important;  }  .space-tm-180 {   padding-top:calc(var(--section-space-mobile) - 180px) !important;  }  .space-bm-180 {   padding-bottom:calc(var(--section-space-mobile) - 180px) !important;  }  .space-tp-180 {   padding-top:calc(var(--section-space-mobile) + 180px) !important;  }  .space-bp-180 {   padding-bottom:calc(var(--section-space-mobile) + 180px) !important;  }  .space-tm-185 {   padding-top:calc(var(--section-space-mobile) - 185px) !important;  }  .space-bm-185 {   padding-bottom:calc(var(--section-space-mobile) - 185px) !important;  }  .space-tp-185 {   padding-top:calc(var(--section-space-mobile) + 185px) !important;  }  .space-bp-185 {   padding-bottom:calc(var(--section-space-mobile) + 185px) !important;  }  .space-tm-190 {   padding-top:calc(var(--section-space-mobile) - 190px) !important;  }  .space-bm-190 {   padding-bottom:calc(var(--section-space-mobile) - 190px) !important;  }  .space-tp-190 {   padding-top:calc(var(--section-space-mobile) + 190px) !important;  }  .space-bp-190 {   padding-bottom:calc(var(--section-space-mobile) + 190px) !important;  }  .space-tm-195 {   padding-top:calc(var(--section-space-mobile) - 195px) !important;  }  .space-bm-195 {   padding-bottom:calc(var(--section-space-mobile) - 195px) !important;  }  .space-tp-195 {   padding-top:calc(var(--section-space-mobile) + 195px) !important;  }  .space-bp-195 {   padding-bottom:calc(var(--section-space-mobile) + 195px) !important;  }  .space-tm-200 {   padding-top:calc(var(--section-space-mobile) - 200px) !important;  }  .space-bm-200 {   padding-bottom:calc(var(--section-space-mobile) - 200px) !important;  }  .space-tp-200 {   padding-top:calc(var(--section-space-mobile) + 200px) !important;  }  .space-bp-200 {   padding-bottom:calc(var(--section-space-mobile) + 200px) !important;  }  .space-tm-205 {   padding-top:calc(var(--section-space-mobile) - 205px) !important;  }  .space-bm-205 {   padding-bottom:calc(var(--section-space-mobile) - 205px) !important;  }  .space-tp-205 {   padding-top:calc(var(--section-space-mobile) + 205px) !important;  }  .space-bp-205 {   padding-bottom:calc(var(--section-space-mobile) + 205px) !important;  }  .space-tm-210 {   padding-top:calc(var(--section-space-mobile) - 210px) !important;  }  .space-bm-210 {   padding-bottom:calc(var(--section-space-mobile) - 210px) !important;  }  .space-tp-210 {   padding-top:calc(var(--section-space-mobile) + 210px) !important;  }  .space-bp-210 {   padding-bottom:calc(var(--section-space-mobile) + 210px) !important;  }  .space-tm-215 {   padding-top:calc(var(--section-space-mobile) - 215px) !important;  }  .space-bm-215 {   padding-bottom:calc(var(--section-space-mobile) - 215px) !important;  }  .space-tp-215 {   padding-top:calc(var(--section-space-mobile) + 215px) !important;  }  .space-bp-215 {   padding-bottom:calc(var(--section-space-mobile) + 215px) !important;  }  .space-tm-220 {   padding-top:calc(var(--section-space-mobile) - 220px) !important;  }  .space-bm-220 {   padding-bottom:calc(var(--section-space-mobile) - 220px) !important;  }  .space-tp-220 {   padding-top:calc(var(--section-space-mobile) + 220px) !important;  }  .space-bp-220 {   padding-bottom:calc(var(--section-space-mobile) + 220px) !important;  }  .space-tm-225 {   padding-top:calc(var(--section-space-mobile) - 225px) !important;  }  .space-bm-225 {   padding-bottom:calc(var(--section-space-mobile) - 225px) !important;  }  .space-tp-225 {   padding-top:calc(var(--section-space-mobile) + 225px) !important;  }  .space-bp-225 {   padding-bottom:calc(var(--section-space-mobile) + 225px) !important;  }  .space-tm-230 {   padding-top:calc(var(--section-space-mobile) - 230px) !important;  }  .space-bm-230 {   padding-bottom:calc(var(--section-space-mobile) - 230px) !important;  }  .space-tp-230 {   padding-top:calc(var(--section-space-mobile) + 230px) !important;  }  .space-bp-230 {   padding-bottom:calc(var(--section-space-mobile) + 230px) !important;  }  .space-tm-235 {   padding-top:calc(var(--section-space-mobile) - 235px) !important;  }  .space-bm-235 {   padding-bottom:calc(var(--section-space-mobile) - 235px) !important;  }  .space-tp-235 {   padding-top:calc(var(--section-space-mobile) + 235px) !important;  }  .space-bp-235 {   padding-bottom:calc(var(--section-space-mobile) + 235px) !important;  }  .space-tm-240 {   padding-top:calc(var(--section-space-mobile) - 240px) !important;  }  .space-bm-240 {   padding-bottom:calc(var(--section-space-mobile) - 240px) !important;  }  .space-tp-240 {   padding-top:calc(var(--section-space-mobile) + 240px) !important;  }  .space-bp-240 {   padding-bottom:calc(var(--section-space-mobile) + 240px) !important;  }  .space-tm-245 {   padding-top:calc(var(--section-space-mobile) - 245px) !important;  }  .space-bm-245 {   padding-bottom:calc(var(--section-space-mobile) - 245px) !important;  }  .space-tp-245 {   padding-top:calc(var(--section-space-mobile) + 245px) !important;  }  .space-bp-245 {   padding-bottom:calc(var(--section-space-mobile) + 245px) !important;  }  .space-tm-250 {   padding-top:calc(var(--section-space-mobile) - 250px) !important;  }  .space-bm-250 {   padding-bottom:calc(var(--section-space-mobile) - 250px) !important;  }  .space-tp-250 {   padding-top:calc(var(--section-space-mobile) + 250px) !important;  }  .space-bp-250 {   padding-bottom:calc(var(--section-space-mobile) + 250px) !important;  }  .space-tm-255 {   padding-top:calc(var(--section-space-mobile) - 255px) !important;  }  .space-bm-255 {   padding-bottom:calc(var(--section-space-mobile) - 255px) !important;  }  .space-tp-255 {   padding-top:calc(var(--section-space-mobile) + 255px) !important;  }  .space-bp-255 {   padding-bottom:calc(var(--section-space-mobile) + 255px) !important;  }  .space-tm-260 {   padding-top:calc(var(--section-space-mobile) - 260px) !important;  }  .space-bm-260 {   padding-bottom:calc(var(--section-space-mobile) - 260px) !important;  }  .space-tp-260 {   padding-top:calc(var(--section-space-mobile) + 260px) !important;  }  .space-bp-260 {   padding-bottom:calc(var(--section-space-mobile) + 260px) !important;  }  .space-tm-265 {   padding-top:calc(var(--section-space-mobile) - 265px) !important;  }  .space-bm-265 {   padding-bottom:calc(var(--section-space-mobile) - 265px) !important;  }  .space-tp-265 {   padding-top:calc(var(--section-space-mobile) + 265px) !important;  }  .space-bp-265 {   padding-bottom:calc(var(--section-space-mobile) + 265px) !important;  }  .space-tm-270 {   padding-top:calc(var(--section-space-mobile) - 270px) !important;  }  .space-bm-270 {   padding-bottom:calc(var(--section-space-mobile) - 270px) !important;  }  .space-tp-270 {   padding-top:calc(var(--section-space-mobile) + 270px) !important;  }  .space-bp-270 {   padding-bottom:calc(var(--section-space-mobile) + 270px) !important;  }  .space-tm-275 {   padding-top:calc(var(--section-space-mobile) - 275px) !important;  }  .space-bm-275 {   padding-bottom:calc(var(--section-space-mobile) - 275px) !important;  }  .space-tp-275 {   padding-top:calc(var(--section-space-mobile) + 275px) !important;  }  .space-bp-275 {   padding-bottom:calc(var(--section-space-mobile) + 275px) !important;  }  .space-tm-280 {   padding-top:calc(var(--section-space-mobile) - 280px) !important;  }  .space-bm-280 {   padding-bottom:calc(var(--section-space-mobile) - 280px) !important;  }  .space-tp-280 {   padding-top:calc(var(--section-space-mobile) + 280px) !important;  }  .space-bp-280 {   padding-bottom:calc(var(--section-space-mobile) + 280px) !important;  }  .space-tm-285 {   padding-top:calc(var(--section-space-mobile) - 285px) !important;  }  .space-bm-285 {   padding-bottom:calc(var(--section-space-mobile) - 285px) !important;  }  .space-tp-285 {   padding-top:calc(var(--section-space-mobile) + 285px) !important;  }  .space-bp-285 {   padding-bottom:calc(var(--section-space-mobile) + 285px) !important;  }  .space-tm-290 {   padding-top:calc(var(--section-space-mobile) - 290px) !important;  }  .space-bm-290 {   padding-bottom:calc(var(--section-space-mobile) - 290px) !important;  }  .space-tp-290 {   padding-top:calc(var(--section-space-mobile) + 290px) !important;  }  .space-bp-290 {   padding-bottom:calc(var(--section-space-mobile) + 290px) !important;  }  .space-tm-295 {   padding-top:calc(var(--section-space-mobile) - 295px) !important;  }  .space-bm-295 {   padding-bottom:calc(var(--section-space-mobile) - 295px) !important;  }  .space-tp-295 {   padding-top:calc(var(--section-space-mobile) + 295px) !important;  }  .space-bp-295 {   padding-bottom:calc(var(--section-space-mobile) + 295px) !important;  }  .space-tm-300 {   padding-top:calc(var(--section-space-mobile) - 300px) !important;  }  .space-bm-300 {   padding-bottom:calc(var(--section-space-mobile) - 300px) !important;  }  .space-tp-300 {   padding-top:calc(var(--section-space-mobile) + 300px) !important;  }  .space-bp-300 {   padding-bottom:calc(var(--section-space-mobile) + 300px) !important;  } } @media (max-width:375px) {  .space-tm-5 {   padding-top:calc(var(--section-space-small-mobile) - 5px) !important;  }  .space-bm-5 {   padding-bottom:calc(var(--section-space-small-mobile) - 5px) !important;  }  .space-tp-5 {   padding-top:calc(var(--section-space-small-mobile) + 5px) !important;  }  .space-bp-5 {   padding-bottom:calc(var(--section-space-small-mobile) + 5px) !important;  }  .space-tm-10 {   padding-top:calc(var(--section-space-small-mobile) - 10px) !important;  }  .space-bm-10 {   padding-bottom:calc(var(--section-space-small-mobile) - 10px) !important;  }  .space-tp-10 {   padding-top:calc(var(--section-space-small-mobile) + 10px) !important;  }  .space-bp-10 {   padding-bottom:calc(var(--section-space-small-mobile) + 10px) !important;  }  .space-tm-15 {   padding-top:calc(var(--section-space-small-mobile) - 15px) !important;  }  .space-bm-15 {   padding-bottom:calc(var(--section-space-small-mobile) - 15px) !important;  }  .space-tp-15 {   padding-top:calc(var(--section-space-small-mobile) + 15px) !important;  }  .space-bp-15 {   padding-bottom:calc(var(--section-space-small-mobile) + 15px) !important;  }  .space-tm-20 {   padding-top:calc(var(--section-space-small-mobile) - 20px) !important;  }  .space-bm-20 {   padding-bottom:calc(var(--section-space-small-mobile) - 20px) !important;  }  .space-tp-20 {   padding-top:calc(var(--section-space-small-mobile) + 20px) !important;  }  .space-bp-20 {   padding-bottom:calc(var(--section-space-small-mobile) + 20px) !important;  }  .space-tm-25 {   padding-top:calc(var(--section-space-small-mobile) - 25px) !important;  }  .space-bm-25 {   padding-bottom:calc(var(--section-space-small-mobile) - 25px) !important;  }  .space-tp-25 {   padding-top:calc(var(--section-space-small-mobile) + 25px) !important;  }  .space-bp-25 {   padding-bottom:calc(var(--section-space-small-mobile) + 25px) !important;  }  .space-tm-30 {   padding-top:calc(var(--section-space-small-mobile) - 30px) !important;  }  .space-bm-30 {   padding-bottom:calc(var(--section-space-small-mobile) - 30px) !important;  }  .space-tp-30 {   padding-top:calc(var(--section-space-small-mobile) + 30px) !important;  }  .space-bp-30 {   padding-bottom:calc(var(--section-space-small-mobile) + 30px) !important;  }  .space-tm-35 {   padding-top:calc(var(--section-space-small-mobile) - 35px) !important;  }  .space-bm-35 {   padding-bottom:calc(var(--section-space-small-mobile) - 35px) !important;  }  .space-tp-35 {   padding-top:calc(var(--section-space-small-mobile) + 35px) !important;  }  .space-bp-35 {   padding-bottom:calc(var(--section-space-small-mobile) + 35px) !important;  }  .space-tm-40 {   padding-top:calc(var(--section-space-small-mobile) - 40px) !important;  }  .space-bm-40 {   padding-bottom:calc(var(--section-space-small-mobile) - 40px) !important;  }  .space-tp-40 {   padding-top:calc(var(--section-space-small-mobile) + 40px) !important;  }  .space-bp-40 {   padding-bottom:calc(var(--section-space-small-mobile) + 40px) !important;  }  .space-tm-45 {   padding-top:calc(var(--section-space-small-mobile) - 45px) !important;  }  .space-bm-45 {   padding-bottom:calc(var(--section-space-small-mobile) - 45px) !important;  }  .space-tp-45 {   padding-top:calc(var(--section-space-small-mobile) + 45px) !important;  }  .space-bp-45 {   padding-bottom:calc(var(--section-space-small-mobile) + 45px) !important;  }  .space-tm-50 {   padding-top:calc(var(--section-space-small-mobile) - 50px) !important;  }  .space-bm-50 {   padding-bottom:calc(var(--section-space-small-mobile) - 50px) !important;  }  .space-tp-50 {   padding-top:calc(var(--section-space-small-mobile) + 50px) !important;  }  .space-bp-50 {   padding-bottom:calc(var(--section-space-small-mobile) + 50px) !important;  }  .space-tm-55 {   padding-top:calc(var(--section-space-small-mobile) - 55px) !important;  }  .space-bm-55 {   padding-bottom:calc(var(--section-space-small-mobile) - 55px) !important;  }  .space-tp-55 {   padding-top:calc(var(--section-space-small-mobile) + 55px) !important;  }  .space-bp-55 {   padding-bottom:calc(var(--section-space-small-mobile) + 55px) !important;  }  .space-tm-60 {   padding-top:calc(var(--section-space-small-mobile) - 60px) !important;  }  .space-bm-60 {   padding-bottom:calc(var(--section-space-small-mobile) - 60px) !important;  }  .space-tp-60 {   padding-top:calc(var(--section-space-small-mobile) + 60px) !important;  }  .space-bp-60 {   padding-bottom:calc(var(--section-space-small-mobile) + 60px) !important;  }  .space-tm-65 {   padding-top:calc(var(--section-space-small-mobile) - 65px) !important;  }  .space-bm-65 {   padding-bottom:calc(var(--section-space-small-mobile) - 65px) !important;  }  .space-tp-65 {   padding-top:calc(var(--section-space-small-mobile) + 65px) !important;  }  .space-bp-65 {   padding-bottom:calc(var(--section-space-small-mobile) + 65px) !important;  }  .space-tm-70 {   padding-top:calc(var(--section-space-small-mobile) - 70px) !important;  }  .space-bm-70 {   padding-bottom:calc(var(--section-space-small-mobile) - 70px) !important;  }  .space-tp-70 {   padding-top:calc(var(--section-space-small-mobile) + 70px) !important;  }  .space-bp-70 {   padding-bottom:calc(var(--section-space-small-mobile) + 70px) !important;  }  .space-tm-75 {   padding-top:calc(var(--section-space-small-mobile) - 75px) !important;  }  .space-bm-75 {   padding-bottom:calc(var(--section-space-small-mobile) - 75px) !important;  }  .space-tp-75 {   padding-top:calc(var(--section-space-small-mobile) + 75px) !important;  }  .space-bp-75 {   padding-bottom:calc(var(--section-space-small-mobile) + 75px) !important;  }  .space-tm-80 {   padding-top:calc(var(--section-space-small-mobile) - 80px) !important;  }  .space-bm-80 {   padding-bottom:calc(var(--section-space-small-mobile) - 80px) !important;  }  .space-tp-80 {   padding-top:calc(var(--section-space-small-mobile) + 80px) !important;  }  .space-bp-80 {   padding-bottom:calc(var(--section-space-small-mobile) + 80px) !important;  }  .space-tm-85 {   padding-top:calc(var(--section-space-small-mobile) - 85px) !important;  }  .space-bm-85 {   padding-bottom:calc(var(--section-space-small-mobile) - 85px) !important;  }  .space-tp-85 {   padding-top:calc(var(--section-space-small-mobile) + 85px) !important;  }  .space-bp-85 {   padding-bottom:calc(var(--section-space-small-mobile) + 85px) !important;  }  .space-tm-90 {   padding-top:calc(var(--section-space-small-mobile) - 90px) !important;  }  .space-bm-90 {   padding-bottom:calc(var(--section-space-small-mobile) - 90px) !important;  }  .space-tp-90 {   padding-top:calc(var(--section-space-small-mobile) + 90px) !important;  }  .space-bp-90 {   padding-bottom:calc(var(--section-space-small-mobile) + 90px) !important;  }  .space-tm-95 {   padding-top:calc(var(--section-space-small-mobile) - 95px) !important;  }  .space-bm-95 {   padding-bottom:calc(var(--section-space-small-mobile) - 95px) !important;  }  .space-tp-95 {   padding-top:calc(var(--section-space-small-mobile) + 95px) !important;  }  .space-bp-95 {   padding-bottom:calc(var(--section-space-small-mobile) + 95px) !important;  }  .space-tm-100 {   padding-top:calc(var(--section-space-small-mobile) - 100px) !important;  }  .space-bm-100 {   padding-bottom:calc(var(--section-space-small-mobile) - 100px) !important;  }  .space-tp-100 {   padding-top:calc(var(--section-space-small-mobile) + 100px) !important;  }  .space-bp-100 {   padding-bottom:calc(var(--section-space-small-mobile) + 100px) !important;  }  .space-tm-105 {   padding-top:calc(var(--section-space-small-mobile) - 105px) !important;  }  .space-bm-105 {   padding-bottom:calc(var(--section-space-small-mobile) - 105px) !important;  }  .space-tp-105 {   padding-top:calc(var(--section-space-small-mobile) + 105px) !important;  }  .space-bp-105 {   padding-bottom:calc(var(--section-space-small-mobile) + 105px) !important;  }  .space-tm-110 {   padding-top:calc(var(--section-space-small-mobile) - 110px) !important;  }  .space-bm-110 {   padding-bottom:calc(var(--section-space-small-mobile) - 110px) !important;  }  .space-tp-110 {   padding-top:calc(var(--section-space-small-mobile) + 110px) !important;  }  .space-bp-110 {   padding-bottom:calc(var(--section-space-small-mobile) + 110px) !important;  }  .space-tm-115 {   padding-top:calc(var(--section-space-small-mobile) - 115px) !important;  }  .space-bm-115 {   padding-bottom:calc(var(--section-space-small-mobile) - 115px) !important;  }  .space-tp-115 {   padding-top:calc(var(--section-space-small-mobile) + 115px) !important;  }  .space-bp-115 {   padding-bottom:calc(var(--section-space-small-mobile) + 115px) !important;  }  .space-tm-120 {   padding-top:calc(var(--section-space-small-mobile) - 120px) !important;  }  .space-bm-120 {   padding-bottom:calc(var(--section-space-small-mobile) - 120px) !important;  }  .space-tp-120 {   padding-top:calc(var(--section-space-small-mobile) + 120px) !important;  }  .space-bp-120 {   padding-bottom:calc(var(--section-space-small-mobile) + 120px) !important;  }  .space-tm-125 {   padding-top:calc(var(--section-space-small-mobile) - 125px) !important;  }  .space-bm-125 {   padding-bottom:calc(var(--section-space-small-mobile) - 125px) !important;  }  .space-tp-125 {   padding-top:calc(var(--section-space-small-mobile) + 125px) !important;  }  .space-bp-125 {   padding-bottom:calc(var(--section-space-small-mobile) + 125px) !important;  }  .space-tm-130 {   padding-top:calc(var(--section-space-small-mobile) - 130px) !important;  }  .space-bm-130 {   padding-bottom:calc(var(--section-space-small-mobile) - 130px) !important;  }  .space-tp-130 {   padding-top:calc(var(--section-space-small-mobile) + 130px) !important;  }  .space-bp-130 {   padding-bottom:calc(var(--section-space-small-mobile) + 130px) !important;  }  .space-tm-135 {   padding-top:calc(var(--section-space-small-mobile) - 135px) !important;  }  .space-bm-135 {   padding-bottom:calc(var(--section-space-small-mobile) - 135px) !important;  }  .space-tp-135 {   padding-top:calc(var(--section-space-small-mobile) + 135px) !important;  }  .space-bp-135 {   padding-bottom:calc(var(--section-space-small-mobile) + 135px) !important;  }  .space-tm-140 {   padding-top:calc(var(--section-space-small-mobile) - 140px) !important;  }  .space-bm-140 {   padding-bottom:calc(var(--section-space-small-mobile) - 140px) !important;  }  .space-tp-140 {   padding-top:calc(var(--section-space-small-mobile) + 140px) !important;  }  .space-bp-140 {   padding-bottom:calc(var(--section-space-small-mobile) + 140px) !important;  }  .space-tm-145 {   padding-top:calc(var(--section-space-small-mobile) - 145px) !important;  }  .space-bm-145 {   padding-bottom:calc(var(--section-space-small-mobile) - 145px) !important;  }  .space-tp-145 {   padding-top:calc(var(--section-space-small-mobile) + 145px) !important;  }  .space-bp-145 {   padding-bottom:calc(var(--section-space-small-mobile) + 145px) !important;  }  .space-tm-150 {   padding-top:calc(var(--section-space-small-mobile) - 150px) !important;  }  .space-bm-150 {   padding-bottom:calc(var(--section-space-small-mobile) - 150px) !important;  }  .space-tp-150 {   padding-top:calc(var(--section-space-small-mobile) + 150px) !important;  }  .space-bp-150 {   padding-bottom:calc(var(--section-space-small-mobile) + 150px) !important;  }  .space-tm-155 {   padding-top:calc(var(--section-space-small-mobile) - 155px) !important;  }  .space-bm-155 {   padding-bottom:calc(var(--section-space-small-mobile) - 155px) !important;  }  .space-tp-155 {   padding-top:calc(var(--section-space-small-mobile) + 155px) !important;  }  .space-bp-155 {   padding-bottom:calc(var(--section-space-small-mobile) + 155px) !important;  }  .space-tm-160 {   padding-top:calc(var(--section-space-small-mobile) - 160px) !important;  }  .space-bm-160 {   padding-bottom:calc(var(--section-space-small-mobile) - 160px) !important;  }  .space-tp-160 {   padding-top:calc(var(--section-space-small-mobile) + 160px) !important;  }  .space-bp-160 {   padding-bottom:calc(var(--section-space-small-mobile) + 160px) !important;  }  .space-tm-165 {   padding-top:calc(var(--section-space-small-mobile) - 165px) !important;  }  .space-bm-165 {   padding-bottom:calc(var(--section-space-small-mobile) - 165px) !important;  }  .space-tp-165 {   padding-top:calc(var(--section-space-small-mobile) + 165px) !important;  }  .space-bp-165 {   padding-bottom:calc(var(--section-space-small-mobile) + 165px) !important;  }  .space-tm-170 {   padding-top:calc(var(--section-space-small-mobile) - 170px) !important;  }  .space-bm-170 {   padding-bottom:calc(var(--section-space-small-mobile) - 170px) !important;  }  .space-tp-170 {   padding-top:calc(var(--section-space-small-mobile) + 170px) !important;  }  .space-bp-170 {   padding-bottom:calc(var(--section-space-small-mobile) + 170px) !important;  }  .space-tm-175 {   padding-top:calc(var(--section-space-small-mobile) - 175px) !important;  }  .space-bm-175 {   padding-bottom:calc(var(--section-space-small-mobile) - 175px) !important;  }  .space-tp-175 {   padding-top:calc(var(--section-space-small-mobile) + 175px) !important;  }  .space-bp-175 {   padding-bottom:calc(var(--section-space-small-mobile) + 175px) !important;  }  .space-tm-180 {   padding-top:calc(var(--section-space-small-mobile) - 180px) !important;  }  .space-bm-180 {   padding-bottom:calc(var(--section-space-small-mobile) - 180px) !important;  }  .space-tp-180 {   padding-top:calc(var(--section-space-small-mobile) + 180px) !important;  }  .space-bp-180 {   padding-bottom:calc(var(--section-space-small-mobile) + 180px) !important;  }  .space-tm-185 {   padding-top:calc(var(--section-space-small-mobile) - 185px) !important;  }  .space-bm-185 {   padding-bottom:calc(var(--section-space-small-mobile) - 185px) !important;  }  .space-tp-185 {   padding-top:calc(var(--section-space-small-mobile) + 185px) !important;  }  .space-bp-185 {   padding-bottom:calc(var(--section-space-small-mobile) + 185px) !important;  }  .space-tm-190 {   padding-top:calc(var(--section-space-small-mobile) - 190px) !important;  }  .space-bm-190 {   padding-bottom:calc(var(--section-space-small-mobile) - 190px) !important;  }  .space-tp-190 {   padding-top:calc(var(--section-space-small-mobile) + 190px) !important;  }  .space-bp-190 {   padding-bottom:calc(var(--section-space-small-mobile) + 190px) !important;  }  .space-tm-195 {   padding-top:calc(var(--section-space-small-mobile) - 195px) !important;  }  .space-bm-195 {   padding-bottom:calc(var(--section-space-small-mobile) - 195px) !important;  }  .space-tp-195 {   padding-top:calc(var(--section-space-small-mobile) + 195px) !important;  }  .space-bp-195 {   padding-bottom:calc(var(--section-space-small-mobile) + 195px) !important;  }  .space-tm-200 {   padding-top:calc(var(--section-space-small-mobile) - 200px) !important;  }  .space-bm-200 {   padding-bottom:calc(var(--section-space-small-mobile) - 200px) !important;  }  .space-tp-200 {   padding-top:calc(var(--section-space-small-mobile) + 200px) !important;  }  .space-bp-200 {   padding-bottom:calc(var(--section-space-small-mobile) + 200px) !important;  }  .space-tm-205 {   padding-top:calc(var(--section-space-small-mobile) - 205px) !important;  }  .space-bm-205 {   padding-bottom:calc(var(--section-space-small-mobile) - 205px) !important;  }  .space-tp-205 {   padding-top:calc(var(--section-space-small-mobile) + 205px) !important;  }  .space-bp-205 {   padding-bottom:calc(var(--section-space-small-mobile) + 205px) !important;  }  .space-tm-210 {   padding-top:calc(var(--section-space-small-mobile) - 210px) !important;  }  .space-bm-210 {   padding-bottom:calc(var(--section-space-small-mobile) - 210px) !important;  }  .space-tp-210 {   padding-top:calc(var(--section-space-small-mobile) + 210px) !important;  }  .space-bp-210 {   padding-bottom:calc(var(--section-space-small-mobile) + 210px) !important;  }  .space-tm-215 {   padding-top:calc(var(--section-space-small-mobile) - 215px) !important;  }  .space-bm-215 {   padding-bottom:calc(var(--section-space-small-mobile) - 215px) !important;  }  .space-tp-215 {   padding-top:calc(var(--section-space-small-mobile) + 215px) !important;  }  .space-bp-215 {   padding-bottom:calc(var(--section-space-small-mobile) + 215px) !important;  }  .space-tm-220 {   padding-top:calc(var(--section-space-small-mobile) - 220px) !important;  }  .space-bm-220 {   padding-bottom:calc(var(--section-space-small-mobile) - 220px) !important;  }  .space-tp-220 {   padding-top:calc(var(--section-space-small-mobile) + 220px) !important;  }  .space-bp-220 {   padding-bottom:calc(var(--section-space-small-mobile) + 220px) !important;  }  .space-tm-225 {   padding-top:calc(var(--section-space-small-mobile) - 225px) !important;  }  .space-bm-225 {   padding-bottom:calc(var(--section-space-small-mobile) - 225px) !important;  }  .space-tp-225 {   padding-top:calc(var(--section-space-small-mobile) + 225px) !important;  }  .space-bp-225 {   padding-bottom:calc(var(--section-space-small-mobile) + 225px) !important;  }  .space-tm-230 {   padding-top:calc(var(--section-space-small-mobile) - 230px) !important;  }  .space-bm-230 {   padding-bottom:calc(var(--section-space-small-mobile) - 230px) !important;  }  .space-tp-230 {   padding-top:calc(var(--section-space-small-mobile) + 230px) !important;  }  .space-bp-230 {   padding-bottom:calc(var(--section-space-small-mobile) + 230px) !important;  }  .space-tm-235 {   padding-top:calc(var(--section-space-small-mobile) - 235px) !important;  }  .space-bm-235 {   padding-bottom:calc(var(--section-space-small-mobile) - 235px) !important;  }  .space-tp-235 {   padding-top:calc(var(--section-space-small-mobile) + 235px) !important;  }  .space-bp-235 {   padding-bottom:calc(var(--section-space-small-mobile) + 235px) !important;  }  .space-tm-240 {   padding-top:calc(var(--section-space-small-mobile) - 240px) !important;  }  .space-bm-240 {   padding-bottom:calc(var(--section-space-small-mobile) - 240px) !important;  }  .space-tp-240 {   padding-top:calc(var(--section-space-small-mobile) + 240px) !important;  }  .space-bp-240 {   padding-bottom:calc(var(--section-space-small-mobile) + 240px) !important;  }  .space-tm-245 {   padding-top:calc(var(--section-space-small-mobile) - 245px) !important;  }  .space-bm-245 {   padding-bottom:calc(var(--section-space-small-mobile) - 245px) !important;  }  .space-tp-245 {   padding-top:calc(var(--section-space-small-mobile) + 245px) !important;  }  .space-bp-245 {   padding-bottom:calc(var(--section-space-small-mobile) + 245px) !important;  }  .space-tm-250 {   padding-top:calc(var(--section-space-small-mobile) - 250px) !important;  }  .space-bm-250 {   padding-bottom:calc(var(--section-space-small-mobile) - 250px) !important;  }  .space-tp-250 {   padding-top:calc(var(--section-space-small-mobile) + 250px) !important;  }  .space-bp-250 {   padding-bottom:calc(var(--section-space-small-mobile) + 250px) !important;  }  .space-tm-255 {   padding-top:calc(var(--section-space-small-mobile) - 255px) !important;  }  .space-bm-255 {   padding-bottom:calc(var(--section-space-small-mobile) - 255px) !important;  }  .space-tp-255 {   padding-top:calc(var(--section-space-small-mobile) + 255px) !important;  }  .space-bp-255 {   padding-bottom:calc(var(--section-space-small-mobile) + 255px) !important;  }  .space-tm-260 {   padding-top:calc(var(--section-space-small-mobile) - 260px) !important;  }  .space-bm-260 {   padding-bottom:calc(var(--section-space-small-mobile) - 260px) !important;  }  .space-tp-260 {   padding-top:calc(var(--section-space-small-mobile) + 260px) !important;  }  .space-bp-260 {   padding-bottom:calc(var(--section-space-small-mobile) + 260px) !important;  }  .space-tm-265 {   padding-top:calc(var(--section-space-small-mobile) - 265px) !important;  }  .space-bm-265 {   padding-bottom:calc(var(--section-space-small-mobile) - 265px) !important;  }  .space-tp-265 {   padding-top:calc(var(--section-space-small-mobile) + 265px) !important;  }  .space-bp-265 {   padding-bottom:calc(var(--section-space-small-mobile) + 265px) !important;  }  .space-tm-270 {   padding-top:calc(var(--section-space-small-mobile) - 270px) !important;  }  .space-bm-270 {   padding-bottom:calc(var(--section-space-small-mobile) - 270px) !important;  }  .space-tp-270 {   padding-top:calc(var(--section-space-small-mobile) + 270px) !important;  }  .space-bp-270 {   padding-bottom:calc(var(--section-space-small-mobile) + 270px) !important;  }  .space-tm-275 {   padding-top:calc(var(--section-space-small-mobile) - 275px) !important;  }  .space-bm-275 {   padding-bottom:calc(var(--section-space-small-mobile) - 275px) !important;  }  .space-tp-275 {   padding-top:calc(var(--section-space-small-mobile) + 275px) !important;  }  .space-bp-275 {   padding-bottom:calc(var(--section-space-small-mobile) + 275px) !important;  }  .space-tm-280 {   padding-top:calc(var(--section-space-small-mobile) - 280px) !important;  }  .space-bm-280 {   padding-bottom:calc(var(--section-space-small-mobile) - 280px) !important;  }  .space-tp-280 {   padding-top:calc(var(--section-space-small-mobile) + 280px) !important;  }  .space-bp-280 {   padding-bottom:calc(var(--section-space-small-mobile) + 280px) !important;  }  .space-tm-285 {   padding-top:calc(var(--section-space-small-mobile) - 285px) !important;  }  .space-bm-285 {   padding-bottom:calc(var(--section-space-small-mobile) - 285px) !important;  }  .space-tp-285 {   padding-top:calc(var(--section-space-small-mobile) + 285px) !important;  }  .space-bp-285 {   padding-bottom:calc(var(--section-space-small-mobile) + 285px) !important;  }  .space-tm-290 {   padding-top:calc(var(--section-space-small-mobile) - 290px) !important;  }  .space-bm-290 {   padding-bottom:calc(var(--section-space-small-mobile) - 290px) !important;  }  .space-tp-290 {   padding-top:calc(var(--section-space-small-mobile) + 290px) !important;  }  .space-bp-290 {   padding-bottom:calc(var(--section-space-small-mobile) + 290px) !important;  }  .space-tm-295 {   padding-top:calc(var(--section-space-small-mobile) - 295px) !important;  }  .space-bm-295 {   padding-bottom:calc(var(--section-space-small-mobile) - 295px) !important;  }  .space-tp-295 {   padding-top:calc(var(--section-space-small-mobile) + 295px) !important;  }  .space-bp-295 {   padding-bottom:calc(var(--section-space-small-mobile) + 295px) !important;  }  .space-tm-300 {   padding-top:calc(var(--section-space-small-mobile) - 300px) !important;  }  .space-bm-300 {   padding-bottom:calc(var(--section-space-small-mobile) - 300px) !important;  }  .space-tp-300 {   padding-top:calc(var(--section-space-small-mobile) + 300px) !important;  }  .space-bp-300 {   padding-bottom:calc(var(--section-space-small-mobile) + 300px) !important;  } }